{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9fd13cb1-f325-4f2c-9f04-3bcdc8e8df51",
          "code": "2052-49-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2052-49-5",
          "code_system": "CAS",
          "references": [
            "97b56b90-3d26-4101-bc63-8e9ad557b40c",
            "5354ce10-622b-4330-b8a6-042fa75ea823"
          ]
        },
        {
          "uuid": "f8ecc005-4b9d-46ff-b470-3a8f6c054783",
          "code": "TETRABUTYLAMMONIUM HYDROXIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Tetrabutylammonium_hydroxide",
          "code_system": "WIKIPEDIA",
          "references": [
            "97b56b90-3d26-4101-bc63-8e9ad557b40c"
          ]
        },
        {
          "uuid": "3a98e900-0558-4600-a7f6-d80eb1c42181",
          "code": "2723671",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2723671",
          "code_system": "PUBCHEM",
          "references": [
            "97b56b90-3d26-4101-bc63-8e9ad557b40c"
          ]
        },
        {
          "uuid": "cdb97ab7-2e12-402d-8632-b935a20829a1",
          "code": "218-147-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.016.498",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "97b56b90-3d26-4101-bc63-8e9ad557b40c"
          ]
        },
        {
          "uuid": "2c38e06e-964a-96bb-ad66-44042a3eeeb6",
          "code": "DTXSID8062155",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8062155",
          "code_system": "EPA CompTox",
          "references": [
            "26d3c1d6-2cef-7560-c537-0bd3f1b3b897"
          ]
        },
        {
          "uuid": "15c840ef-2536-4e72-b52a-f6e570950932",
          "code": "68I858J9S1",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "5354ce10-622b-4330-b8a6-042fa75ea823"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "91c6993c-00e2-4f17-b83f-67ddd9606b77",
          "amount": {
            "uuid": "6a0ea06e-eebb-4f8a-bcb8-903d65fce616"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "679327e8-7936-4cce-ba28-d676c85c9ff4",
            "refuuid": "1005e88f-ecd8-4004-b52c-4182da2dbdf1",
            "name": "Tetrabutylammonium",
            "unii": "CBU2X6BBJR",
            "linking_id": "CBU2X6BBJR",
            "ref_pname": "Tetrabutylammonium",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "88124d6c-cfc0-443e-987a-61abdfe5d83b",
          "amount": {
            "uuid": "f0c379d7-7ee6-4d21-9b53-dd9637f5d5a4"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "a2382846-7631-4c1a-990f-9dcc1bdf929f",
            "refuuid": "1005e88f-ecd8-4004-b52c-4182da2dbdf1",
            "name": "Tetrabutylammonium",
            "unii": "CBU2X6BBJR",
            "linking_id": "CBU2X6BBJR",
            "ref_pname": "Tetrabutylammonium",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a32eea38-29eb-4f73-85a9-e799297d6476",
          "name": "1-Butanaminium, N,N,N-tributyl-, hydroxide",
          "stdName": "1-BUTANAMINIUM, N,N,N-TRIBUTYL-, HYDROXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5354ce10-622b-4330-b8a6-042fa75ea823"
          ],
          "display_name": false
        },
        {
          "uuid": "b94544be-d0d1-4c95-bf33-c577fff3b632",
          "name": "1-Butanaminium, N,N,N-tributyl-, hydroxide (1:1)",
          "stdName": "1-BUTANAMINIUM, N,N,N-TRIBUTYL-, HYDROXIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5354ce10-622b-4330-b8a6-042fa75ea823"
          ],
          "display_name": false
        },
        {
          "uuid": "969e6a4f-7b67-43e9-9951-4f94b67e1ffe",
          "name": "Tetrabutylammonium hydroxide",
          "stdName": "TETRABUTYLAMMONIUM HYDROXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4d5aeabf-70a5-4121-989d-466ff5b5f2db"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "4d5aeabf-70a5-4121-989d-466ff5b5f2db",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "97b56b90-3d26-4101-bc63-8e9ad557b40c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391100000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01709b13-3a0a-450e-bfd6-2ffd1c3bfa41",
          "citation": "SRS import [68I858J9S1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=68I858J9S1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391100000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "77e2094a-7bfe-49fd-8738-0805635a5c2c",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26d3c1d6-2cef-7560-c537-0bd3f1b3b897",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2052-49-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5354ce10-622b-4330-b8a6-042fa75ea823",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8401160c-8ae4-4b78-882b-001c2f677835",
          "id": "8401160c-8ae4-4b78-882b-001c2f677835",
          "molfile": "\n  Marvin  10062317122D          \n\n 17 16  0  0  0  0            999 V2000\n   10.3987   -2.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1956   -2.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7790   -2.7967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5758   -2.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1592   -3.1665    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   13.7426   -2.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5395   -2.7967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1228   -2.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9197   -2.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5758   -3.7499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7894   -4.5468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2060   -5.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4195   -5.9270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7426   -3.7499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5290   -4.5468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1124   -5.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8989   -5.9270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  1  0  0  0  0\n  5 14  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\nM  CHG  1   5   1\nM  END",
          "smiles": "CCCC[N+](CCCC)(CCCC)CCCC",
          "formula": "C16H36N",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "df5e33c4-818d-4baa-b89f-498fb262050a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "242.4643",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "38416bf4-53bf-4f93-a97b-76b9329cd441",
          "id": "38416bf4-53bf-4f93-a97b-76b9329cd441",
          "molfile": "\n  Marvin  10062317122D          \n\n  1  0  0  0  0  0            999 V2000\n    8.7487   -3.6420    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "[OH-]",
          "formula": "HO",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4d8dc942-4450-4e86-b002-ebf75f882948"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "17.0073",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3d07deaa-d142-4ad4-ba30-e3f2df7a2c19",
      "version": "5",
      "structure": {
        "id": "b8547f36-58ff-44af-b396-c41e30acf21e",
        "molfile": "\n   JSDraw210062317122D\n\n 18 16  0  0  0  0              0 V2000\n   16.5424   -6.8864    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   19.6623   -4.5887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1691   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.2722   -5.2881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7788   -4.8842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.8819   -5.9873    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   25.9851   -4.8842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.4919   -5.2881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5948   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.1016   -4.5887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7788   -7.0905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1827   -8.5973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0796   -9.7002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4833  -11.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9851   -7.0905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.5812   -8.5973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6843   -9.7002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.2806  -11.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  6 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  6 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  CHG  2   1  -1   6   1\nM  END",
        "smiles": "CCCC[N+](CCCC)(CCCC)CCCC.[OH-]",
        "formula": "C16H36N.HO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "259.4717",
        "optical_activity": "NONE",
        "references": [
          "77e2094a-7bfe-49fd-8738-0805635a5c2c",
          "01709b13-3a0a-450e-bfd6-2ffd1c3bfa41"
        ],
        "stereo_centers": 0
      },
      "unii": "68I858J9S1"
    }
  ]
}