{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d2d282d4-f4aa-4f57-b481-02b2cefb9b09",
          "code": "50-69-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=50-69-1",
          "code_system": "CAS",
          "references": [
            "022faa8f-4a24-4db7-879f-e524790db209",
            "abdd1538-e801-4967-ad1a-dd7c7e4a6ce7"
          ]
        },
        {
          "uuid": "f16512e6-455e-4f1a-b386-06991368459e",
          "code": "C68487",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68487",
          "code_system": "NCI_THESAURUS",
          "references": [
            "022faa8f-4a24-4db7-879f-e524790db209"
          ]
        },
        {
          "uuid": "7d120bed-10e5-41a5-a40c-725ea88da25a",
          "code": "10257-32-6",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=10257-32-6",
          "code_system": "CAS",
          "references": [
            "022faa8f-4a24-4db7-879f-e524790db209",
            "598e1eea-6965-4ca2-979a-39c47c908398"
          ]
        },
        {
          "uuid": "ad870fe7-9dc3-478b-a3db-8990800cafd6",
          "code": "613-83-2",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=613-83-2",
          "code_system": "CAS",
          "references": [
            "022faa8f-4a24-4db7-879f-e524790db209",
            "3295f471-ddc4-4e3a-959b-cf0ceffc4bcc"
          ]
        },
        {
          "uuid": "0bc514ae-cba0-4647-a265-f6bb17eb180a",
          "code": "RIBOSE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ribose",
          "code_system": "WIKIPEDIA",
          "references": [
            "022faa8f-4a24-4db7-879f-e524790db209"
          ]
        },
        {
          "uuid": "0dd30253-4fab-41e2-a2ad-7ba935e04362",
          "code": "200-059-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.055",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "022faa8f-4a24-4db7-879f-e524790db209"
          ]
        },
        {
          "uuid": "cfab91cb-f386-47e1-9cd7-51025097de64",
          "code": "1314858",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1314858/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "022faa8f-4a24-4db7-879f-e524790db209"
          ]
        },
        {
          "uuid": "f099a987-bec6-4914-94dd-d1293d478cbb",
          "code": "m9598",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9598?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "022faa8f-4a24-4db7-879f-e524790db209"
          ]
        },
        {
          "uuid": "6cc3e984-9b7e-4183-8871-156db4d95345",
          "code": "SUB32509",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "022faa8f-4a24-4db7-879f-e524790db209"
          ]
        },
        {
          "uuid": "083d9fcc-a764-47ea-8ed5-ae6fc3f9edc5",
          "code": "SUB128226",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "022faa8f-4a24-4db7-879f-e524790db209"
          ]
        },
        {
          "uuid": "c57f1db4-6a74-411f-b6f8-c85b556772f4",
          "code": "5311110",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5311110",
          "code_system": "PUBCHEM",
          "references": [
            "022faa8f-4a24-4db7-879f-e524790db209"
          ]
        },
        {
          "uuid": "060485c1-b185-939e-ba49-ed389a5afcbd",
          "code": "DTXSID6043917",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6043917",
          "code_system": "EPA CompTox",
          "references": [
            "f13e38b4-f420-6a76-6e78-bd1b06fe85a2"
          ]
        },
        {
          "uuid": "7c537dc2-374d-960a-eb64-d361aeaa5d90",
          "code": "C68484",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Dietary Carbohydrate[C68470]|Monosaccharide[C68471]|Pentose",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68484",
          "code_system": "NCI_THESAURUS",
          "references": [
            "9b9b5e19-6ccf-ec95-f039-0cb73c513141"
          ]
        },
        {
          "uuid": "2e27bc02-b589-111b-b312-ca1357d68c15",
          "code": "2926-4",
          "comments": "LOINC|ACTIVE|CHEM|Ser|Ribose [Mass/volume] in Serum",
          "type": "PRIMARY",
          "url": "https://loinc.org/2926-4/",
          "code_system": "LOINC",
          "references": [
            "9b9b5e19-6ccf-ec95-f039-0cb73c513141"
          ]
        },
        {
          "uuid": "c81b65c4-c846-e400-d8e6-6f5b4118ddb4",
          "code": "32268-5",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Ribose [Presence] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/32268-5/",
          "code_system": "LOINC",
          "references": [
            "9b9b5e19-6ccf-ec95-f039-0cb73c513141"
          ]
        },
        {
          "uuid": "be5ecbc8-9939-0624-8d68-9609f4b9c9e6",
          "code": "1603108",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1603108",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "9b9b5e19-6ccf-ec95-f039-0cb73c513141"
          ]
        },
        {
          "uuid": "677aad2f-a940-fbb2-69d4-4026d46b0a20",
          "code": "1711 (Number of products:221)",
          "comments": "Dietary Supplement Label Database|Chemical|Ribose",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1711&item=Ribose",
          "code_system": "DSLD",
          "references": [
            "9b9b5e19-6ccf-ec95-f039-0cb73c513141"
          ]
        },
        {
          "uuid": "b237e512-5287-4cd6-dcf8-d79134d49647",
          "code": "712 (Number of products:2)",
          "comments": "Dietary Supplement Label Database|Other|D-Ribose",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=712&item=D-Ribose",
          "code_system": "DSLD",
          "references": [
            "9b9b5e19-6ccf-ec95-f039-0cb73c513141"
          ]
        },
        {
          "uuid": "dc28f30f-884a-6eac-bd67-149a77505159",
          "code": "DB15073",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB15073",
          "code_system": "DRUG BANK",
          "references": [
            "9b9b5e19-6ccf-ec95-f039-0cb73c513141"
          ]
        },
        {
          "uuid": "d548a54e-c334-4d9d-974b-a4c1fdfc4c96",
          "code": "681HV46001",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f89f2f2a-9efc-c5a7-66ac-632dc0ab6bed",
          "code": "45506",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:45506",
          "code_system": "CHEBI",
          "references": [
            "9b9b5e19-6ccf-ec95-f039-0cb73c513141"
          ]
        },
        {
          "uuid": "ced62758-b77b-3619-e9cd-9232286981e1",
          "code": "33942",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:33942",
          "code_system": "CHEBI",
          "references": [
            "9b9b5e19-6ccf-ec95-f039-0cb73c513141"
          ]
        },
        {
          "uuid": "eb33c99a-579e-e8e6-2918-95ecfd9928bd",
          "code": "16988",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16988",
          "code_system": "CHEBI",
          "references": [
            "9b9b5e19-6ccf-ec95-f039-0cb73c513141"
          ]
        },
        {
          "uuid": "978db339-b4e2-25be-e4ab-55caebc3d87e",
          "code": "47014",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:47014",
          "code_system": "CHEBI",
          "references": [
            "9b9b5e19-6ccf-ec95-f039-0cb73c513141"
          ]
        },
        {
          "uuid": "819fe82f-3138-9b6e-6fb6-d4cdf0441571",
          "code": "47013",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:47013",
          "code_system": "CHEBI",
          "references": [
            "9b9b5e19-6ccf-ec95-f039-0cb73c513141"
          ]
        },
        {
          "uuid": "5380c731-d625-38f7-1bc3-79068bac2bf7",
          "code": "27476",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:27476",
          "code_system": "CHEBI",
          "references": [
            "9b9b5e19-6ccf-ec95-f039-0cb73c513141"
          ]
        },
        {
          "uuid": "416815e4-d8dd-6188-0fcb-00e5b59ff0ad",
          "code": "681HV46001",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=681HV46001",
          "code_system": "DAILYMED",
          "references": [
            "ce24e6af-fe43-aafd-7a70-ccd98af240d6"
          ]
        },
        {
          "uuid": "e9ef730d-52cc-4499-e277-e6805d26d546",
          "code": "100000124325",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ca510f49-7fe8-e76b-bf24-ef173b3cb31a"
          ]
        },
        {
          "uuid": "73cb6b0f-e2b9-d63e-04fe-58c10c2a2c33",
          "code": "243",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=243",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9b9b5e19-6ccf-ec95-f039-0cb73c513141"
          ]
        },
        {
          "uuid": "7139c8c1-15e2-faa6-7ca2-07e2c001b1a4",
          "code": "100",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=100",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9b9b5e19-6ccf-ec95-f039-0cb73c513141"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ec02c0ef-22b4-4091-a139-83425441180c",
          "amount": {
            "uuid": "e8de6be5-c300-4a27-ab83-e72af6b6762f"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "857c6844-a2ea-4375-bae2-d0dfa98ba1ea",
            "refuuid": "e34a24e6-bfa4-4086-9fb8-387fc5afeab4",
            "name": "Ribose, D-",
            "unii": "681HV46001",
            "linking_id": "681HV46001",
            "ref_pname": "Ribose, D-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "856a7c3a-ab56-467a-a171-3c9de41b0186",
          "amount": {
            "uuid": "bc66b368-167b-46ba-92a3-90eef87351d3"
          },
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "fdb3028f-6caa-4bc2-b25e-defe952f958c",
            "refuuid": "45789309-6346-4eb9-967b-81f52df40d0e",
            "name": "ALTERNATIVE DEFINITION for [Ribose, D-]",
            "linking_id": "45789309-6346-4eb9-967b-81f52df40d0e",
            "ref_pname": "NO NAME"
          }
        },
        {
          "uuid": "c8cab405-4f72-4972-b089-acdc9f0efbc7",
          "amount": {
            "uuid": "180caffd-d5fe-46a0-8949-cc7bff53d52c"
          },
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "77bbe9a0-7997-4cbe-bd66-66f8c8767333",
            "refuuid": "d354ed56-a37e-485f-94de-6950f580be88",
            "name": "ALTERNATIVE DEFINITION for [Ribose, D-]",
            "linking_id": "d354ed56-a37e-485f-94de-6950f580be88",
            "ref_pname": "NO NAME"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6f17735d-e7dd-4ec2-bb30-3a2a9251947b",
          "name": "(2R,3R,4R)-2,3,4,5-TETRAHYDROXYPENTANAL",
          "stdName": "(2R,3R,4R)-2,3,4,5-TETRAHYDROXYPENTANAL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03d716e3-62f2-465e-85ea-d5f6cdd04ed5",
            "02e4c9c5-f32a-48b9-be93-905e367e95fb"
          ],
          "display_name": false
        },
        {
          "uuid": "04d4ca9d-5eda-4955-a482-e1fe82f854bb",
          "name": "(3R,4R,5R)-TETRAHYDRO-2H-PYRAN-2,3,4,5-TETRAOL",
          "stdName": "(3R,4R,5R)-TETRAHYDRO-2H-PYRAN-2,3,4,5-TETRAOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03d716e3-62f2-465e-85ea-d5f6cdd04ed5",
            "02e4c9c5-f32a-48b9-be93-905e367e95fb"
          ],
          "display_name": false
        },
        {
          "uuid": "827c57d7-ddaa-41b8-ad43-d42836a2bd2d",
          "name": "(3R,4S,5R)-5-(HYDROXYMETHYL)TETRAHYDROFURAN-2,3,4-TRIOL",
          "stdName": "(3R,4S,5R)-5-(HYDROXYMETHYL)TETRAHYDROFURAN-2,3,4-TRIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03d716e3-62f2-465e-85ea-d5f6cdd04ed5",
            "02e4c9c5-f32a-48b9-be93-905e367e95fb"
          ],
          "display_name": false
        },
        {
          "uuid": "07c22c3f-a1d3-40f6-8396-38c44a5b5a05",
          "name": "D-RIBOSE",
          "stdName": "D-RIBOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03d716e3-62f2-465e-85ea-d5f6cdd04ed5",
            "265a8aad-57dd-4179-aebb-835f051b019c",
            "5d5d1ed8-fc11-4bca-86c7-7c7b23b347e0",
            "c7d7c66a-c3a5-4ce8-8949-ef3289a49163",
            "27360ac4-81db-4ff7-a565-f1e6dec882db",
            "bb88a47e-6069-44fb-8754-f2a933f6456a",
            "8200127c-3b15-4f37-86a3-ef9b3b295e67"
          ],
          "display_name": false
        },
        {
          "uuid": "98c4231e-9cbe-4685-8fc4-a85caa2cdd43",
          "name": "D-RIBOSE [FHFI]",
          "stdName": "D-RIBOSE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03d716e3-62f2-465e-85ea-d5f6cdd04ed5",
            "bb88a47e-6069-44fb-8754-f2a933f6456a"
          ],
          "display_name": false
        },
        {
          "uuid": "af024ed7-190d-4cd0-9682-1c0571294027",
          "name": "D-RIBOSE [MI]",
          "stdName": "D-RIBOSE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03d716e3-62f2-465e-85ea-d5f6cdd04ed5",
            "27360ac4-81db-4ff7-a565-f1e6dec882db"
          ],
          "display_name": false
        },
        {
          "uuid": "366676e9-ec30-c459-edb5-4823898f8e07",
          "name": "D-ribose [WHO-DD]",
          "stdName": "D-RIBOSE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "519e32f2-4e80-3a10-85f2-6c646319d6db"
          ],
          "display_name": false
        },
        {
          "uuid": "840ded4c-5f3c-437d-abad-1afe2013a7c4",
          "name": "FEMA NO. 3793",
          "stdName": "FEMA NO. 3793",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03d716e3-62f2-465e-85ea-d5f6cdd04ed5",
            "bb88a47e-6069-44fb-8754-f2a933f6456a"
          ],
          "display_name": false
        },
        {
          "uuid": "0428afd2-cfc8-4b46-bd06-70a6e4b414e0",
          "name": "RIBO-2,3,4,5-TETRAHYDROXYVALERALDEHYDE, D-",
          "stdName": "RIBO-2,3,4,5-TETRAHYDROXYVALERALDEHYDE, D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03d716e3-62f2-465e-85ea-d5f6cdd04ed5",
            "bb88a47e-6069-44fb-8754-f2a933f6456a"
          ],
          "display_name": false
        },
        {
          "uuid": "289daaf7-9fdd-4faf-b9c5-eaefa14ff934",
          "name": "RIBOSE",
          "stdName": "RIBOSE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "03d716e3-62f2-465e-85ea-d5f6cdd04ed5",
            "33b87b76-7f03-4218-940c-d43208ae58c7",
            "bf25afce-fee0-4591-b05d-ede1804e9201",
            "8924f746-4099-4bd9-8a2a-eb4365998764",
            "975ee447-f09f-41ff-91ce-2d058bd959f3",
            "009238c9-e26c-4083-9c58-9a3fbc1a680e"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c44c5544-892b-4817-a19e-60feaa1b2bfe",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "792aa42f-dd75-4ccc-8b49-71993a3e8d20",
          "name": "RIBOSE [USP-RS]",
          "stdName": "RIBOSE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03d716e3-62f2-465e-85ea-d5f6cdd04ed5",
            "33b87b76-7f03-4218-940c-d43208ae58c7"
          ],
          "display_name": false
        },
        {
          "uuid": "daa2f5fc-ec91-4fd7-9b57-060e56f9f626",
          "name": "RIBOXYL",
          "stdName": "RIBOXYL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03d716e3-62f2-465e-85ea-d5f6cdd04ed5",
            "8924f746-4099-4bd9-8a2a-eb4365998764"
          ],
          "display_name": false
        },
        {
          "uuid": "68dbbb9d-4167-4d2c-a34a-7973c0d0affd",
          "name": "Ribose, D-",
          "stdName": "RIBOSE, D-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03d716e3-62f2-465e-85ea-d5f6cdd04ed5",
            "67094c6c-841d-4fd6-b014-6a1ad1ce140b"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "3295f471-ddc4-4e3a-959b-cf0ceffc4bcc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "598e1eea-6965-4ca2-979a-39c47c908398",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "abdd1538-e801-4967-ad1a-dd7c7e4a6ce7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "27360ac4-81db-4ff7-a565-f1e6dec882db",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "03d716e3-62f2-465e-85ea-d5f6cdd04ed5",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67094c6c-841d-4fd6-b014-6a1ad1ce140b",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb88a47e-6069-44fb-8754-f2a933f6456a",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8924f746-4099-4bd9-8a2a-eb4365998764",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33b87b76-7f03-4218-940c-d43208ae58c7",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8200127c-3b15-4f37-86a3-ef9b3b295e67",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf25afce-fee0-4591-b05d-ede1804e9201",
          "citation": "clinical trials",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02e4c9c5-f32a-48b9-be93-905e367e95fb",
          "citation": "CHEMBIODRAW",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "022faa8f-4a24-4db7-879f-e524790db209",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389721000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e01013a3-6eea-450d-bcf5-d16293b876a1",
          "citation": "SRS import [681HV46001]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=681HV46001",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389721000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c7d7c66a-c3a5-4ce8-8949-ef3289a49163",
          "citation": "D-RIBOSE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "009238c9-e26c-4083-9c58-9a3fbc1a680e",
          "citation": "RIBOSE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "975ee447-f09f-41ff-91ce-2d058bd959f3",
          "citation": "RIBOSE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "265a8aad-57dd-4179-aebb-835f051b019c",
          "citation": "D-RIBOSE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5d5d1ed8-fc11-4bca-86c7-7c7b23b347e0",
          "citation": "D-RIBOSE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f13e38b4-f420-6a76-6e78-bd1b06fe85a2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=50-69-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ca510f49-7fe8-e76b-bf24-ef173b3cb31a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "9b9b5e19-6ccf-ec95-f039-0cb73c513141",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "519e32f2-4e80-3a10-85f2-6c646319d6db",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ce24e6af-fe43-aafd-7a70-ccd98af240d6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "cfa70833-775e-4cc9-bdf4-ac83b8080ac9",
          "id": "cfa70833-775e-4cc9-bdf4-ac83b8080ac9",
          "molfile": "\n  CDK     07082418542D\n\n 10  9  0  0  1  0  0  0  0  0999 V2000\n   26.0500   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.4010   -8.0860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6990   -8.0860    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   23.3479   -7.3060    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   21.9970   -8.0860    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   20.6460   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2950   -8.0860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.9970   -9.6460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3479   -5.7460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6990   -9.6460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  5  8  1  6  0  0  0\n  4  9  1  1  0  0  0\n  3 10  1  6  0  0  0\nM  END",
          "smiles": "C(=O)[C@@H]([C@@H]([C@@H](CO)O)O)O",
          "formula": "C5H10O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "218ef4ba-66e2-4e44-94fd-a2d491060266"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "150.1301",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e34a24e6-bfa4-4086-9fb8-387fc5afeab4",
      "version": "35",
      "structure": {
        "id": "749b0403-8d6c-4471-a320-28055df3c2e8",
        "molfile": "\n   JSDraw207082418542D\n\n 10  9  0  0  1  0              0 V2000\n   26.0500   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.4010   -8.0860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6990   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3479   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.9970   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6460   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2950   -8.0860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.9970   -9.6460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3479   -5.7460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6990   -9.6460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  5  8  1  6  0  0  0\n  4  9  1  1  0  0  0\n  3 10  1  6  0  0  0\nM  END",
        "smiles": "C(=O)[C@@H]([C@@H]([C@@H](CO)O)O)O",
        "formula": "C5H10O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "150.1301",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e01013a3-6eea-450d-bcf5-d16293b876a1",
          "27360ac4-81db-4ff7-a565-f1e6dec882db"
        ],
        "stereo_centers": 3
      },
      "unii": "681HV46001"
    }
  ]
}