{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e6f41dbe-ab8f-4ab0-a568-53c6a2d4582e",
          "code": "52829-07-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=52829-07-9",
          "code_system": "CAS",
          "references": [
            "31791ad0-4178-4a4e-a524-fe0aa5192195",
            "13e581fc-7545-4c65-b13d-6efc501161a8"
          ]
        },
        {
          "uuid": "5be782b0-f8b3-4852-b3d0-d00a56c7eef6",
          "code": "C083752",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67083752",
          "code_system": "MESH",
          "references": [
            "31791ad0-4178-4a4e-a524-fe0aa5192195"
          ]
        },
        {
          "uuid": "384822d8-fef3-4178-9249-992fe4849c58",
          "code": "258-207-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.052.899",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "31791ad0-4178-4a4e-a524-fe0aa5192195"
          ]
        },
        {
          "uuid": "bf87f7a8-03dc-49b5-8e50-f9c3a4229087",
          "code": "164282",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/164282",
          "code_system": "PUBCHEM",
          "references": [
            "31791ad0-4178-4a4e-a524-fe0aa5192195"
          ]
        },
        {
          "uuid": "0f20a419-0974-a5d2-cf38-1579ee47e808",
          "code": "DTXSID0028030",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0028030",
          "code_system": "EPA CompTox",
          "references": [
            "e7959795-5dfa-b628-3104-9e71d7ba07b8"
          ]
        },
        {
          "uuid": "a380a5f0-1535-4272-b250-fde827b8f66b",
          "code": "6803A71201",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "63d70f61-b1b4-45fb-936d-5010f6036edc",
          "name": "ADK STAB LA 77",
          "stdName": "ADK STAB LA 77",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3465405-170b-4e57-8a72-d4144131a3ca",
            "3fc9c67f-c372-4d7d-af7d-5b8547e89dac"
          ],
          "display_name": false
        },
        {
          "uuid": "94a0a511-75f8-41f9-9884-b3400d9547ef",
          "name": "BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDINYL) DECANEDIOATE",
          "stdName": "BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDINYL) DECANEDIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3465405-170b-4e57-8a72-d4144131a3ca",
            "125067e0-a482-4527-9293-499998daf602"
          ],
          "display_name": false
        },
        {
          "uuid": "cf149292-cccd-4091-9277-0e24446e5f89",
          "name": "BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDINYL) SEBACATE",
          "stdName": "BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDINYL) SEBACATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3465405-170b-4e57-8a72-d4144131a3ca",
            "1e01ba9f-2c3f-441f-b46e-8de4033674d5"
          ],
          "display_name": true
        },
        {
          "uuid": "39f340aa-eff5-45a0-bdd0-7753b2da9108",
          "name": "DECANEDIOIC ACID, 1,10-BIS(2,2,6,6-TETRAMETHYL-4- PIPERIDINYL) ESTER",
          "stdName": "DECANEDIOIC ACID, 1,10-BIS(2,2,6,6-TETRAMETHYL-4- PIPERIDINYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3465405-170b-4e57-8a72-d4144131a3ca",
            "a13b3317-12b7-4924-b8cb-2df0a7e8b5e5"
          ],
          "display_name": false
        },
        {
          "uuid": "f0269fbe-de43-4673-a816-0c89f20c621c",
          "name": "DECANEDIOIC ACID, BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDINYL) ESTER",
          "stdName": "DECANEDIOIC ACID, BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDINYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3465405-170b-4e57-8a72-d4144131a3ca",
            "a13b3317-12b7-4924-b8cb-2df0a7e8b5e5"
          ],
          "display_name": false
        },
        {
          "uuid": "c8835138-cf57-4891-aad4-01192275c51d",
          "name": "EVERSORB 90",
          "stdName": "EVERSORB 90",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3465405-170b-4e57-8a72-d4144131a3ca",
            "3fc9c67f-c372-4d7d-af7d-5b8547e89dac"
          ],
          "display_name": false
        },
        {
          "uuid": "e01b419c-fb1b-4f64-b779-31908544d446",
          "name": "HALS 770",
          "stdName": "HALS 770",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3465405-170b-4e57-8a72-d4144131a3ca",
            "a13b3317-12b7-4924-b8cb-2df0a7e8b5e5"
          ],
          "display_name": false
        },
        {
          "uuid": "e755e04c-b0bf-477d-a5af-323db31c4fe9",
          "name": "SANOL 770",
          "stdName": "SANOL 770",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3465405-170b-4e57-8a72-d4144131a3ca",
            "a13b3317-12b7-4924-b8cb-2df0a7e8b5e5"
          ],
          "display_name": false
        },
        {
          "uuid": "1ada5c2b-d3c3-4241-a96e-bad509ed2c39",
          "name": "TINUVIN 770",
          "stdName": "TINUVIN 770",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3465405-170b-4e57-8a72-d4144131a3ca",
            "e1e757e8-93d1-4308-b260-3b84a9cc8b70"
          ],
          "display_name": false
        },
        {
          "uuid": "0e843c41-c3f1-49f9-ae62-f57fe336f6ab",
          "name": "TK-10665",
          "stdName": "TK-10665",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3465405-170b-4e57-8a72-d4144131a3ca",
            "a13b3317-12b7-4924-b8cb-2df0a7e8b5e5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e1e757e8-93d1-4308-b260-3b84a9cc8b70",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f3465405-170b-4e57-8a72-d4144131a3ca",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e01ba9f-2c3f-441f-b46e-8de4033674d5",
          "citation": "cedi",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a13b3317-12b7-4924-b8cb-2df0a7e8b5e5",
          "citation": "chemid",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3fc9c67f-c372-4d7d-af7d-5b8547e89dac",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "125067e0-a482-4527-9293-499998daf602",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31791ad0-4178-4a4e-a524-fe0aa5192195",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391630000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0af8f595-f14c-4e58-b429-351467d31e39",
          "citation": "SRS import [6803A71201]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6803A71201",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391630000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a95aeff-64d2-436f-a32c-008ebb6382ba",
          "citation": "CHEMID RECORD 52829-07-9",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7959795-5dfa-b628-3104-9e71d7ba07b8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=52829-07-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "13e581fc-7545-4c65-b13d-6efc501161a8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f0258b98-130e-46db-991a-107fa69053c5",
          "id": "f0258b98-130e-46db-991a-107fa69053c5",
          "molfile": "\n  Marvin  01132112282D          \n\n 34 35  0  0  0  0            999 V2000\n   -2.3523    1.7397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8220    1.1077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2918    1.7397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1076    0.6952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1076   -0.1297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8220   -0.5422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5365   -0.1297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3490    0.0135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8187   -0.9050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5365    0.6952    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3931   -0.5422    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3931   -1.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1076   -1.7797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3214   -1.7797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0358   -1.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7503   -1.7797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4648   -1.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1792   -1.7797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8937   -1.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6082   -1.7797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3226   -1.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0371   -1.7797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7515   -1.3672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0371   -2.6047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7515   -3.0172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7515   -3.8422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4660   -4.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9357   -4.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9963   -4.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1805   -3.8422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1805   -3.0172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9929   -3.1604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4626   -2.2419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4660   -2.6047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2 10  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n 11  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  2  0  0  0  0\n 24 22  1  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 34  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 27 29  1  0  0  0  0\n 27 30  1  0  0  0  0\n 31 30  1  0  0  0  0\n 31 32  1  0  0  0  0\n 31 33  1  0  0  0  0\n 34 31  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)CC(CC(C)(C)N1)OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)NC(C)(C)C2",
          "formula": "C28H52N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "847aaf7f-2aa3-43e5-b612-2edc278e6042"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "480.7246",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5e68b0c8-a2ac-4e94-8c55-813aef168903",
      "version": "3",
      "structure": {
        "id": "43f27a7c-faeb-413b-a2ed-1c94c0f5a9d0",
        "molfile": "\n  Marvin  01132103352D          \n\n 34 35  0  0  0  0            999 V2000\n    6.7515   -3.0172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0371   -2.6047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0371   -1.7797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7515   -1.3672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3226   -1.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6082   -1.7797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8937   -1.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1792   -1.7797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4648   -1.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7503   -1.7797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0358   -1.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3214   -1.7797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3931   -1.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1076   -1.7797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3931   -0.5422    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1076   -0.1297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8220   -0.5422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5365   -0.1297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5365    0.6952    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8220    1.1077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1076    0.6952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3523    1.7397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2918    1.7397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3490    0.0135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8187   -0.9050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4660   -2.6047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1805   -3.0172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1805   -3.8422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4660   -4.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7515   -3.8422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9357   -4.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9963   -4.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9929   -3.1604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4626   -2.2419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 16 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 20 23  1  0  0  0  0\n 18 24  1  0  0  0  0\n 18 25  1  0  0  0  0\n  1 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 29 28  1  0  0  0  0\n 30 29  1  0  0  0  0\n  1 30  1  0  0  0  0\n 29 31  1  0  0  0  0\n 29 32  1  0  0  0  0\n 27 33  1  0  0  0  0\n 27 34  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)CC(CC(C)(C)N1)OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)NC(C)(C)C2",
        "formula": "C28H52N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "480.7246",
        "optical_activity": "NONE",
        "references": [
          "8a95aeff-64d2-436f-a32c-008ebb6382ba",
          "0af8f595-f14c-4e58-b429-351467d31e39"
        ],
        "stereo_centers": 0
      },
      "unii": "6803A71201"
    }
  ]
}