{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9bb2f30f-4419-432c-85f7-433c5cfe7896",
          "code": "99-63-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=99-63-8",
          "code_system": "CAS",
          "references": [
            "d31c5279-0a9e-4e2f-975c-4efbc258acac",
            "ace5858c-b570-4d91-ac07-d1399ff63e35"
          ]
        },
        {
          "uuid": "62499f3c-76a8-45e8-9d3e-fb5f13e1af1c",
          "code": "C035659",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67035659",
          "code_system": "MESH",
          "references": [
            "d31c5279-0a9e-4e2f-975c-4efbc258acac"
          ]
        },
        {
          "uuid": "eefd53b8-cb52-4218-afef-7ff1c670fa96",
          "code": "202-774-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.522",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d31c5279-0a9e-4e2f-975c-4efbc258acac"
          ]
        },
        {
          "uuid": "bd811d40-d85b-4ec5-9174-921ea2681a1c",
          "code": "7451",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7451",
          "code_system": "PUBCHEM",
          "references": [
            "d31c5279-0a9e-4e2f-975c-4efbc258acac"
          ]
        },
        {
          "uuid": "d6f399b0-189b-99fd-b9ae-395f9849cccc",
          "code": "5326",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5326",
          "code_system": "HSDB",
          "references": [
            "93afd3d6-0b87-1e11-a878-e7da8984166e"
          ]
        },
        {
          "uuid": "377b2a9b-176f-ac09-2b68-6fa77a484546",
          "code": "DTXSID3026641",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3026641",
          "code_system": "EPA CompTox",
          "references": [
            "44784562-8d51-a42e-97c0-140043727ab9"
          ]
        },
        {
          "uuid": "e598f32c-2ec9-4baf-8f6c-963a5c4dc8f6",
          "code": "6A3LDJ6CL3",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d655f8a9-3871-e5f6-7f6d-653b6b2cbde0",
          "code": "41884",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=41884",
          "code_system": "NSC",
          "references": [
            "9d681430-d47e-3faf-db09-c69cc7df9ab3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "061466d9-dd94-4662-aff5-3130c47eedbf",
          "name": "1,3-BENZENEDICARBONYL CHLORIDE [HSDB]",
          "stdName": "1,3-BENZENEDICARBONYL CHLORIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6786d340-c297-479b-be58-b828fb7a98cf",
            "6f462e18-beed-4b62-99bd-3305921791f0"
          ],
          "display_name": false
        },
        {
          "uuid": "4fc529ba-f9e6-4d28-920e-ee2d6e41c014",
          "name": "1,3-BENZENEDICARBONYL DICHLORIDE",
          "stdName": "1,3-BENZENEDICARBONYL DICHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6786d340-c297-479b-be58-b828fb7a98cf",
            "bf781eb5-1766-412c-ad08-d30b87acd6cc"
          ],
          "display_name": false
        },
        {
          "uuid": "ef4a160c-604e-44a4-94c8-29b73c03f18f",
          "name": "1,3-BIS(CHLOROCARBONYL)BENZENE",
          "stdName": "1,3-BIS(CHLOROCARBONYL)BENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6786d340-c297-479b-be58-b828fb7a98cf",
            "bf781eb5-1766-412c-ad08-d30b87acd6cc"
          ],
          "display_name": false
        },
        {
          "uuid": "10030c64-a907-44a7-9aac-4afde4e5f4b0",
          "name": "1,3-DI(CHLOROCARBONYL)BENZENE",
          "stdName": "1,3-DI(CHLOROCARBONYL)BENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6786d340-c297-479b-be58-b828fb7a98cf",
            "bf781eb5-1766-412c-ad08-d30b87acd6cc"
          ],
          "display_name": false
        },
        {
          "uuid": "8e4a8aaa-8dc5-4d6a-b5d1-bd247909c79d",
          "name": "ISOPHTHALIC ACID CHLORIDE",
          "stdName": "ISOPHTHALIC ACID CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6786d340-c297-479b-be58-b828fb7a98cf",
            "bf781eb5-1766-412c-ad08-d30b87acd6cc"
          ],
          "display_name": false
        },
        {
          "uuid": "6ac7c8ed-7bc0-4435-ad08-14d5586e83ad",
          "name": "ISOPHTHALIC ACID DICHLORIDE",
          "stdName": "ISOPHTHALIC ACID DICHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6786d340-c297-479b-be58-b828fb7a98cf",
            "bf781eb5-1766-412c-ad08-d30b87acd6cc"
          ],
          "display_name": false
        },
        {
          "uuid": "cc4cc3c3-d76f-4efd-8a1b-73f28b80fde4",
          "name": "ISOPHTHALOYL CHLORIDE",
          "stdName": "ISOPHTHALOYL CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b06e7dfa-4bc1-430a-a439-ecc9c939187f"
          ],
          "display_name": true
        },
        {
          "uuid": "03847eb0-aedd-4fcf-aecc-238b8d22fb10",
          "name": "ISOPHTHALYL DICHLORIDE",
          "stdName": "ISOPHTHALYL DICHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6786d340-c297-479b-be58-b828fb7a98cf",
            "bf781eb5-1766-412c-ad08-d30b87acd6cc"
          ],
          "display_name": false
        },
        {
          "uuid": "6f7a1ce6-1df9-4478-aecd-5dafc160f8bc",
          "name": "M-BENZENEDICARBONYL CHLORID",
          "stdName": "M-BENZENEDICARBONYL CHLORID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6786d340-c297-479b-be58-b828fb7a98cf",
            "bf781eb5-1766-412c-ad08-d30b87acd6cc"
          ],
          "display_name": false
        },
        {
          "uuid": "4b8d045d-96c6-4b22-934f-83e73606ee76",
          "name": "M-PHTHALIC DICHLORIDE",
          "stdName": "M-PHTHALIC DICHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6786d340-c297-479b-be58-b828fb7a98cf",
            "bf781eb5-1766-412c-ad08-d30b87acd6cc"
          ],
          "display_name": false
        },
        {
          "uuid": "4fd695ca-9555-4d93-b87a-fc0879ae25ed",
          "name": "M-PHTHALOYL CHLORIDE",
          "stdName": "M-PHTHALOYL CHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6786d340-c297-479b-be58-b828fb7a98cf",
            "bf781eb5-1766-412c-ad08-d30b87acd6cc"
          ],
          "display_name": false
        },
        {
          "uuid": "57b242fd-362b-46ec-9e77-f47af57f39e6",
          "name": "M-PHTHALOYL DICHLORIDE",
          "stdName": "M-PHTHALOYL DICHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6786d340-c297-479b-be58-b828fb7a98cf",
            "bf781eb5-1766-412c-ad08-d30b87acd6cc"
          ],
          "display_name": false
        },
        {
          "uuid": "6909c127-81c9-4562-adba-57d54ada70c1",
          "name": "NSC-41884",
          "stdName": "NSC-41884",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6786d340-c297-479b-be58-b828fb7a98cf",
            "e034f811-68a4-421f-a999-393a9dc0b354"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b06e7dfa-4bc1-430a-a439-ecc9c939187f",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6f462e18-beed-4b62-99bd-3305921791f0",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6786d340-c297-479b-be58-b828fb7a98cf",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf781eb5-1766-412c-ad08-d30b87acd6cc",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e034f811-68a4-421f-a999-393a9dc0b354",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d31c5279-0a9e-4e2f-975c-4efbc258acac",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391080000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad51e8c2-3d6e-482e-a5d8-d9a6545bff6f",
          "citation": "SRS import [6A3LDJ6CL3]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6A3LDJ6CL3",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391080000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86a17e68-681e-42b7-8c82-9f3743a4ba16",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93afd3d6-0b87-1e11-a878-e7da8984166e",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+99-63-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "44784562-8d51-a42e-97c0-140043727ab9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=99-63-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ace5858c-b570-4d91-ac07-d1399ff63e35",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9d681430-d47e-3faf-db09-c69cc7df9ab3",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6f41efca-81b7-4c05-8200-13c00d976dee",
          "id": "6f41efca-81b7-4c05-8200-13c00d976dee",
          "molfile": "\n  Marvin  01132105472D          \n\n 12 12  0  0  0  0            999 V2000\n    8.3503   -6.3624    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.3503   -5.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0683   -5.1242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6357   -5.1242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6357   -4.3054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9256   -3.8837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2106   -4.3054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2106   -5.1242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9256   -5.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4931   -5.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4931   -6.3624    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.7829   -5.1242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\nM  END",
          "smiles": "c1cc(cc(c1)C(=O)Cl)C(=O)Cl",
          "formula": "C8H4Cl2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "42b19d78-e7ad-45e1-a329-5b814ddd7780"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "203.0223",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1d0263bd-7ec5-4b37-9d0a-edce5613ebcf",
      "version": "8",
      "structure": {
        "id": "c2e75466-f179-42e0-8271-f1f05c132520",
        "molfile": "\n  Marvin  01132110042D          \n\n 12 12  0  0  0  0            999 V2000\n    6.2106   -5.1242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9256   -5.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6357   -5.1242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6357   -4.3054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9256   -3.8837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2106   -4.3054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3503   -5.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0683   -5.1242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3503   -6.3624    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.4931   -5.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7829   -5.1242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4931   -6.3624    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\nM  END",
        "smiles": "c1cc(cc(c1)C(=O)Cl)C(=O)Cl",
        "formula": "C8H4Cl2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "203.0223",
        "optical_activity": "NONE",
        "references": [
          "86a17e68-681e-42b7-8c82-9f3743a4ba16",
          "ad51e8c2-3d6e-482e-a5d8-d9a6545bff6f"
        ],
        "stereo_centers": 0
      },
      "unii": "6A3LDJ6CL3"
    }
  ]
}