{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3ff697e2-6a18-4a55-a011-ce5302e77382",
          "code": "2915-57-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2915-57-3",
          "code_system": "CAS",
          "references": [
            "fe4dce8c-0754-477c-9938-47f43ce7a731",
            "1d9b3479-56ad-44e1-9bf5-bcc334d29bcf"
          ]
        },
        {
          "uuid": "2f72385b-4ee5-4304-88f4-a1f53335316b",
          "code": "220-836-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.018.943",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "fe4dce8c-0754-477c-9938-47f43ce7a731"
          ]
        },
        {
          "uuid": "8f260a6d-781f-46e4-9701-142c379cad2e",
          "code": "1313740",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1313740/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "fe4dce8c-0754-477c-9938-47f43ce7a731"
          ]
        },
        {
          "uuid": "5ac9dc96-e0b1-444f-ac09-ab61a8b65c60",
          "code": "102903",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/102903",
          "code_system": "PUBCHEM",
          "references": [
            "fe4dce8c-0754-477c-9938-47f43ce7a731"
          ]
        },
        {
          "uuid": "425632bf-d10a-4800-a641-a9765eade42b",
          "code": "69W9UMG3P8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "de98d155-3a36-1817-316b-98f64e978cb1",
          "code": "DTXSID60863057",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60863057",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "7ccf2037-1537-b473-76f4-5f32e4244088",
          "code": "69W9UMG3P8",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=69W9UMG3P8",
          "code_system": "DAILYMED",
          "references": [
            "1882fb3d-cbfe-145f-c210-03a2e9b17275"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5c708425-e627-40ad-87a2-d1bf62edc617",
          "name": "BIS(2-ETHYLHEXYL) SUCCINATE",
          "stdName": "BIS(2-ETHYLHEXYL) SUCCINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da6684f8-c437-4c23-91a4-8411e68b92ba",
            "f17d8cd1-172c-4f4c-99f8-8d777a561630"
          ],
          "display_name": false
        },
        {
          "uuid": "0af6e416-604f-4e0d-b99d-78d0b5192a0b",
          "name": "BIS(2-ETHYLHEXYL)BUTANEDIOATE",
          "stdName": "BIS(2-ETHYLHEXYL)BUTANEDIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b846070-91a6-46c8-899f-b687d669faf1",
            "da6684f8-c437-4c23-91a4-8411e68b92ba"
          ],
          "display_name": false
        },
        {
          "uuid": "6f1cb499-18bf-4175-9a5d-7982bbec1bb8",
          "name": "BUTANEDIOIC ACID, BIS(2-ETHYLHEXYL) ESTER",
          "stdName": "BUTANEDIOIC ACID, BIS(2-ETHYLHEXYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b846070-91a6-46c8-899f-b687d669faf1",
            "da6684f8-c437-4c23-91a4-8411e68b92ba"
          ],
          "display_name": false
        },
        {
          "uuid": "7f3493f9-c0eb-4f14-a915-50b026d85d20",
          "name": "CRODAMOL OSU",
          "stdName": "CRODAMOL OSU",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b846070-91a6-46c8-899f-b687d669faf1",
            "da6684f8-c437-4c23-91a4-8411e68b92ba"
          ],
          "display_name": false
        },
        {
          "uuid": "34947d87-fa6a-4544-9f0d-2db46272abe3",
          "name": "DI-(2-ETHYLHEXYL) SUCCINATE",
          "stdName": "DI-(2-ETHYLHEXYL) SUCCINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b846070-91a6-46c8-899f-b687d669faf1",
            "da6684f8-c437-4c23-91a4-8411e68b92ba"
          ],
          "display_name": false
        },
        {
          "uuid": "c855cdc3-4b90-4d4b-a838-f1722f5f8a7f",
          "name": "DIETHYLHEXYL SUCCINATE",
          "stdName": "DIETHYLHEXYL SUCCINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "565f41ce-b214-42eb-9e93-76c6aca0a63c",
            "1b846070-91a6-46c8-899f-b687d669faf1",
            "ef078bea-bb04-45a6-b662-9b8e5b4a3769",
            "da6684f8-c437-4c23-91a4-8411e68b92ba"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "263692df-a689-459c-bb57-1facdfcf90da",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "78b46ccd-55a5-460d-b4a7-9c5326b4fcde",
          "name": "DIOCTYL SUCCINATE",
          "stdName": "DIOCTYL SUCCINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d974926c-f056-4309-8360-7a6d8fd15e72",
            "1b846070-91a6-46c8-899f-b687d669faf1"
          ],
          "display_name": false
        },
        {
          "uuid": "05f5f3db-80ed-46ad-a93b-862595faafdd",
          "name": "DUB SDO",
          "stdName": "DUB SDO",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b846070-91a6-46c8-899f-b687d669faf1",
            "da6684f8-c437-4c23-91a4-8411e68b92ba"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f17d8cd1-172c-4f4c-99f8-8d777a561630",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe4dce8c-0754-477c-9938-47f43ce7a731",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390916000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd2f26bc-683b-4f3a-876e-0afd2f412bdd",
          "citation": "SRS import [69W9UMG3P8]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=69W9UMG3P8",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390916000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef078bea-bb04-45a6-b662-9b8e5b4a3769",
          "citation": "DIETHYLHEXYL SUCCINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1b846070-91a6-46c8-899f-b687d669faf1",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d974926c-f056-4309-8360-7a6d8fd15e72",
          "citation": "CTFA DL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da6684f8-c437-4c23-91a4-8411e68b92ba",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "565f41ce-b214-42eb-9e93-76c6aca0a63c",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d9b3479-56ad-44e1-9bf5-bcc334d29bcf",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1882fb3d-cbfe-145f-c210-03a2e9b17275",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fe3447c5-c04b-49b0-bbbd-acb65a966c32",
          "id": "fe3447c5-c04b-49b0-bbbd-acb65a966c32",
          "molfile": "\n  Marvin  01132113102D          \n\n 24 23  0  0  0  0            999 V2000\n    0.0000   -1.6459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7519   -1.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4211   -1.4831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1730   -1.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8319   -1.3178    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.7389   -0.4910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3978   -0.0078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5967   -1.6382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2582   -1.1472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0101   -1.4754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1109   -2.2945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6690   -0.9793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4338   -1.3100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0953   -0.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9996    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8549   -1.1343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5138   -0.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2708   -0.9715    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.3665   -1.7906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7050   -2.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9323   -0.4754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6920   -0.8088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3509   -0.3127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1079   -0.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 21 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COC(=O)CCC(=O)OCC(CC)CCCC",
          "formula": "C20H38O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cb4d5191-2e5e-4fcb-bcea-c7458121cdbf"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "342.5141",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2f4d8c58-815d-4041-8e7b-27fa7f9c97a5",
      "version": "5",
      "structure": {
        "id": "824eab2a-42e4-4869-bf1c-0e92a2f82c1b",
        "molfile": "\n  Marvin  01132106462D          \n\n 24 23  0  0  0  0            999 V2000\n    5.0101   -1.4754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0953   -0.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1109   -2.2945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9996    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2582   -1.1472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8549   -1.1343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6690   -0.9793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4338   -1.3100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5967   -1.6382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5138   -0.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8319   -1.3178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2708   -0.9715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7389   -0.4910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3665   -1.7906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1730   -1.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9323   -0.4754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7519   -1.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3509   -0.3127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6920   -0.8088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4211   -1.4831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3978   -0.0078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7050   -2.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.6459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1079   -0.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  8  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  2  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  6  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 11  1  0  0  0  0\n 16 12  1  0  0  0  0\n 17 20  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 16  1  0  0  0  0\n 20 15  1  0  0  0  0\n 21 13  1  0  0  0  0\n 22 14  1  0  0  0  0\n 23 17  1  0  0  0  0\n 24 18  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COC(=O)CCC(=O)OCC(CC)CCCC",
        "formula": "C20H38O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "342.5141",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "fd2f26bc-683b-4f3a-876e-0afd2f412bdd",
          "1b846070-91a6-46c8-899f-b687d669faf1"
        ],
        "stereo_centers": 2
      },
      "unii": "69W9UMG3P8"
    }
  ]
}