{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b4ed169d-8338-4e37-a005-485fbf8d5b10",
          "code": "14281-83-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14281-83-5",
          "code_system": "CAS",
          "references": [
            "46fca877-3543-47b4-bd1e-316dbd76d437",
            "fc42e9f0-6dc8-422c-aa25-cdeb65054adc"
          ]
        },
        {
          "uuid": "f6fed1ee-72e6-4e83-93be-f7fad990c5cf",
          "code": "C016838",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67016838",
          "code_system": "MESH",
          "references": [
            "46fca877-3543-47b4-bd1e-316dbd76d437"
          ]
        },
        {
          "uuid": "86c96ed2-0432-40da-9333-71b6b1998a80",
          "code": "806626",
          "type": "ALTERNATIVE",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/806626/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "46fca877-3543-47b4-bd1e-316dbd76d437"
          ]
        },
        {
          "uuid": "a29fce7f-1b53-4fac-8dec-f5f786ccebed",
          "code": "1306063",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1306063/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "46fca877-3543-47b4-bd1e-316dbd76d437"
          ]
        },
        {
          "uuid": "effa15f8-5c6a-4a84-b1a5-63d4b8161dfd",
          "code": "SUB22939",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "46fca877-3543-47b4-bd1e-316dbd76d437"
          ]
        },
        {
          "uuid": "747ac0ba-316e-4844-9f5f-1c4c77e73c39",
          "code": "151910",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/151910",
          "code_system": "PUBCHEM",
          "references": [
            "46fca877-3543-47b4-bd1e-316dbd76d437"
          ]
        },
        {
          "uuid": "b00356d3-2b0c-433c-850f-8b453342fa78",
          "code": "238-173-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.034.687",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "46fca877-3543-47b4-bd1e-316dbd76d437"
          ]
        },
        {
          "uuid": "7c91b291-10f0-8ffe-419c-16399605534c",
          "code": "DTXSID60162193",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60162193",
          "code_system": "EPA CompTox",
          "references": [
            "4e7f434d-d040-96fd-f55e-b65ade608ed8"
          ]
        },
        {
          "uuid": "3579ea1e-38db-72a3-ca1f-8077227aba29",
          "code": "DB14493",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB14493",
          "code_system": "DRUG BANK",
          "references": [
            "7745893b-1d50-877f-00fd-50f699aae4be"
          ]
        },
        {
          "uuid": "2c54f216-e0b7-40e8-8d24-da9b5a43618f",
          "code": "681VJX72FE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6c9861f8-b49b-86c5-7cdb-a233ab64ebfb",
          "code": "137 (Number of products:9660)",
          "comments": "Dietary Supplement Label Database|Mineral|Zinc",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=137&item=Zinc",
          "code_system": "DSLD",
          "references": [
            "7745893b-1d50-877f-00fd-50f699aae4be"
          ]
        },
        {
          "uuid": "61124038-4775-d87c-ffb5-f0de1bf7bbb6",
          "code": "681VJX72FE",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=681VJX72FE",
          "code_system": "DAILYMED",
          "references": [
            "f1c5e281-60bf-56da-8d8c-0e5d08fe3fc6"
          ]
        },
        {
          "uuid": "84753670-692e-296c-a518-a0b33873f356",
          "code": "300000011643",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "509e0097-9670-594e-ffd5-b25415c0c7f3"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b4bd8529-001e-4db0-808c-e2f20a272d8f",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "2d4f8f35-3d77-4541-b5e1-aec7adecd6d2",
            "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c",
            "name": "ZINC CATION",
            "unii": "13S1S8SF37",
            "linking_id": "13S1S8SF37",
            "ref_pname": "ZINC CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "10ef7c37-f0dd-43cd-b209-d5d4bc38869a",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "84758c16-ee85-4775-9de0-96e13703e452",
            "refuuid": "bb33ce2a-adb7-4088-ad4a-1e259b21b5f0",
            "name": "Glycine",
            "unii": "TE7660XO1C",
            "linking_id": "TE7660XO1C",
            "ref_pname": "Glycine",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "dc2041d3-318b-4fc5-8e91-a4c470a5c1a5",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "fdaae89e-17d9-4c9f-b104-3fb6b4558471",
            "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c",
            "name": "ZINC CATION",
            "unii": "13S1S8SF37",
            "linking_id": "13S1S8SF37",
            "ref_pname": "ZINC CATION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e348a226-62ac-45f7-9871-885e2bade345",
          "name": "(T-4)-BIS(GLYCINATO-N,O)ZINC",
          "stdName": "(T-4)-BIS(GLYCINATO-N,O)ZINC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "23293acf-1d77-49a2-9f61-7cfcfb0faf4a",
            "a09fa193-0123-4179-a693-4ab7518eb623"
          ],
          "display_name": false
        },
        {
          "uuid": "e4bd4f95-71ba-44af-97ef-75ff8b575634",
          "name": "BIS(GLYCINATO)ZINC",
          "stdName": "BIS(GLYCINATO)ZINC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22a163de-9faf-4744-951a-c71591e5e8f0",
            "a09fa193-0123-4179-a693-4ab7518eb623"
          ],
          "display_name": false
        },
        {
          "uuid": "125ae9a1-affb-4d3b-a72c-fccaa2de1196",
          "name": "BIS(GLYCINATO-N,O)ZINC",
          "stdName": "BIS(GLYCINATO-N,O)ZINC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "23293acf-1d77-49a2-9f61-7cfcfb0faf4a",
            "a09fa193-0123-4179-a693-4ab7518eb623"
          ],
          "display_name": false
        },
        {
          "uuid": "24c37ae5-6158-4893-a0e7-818f92b120b8",
          "name": "GLYCINE ZINC CHELATE",
          "stdName": "GLYCINE ZINC CHELATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e21a6c4-e5c3-4058-a3f8-ae25553a3ce2",
            "a09fa193-0123-4179-a693-4ab7518eb623"
          ],
          "display_name": false
        },
        {
          "uuid": "89b0781c-5b25-4d45-9e6c-35ea02deac41",
          "name": "GLYCINE ZINC SALT",
          "stdName": "GLYCINE ZINC SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22a163de-9faf-4744-951a-c71591e5e8f0",
            "a09fa193-0123-4179-a693-4ab7518eb623"
          ],
          "display_name": false
        },
        {
          "uuid": "974391d1-2f8b-4a90-8c83-6a29ebdac10d",
          "name": "GLYCINE, ZINC SALT (2:1)",
          "stdName": "GLYCINE, ZINC SALT (2:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a09fa193-0123-4179-a693-4ab7518eb623",
            "8635a4ea-fc56-44a7-9e97-5d93c3161e65"
          ],
          "display_name": false
        },
        {
          "uuid": "f017f017-2fa4-4867-b544-7c71440c91c0",
          "name": "ZINC AMINO ACID CHELATE [VANDF]",
          "stdName": "ZINC AMINO ACID CHELATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bcbfe0ac-7e4a-416c-96dc-34076fe57cce",
            "a09fa193-0123-4179-a693-4ab7518eb623"
          ],
          "display_name": false
        },
        {
          "uuid": "1e9ca5ea-04f2-492e-b47a-c221eaabf384",
          "name": "ZINC BIS(AMINOACETATE)",
          "stdName": "ZINC BIS(AMINOACETATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a09fa193-0123-4179-a693-4ab7518eb623",
            "8635a4ea-fc56-44a7-9e97-5d93c3161e65"
          ],
          "display_name": false
        },
        {
          "uuid": "f64bb05e-12ae-4b33-b3ff-9875b55eb6cd",
          "name": "ZINC BISGLYCINATE",
          "stdName": "ZINC BISGLYCINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22a163de-9faf-4744-951a-c71591e5e8f0",
            "a09fa193-0123-4179-a693-4ab7518eb623"
          ],
          "display_name": false
        },
        {
          "uuid": "d0a06305-78a0-4034-b0a8-d0b20c361777",
          "name": "ZINC CHELAZOME",
          "stdName": "ZINC CHELAZOME",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22a163de-9faf-4744-951a-c71591e5e8f0",
            "a09fa193-0123-4179-a693-4ab7518eb623"
          ],
          "display_name": false
        },
        {
          "uuid": "f662e3b0-e11b-4ef6-9b26-4cfa8bda59bb",
          "name": "ZINC GLYCINATE",
          "stdName": "ZINC GLYCINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "521d4a7f-bd1b-47a3-904a-baeb259fee13",
            "2d110a1c-947a-4221-801e-c8fec89e3bd3",
            "d23e864f-286d-4a7b-be4f-19b2429aefe1",
            "a09fa193-0123-4179-a693-4ab7518eb623",
            "3ef489f4-e72a-4893-83b0-1057e508beea",
            "bc6401e9-6d09-4187-b939-8998d44c86ef"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6ec5ada0-c51f-4808-b7ee-cc2bae093d3a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "a5c31ce1-e003-4c42-8db0-99fca328cee8",
          "name": "ZINC(II) GLYCINATE",
          "stdName": "ZINC(II) GLYCINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22a163de-9faf-4744-951a-c71591e5e8f0",
            "a09fa193-0123-4179-a693-4ab7518eb623"
          ],
          "display_name": false
        },
        {
          "uuid": "a446a711-51f0-85eb-265e-49a5ada6dd25",
          "name": "Zinc amino acid chelate [WHO-DD]",
          "stdName": "ZINC AMINO ACID CHELATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3da268ff-72fe-79f2-3c7d-f6557a3e6397"
          ],
          "display_name": false
        },
        {
          "uuid": "cf0455ed-8207-ea59-24e3-99a5c49553b7",
          "name": "Zinc bis glycinate chelate [WHO-DD]",
          "stdName": "ZINC BIS GLYCINATE CHELATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3da268ff-72fe-79f2-3c7d-f6557a3e6397"
          ],
          "display_name": false
        },
        {
          "uuid": "1351d39e-8198-db00-ab17-13af316b6697",
          "name": "Zinc glycinate [WHO-DD]",
          "stdName": "ZINC GLYCINATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3da268ff-72fe-79f2-3c7d-f6557a3e6397"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "70b55d95-1710-45c5-9426-ed5b8954034b",
          "citation": "SRS import [681VJX72FE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=681VJX72FE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389916000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ef489f4-e72a-4893-83b0-1057e508beea",
          "citation": "ZINC GLYCINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e8cf7107-cfaa-425b-90e3-b5ca1cbc7516",
          "citation": "ZINC AMINO ACID CHELATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d23e864f-286d-4a7b-be4f-19b2429aefe1",
          "citation": "ZINC GLYCINATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6595d869-7f98-4def-9e43-2ed9f0c0e033",
          "citation": "ZINC AMINO ACID CHELATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "521d4a7f-bd1b-47a3-904a-baeb259fee13",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bc6401e9-6d09-4187-b939-8998d44c86ef",
          "citation": "DL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "23293acf-1d77-49a2-9f61-7cfcfb0faf4a",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a09fa193-0123-4179-a693-4ab7518eb623",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8635a4ea-fc56-44a7-9e97-5d93c3161e65",
          "citation": "ChemSpider",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22a163de-9faf-4744-951a-c71591e5e8f0",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e21a6c4-e5c3-4058-a3f8-ae25553a3ce2",
          "citation": "rxnorm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b86ae0a-dbaa-4200-85fc-fc33b66ef388",
          "citation": "who-dd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d110a1c-947a-4221-801e-c8fec89e3bd3",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bcbfe0ac-7e4a-416c-96dc-34076fe57cce",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "46fca877-3543-47b4-bd1e-316dbd76d437",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389916000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e7f434d-d040-96fd-f55e-b65ade608ed8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=14281-83-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "509e0097-9670-594e-ffd5-b25415c0c7f3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "7745893b-1d50-877f-00fd-50f699aae4be",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "fc42e9f0-6dc8-422c-aa25-cdeb65054adc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3da268ff-72fe-79f2-3c7d-f6557a3e6397",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f1c5e281-60bf-56da-8d8c-0e5d08fe3fc6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8bce8f19-20a5-4f0a-a8a2-190b97c8ff5c",
          "id": "8bce8f19-20a5-4f0a-a8a2-190b97c8ff5c",
          "molfile": "\n  Marvin  01132107162D          \n\n  1  0  0  0  0  0            999 V2000\n    5.1851   -1.6531    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "522f4923-b8c3-4ec7-a2ef-92f06a1339bc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "a32b191c-a327-4da9-9e5a-93b1c371a44e",
          "id": "a32b191c-a327-4da9-9e5a-93b1c371a44e",
          "molfile": "\n  Marvin  01132108292D          \n\n  5  4  0  0  0  0            999 V2000\n    1.7197   -1.8702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4327   -2.2835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1470   -1.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8539   -2.2832    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.1486   -1.0524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\nM  CHG  1   4  -1\nM  END",
          "smiles": "C(C(=O)[O-])N",
          "formula": "C2H4NO2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "1c72b6cf-1c8a-48be-8d2e-c020ec6be428"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "74.0587",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c55486ae-3b81-4a82-a1c0-82101f2a4e3d",
      "version": "14",
      "structure": {
        "id": "bad9bea8-88fa-41ec-ac26-cf7edc21c214",
        "molfile": "\n  Marvin  01132109402D          \n\n 11  8  0  0  0  0            999 V2000\n    3.1470   -1.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8539   -2.2832    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.1486   -1.0524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4327   -2.2835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7197   -1.8702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1851   -1.6531    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n    3.1470   -1.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8539   -2.2832    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.1486   -1.0524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4327   -2.2835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7197   -1.8702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4  1  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\n 10  7  1  0  0  0  0\n 10 11  1  0  0  0  0\nM  CHG  3   2  -1   6   2   8  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 10   1   2   3   4   5   7   8   9  10  11\nM  SPA   1  5   1   2   3   4   5\nM  SDI   1  4    1.2997   -2.7035    1.2997   -0.6324\nM  SDI   1  4    4.2739   -0.6324    4.2739   -2.7035\nM  SMT   1 2\nM  END",
        "smiles": "C(C(=O)[O-])N.C(C(=O)[O-])N.[Zn+2]",
        "formula": "2C2H4NO2.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "213.5131",
        "optical_activity": "NONE",
        "references": [
          "22a163de-9faf-4744-951a-c71591e5e8f0",
          "70b55d95-1710-45c5-9426-ed5b8954034b"
        ],
        "stereo_centers": 0
      },
      "unii": "681VJX72FE"
    }
  ]
}