{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a62ec08d-3e46-4dcb-81b8-9eb12454c7c2",
          "code": "81489-64-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=81489-64-7",
          "code_system": "CAS",
          "references": [
            "1bb6dc70-b0ed-49c8-a846-f67a4801d6b0",
            "1d09c1ec-fe75-4543-aa2b-48ad05a9ce70"
          ]
        },
        {
          "uuid": "abb1080c-51fa-4f8a-837b-60b065a21724",
          "code": "135943",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135943",
          "code_system": "PUBCHEM",
          "references": [
            "1bb6dc70-b0ed-49c8-a846-f67a4801d6b0"
          ]
        },
        {
          "uuid": "1b98110c-8e23-444f-8fc1-914233ee3b18",
          "code": "6A4QE4GR0Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "dad98edc-2371-4384-a6d0-7ffc75cfe6c4",
          "name": "ASCORBYL NICOTINATE",
          "stdName": "ASCORBYL NICOTINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1047b547-598a-4200-aac6-16917c0a4ea5",
            "86ca5b6c-e562-4799-ba64-7ace3fa97fd3",
            "c852db21-9eeb-4e86-9128-693279ac7dbc"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3c19ec76-5fb5-480b-9498-0c23ff6cfce5",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "440a9543-3975-4947-9995-cbd0779358a7",
          "name": "COS-CB3",
          "stdName": "COS-CB3",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1047b547-598a-4200-aac6-16917c0a4ea5",
            "c852db21-9eeb-4e86-9128-693279ac7dbc"
          ],
          "display_name": false
        },
        {
          "uuid": "a1b01727-e9cd-477a-b49e-42e87a79f88b",
          "name": "L-ASCORBIC ACID, 3-(3-PYRIDINECARBOXYLATE)",
          "stdName": "L-ASCORBIC ACID, 3-(3-PYRIDINECARBOXYLATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b393e6e-1be7-4305-8fa2-7d41698b29a3",
            "c852db21-9eeb-4e86-9128-693279ac7dbc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1047b547-598a-4200-aac6-16917c0a4ea5",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c852db21-9eeb-4e86-9128-693279ac7dbc",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b393e6e-1be7-4305-8fa2-7d41698b29a3",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1bb6dc70-b0ed-49c8-a846-f67a4801d6b0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391943000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cbf9ddea-d0a6-46c5-8d3d-588579940e85",
          "citation": "SRS import [6A4QE4GR0Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6A4QE4GR0Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391943000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86ca5b6c-e562-4799-ba64-7ace3fa97fd3",
          "citation": "ASCORBYL NICOTINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1d09c1ec-fe75-4543-aa2b-48ad05a9ce70",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8d475398-ecfa-4350-83b9-bd6864aba7fc",
          "id": "8d475398-ecfa-4350-83b9-bd6864aba7fc",
          "molfile": "\n  Marvin  01132107202D          \n\n 20 21  0  0  1  0            999 V2000\n    7.9005   -1.6276    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.9682   -0.8054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1545   -1.9800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4763   -1.5102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5786   -2.0974    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.3396   -2.4160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2718   -3.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8972   -3.7763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4689   -3.4278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1504   -4.1888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0405   -2.7228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2183   -2.6550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8734   -3.4045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3500   -4.0778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0519   -3.4805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7070   -4.2299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8855   -4.3059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4089   -3.6325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7538   -2.8831    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5753   -2.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5 11  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 13  1  0  0  0  0\n 15 16  1  0  0  0  0\n 20 15  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  2  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "c1cc(cnc1)C(=O)OC2=C(C(=O)O[C@@H]2[C@H](CO)O)O",
          "formula": "C12H11NO7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4d38112d-2ecc-48d2-9703-dab0aaa58079"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "281.2187",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4a6ce525-15ee-4b88-b4a3-85b67e6f2684",
      "version": "3",
      "structure": {
        "id": "b56028a5-cd70-409a-8c05-13b70a287e32",
        "molfile": "\n  Marvin  01132109232D          \n\n 21 22  0  0  1  0            999 V2000\n    8.5786   -2.0974    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.9005   -1.6276    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.9750   -1.3739    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0405   -2.7228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2183   -2.6550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8734   -3.4045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0519   -3.4805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5753   -2.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7538   -2.8831    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4089   -3.6325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8855   -4.3059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7070   -4.2299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3500   -4.0778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4689   -3.4278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1504   -4.1888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2718   -3.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8972   -3.7763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3396   -2.4160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9682   -0.8054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1545   -1.9800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4763   -1.5102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  6  0  0  0\n  1  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n  7 12  2  0  0  0  0\n 12 11  1  0  0  0  0\n  6 13  2  0  0  0  0\n  4 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 16  1  0  0  0  0\n  1 18  1  0  0  0  0\n  2 19  1  6  0  0  0\n  2 20  1  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
        "smiles": "c1cc(cnc1)C(=O)OC2=C(C(=O)O[C@]2([H])[C@H](CO)O)O",
        "formula": "C12H11NO7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "281.2187",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "cbf9ddea-d0a6-46c5-8d3d-588579940e85",
          "5b393e6e-1be7-4305-8fa2-7d41698b29a3"
        ],
        "stereo_centers": 2
      },
      "unii": "6A4QE4GR0Z"
    }
  ]
}