{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "efcbe756-0138-4d30-8629-ba2725bb216c", "code": "C01BC03", "comments": "ATC|CARDIOVASCULAR SYSTEM|CARDIAC THERAPY|ANTIARRHYTHMICS, CLASS I AND III|Antiarrhythmics, class Ic|propafenone", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=C01BC03&showdescription=yes", "code_system": "WHO-ATC", "references": [ "d5456051-f638-4ce0-b59d-2a647915ee78" ] }, { "uuid": "a9f9d43e-4696-4edc-b973-08f942b2c8b7", "code": "N0000175426", "comments": "Established Pharmacologic Class [EPC]|Antiarrhythmic [EPC]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175426", "code_system": "NDF-RT", "references": [ "d5456051-f638-4ce0-b59d-2a647915ee78" ] }, { "uuid": "da1bfc06-0148-4a3d-8a63-5ca8eb20b170", "code": "QC01BC03", "comments": "VATC|CARDIAC THERAPY|ANTIARRYTHMICS, CLASS I AND III|Antiarrhythmics, class Ic|propafenone", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC01BC03&showdescription=yes", "code_system": "WHO-VATC", "references": [ "d5456051-f638-4ce0-b59d-2a647915ee78" ] }, { "uuid": "8eebf243-d335-4755-a5d2-518f055998d6", "code": "54063-53-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=54063-53-5", "code_system": "CAS", "references": [ "d5456051-f638-4ce0-b59d-2a647915ee78", "999d0a6c-0d05-4b2e-812e-3ed909ed9124" ] }, { "uuid": "c1b0bf4a-3d82-4c32-b190-52939bca8fa2", "code": "C61909", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61909", "code_system": "NCI_THESAURUS", "references": [ "d5456051-f638-4ce0-b59d-2a647915ee78" ] }, { "uuid": "a578eed8-8369-4f7f-80fc-d9794d9771e8", "code": "D011405", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68011405", "code_system": "MESH", "references": [ "d5456051-f638-4ce0-b59d-2a647915ee78" ] }, { "uuid": "5bcd0c1b-539f-4e62-9b3d-e6715301e8dd", "code": "NBK548005", "comments": "LiverTox|Cardiac|Anti-arrhythmic|Na channel blocker: Class Ic", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/NBK548005/", "code_system": "LIVERTOX", "references": [ "b9aacb87-137b-f496-df20-a7faaaba4e78" ] }, { "uuid": "60a48674-aa1b-42f2-9a1b-f5dae403a45c", "code": "PROPAFENONE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Propafenone", "code_system": "WIKIPEDIA", "references": [ "d5456051-f638-4ce0-b59d-2a647915ee78" ] }, { "uuid": "fe230c37-3446-4d03-a90f-18ea4a61c79e", "code": "SUB10094MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "d5456051-f638-4ce0-b59d-2a647915ee78" ] }, { "uuid": "99e52111-fac8-44d8-bbf3-85a95a49295d", "code": "3312", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3312", "code_system": "INN", "references": [ "d5456051-f638-4ce0-b59d-2a647915ee78" ] }, { "uuid": "5f099b59-d5b4-429c-8361-706f449f513d", "code": "258-955-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.053.578", "code_system": "ECHA (EC/EINECS)", "references": [ "d5456051-f638-4ce0-b59d-2a647915ee78" ] }, { "uuid": "2865c7e7-67f6-4688-8525-57be84ccc42b", "code": "2561", "type": "PRIMARY", "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=2561", "code_system": "IUPHAR", "references": [ "d5456051-f638-4ce0-b59d-2a647915ee78" ] }, { "uuid": "88c9c8ac-b392-4a7c-8475-e6e8933121ca", "code": "8754", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/8754/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "d5456051-f638-4ce0-b59d-2a647915ee78" ] }, { "uuid": "a20beb6b-8e9f-4817-bcf7-c7e634680713", "code": "m9178", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m9178?q=authorize", "code_system": "MERCK INDEX", "references": [ "d5456051-f638-4ce0-b59d-2a647915ee78" ] }, { "uuid": "11b6c3b2-3173-4362-ba10-d942dfd02773", "code": "DB01182", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB01182", "code_system": "DRUG BANK", "references": [ "d5456051-f638-4ce0-b59d-2a647915ee78" ] }, { "uuid": "6283ff2a-0440-4a40-a273-cc7336c89adf", "code": "CHEMBL631", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL631", "code_system": "ChEMBL", "references": [ "d5456051-f638-4ce0-b59d-2a647915ee78" ] }, { "uuid": "84156c89-79b5-4ad5-b7c9-fd68b39577a2", "code": "4932", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4932", "code_system": "PUBCHEM", "references": [ "d5456051-f638-4ce0-b59d-2a647915ee78" ] }, { "uuid": "9586c10b-c0a7-642c-ad91-1cdd2b08cc64", "code": "7929", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7929", "code_system": "HSDB", "references": [ "5fd47ccd-3782-fce7-f883-2eb992da86ad" ] }, { "uuid": "03b1b2fc-e849-8b24-7ef8-acc00eb03f24", "code": "DTXSID9045184", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9045184", "code_system": "EPA CompTox", "references": [ "ceacec08-0487-8797-aec4-5ecabe5d8a5e" ] }, { "uuid": "70bada62-8a5b-e949-af7c-61213498a469", "code": "Propafenone", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM229/", "code_system": "LACTMED", "references": [ "b9aacb87-137b-f496-df20-a7faaaba4e78" ] }, { "uuid": "d38bb221-d968-0b7c-6ea4-7457f3b0cec8", "code": "C47793", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Cardiovascular System[C78274]|Antiarrhythmic Agent", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47793", "code_system": "NCI_THESAURUS", "references": [ "b9aacb87-137b-f496-df20-a7faaaba4e78" ] }, { "uuid": "1c7213c1-69ed-9568-840a-a1a22eb139f2", "code": "C93038", "comments": "Pharmacologic Substance[C1909]|Cation Channel Blocker", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C93038", "code_system": "NCI_THESAURUS", "references": [ "b9aacb87-137b-f496-df20-a7faaaba4e78" ] }, { "uuid": "680715e8-2ceb-412f-8ab2-a6c1886cac4c", "code": "68IQX3T69U", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "5abd7f16-089c-2b0f-be9e-267f5561f5da", "code": "2291", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/2291", "code_system": "DRUG CENTRAL", "references": [ "b9aacb87-137b-f496-df20-a7faaaba4e78" ] }, { "uuid": "94f916fa-7a75-7a72-5dc3-734c94392d5b", "code": "63619", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:63619", "code_system": "CHEBI", "references": [ "b9aacb87-137b-f496-df20-a7faaaba4e78" ] }, { "uuid": "fba9fb60-23e6-4056-8132-0dc0c9052f67", "code": "68IQX3T69U", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=68IQX3T69U", "code_system": "DAILYMED", "references": [ "cfbd1a6f-4a1d-f26d-1159-58e21626c426" ] }, { "uuid": "94e5cc17-f072-6709-b56b-be57c264c0b1", "code": "100000081149", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "8154507b-d9b0-6581-1309-21be6009147d" ] } ], "substance_class": "chemical", "references": [ { "uuid": "046c3c93-69fa-4ae8-a04d-fe7458bcc3e5", "citation": "USP Dictionary", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "0699a0a5-913e-44fb-90f3-627a34d21f19", "citation": "ACD 9.0", "doc_type": "ACD", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f4fba0bb-ad04-4ff4-83e1-8a6dc9b4f11c", "citation": "INN Proposed List 29", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL29.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e2391e84-ada0-4e86-b8e5-c269a0c7d0b1", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8c73eea9-bf24-4fa2-bb8f-52c93b0009cb", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "186511e9-b400-43ec-bbe7-b5f4d1f72636", "citation": "KEGG 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "eb35d8ee-8355-42dc-9191-dece033b9f2c", "citation": "D08435", "doc_type": "KEGG", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "03b6a7ad-aca1-4a9e-9120-07ccbeb2bad6", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "39f39549-3a9b-4013-81ab-48b5b2e4636c", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "67b9f7c6-990b-4980-b04f-1370e3a826d2", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d5456051-f638-4ce0-b59d-2a647915ee78", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390011000, "tags": [ "NOMEN" ] }, { "uuid": "a2752b76-8270-476b-99d5-12e8f5d49e3d", "citation": "http://www.accessdata.fda.gov/spl/data/a3a897b6-f45b-404d-a7f2-1b1811002b98/a3a897b6-f45b-404d-a7f2-1b1811002b98.xml", "url": "http://www.accessdata.fda.gov/spl/data/a3a897b6-f45b-404d-a7f2-1b1811002b98/a3a897b6-f45b-404d-a7f2-1b1811002b98.xml", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f571850e-1007-48ba-a836-d22c14bf3d88", "citation": "SRS import [68IQX3T69U]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=68IQX3T69U", "doc_type": "SRS", "public_domain": true, "document_date": 1493390011000, "tags": [ "NOMEN" ] }, { "uuid": "fe631170-9094-4036-94f8-28a8f529b259", "citation": "PROPAFENONE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2826b181-48bc-4e86-ae83-cc1412138f79", "citation": "PROPAFENONE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "752bad12-6e27-46ac-be7e-041828ceacc9", "citation": "PROPAFENONE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "b5838971-a988-47f7-950a-06f92458fb04", "citation": "PROPAFENONE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "3056eb33-96c4-456e-b982-0c3f3f686271", "citation": "PROPAFENONE [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f8a4b154-dbba-1e81-268e-91cdfc958b80", "citation": "Drug Information Handbook, 2016-2017 - 25th edition; Lexicomp Drug Reference Handbook; ISBN13: 9781591953531", "doc_type": "BOOK", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "7ab18714-75b6-6ac8-b5e2-c5a7b0254483", "citation": "Pharmacol Rev 65:578–640, April 2013", "url": "http://dx.doi.org/10.1124/pr.111.005439", "doc_type": "JA", "public_domain": true }, { "uuid": "5fd47ccd-3782-fce7-f883-2eb992da86ad", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+54063-53-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ceacec08-0487-8797-aec4-5ecabe5d8a5e", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=54063-53-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "7dc7c8b4-a6fb-86fa-be55-78b6d5251e59", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+54063-53-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "abaa2f31-7e4a-6c96-531b-e30878af1213", "citation": "Obach, R. S., Huynh, P., Allen, M. C. and Beedham, C. (2004), Human Liver Aldehyde Oxidase: Inhibition by 239 Drugs. The Journal of Clinical Pharmacology, 44: 7–19. doi:10.1177/0091270003260336", "url": "http://onlinelibrary.wiley.com/doi/10.1177/0091270003260336/full", "doc_type": "JA", "public_domain": true }, { "uuid": "8154507b-d9b0-6581-1309-21be6009147d", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "b9aacb87-137b-f496-df20-a7faaaba4e78", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "999d0a6c-0d05-4b2e-812e-3ed909ed9124", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "7887a013-f986-4796-afcb-a05ca216cd7f", "citation": "Clin Pharmacol Ther 1985;37(6):610", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a3cfdec9-aeb9-c7dc-433c-8b4e2ed22fe9", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "cfbd1a6f-4a1d-f26d-1159-58e21626c426", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b7f6bdba-231c-43d1-a3ba-18d225541113", "id": "b7f6bdba-231c-43d1-a3ba-18d225541113", "molfile": "\n Marvin 01132109312D \n\n 25 26 0 0 0 0 999 V2000\n 4.5197 -3.6251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5275 -2.7620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6644 -2.3724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6644 -1.5772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8405 -1.1770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8405 -0.3714 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 3.5310 0.1151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1186 -0.0078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4124 -0.4552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4124 -1.2738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1342 -1.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1264 -2.4874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4124 -2.9189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7141 -2.4796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7141 -1.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0235 -1.2738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0314 -0.4158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6984 -1.6975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4517 -1.2738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2050 -1.7054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8954 -1.2816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6016 -1.7289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6016 -2.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8954 -2.9503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2050 -2.5685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 10 15 2 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 16 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 25 20 2 0 0 0 0\n 22 21 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\nM END", "smiles": "CCCNCC(COc1ccccc1C(=O)CCc2ccccc2)O", "formula": "C21H27NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4f2fcad4-68c3-4cbe-a4f2-6a7978db0bb1" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "341.4448", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "d61faaae-a94e-4694-84dc-10f0cacba7ed", "version": "28", "structure": { "id": "0df725b1-e786-4e9e-b6bb-b95ab9df526c", "molfile": "\n Marvin 01132100582D \n\n 25 26 0 0 0 0 999 V2000\n 0.7141 -1.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0235 -1.2738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4124 -1.2738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4124 -0.4552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0314 -0.4158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6984 -1.6975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1186 -0.0078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8405 -0.3714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4517 -1.2738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6644 -1.5772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2050 -1.7054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5310 0.1151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7141 -2.4796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8405 -1.1770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1342 -1.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6644 -2.3724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2050 -2.5685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8954 -1.2816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5275 -2.7620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4124 -2.9189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5197 -3.6251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1264 -2.4874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6016 -1.7289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8954 -2.9503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6016 -2.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 2 0 0 0 0\n 4 3 1 0 0 0 0\n 5 2 2 0 0 0 0\n 6 2 1 0 0 0 0\n 7 4 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 6 1 0 0 0 0\n 10 14 1 0 0 0 0\n 11 9 1 0 0 0 0\n 12 8 1 0 0 0 0\n 13 1 1 0 0 0 0\n 14 8 1 0 0 0 0\n 15 3 1 0 0 0 0\n 16 10 1 0 0 0 0\n 17 11 1 0 0 0 0\n 18 11 2 0 0 0 0\n 19 16 1 0 0 0 0\n 20 13 2 0 0 0 0\n 21 19 1 0 0 0 0\n 22 20 1 0 0 0 0\n 23 18 1 0 0 0 0\n 24 17 2 0 0 0 0\n 25 24 1 0 0 0 0\n 15 22 2 0 0 0 0\n 23 25 2 0 0 0 0\nM END", "smiles": "CCCNCC(COc1ccccc1C(=O)CCc2ccccc2)O", "formula": "C21H27NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "341.4448", "optical_activity": "( + / - )", "references": [ "f571850e-1007-48ba-a836-d22c14bf3d88", "046c3c93-69fa-4ae8-a04d-fe7458bcc3e5", "f4fba0bb-ad04-4ff4-83e1-8a6dc9b4f11c" ], "stereo_centers": 1 }, "unii": "68IQX3T69U", "relationships": [ { "uuid": "6ce6418f-f5d2-4f67-b8b8-6f5ce0c91f01", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "9484eaf7-89ca-4731-9c56-b51269345ed1", "refuuid": "d61faaae-a94e-4694-84dc-10f0cacba7ed", "name": "PROPAFENONE", "unii": "68IQX3T69U", "linking_id": "68IQX3T69U", "ref_pname": "PROPAFENONE", "substance_class": "reference" } }, { "uuid": "ef85dce8-5bf0-4dd9-bb48-0fa515e3e642", "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "cac5ef48-e3b3-4e20-96e3-a9b3bece125f", "refuuid": "fb38fe5e-92ff-4890-b99e-a94cda3c17d9", "name": "PROPAFENONE HYDROCHLORIDE", "unii": "33XCH0HOCD", "linking_id": "33XCH0HOCD", "ref_pname": "PROPAFENONE HYDROCHLORIDE", "substance_class": "reference" } }, { "uuid": "750abe20-51e6-4540-a2a6-1609bc097f58", "type": "METABOLITE ACTIVE->PARENT", "mediator_substance": { "uuid": "596babeb-ce53-4db9-be2f-f332e6bceba3", "refuuid": "2964cc53-40a9-4b2b-b19c-d61342fadb5a", "name": "CYTOCHROME P450 1A2", "unii": "VK4SQL11C0", "linking_id": "VK4SQL11C0", "ref_pname": "CYTOCHROME P450 1A2", "substance_class": "reference" }, "references": [ "a2752b76-8270-476b-99d5-12e8f5d49e3d" ], "related_substance": { "uuid": "b34c547a-b4d7-40ad-a3b9-3e0d198d0567", "refuuid": "eb07afe2-5505-4e35-8408-e8806957c39b", "name": "N-DEPROPYLPROPAFENONE", "unii": "KN087PHW5T", "linking_id": "KN087PHW5T", "ref_pname": "N-DEPROPYLPROPAFENONE", "substance_class": "reference" } }, { "uuid": "43618fc3-9e5b-42d1-9ee4-909434071aaa", "type": "METABOLITE ACTIVE->PARENT", "mediator_substance": { "uuid": "88924a13-1656-4105-8eaf-310f474cabc7", "refuuid": "4275827d-e329-4907-95b5-7d690692872a", "name": "CYTOCHROME P450 3A4", "unii": "PUO0521HZV", "linking_id": "PUO0521HZV", "ref_pname": "CYTOCHROME P450 3A4", "substance_class": "reference" }, "references": [ "7887a013-f986-4796-afcb-a05ca216cd7f" ], "related_substance": { "uuid": "5b5d9997-bf4f-402a-80c5-039c5ffc70da", "refuuid": "eb07afe2-5505-4e35-8408-e8806957c39b", "name": "N-DEPROPYLPROPAFENONE", "unii": "KN087PHW5T", "linking_id": "KN087PHW5T", "ref_pname": "N-DEPROPYLPROPAFENONE", "substance_class": "reference" } }, { "uuid": "fb748fe2-eed2-4f8b-9f76-a9a438fba1c6", "type": "METABOLITE ACTIVE->PARENT", "mediator_substance": { "uuid": "49556d7f-922a-4a54-953f-fe867b4ce3cb", "refuuid": "cc92795c-ba54-4e71-a72b-1af36b57df6b", "name": "CYTOCHROME P450 2D6", "unii": "8E4LAA4357", "linking_id": "8E4LAA4357", "ref_pname": "CYTOCHROME P450 2D6", "substance_class": "reference" }, "references": [ "a2752b76-8270-476b-99d5-12e8f5d49e3d" ], "related_substance": { "uuid": "f7502ee6-a604-4648-af60-d72c0e7a2ee3", "refuuid": "beeb52fe-bcf6-41f3-baca-e82e9527c8a0", "name": "5-HYDROXYPROPAFENONE", "unii": "7AC8BF38NP", "linking_id": "7AC8BF38NP", "ref_pname": "5-HYDROXYPROPAFENONE", "substance_class": "reference" } }, { "uuid": "df30c6aa-1619-4ebc-824a-5b132acfd027", "type": "BINDER->LIGAND", "references": [ "7ab18714-75b6-6ac8-b5e2-c5a7b0254483" ], "related_substance": { "uuid": "d1675076-0178-4ec9-ab5d-f20021449756", "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30", "name": "PLASMA PROTEIN FRACTION (HUMAN)", "unii": "6D53G0FD0Z", "linking_id": "6D53G0FD0Z", "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)", "substance_class": "reference" } }, { "uuid": "ebe62afb-7946-4f94-95b0-59dd0938de17", "amount": { "uuid": "289566ec-9df4-42f3-8e3b-105af6d4d958", "average": 2.5, "high": 3.5, "low": 1.5, "units": "MICROMOLAR" }, "qualification": "IC50", "type": "METABOLIC ENZYME->INHIBITOR", "references": [ "abaa2f31-7e4a-6c96-531b-e30878af1213" ], "related_substance": { "uuid": "92aeba15-b7ac-43e2-8ac0-749c65fc661a", "refuuid": "393aa2e6-c500-402e-8f58-a069ed6e2771", "name": "ALDEHYDE OXIDASE", "unii": "LR0F81F33L", "linking_id": "LR0F81F33L", "ref_pname": "ALDEHYDE OXIDASE", "substance_class": "reference" } } ], "names": [ { "uuid": "16f04ba4-9a9a-422e-883b-9b7ea298624f", "name": "PROPAFENON HEXAL", "stdName": "PROPAFENON HEXAL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "186511e9-b400-43ec-bbe7-b5f4d1f72636", "eb35d8ee-8355-42dc-9191-dece033b9f2c" ], "display_name": false }, { "uuid": "0bf39690-c12a-46dd-803b-d91ee2939837", "name": "PROPAFENONE", "stdName": "PROPAFENONE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "2826b181-48bc-4e86-ae83-cc1412138f79", "e2391e84-ada0-4e86-b8e5-c269a0c7d0b1", "39f39549-3a9b-4013-81ab-48b5b2e4636c", "fe631170-9094-4036-94f8-28a8f529b259", "b5838971-a988-47f7-950a-06f92458fb04", "8c73eea9-bf24-4fa2-bb8f-52c93b0009cb", "046c3c93-69fa-4ae8-a04d-fe7458bcc3e5", "752bad12-6e27-46ac-be7e-041828ceacc9", "f4fba0bb-ad04-4ff4-83e1-8a6dc9b4f11c", "03b6a7ad-aca1-4a9e-9120-07ccbeb2bad6", "67b9f7c6-990b-4980-b04f-1370e3a826d2", "3056eb33-96c4-456e-b982-0c3f3f686271" ], "display_name": true, "domains": [ "drug", "cosmetic" ], "name_orgs": [ { "uuid": "5fc15b2d-9641-47f2-a247-93b7cf9aabbc", "name_org": "INN" }, { "uuid": "8b825a63-9aea-4f0e-9433-2fa2d87ce543", "name_org": "INCI" } ] }, { "uuid": "0878525d-5f09-4740-846f-41816afaae9a", "name": "PROPAFENONE [MI]", "stdName": "PROPAFENONE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e2391e84-ada0-4e86-b8e5-c269a0c7d0b1", "8c73eea9-bf24-4fa2-bb8f-52c93b0009cb" ], "display_name": false }, { "uuid": "995c1f36-5258-40f4-abe6-fae5e5887d56", "name": "PROPAFENONE [VANDF]", "stdName": "PROPAFENONE [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8c73eea9-bf24-4fa2-bb8f-52c93b0009cb", "67b9f7c6-990b-4980-b04f-1370e3a826d2" ], "display_name": false }, { "uuid": "c1ced996-a886-2614-f0e7-530e34753980", "name": "Propafenone [WHO-DD]", "stdName": "PROPAFENONE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a3cfdec9-aeb9-c7dc-433c-8b4e2ed22fe9" ], "display_name": false }, { "uuid": "e482d598-5b82-46b0-9f2f-3c6ebfb8c99e", "name": "propafenone [INN]", "stdName": "PROPAFENONE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f4fba0bb-ad04-4ff4-83e1-8a6dc9b4f11c" ], "display_name": false } ], "properties": [ { "uuid": "df529ddb-5aa0-4f65-a957-10d813587994", "name": "Volume of Distribution", "value": { "uuid": "ccc44c7e-a5ce-47a2-bf10-0ebf2650d09d" }, "defining": false, "parameters": [ { "uuid": "377949ed-4fb0-4fb3-bfb4-0028dcd83cd0", "name": "Population", "type": "PHARMACOKINETIC", "value": { "uuid": "fc9fd01a-5adf-4175-8990-8efd60f1a530", "average": 252, "units": "LITERS", "references": [], "non_numeric_value": "For Adults." }, "references": [] } ], "property_type": "PHARMACOKINETIC", "references": [ "f8a4b154-dbba-1e81-268e-91cdfc958b80" ] }, { "uuid": "4f87a2b3-e76c-499e-84cb-661541d4ac3b", "name": "Biological Half-life", "defining": false, "parameters": [ { "uuid": "dd52e280-a423-4ab3-8767-39abfdb7f880", "name": "Elimination", "type": "PHARMACOKINETIC", "value": { "uuid": "f1657120-656a-4d67-bdd1-7face6375f63", "high": 10, "low": 2, "units": "hours", "references": [], "non_numeric_value": "For Extensive metabolizers." }, "references": [] }, { "uuid": "27153479-8e46-4960-92bc-8b49df27f666", "name": "Elimination", "type": "PHARMACOKINETIC", "value": { "uuid": "a5d73366-124a-469c-87cd-bde425940207", "high": 32, "low": 10, "units": "hours", "references": [], "non_numeric_value": "For Poor metabolizers." }, "references": [] } ], "property_type": "PHARMACOKINETIC", "references": [ "f8a4b154-dbba-1e81-268e-91cdfc958b80" ] } ] } ] }