{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e48eba7d-f52f-4dab-9377-d8a783c82677",
          "code": "666706-39-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=666706-39-4",
          "code_system": "CAS",
          "references": [
            "149cd2ba-88b4-4d00-9cc0-55a597749589",
            "6f2459fa-8a48-43a2-ab24-e3ac2300fc06"
          ]
        },
        {
          "uuid": "8203426b-e440-40ce-b547-7102ec153eed",
          "code": "233603-82-2",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=233603-82-2",
          "code_system": "CAS",
          "references": [
            "149cd2ba-88b4-4d00-9cc0-55a597749589",
            "6d296f36-d7f0-41d3-b98c-ea5a54a8cfb5"
          ]
        },
        {
          "uuid": "7e52b395-2621-4c1b-b0dd-a9e4fa40d5fa",
          "code": "6901307Z5U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "967a5eb7-4e0c-baed-40d2-949683e59ddc",
          "code": "135539121",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135539121",
          "code_system": "PUBCHEM",
          "references": [
            "f5508ab2-d044-913d-3497-79ea7ce9f4be"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9ef6795c-3acb-419d-9e6b-1d3e18ead5c4",
          "name": "(S)-NS-1209",
          "stdName": "(S)-NS-1209",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c22a02d7-f661-495e-ae00-414063c8d669",
            "b064b5f7-9f90-4cbb-9a5c-b5123274525a"
          ],
          "display_name": false
        },
        {
          "uuid": "fd63bcb5-4b81-447f-9924-3ab9a603801e",
          "name": "BUTANOIC ACID, 2-(((Z)-(5-(4-((DIMETHYLAMINO)SULFONYL)PHENYL)-1,2,6,7,8,9-HEXAHYDRO-8-METHYL-2-OXO-3H-PYRROLO(3,2-H)ISOQUINOLIN-3-YLIDENE)AMINO)OXY)-4-HYDROXY-, (2S)-",
          "stdName": "BUTANOIC ACID, 2-(((Z)-(5-(4-((DIMETHYLAMINO)SULFONYL)PHENYL)-1,2,6,7,8,9-HEXAHYDRO-8-METHYL-2-OXO-3H-PYRROLO(3,2-H)ISOQUINOLIN-3-YLIDENE)AMINO)OXY)-4-HYDROXY-, (2S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c22a02d7-f661-495e-ae00-414063c8d669",
            "b064b5f7-9f90-4cbb-9a5c-b5123274525a"
          ],
          "display_name": false
        },
        {
          "uuid": "b2e9820b-c6c9-4305-a187-8dc2925973c5",
          "name": "NS-1209, (S)-",
          "stdName": "NS-1209, (S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b74827aa-c01e-467f-a450-f33db6d82b67",
            "c22a02d7-f661-495e-ae00-414063c8d669"
          ],
          "display_name": true
        },
        {
          "uuid": "f53ce805-cce2-455b-a030-67b3fd392c24",
          "name": "NS-1220",
          "stdName": "NS-1220",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ec4ce35-c20f-4d6a-8fc1-e351b0815b94",
            "c22a02d7-f661-495e-ae00-414063c8d669"
          ],
          "display_name": false
        },
        {
          "uuid": "0c3f082e-cce5-47a7-91ef-af8d8d75d220",
          "name": "SPD-502, (S)-",
          "stdName": "SPD-502, (S)-",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ec4ce35-c20f-4d6a-8fc1-e351b0815b94",
            "c22a02d7-f661-495e-ae00-414063c8d669"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b74827aa-c01e-467f-a450-f33db6d82b67",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c22a02d7-f661-495e-ae00-414063c8d669",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b064b5f7-9f90-4cbb-9a5c-b5123274525a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ec4ce35-c20f-4d6a-8fc1-e351b0815b94",
          "citation": "J Pharmacol Exp Ther. 1999 Jun;289(3):1492-501",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "149cd2ba-88b4-4d00-9cc0-55a597749589",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391728000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "39f78663-1ba6-446e-9d63-faebe3bfde96",
          "citation": "SRS import [6901307Z5U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6901307Z5U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391728000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d296f36-d7f0-41d3-b98c-ea5a54a8cfb5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6f2459fa-8a48-43a2-ab24-e3ac2300fc06",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f5508ab2-d044-913d-3497-79ea7ce9f4be",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "324c1e53-ae1a-4f13-ae56-29999a27edbb",
          "id": "324c1e53-ae1a-4f13-ae56-29999a27edbb",
          "molfile": "\n  Marvin  01132102412D          \n\n 36 39  0  0  1  0            999 V2000\n   10.8322   -3.2111    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   11.3842   -2.5981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1912   -2.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7432   -2.1565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0252   -3.0396    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4732   -3.6527    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6663   -3.4812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0532   -4.0332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0532   -4.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3387   -5.2707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3387   -6.0957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6242   -6.5082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6242   -7.3332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3387   -7.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0532   -7.3332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0532   -6.5082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3387   -8.5707    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5137   -8.5707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3387   -9.3957    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1637   -8.5707    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5762   -9.2851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5761   -7.8562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6242   -4.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9098   -5.2707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1953   -4.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1953   -4.0332    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4808   -3.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9098   -3.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6242   -4.0332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3387   -3.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5102   -2.8138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3307   -2.7275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7432   -2.0130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0872   -3.9958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8941   -4.1672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5352   -4.6088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  5  1  1  0  0  0\n  1 34  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  3  0  0  0\n  7 32  1  0  0  0  0\n  9  8  1  0  0  0  0\n 30  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 23 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 16  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 17  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  2  0  0  0  0\n 17 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 23 29  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  1  0  0  0  0\n 28 26  1  0  0  0  0\n 28 29  1  0  0  0  0\n 30 29  1  0  0  0  0\n 31 30  2  3  0  0  0\n 31 32  1  0  0  0  0\n 32 33  2  0  0  0  0\n 34 35  1  0  0  0  0\n 34 36  2  0  0  0  0\nM  END",
          "smiles": "CN(C)S(=O)(=O)c1ccc(cc1)-c2cc3=C(C(=O)N=c3c4CN(C)CCc24)NO[C@@H](CCO)C(=O)O",
          "formula": "C24H28N4O7S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8455cb41-14b4-4229-ad9d-c67b4335d8ee"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "516.5687",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "aa52ff95-8dea-4ffe-8029-4d05b83aca87",
      "version": "5",
      "structure": {
        "id": "7961bb4f-9fd7-43bb-96ce-152b0d925360",
        "molfile": "\n  Marvin  01132106182D          \n\n 36 39  0  0  1  0            999 V2000\n    6.6242   -4.0332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3387   -3.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5102   -2.8138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3307   -2.7275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6663   -3.4812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0532   -4.0332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0532   -4.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3387   -5.2707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3387   -6.0957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6242   -6.5082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6242   -7.3332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3387   -7.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3387   -8.5707    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1637   -8.5707    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5762   -9.2851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5761   -7.8562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5137   -8.5707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3387   -9.3957    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0532   -7.3332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0532   -6.5082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6242   -4.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9098   -5.2707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1953   -4.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1953   -4.0332    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9098   -3.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4808   -3.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4732   -3.6527    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0252   -3.0396    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8322   -3.2111    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.0872   -3.9958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8941   -4.1672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5352   -4.6088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3842   -2.5981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1912   -2.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7432   -2.1565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7432   -2.0130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 13 17  2  0  0  0  0\n 13 18  2  0  0  0  0\n 12 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n  9 20  1  0  0  0  0\n 21  8  2  0  0  0  0\n 21  1  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25  1  1  0  0  0  0\n 25 24  1  0  0  0  0\n 24 26  1  0  0  0  0\n  5 27  2  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  1  1  0  0  0\n 29 30  1  0  0  0  0\n 30 31  1  0  0  0  0\n 30 32  2  0  0  0  0\n 29 33  1  0  0  0  0\n 34 33  1  0  0  0  0\n 34 35  1  0  0  0  0\n  4 36  2  0  0  0  0\nM  END",
        "smiles": "CN(C)S(=O)(=O)c1ccc(cc1)-c2cc/3c(c4CN(C)CCc24)NC(=O)\\C3=N/O[C@@H](CCO)C(=O)O",
        "formula": "C24H28N4O7S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 1,
        "molecular_weight": "516.5687",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "39f78663-1ba6-446e-9d63-faebe3bfde96",
          "b064b5f7-9f90-4cbb-9a5c-b5123274525a"
        ],
        "stereo_centers": 1
      },
      "unii": "6901307Z5U"
    }
  ]
}