{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "69f34023-8737-4969-949b-4e04a1674b1d", "code": "15834-05-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=15834-05-6", "code_system": "CAS", "references": [ "8fbd1e96-ea05-42f6-a864-bdef2ddfc5ea" ] }, { "uuid": "a24a9046-30b3-abbf-f3f5-1ac980e3b0ec", "code": "DTXSID00864644", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00864644", "code_system": "EPA CompTox", "references": [ "5c382f8e-28a7-b803-f23d-054336ef38e7" ] }, { "uuid": "b5c8ab1b-c0e2-40c0-a6f4-b94d6ed6acf9", "code": "68ZA785RNL", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "a0b92380-6d6c-eb30-b44a-af8fea41561e", "code": "85132", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/85132", "code_system": "PUBCHEM", "references": [ "872e85ce-f95f-c388-e4d4-7b4bb2b5aa07" ] } ], "substance_class": "chemical", "names": [ { "uuid": "142b6da0-98c7-493a-8bb4-094d79609973", "name": "1,1′-(2,2-Dimethyl-1,3-propanediyl) dinonanoate", "stdName": "1,1'-(2,2-DIMETHYL-1,3-PROPANEDIYL) DINONANOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8fbd1e96-ea05-42f6-a864-bdef2ddfc5ea" ], "display_name": false }, { "uuid": "862b4f9b-0d62-4d55-8539-20c755dbfad9", "name": "2,2-Dimethylpropane-1,3-diyl dinonanoate", "stdName": "2,2-DIMETHYLPROPANE-1,3-DIYL DINONANOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8fbd1e96-ea05-42f6-a864-bdef2ddfc5ea" ], "display_name": true }, { "uuid": "ec56c7ac-e7ca-426c-8161-f937e939ec33", "name": "Nonanoic acid 1,1′-(2,2-dimethyl-1,3-propanediyl) ester", "stdName": "NONANOIC ACID 1,1'-(2,2-DIMETHYL-1,3-PROPANEDIYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8fbd1e96-ea05-42f6-a864-bdef2ddfc5ea" ], "display_name": false }, { "uuid": "13f0323b-bb5f-415f-9aaa-a0eac387ff97", "name": "Nonanoic acid,2,2-dimethyl-1,3-propanediyl ester", "stdName": "NONANOIC ACID,2,2-DIMETHYL-1,3-PROPANEDIYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8fbd1e96-ea05-42f6-a864-bdef2ddfc5ea" ], "display_name": false } ], "references": [ { "uuid": "8fbd1e96-ea05-42f6-a864-bdef2ddfc5ea", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "5c382f8e-28a7-b803-f23d-054336ef38e7", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "872e85ce-f95f-c388-e4d4-7b4bb2b5aa07", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "df63f56b-8dcd-4583-b91e-4114be25ee88", "id": "df63f56b-8dcd-4583-b91e-4114be25ee88", "molfile": "1,1'-(2,2-Dimethyl-1,3-propanediyl) dinonanoate\n CDK 12292309542D\n15834-05-6 Copyright (C) 2023 ACS\n 27 26 0 0 0 0 0 0 0 0999 V2000\n 11.5503 6.6685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3203 8.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0102 6.6685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6539 7.2323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0903 9.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9864 8.7723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2402 5.3348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9876 8.0023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7002 5.3348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0102 4.0012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3213 7.2323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9302 4.0012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6551 8.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3213 5.6923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3901 4.0012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9888 7.2323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6201 2.6675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3224 8.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0801 2.6675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6561 7.2323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3100 1.3337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.9899 8.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7700 1.3337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3236 7.2323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6573 8.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.9909 7.2323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 2 5 1 0 0 0 0\n 2 6 1 0 0 0 0\n 3 7 1 0 0 0 0\n 4 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 7 10 2 0 0 0 0\n 8 11 1 0 0 0 0\n 9 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 11 14 2 0 0 0 0\n 12 15 1 0 0 0 0\n 13 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 20 22 1 0 0 0 0\n 21 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 24 26 1 0 0 0 0\n 26 27 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC(=O)OCC(C)(C)COC(=O)CCCCCCCC", "formula": "C23H44O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "157025da-5ee8-474d-85fb-5746172aba45" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "384.5939", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "10b45264-e84e-4b5b-b86b-430b8dbb792c", "version": "6", "structure": { "id": "ccf942d1-5dc6-4084-884a-fc03c07c44ce", "molfile": "\n JSDraw206282417572D\n\n 27 26 0 0 0 0 0 V2000\n 38.1570 -7.9035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.8060 -7.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.4550 -7.9035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.1040 -7.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.7530 -7.9035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.4020 -7.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0510 -7.9035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6999 -7.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3490 -7.9035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3490 -9.4635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9980 -7.1235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6470 -7.9035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2960 -7.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2988 -5.9285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.2932 -5.9285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.9450 -7.9035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5940 -7.1235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2430 -7.9035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2430 -9.4635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8920 -7.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5410 -7.9035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1900 -7.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8390 -7.9035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4880 -7.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1369 -7.9035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7860 -7.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4350 -7.9035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 13 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC(=O)OCC(C)(C)COC(=O)CCCCCCCC", "formula": "C23H44O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "384.5939", "optical_activity": "NONE", "references": [ "8fbd1e96-ea05-42f6-a864-bdef2ddfc5ea" ], "stereo_centers": 0 }, "unii": "68ZA785RNL" } ] }