{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "2f0fd1be-2e14-4e98-aed6-aebfe89a4723", "code": "57693-14-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=57693-14-8", "code_system": "CAS", "references": [ "6efd37bd-b683-463a-b676-ab0ce634a9ae", "e49643d0-5f43-4dac-a9dc-f4bc6c4a0c26" ] }, { "uuid": "81ab3aa9-becc-4786-878c-baa5150dad39", "code": "260-906-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.055.352", "code_system": "ECHA (EC/EINECS)", "references": [ "6efd37bd-b683-463a-b676-ab0ce634a9ae" ] }, { "uuid": "f5708476-8c89-ec13-781a-e2a102ceddd0", "code": "DTXSID9028045", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9028045", "code_system": "EPA CompTox", "references": [ "e559d555-0598-1c78-bc0d-e7e70aa308b7" ] }, { "uuid": "61318ffa-06fa-42f6-9dab-c0f01ed82b31", "code": "67U4FM81UF", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "dc498375-dd3f-43a6-ab05-a1cdd7483dd5", "name": "ACID BLACK 172", "stdName": "ACID BLACK 172", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "795f73c7-abc5-462f-90c4-def0f4a53d5d", "2947e2cb-bc2d-4587-bd34-c5a009558894" ], "display_name": true }, { "uuid": "0c659e6b-c4c8-41ab-a751-74b27a6b76a0", "name": "C.I. 15711:1", "stdName": "C.I. 15711:1", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bac347aa-7e33-4233-9577-94b24253a9da", "2947e2cb-bc2d-4587-bd34-c5a009558894" ], "display_name": false }, { "uuid": "46950a0f-2093-47c9-a9c7-99696f5cfb1e", "name": "C.I. ACID BLACK 172", "stdName": "C.I. ACID BLACK 172", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "795f73c7-abc5-462f-90c4-def0f4a53d5d", "2947e2cb-bc2d-4587-bd34-c5a009558894" ], "display_name": false }, { "uuid": "a76c60e0-1914-41ed-9b0e-8c8399106e84", "name": "CHROMATE(3-), BIS(3-(HYDROXY-.KAPPA.O)-4-(2-(2-(HYDROXY-.KAPPA.O)-1-NAPHTHALENYL)DIAZENYL-.KAPPA.N1)-7-NITRO-1-NAPHTHALENESULFONATO(3-))-, SODIUM (1:3)", "stdName": "CHROMATE(3-), BIS(3-(HYDROXY-.KAPPA.O)-4-(2-(2-(HYDROXY-.KAPPA.O)-1-NAPHTHALENYL)DIAZENYL-.KAPPA.N1)-7-NITRO-1-NAPHTHALENESULFONATO(3-))-, SODIUM (1:3)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bac347aa-7e33-4233-9577-94b24253a9da", "2947e2cb-bc2d-4587-bd34-c5a009558894" ], "display_name": false }, { "uuid": "5b75d31b-500a-456d-8263-4841337be17c", "name": "CI 15711:1", "stdName": "CI 15711:1", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bac347aa-7e33-4233-9577-94b24253a9da", "2947e2cb-bc2d-4587-bd34-c5a009558894" ], "display_name": false }, { "uuid": "7e716729-1a6b-4104-933e-3452c99ff7ad", "name": "TRISODIUM BIS(3-HYDROXY-4-((2-HYDROXY-1-NAPHTHYL)AZO)-7-NITRONAPHTHALENE-1-SULPHONATO(3-))CHROMATE(3-)", "stdName": "TRISODIUM BIS(3-HYDROXY-4-((2-HYDROXY-1-NAPHTHYL)AZO)-7-NITRONAPHTHALENE-1-SULPHONATO(3-))CHROMATE(3-)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "795f73c7-abc5-462f-90c4-def0f4a53d5d", "2947e2cb-bc2d-4587-bd34-c5a009558894" ], "display_name": false } ], "references": [ { "uuid": "795f73c7-abc5-462f-90c4-def0f4a53d5d", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "2947e2cb-bc2d-4587-bd34-c5a009558894", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bac347aa-7e33-4233-9577-94b24253a9da", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6efd37bd-b683-463a-b676-ab0ce634a9ae", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392160000, "tags": [ "NOMEN" ] }, { "uuid": "a22d5cab-a056-432f-8f5c-6c8372495f8d", "citation": "SRS import [67U4FM81UF]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=67U4FM81UF", "doc_type": "SRS", "public_domain": true, "document_date": 1493392160000, "tags": [ "NOMEN" ] }, { "uuid": "e559d555-0598-1c78-bc0d-e7e70aa308b7", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=57693-14-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e49643d0-5f43-4dac-a9dc-f4bc6c4a0c26", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "11c40f51-684b-4f61-9313-964cab43d627", "id": "11c40f51-684b-4f61-9313-964cab43d627", "molfile": "\n Marvin 01132101082D \n\n 1 0 0 0 0 0 999 V2000\n 7.5606 -11.9301 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 3, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 3, "units": "MOL RATIO", "uuid": "d8ab767c-0b85-41c6-bf4f-5ae7897693b2" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "b1dd41f4-bac8-4a83-b93b-a02502610419", "id": "b1dd41f4-bac8-4a83-b93b-a02502610419", "molfile": "\n Marvin 01132109132D \n\n 1 0 0 0 0 0 999 V2000\n 7.4967 -15.2923 0.0000 Cr 0 1 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 3\nM END", "smiles": "[Cr+3]", "formula": "Cr", "atropisomerism": "No", "charge": 3, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "7c538eee-9f13-490d-a402-9a3214fc1802" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "51.9961", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "9bb61d18-bea2-455f-a6fe-570938e35d99", "id": "9bb61d18-bea2-455f-a6fe-570938e35d99", "molfile": "\n Marvin 01132108052D \n\n 31 34 0 0 0 0 999 V2000\n 14.7866 -16.1206 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 14.0735 -15.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3603 -16.1206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6426 -15.7081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6426 -14.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9293 -14.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9293 -13.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6426 -13.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3603 -13.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3603 -14.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0735 -14.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7866 -14.4708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5044 -14.8832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2176 -14.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2176 -13.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5044 -13.2334 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 16.9353 -13.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6485 -13.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6485 -14.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3662 -14.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3662 -15.7081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6485 -16.1206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9353 -15.7081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9353 -14.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0794 -16.1206 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 19.0794 -16.9455 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 19.7971 -15.7081 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3662 -13.2334 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1503 -12.4322 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 18.7141 -13.9802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1408 -12.9481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 11 2 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 10 2 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 24 14 2 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 28 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 24 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 21 25 1 0 0 0 0\n 22 23 2 0 0 0 0\n 24 23 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 27 2 0 0 0 0\n 28 29 1 0 0 0 0\n 28 30 2 0 0 0 0\n 28 31 2 0 0 0 0\nM CHG 5 1 -1 16 -1 25 1 26 -1 29 -1\nM END", "smiles": "c1ccc2c(c1)ccc(c2/N=N/c3c4ccc(cc4c(cc3[O-])S(=O)(=O)[O-])[N+](=O)[O-])[O-]", "formula": "C20H10N3O7S", "atropisomerism": "No", "charge": -3, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "8fb39151-375b-46b7-8900-ab48a895ead7" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "436.3762", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "a7206dc5-ef84-4c1a-90e2-c11dbc47eb53", "version": "3", "structure": { "id": "fba39f96-4ac1-4fd0-84f7-e5958f6e8bbd", "molfile": "\n Marvin 01132113022D \n\n 66 68 0 0 0 0 999 V2000\n 15.5044 -14.8832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7866 -14.4708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0735 -14.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3603 -14.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3603 -13.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6426 -13.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9293 -13.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9293 -14.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6426 -14.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6426 -15.7081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3603 -16.1206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0735 -15.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7866 -16.1206 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 16.2176 -14.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2176 -13.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9353 -13.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6485 -13.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6485 -14.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9353 -14.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9353 -15.7081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6485 -16.1206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3662 -15.7081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0794 -16.1206 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 19.0794 -16.9455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7971 -15.7081 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 18.3662 -14.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3662 -13.2334 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1503 -12.4322 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 18.7141 -13.9802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1408 -12.9481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5044 -13.2334 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 7.5606 -11.9301 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 7.4967 -15.2923 0.0000 Cr 0 1 0 0 0 0 0 0 0 0 0 0\n 7.5606 -11.9301 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 7.5606 -11.9301 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 15.5044 -14.8832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7866 -14.4708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0735 -14.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3603 -14.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3603 -13.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6426 -13.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9293 -13.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9293 -14.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6426 -14.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6426 -15.7081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3603 -16.1206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0735 -15.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7866 -16.1206 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 16.2176 -14.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2176 -13.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9353 -13.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6485 -13.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6485 -14.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9353 -14.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9353 -15.7081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6485 -16.1206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3662 -15.7081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0794 -16.1206 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 19.0794 -16.9455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7971 -15.7081 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 18.3662 -14.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3662 -13.2334 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1503 -12.4322 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 18.7141 -13.9802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1408 -12.9481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5044 -13.2334 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 22 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 23 25 1 0 0 0 0\n 26 22 2 0 0 0 0\n 18 26 1 0 0 0 0\n 17 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 2 0 0 0 0\n 27 30 2 0 0 0 0\n 15 31 1 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 9 8 1 0 0 0 0\n 9 4 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 12 13 1 0 0 0 0\n 3 12 1 0 0 0 0\n 14 1 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 14 1 0 0 0 0\n 19 20 1 0 0 0 0\n 21 20 2 0 0 0 0\n 36 37 2 0 0 0 0\n 49 36 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 2 0 0 0 0\n 38 47 1 0 0 0 0\n 39 40 1 0 0 0 0\n 44 39 1 0 0 0 0\n 40 41 2 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 2 0 0 0 0\n 44 43 1 0 0 0 0\n 45 44 2 0 0 0 0\n 46 45 1 0 0 0 0\n 47 46 2 0 0 0 0\n 47 48 1 0 0 0 0\n 49 50 2 0 0 0 0\n 54 49 1 0 0 0 0\n 50 66 1 0 0 0 0\n 50 51 1 0 0 0 0\n 51 52 2 0 0 0 0\n 52 62 1 0 0 0 0\n 52 53 1 0 0 0 0\n 53 61 1 0 0 0 0\n 53 54 2 0 0 0 0\n 54 55 1 0 0 0 0\n 56 55 2 0 0 0 0\n 57 56 1 0 0 0 0\n 57 58 1 0 0 0 0\n 61 57 2 0 0 0 0\n 58 59 2 0 0 0 0\n 58 60 1 0 0 0 0\n 62 63 1 0 0 0 0\n 62 64 2 0 0 0 0\n 62 65 2 0 0 0 0\nM CHG 8 13 -1 23 1 25 -1 28 -1 31 -1 32 1 33 3 34 1\nM CHG 6 35 1 48 -1 58 1 60 -1 63 -1 66 -1\nM STY 2 1 MUL 2 MUL\nM SCN 1 1 HT \nM SAL 1 3 32 34 35\nM SPA 1 1 32\nM SDI 1 4 7.1406 -12.3501 7.1406 -11.5101\nM SDI 1 4 7.9806 -11.5101 7.9806 -12.3501\nM SMT 1 3\nM SCN 1 2 HT \nM SAL 2 15 1 2 3 4 5 6 7 8 9 10 11 12 13 14 15\nM SAL 2 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30\nM SAL 2 15 31 36 37 38 39 40 41 42 43 44 45 46 47 48 49\nM SAL 2 15 50 51 52 53 54 55 56 57 58 59 60 61 62 63 64\nM SAL 2 2 65 66\nM SPA 2 15 1 2 3 4 5 6 7 8 9 10 11 12 13 14 15\nM SPA 2 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30\nM SPA 2 1 31\nM SDI 2 4 11.5093 -17.3655 11.5093 -12.0122\nM SDI 2 4 20.2171 -12.0122 20.2171 -17.3655\nM SMT 2 2\nM END", "smiles": "c1ccc2c(c1)ccc(c2/N=N/c3c4ccc(cc4c(cc3[O-])S(=O)(=O)[O-])[N+](=O)[O-])[O-].c1ccc2c(c1)ccc(c2/N=N/c3c4ccc(cc4c(cc3[O-])S(=O)(=O)[O-])[N+](=O)[O-])[O-].[Cr+3].[Na+].[Na+].[Na+]", "formula": "2C20H10N3O7S.Cr.3Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "993.7178", "optical_activity": "NONE", "references": [ "a22d5cab-a056-432f-8f5c-6c8372495f8d", "bac347aa-7e33-4233-9577-94b24253a9da" ], "stereo_centers": 0 }, "unii": "67U4FM81UF" } ] }