{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "310ef695-7f06-4fef-8a39-8204516d57a5", "code": "149128-48-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=149128-48-3", "code_system": "CAS", "references": [ "7ffbad07-8657-41e0-a139-19a387b57f79", "dc5c7dfb-b14b-430d-b261-23f6ac407e2f" ] }, { "uuid": "833a7185-3425-4058-9cd9-f4f5f5c0630d", "code": "9959565", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9959565", "code_system": "PUBCHEM", "references": [ "7ffbad07-8657-41e0-a139-19a387b57f79" ] }, { "uuid": "003aff2a-cb53-d776-a6b6-10757d30d91a", "code": "DTXSID90164180", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90164180", "code_system": "EPA CompTox", "references": [ "dc6c1197-94b9-da3d-0383-382188e3301d" ] }, { "uuid": "81f8d754-e291-46df-a37d-b183da6a5097", "code": "69B8BD4H9G", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "39187704-91b7-43da-8a29-b98925a3a0f3", "name": "L-SERINE, L-LYSYL-L-THREONYL-L-THREONYL-L-LYSYL-", "stdName": "L-SERINE, L-LYSYL-L-THREONYL-L-THREONYL-L-LYSYL-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b436db8f-58b3-4d5a-864d-ade24f5e63cf", "f2d9f3d2-9f3a-41a5-95b9-3983aa8f3277" ], "display_name": false }, { "uuid": "6b039c1b-8f31-48ad-8977-26eb2090f965", "name": "L-SERINE, N-(N2-(N-(N-L-LYSYL-L-THREONYL)-L-THREONYL)-L-LYSYL)-", "stdName": "L-SERINE, N-(N2-(N-(N-L-LYSYL-L-THREONYL)-L-THREONYL)-L-LYSYL)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b436db8f-58b3-4d5a-864d-ade24f5e63cf", "f2d9f3d2-9f3a-41a5-95b9-3983aa8f3277" ], "display_name": false }, { "uuid": "71f99c90-300d-4058-9c6d-fb18a523c798", "name": "LYS-THR-THR-LYS-SER", "stdName": "LYS-THR-THR-LYS-SER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "908963a7-af4e-4c23-b509-b59f1ea54558", "b436db8f-58b3-4d5a-864d-ade24f5e63cf" ], "display_name": false }, { "uuid": "996e0739-be2e-4c53-8d85-ccb120c090cf", "name": "LYSYLTHREONYLTHREONYLLYSYLSERINE", "stdName": "LYSYLTHREONYLTHREONYLLYSYLSERINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "908963a7-af4e-4c23-b509-b59f1ea54558", "b436db8f-58b3-4d5a-864d-ade24f5e63cf" ], "display_name": true }, { "uuid": "c0cef650-8850-4ab6-aa41-58fabbe9d075", "name": "PENTAPEPTIDE-4", "stdName": "PENTAPEPTIDE-4", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "b436db8f-58b3-4d5a-864d-ade24f5e63cf", "47374f7b-ce29-4182-b492-6d00db744832", "7899b171-e6fe-41f6-aed4-948a1ad19787", "89ff621e-95e1-4626-8734-a7f98539400f" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "7c4d2448-0d99-401a-9c9a-a99d32c4ce84", "name_org": "INCI" } ] } ], "references": [ { "uuid": "7899b171-e6fe-41f6-aed4-948a1ad19787", "citation": "PCPC-4", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "b436db8f-58b3-4d5a-864d-ade24f5e63cf", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f2d9f3d2-9f3a-41a5-95b9-3983aa8f3277", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "47374f7b-ce29-4182-b492-6d00db744832", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "908963a7-af4e-4c23-b509-b59f1ea54558", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7ffbad07-8657-41e0-a139-19a387b57f79", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390975000, "tags": [ "NOMEN" ] }, { "uuid": "feea1238-9d81-419b-b50f-ae1c437d0deb", "citation": "SRS import [69B8BD4H9G]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=69B8BD4H9G", "doc_type": "SRS", "public_domain": true, "document_date": 1493390975000, "tags": [ "NOMEN" ] }, { "uuid": "39f62aee-9e13-43be-b686-438a9d50c7e4", "citation": "http://www.frbiz.com/q-palmitoyl_pentapeptide/", "url": "http://www.frbiz.com/q-palmitoyl_pentapeptide/", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "89ff621e-95e1-4626-8734-a7f98539400f", "citation": "PENTAPEPTIDE-4 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "dc6c1197-94b9-da3d-0383-382188e3301d", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=149128-48-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "dc5c7dfb-b14b-430d-b261-23f6ac407e2f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "246af4c6-9c4c-4715-8b89-05582c41fb9c", "id": "246af4c6-9c4c-4715-8b89-05582c41fb9c", "molfile": "\n Marvin 01132102022D \n\n 39 38 0 0 1 0 999 V2000\n 13.9209 -9.2801 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 14.6354 -9.6926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2064 -9.6926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9209 -8.4551 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 13.2064 -8.0426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4920 -8.4551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4920 -9.2801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7775 -8.0426 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 11.0630 -8.4551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3486 -8.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3486 -7.2176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6341 -8.4551 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 9.6341 -9.2801 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9196 -8.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2051 -8.4551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4907 -8.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7762 -8.4551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0617 -8.0426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7775 -7.2176 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 11.0630 -6.8051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4920 -6.8051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6354 -8.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6354 -7.2176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3498 -8.4551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0643 -8.0426 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 16.0643 -7.2176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7788 -6.8051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7788 -5.9801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4933 -5.5676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4933 -4.7426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7788 -8.4551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7788 -9.2801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4933 -8.0426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2077 -8.4551 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 18.2077 -9.2801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9222 -9.6926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9222 -8.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9222 -7.2176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.6367 -8.4551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 1 0 0 0\n 4 1 1 0 0 0 0\n 4 5 1 6 0 0 0\n 4 22 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 1 0 0 0\n 8 19 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 1 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 1 1 0 0 0\n 22 23 2 0 0 0 0\n 22 24 1 0 0 0 0\n 25 24 1 1 0 0 0\n 25 26 1 0 0 0 0\n 31 25 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 31 32 2 0 0 0 0\n 31 33 1 0 0 0 0\n 34 33 1 6 0 0 0\n 34 35 1 0 0 0 0\n 34 37 1 0 0 0 0\n 35 36 1 0 0 0 0\n 37 38 1 0 0 0 0\n 39 37 2 0 0 0 0\nM END", "smiles": "C[C@H]([C@@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCCCN)N)O", "formula": "C23H45N7O9", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "6f59e174-77c5-44ba-9dbf-c5c71d0b1b70" }, "defined_stereo": 7, "ez_centers": 0, "molecular_weight": "563.6458", "optical_activity": "UNSPECIFIED", "stereo_centers": 7 } ], "definition_level": "COMPLETE", "uuid": "5076e0fe-6dd6-4de1-bd3a-f7c5b421d5b2", "version": "4", "structure": { "id": "2bb82833-6b63-4a33-a515-44d625dcc0f4", "molfile": "\n Marvin 01132102222D \n\n 39 38 0 0 1 0 999 V2000\n 10.3486 -8.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3486 -7.2176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6341 -9.2801 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6341 -8.4551 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.9196 -8.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2051 -8.4551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4907 -8.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7762 -8.4551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0617 -8.0426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4920 -8.4551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4920 -9.2801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0630 -8.4551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7775 -8.0426 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.7775 -7.2176 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.0630 -6.8051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4920 -6.8051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6354 -8.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6354 -7.2176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2064 -8.0426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9209 -8.4551 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.9209 -9.2801 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.6354 -9.6926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2064 -9.6926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7788 -8.4551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7788 -9.2801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3498 -8.4551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0643 -8.0426 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.0643 -7.2176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7788 -6.8051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7788 -5.9801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4933 -5.5676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4933 -4.7426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9222 -8.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9222 -7.2176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4933 -8.0426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2077 -8.4551 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 18.2077 -9.2801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9222 -9.6926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.6367 -8.4551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 4 3 1 1 0 0 0\n 1 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 13 12 1 1 0 0 0\n 10 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 1 0 0 0\n 1 12 1 0 0 0 0\n 17 18 2 0 0 0 0\n 20 19 1 6 0 0 0\n 17 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 1 1 0 0 0\n 10 19 1 0 0 0 0\n 24 25 2 0 0 0 0\n 26 27 1 0 0 0 0\n 24 27 1 0 0 0 0\n 27 28 1 1 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 17 26 1 0 0 0 0\n 33 34 2 0 0 0 0\n 35 36 1 0 0 0 0\n 33 36 1 0 0 0 0\n 36 37 1 6 0 0 0\n 37 38 1 0 0 0 0\n 24 35 1 0 0 0 0\n 39 33 1 0 0 0 0\nM END", "smiles": "C[C@H]([C@@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCCCN)N)O", "formula": "C23H45N7O9", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 7, "ez_centers": 0, "molecular_weight": "563.6458", "optical_activity": "UNSPECIFIED", "references": [ "feea1238-9d81-419b-b50f-ae1c437d0deb", "39f62aee-9e13-43be-b686-438a9d50c7e4" ], "stereo_centers": 7 }, "unii": "69B8BD4H9G" } ] }