{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b76aadec-7943-4db9-a669-1a91dc69dd12",
          "code": "94-23-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=94-23-5",
          "code_system": "CAS",
          "references": [
            "27fa1a27-4155-458b-b34e-916a51711a62",
            "43d4dd90-f197-4587-a73a-ee113a0780e2"
          ]
        },
        {
          "uuid": "51317b77-7ece-483f-91ed-47eacdb0388e",
          "code": "C81402",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81402",
          "code_system": "NCI_THESAURUS",
          "references": [
            "27fa1a27-4155-458b-b34e-916a51711a62"
          ]
        },
        {
          "uuid": "c205780f-d3a9-471d-8f58-47adde26158b",
          "code": "SUB09624MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "27fa1a27-4155-458b-b34e-916a51711a62"
          ]
        },
        {
          "uuid": "7bfda5b0-125b-40c0-afa3-03604543ae08",
          "code": "18",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=18",
          "code_system": "INN",
          "references": [
            "27fa1a27-4155-458b-b34e-916a51711a62"
          ]
        },
        {
          "uuid": "854f6e96-2846-4ce9-a0af-28e24fb526d9",
          "code": "236249",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/236249/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "27fa1a27-4155-458b-b34e-916a51711a62"
          ]
        },
        {
          "uuid": "405aeea8-8a79-481d-93a1-042e6d0150b2",
          "code": "m866",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m866?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "27fa1a27-4155-458b-b34e-916a51711a62"
          ]
        },
        {
          "uuid": "c83825bb-7681-42e1-9cc1-03da54860112",
          "code": "CHEMBL421669",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL421669",
          "code_system": "ChEMBL",
          "references": [
            "27fa1a27-4155-458b-b34e-916a51711a62"
          ]
        },
        {
          "uuid": "180e90fc-92b5-4239-b373-2b180f2cc1f1",
          "code": "7183",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7183",
          "code_system": "PUBCHEM",
          "references": [
            "27fa1a27-4155-458b-b34e-916a51711a62"
          ]
        },
        {
          "uuid": "cedc5762-f305-5af3-d686-65741d8c7cf8",
          "code": "DTXSID0046060",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0046060",
          "code_system": "EPA CompTox",
          "references": [
            "79aa23e5-6414-347c-07ef-2fbf055c3e9b"
          ]
        },
        {
          "uuid": "68dc3796-c17d-7317-b113-6cf8dd56a25b",
          "code": "C245",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anesthetic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C245",
          "code_system": "NCI_THESAURUS",
          "references": [
            "592205e5-4347-edbd-40ea-920f8e69e68b"
          ]
        },
        {
          "uuid": "862171e4-a646-40e4-9ab3-f788f3885b32",
          "code": "68E52E5J67",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3c693508-a230-b8b0-3bf1-17bd7ddf6894",
          "code": "3805",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3805",
          "code_system": "DRUG CENTRAL",
          "references": [
            "592205e5-4347-edbd-40ea-920f8e69e68b"
          ]
        },
        {
          "uuid": "aeb3b891-44ff-8396-69f4-bc33b4a6ef20",
          "code": "100000082796",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "12c84b63-128c-07c9-5d04-2b134126fc2a"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "3abbe7b1-524b-41f1-a811-1ac1c6d01c71",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "3aa4aa4d-4d4b-40b3-9dae-4605743fd781",
            "refuuid": "dc00f90f-c4dc-4aaf-9845-e7bcfa6d3ba3",
            "name": "PARETHOXYCAINE",
            "unii": "68E52E5J67",
            "linking_id": "68E52E5J67",
            "ref_pname": "PARETHOXYCAINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c50424ad-18ea-443c-9f01-120952c9b97a",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "a6bd6215-e003-49b6-a347-3ee862493923",
            "refuuid": "f6577a2c-8d7e-4e5d-bb94-37eb74733da2",
            "name": "PARETHOXYCAINE HYDROCHLORIDE",
            "unii": "414P5USJ7F",
            "linking_id": "414P5USJ7F",
            "ref_pname": "PARETHOXYCAINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "170af730-023a-4c9f-bc53-200fe8d329f2",
          "name": "PARETHOXYCAINE",
          "stdName": "PARETHOXYCAINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3a9b4ab-226f-46d3-9dd2-e6aa1812aea4",
            "be874ff0-c79f-4bc2-b173-029d0b1ef8be",
            "1706dde6-0c94-4147-be87-610803ce302a",
            "0c3ef785-a85e-4e00-b113-0fc4cc5b7375",
            "569b75c1-ce02-49c3-9881-81001913f717",
            "72acd6de-d1a7-45b3-ab63-e03dd7dda9ae",
            "e02c3f30-50c3-4e33-bd8f-39fa983387f8",
            "0785b706-49c4-4718-9f86-bc8773eac443"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "1b989140-5af6-4dab-954b-230d2cdc70fd",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "7da96438-69a7-4ec2-af29-b2ed30140390",
          "name": "PARETHOXYCAINE [MI]",
          "stdName": "PARETHOXYCAINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1706dde6-0c94-4147-be87-610803ce302a",
            "569b75c1-ce02-49c3-9881-81001913f717"
          ],
          "display_name": false
        },
        {
          "uuid": "2a1fb9da-69dc-26f9-b039-6665179af90a",
          "name": "Parethoxycaine [WHO-DD]",
          "stdName": "PARETHOXYCAINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "47f8806c-900f-694a-fff2-e0b42a46e1cb"
          ],
          "display_name": false
        },
        {
          "uuid": "a15212ea-ebe5-4197-b54a-9ae86bd2bd38",
          "name": "parethoxycaine [INN]",
          "stdName": "PARETHOXYCAINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c3ef785-a85e-4e00-b113-0fc4cc5b7375"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "72acd6de-d1a7-45b3-ab63-e03dd7dda9ae",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0c3ef785-a85e-4e00-b113-0fc4cc5b7375",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "be874ff0-c79f-4bc2-b173-029d0b1ef8be",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1706dde6-0c94-4147-be87-610803ce302a",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "569b75c1-ce02-49c3-9881-81001913f717",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27fa1a27-4155-458b-b34e-916a51711a62",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390738000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1ff1e00-71ec-4f25-9f43-f7cb6f1ddd1c",
          "citation": "SRS import [68E52E5J67]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=68E52E5J67",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390738000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e02c3f30-50c3-4e33-bd8f-39fa983387f8",
          "citation": "PARETHOXYCAINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0785b706-49c4-4718-9f86-bc8773eac443",
          "citation": "PARETHOXYCAINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c3a9b4ab-226f-46d3-9dd2-e6aa1812aea4",
          "citation": "PARETHOXYCAINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "79aa23e5-6414-347c-07ef-2fbf055c3e9b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=94-23-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "12c84b63-128c-07c9-5d04-2b134126fc2a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "592205e5-4347-edbd-40ea-920f8e69e68b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "43d4dd90-f197-4587-a73a-ee113a0780e2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "47f8806c-900f-694a-fff2-e0b42a46e1cb",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f95a6435-d6eb-4aac-bf11-2c88bd6967b1",
          "id": "f95a6435-d6eb-4aac-bf11-2c88bd6967b1",
          "molfile": "\n  Marvin  01132112552D          \n\n 19 19  0  0  0  0            999 V2000\n    0.0000   -1.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8172   -1.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2323   -2.1585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0625   -2.1585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4698   -2.8719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2948   -2.8719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7073   -2.1507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2870   -1.4503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4620   -1.4503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5245   -2.1507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0149   -2.7630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9344   -1.4425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7620   -1.4425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1590   -0.7160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9892   -0.7160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3965    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2267    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4043   -1.4425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3512   -1.4425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  9  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  7 10  1  0  0  0  0\n  9  8  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 18 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 19 18  1  0  0  0  0\nM  END",
          "smiles": "CCN(CC)CCOC(=O)c1ccc(cc1)OCC",
          "formula": "C15H23NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3df88d10-dd90-4213-86d1-b1ec4dc99e6d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "265.3486",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "dc00f90f-c4dc-4aaf-9845-e7bcfa6d3ba3",
      "version": "9",
      "structure": {
        "id": "af2db76e-9603-4877-848d-9d4186f277a1",
        "molfile": "\n  Marvin  01132109052D          \n\n 19 19  0  0  0  0            999 V2000\n    4.5245   -2.1507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7073   -2.1507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0149   -2.7630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2948   -2.8719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2870   -1.4503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9344   -1.4425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9892   -0.7160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0625   -2.1585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4698   -2.8719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4620   -1.4503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7620   -1.4425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2323   -2.1585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1590   -0.7160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3965    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4043   -1.4425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8172   -1.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2267    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3512   -1.4425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  2  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7 13  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  5  2  0  0  0  0\n 11  6  1  0  0  0  0\n 12  8  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14  7  1  0  0  0  0\n 15  7  1  0  0  0  0\n 16 12  1  0  0  0  0\n 17 14  1  0  0  0  0\n 18 15  1  0  0  0  0\n 19 16  1  0  0  0  0\n  9  8  2  0  0  0  0\nM  END",
        "smiles": "CCN(CC)CCOC(=O)c1ccc(cc1)OCC",
        "formula": "C15H23NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "265.3486",
        "optical_activity": "NONE",
        "references": [
          "d1ff1e00-71ec-4f25-9f43-f7cb6f1ddd1c",
          "72acd6de-d1a7-45b3-ab63-e03dd7dda9ae",
          "0c3ef785-a85e-4e00-b113-0fc4cc5b7375"
        ],
        "stereo_centers": 0
      },
      "unii": "68E52E5J67"
    }
  ]
}