{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "a32cc2f6-05a9-4deb-acd3-cf83860a9151", "code": "67UNF5G723", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "1e06931c-56a6-41e5-8f40-0861e4919658", "code": "40883-17-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=40883-17-8", "code_system": "CAS", "references": [ "342b5a58-b071-4a00-8692-55f1e2f5af5b", "82bf58eb-b786-4288-9f9c-aec62335e1fb" ] }, { "uuid": "22134944-369b-4d20-9407-b9bd8f7a5fdd", "code": "255-129-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.050.100", "code_system": "ECHA (EC/EINECS)", "references": [ "342b5a58-b071-4a00-8692-55f1e2f5af5b" ] }, { "uuid": "9a9c908b-f4f0-46e5-8273-e5a86f78a056", "code": "6451660", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6451660", "code_system": "PUBCHEM", "references": [ "342b5a58-b071-4a00-8692-55f1e2f5af5b" ] }, { "uuid": "52b09a95-dc29-7aa1-17a9-007bdfe05756", "code": "DTXSID90193859", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90193859", "code_system": "EPA CompTox", "references": [ "f259e78d-9820-6abf-dea0-4d377a6053db" ] }, { "uuid": "134d0443-4ea1-0100-c8b8-386745fe2e1a", "code": "74704", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:74704", "code_system": "CHEBI", "references": [ "59ca46e4-e46d-1e6a-dc08-93f976bba097" ] } ], "substance_class": "chemical", "names": [ { "uuid": "1d940afb-6015-449a-8978-cca47b68d909", "name": "L-METHIONYL-L-ISOLEUCINE", "stdName": "L-METHIONYL-L-ISOLEUCINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e149c139-4fb9-4843-8f2e-7fce774985f4", "0467e12a-6734-45b6-88e7-be963d82f2d7" ], "display_name": true }, { "uuid": "4c19ea97-5604-4282-8237-2503314adaf0", "name": "N-L-Methionyl-L-isoleucine", "stdName": "N-L-METHIONYL-L-ISOLEUCINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "82bf58eb-b786-4288-9f9c-aec62335e1fb" ], "display_name": false } ], "references": [ { "uuid": "e149c139-4fb9-4843-8f2e-7fce774985f4", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0467e12a-6734-45b6-88e7-be963d82f2d7", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "342b5a58-b071-4a00-8692-55f1e2f5af5b", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393751000, "tags": [ "NOMEN" ] }, { "uuid": "f259e78d-9820-6abf-dea0-4d377a6053db", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=40883-17-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "59ca46e4-e46d-1e6a-dc08-93f976bba097", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "82bf58eb-b786-4288-9f9c-aec62335e1fb", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "89d0e440-1e61-468d-a47b-664403eb6db8", "id": "89d0e440-1e61-468d-a47b-664403eb6db8", "molfile": "\n Marvin 08292212232D \n\n 17 16 0 0 1 0 999 V2000\n 5.0013 1.2375 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.2868 0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7157 0.8250 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.0013 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5723 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7157 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7157 2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8578 0.8250 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.5723 2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1446 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8578 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 1.2375 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 6 0 0 0\n 2 5 1 0 0 0 0\n 3 6 1 0 0 0 0\n 3 7 1 6 0 0 0\n 4 8 1 0 0 0 0\n 4 9 2 0 0 0 0\n 5 10 1 0 0 0 0\n 5 11 2 0 0 0 0\n 6 12 1 0 0 0 0\n 10 13 1 0 0 0 0\n 10 14 1 1 0 0 0\n 13 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\nM END", "smiles": "CC[C@H](C)[C@@H](C(=O)O)NC(=O)[C@H](CCSC)N", "formula": "C11H22N2O3S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4a061051-097f-43f1-b565-91e5496ed5b3" }, "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "262.3705", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "f9b2d409-c43a-43f1-b90c-cf8a2de7a24e", "version": "7", "structure": { "id": "9c02f9c6-e75e-4349-98e1-23611feae213", "molfile": "L-Methionyl-L-isoleucine\n JSDraw208292212232D\n\n 17 16 0 0 1 0 0 V2000\n 27.8700 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5190 -8.4760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2209 -8.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8700 -6.1360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1680 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5719 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2209 -10.0360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2209 -5.3560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5190 -5.3560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8170 -8.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1680 -6.1360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9229 -8.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4660 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8170 -10.0360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1151 -8.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7641 -7.6960 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4131 -8.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 6 0 0 0\n 2 5 1 0 0 0 0\n 3 6 1 0 0 0 0\n 3 7 1 6 0 0 0\n 4 8 1 0 0 0 0\n 4 9 2 0 0 0 0\n 5 10 1 0 0 0 0\n 5 11 2 0 0 0 0\n 6 12 1 0 0 0 0\n 10 13 1 0 0 0 0\n 10 14 1 1 0 0 0\n 13 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\nM END", "smiles": "CC[C@H](C)[C@@H](C(=O)O)NC(=O)[C@H](CCSC)N", "formula": "C11H22N2O3S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "262.3705", "optical_activity": "UNSPECIFIED", "references": [ "82bf58eb-b786-4288-9f9c-aec62335e1fb" ], "stereo_centers": 3 }, "unii": "67UNF5G723" } ] }