{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "9219d20e-4af4-4a69-b53e-8925502dc45c", "code": "73384-78-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=73384-78-8", "code_system": "CAS", "references": [ "c7e826a4-a14f-deef-c621-9b7a6a4578f4" ] }, { "uuid": "26b91f6e-ad0d-2f23-8665-bc751ae3b763", "code": "277-419-2", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.070.360", "code_system": "ECHA (EC/EINECS)", "references": [ "d882b715-240b-5664-f256-63715b5a04dc" ] }, { "uuid": "fa8ff59b-dad7-46df-80f1-6a61a051790c", "code": "67SL5C598T", "type": "PRIMARY", "code_system": "FDA UNII" } ], "relationships": [ { "uuid": "2435d651-d9ad-45d9-8a73-2b2da512b903", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "762a06a8-d15d-482b-bda1-d4d823dac511", "refuuid": "8603cb11-befc-4cdc-89f1-ee080057a0b7", "name": "ACID YELLOW 127 FREE ACID", "unii": "KIU8PUB211", "linking_id": "KIU8PUB211", "ref_pname": "ACID YELLOW 127 FREE ACID", "substance_class": "reference" } }, { "uuid": "dee94845-068a-447f-a24f-e2db6c7273b9", "type": "SUBSTANCE->SUB_ALTERNATE", "related_substance": { "uuid": "ab3f76c4-ef4b-463f-ab31-4594e272d376", "refuuid": "fbb251d0-88a6-9482-4c29-d5394ad976ec", "name": "ALTERNATIVE DEFINITION for [ACID YELLOW 127]", "linking_id": "fbb251d0-88a6-9482-4c29-d5394ad976ec", "ref_pname": "NO NAME" } } ], "substance_class": "chemical", "names": [ { "uuid": "83b21494-b886-46aa-a8c1-cbda32af827e", "name": "ACID YELLOW 127", "stdName": "ACID YELLOW 127", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9a7729c0-e318-404f-8463-618116093058" ], "display_name": true }, { "uuid": "2b9230bd-7699-45c5-8f8e-01eb6167ade4", "name": "BENZENESULFONIC ACID, 4-((4-CHLORO-6-(METHYLPHENYLAMINO)-1,3,5-TRIAZIN-2-YL)AMINO)-2-(2-(1-(2-CHLOROPHENYL)-4,5-DIHYDRO-3-METHYL-5-OXO-1H-PYRAZOL-4-YL)DIAZENYL)-, SODIUM SALT (1:1)", "stdName": "BENZENESULFONIC ACID, 4-((4-CHLORO-6-(METHYLPHENYLAMINO)-1,3,5-TRIAZIN-2-YL)AMINO)-2-(2-(1-(2-CHLOROPHENYL)-4,5-DIHYDRO-3-METHYL-5-OXO-1H-PYRAZOL-4-YL)DIAZENYL)-, SODIUM SALT (1:1)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6992957a-d51a-4f5b-afc2-561a096d0297" ], "display_name": false }, { "uuid": "343ade99-43e8-4aa6-b396-7b09cf08015f", "name": "C.I. 18888", "stdName": "C.I. 18888", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "6992957a-d51a-4f5b-afc2-561a096d0297" ], "display_name": false }, { "uuid": "589dc7e3-3b1c-428f-9f1d-03e3b10c4549", "name": "C.I. ACID YELLOW 127", "stdName": "C.I. ACID YELLOW 127", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "63a2b5f5-aeb1-4e14-a812-83615321380b" ], "display_name": false }, { "uuid": "7f121d6e-5db6-4a6a-bca7-f1cfb8f53352", "name": "CI 18888", "stdName": "CI 18888", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "43fd32be-e200-47db-8c05-01ec45bbb50c" ], "display_name": false } ], "references": [ { "uuid": "c7e826a4-a14f-deef-c621-9b7a6a4578f4", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "63a2b5f5-aeb1-4e14-a812-83615321380b", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "9a7729c0-e318-404f-8463-618116093058", "citation": "http://www.worlddyevariety.com/acid-dyes/acid-yellow-127.html", "url": "http://www.worlddyevariety.com/acid-dyes/acid-yellow-127.html", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6992957a-d51a-4f5b-afc2-561a096d0297", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "43fd32be-e200-47db-8c05-01ec45bbb50c", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "af760ed5-c5a9-447a-9026-64f8e3d4547e", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392211000, "tags": [ "NOMEN" ] }, { "uuid": "a3550401-3718-4315-a975-560416855610", "citation": "SRS import [67SL5C598T]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=67SL5C598T", "doc_type": "SRS", "public_domain": true, "document_date": 1493392211000, "tags": [ "NOMEN" ] }, { "uuid": "d882b715-240b-5664-f256-63715b5a04dc", "citation": "EC", "doc_type": "ECHA (EC/EINECS)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "bccba906-1171-4cbc-8587-aa5a7bbbbc91", "id": "bccba906-1171-4cbc-8587-aa5a7bbbbc91", "molfile": "\n Marvin 01132109462D \n\n 1 0 0 0 0 0 999 V2000\n 4.3270 -12.2974 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d49847e2-22fb-43eb-af29-b7f7d17e6385" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "d0b99507-68ea-4154-9bb4-17281d8e3433", "id": "d0b99507-68ea-4154-9bb4-17281d8e3433", "molfile": "\n Marvin 01132110472D \n\n 42 46 0 0 0 0 999 V2000\n 9.8221 -13.0664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5355 -12.6565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2491 -13.0664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9627 -12.6565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6807 -13.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6807 -13.8906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9627 -14.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2491 -13.8906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5355 -11.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2491 -11.4177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2491 -10.5935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9627 -10.1792 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5355 -10.1792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8221 -10.5935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1086 -10.1792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3949 -10.5936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3949 -11.4178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6769 -11.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9634 -11.4178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9634 -10.5936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6769 -10.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2499 -10.1792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5363 -10.5936 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8229 -10.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0655 -10.5177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8951 -11.3225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5175 -9.9050 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9273 -9.1915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5935 -8.4342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0766 -7.7677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7426 -7.0150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9210 -6.9290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4378 -7.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7716 -8.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2886 -9.0149 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7369 -9.3621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3495 -8.8095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2500 -11.8323 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8354 -11.1142 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 6.6643 -12.5458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5363 -12.2421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8221 -11.4178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 9 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 8 2 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 9 10 1 0 0 0 0\n 42 9 2 0 0 0 0\n 11 10 2 0 0 0 0\n 11 12 1 0 0 0 0\n 13 11 1 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 14 42 1 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 21 16 2 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 2 0 0 0 0\n 19 38 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 20 1 0 0 0 0\n 23 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 24 25 2 0 0 0 0\n 36 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 25 1 0 0 0 0\n 28 27 1 0 0 0 0\n 28 29 1 0 0 0 0\n 36 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 34 2 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 33 32 2 0 0 0 0\n 34 33 1 0 0 0 0\n 34 35 1 0 0 0 0\n 37 36 2 0 0 0 0\n 38 39 1 0 0 0 0\n 38 40 2 0 0 0 0\n 38 41 2 0 0 0 0\nM CHG 1 39 -1\nM END", "smiles": "Cc1c(c(=O)n(-c2ccccc2Cl)[nH]1)/N=N/c3cc(ccc3S(=O)(=O)[O-])Nc4nc(Cl)nc(n4)N(C)c5ccccc5", "formula": "C26H20Cl2N9O4S", "atropisomerism": "No", "charge": -1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "9aae1994-c2d5-4216-8610-dcd191003929" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "625.4679", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "7f8f5a33-b88f-44e7-9eb5-77ef39b7cc6f", "version": "8", "structure": { "id": "a3fa4171-ebb0-48d9-adcc-119d99459c0b", "molfile": "\n Marvin 01132108312D \n\n 43 46 0 0 0 0 999 V2000\n 4.3273 -12.2983 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 5.3495 -8.8095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7369 -9.3621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8229 -10.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5363 -10.5936 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2499 -10.1792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9634 -10.5936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6769 -10.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3949 -10.5936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1086 -10.1792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8221 -10.5935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5355 -10.1792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2491 -10.5935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9627 -10.1792 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2491 -11.4177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5355 -11.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5355 -12.6565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2491 -13.0664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9627 -12.6565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6807 -13.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6807 -13.8906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9627 -14.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2491 -13.8906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8221 -13.0664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8221 -11.4178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3949 -11.4178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6769 -11.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9634 -11.4178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2500 -11.8323 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8354 -11.1142 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 6.6643 -12.5458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5363 -12.2421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0655 -10.5177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8951 -11.3225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5175 -9.9050 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9273 -9.1915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5935 -8.4342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0766 -7.7677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7426 -7.0150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9210 -6.9290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4378 -7.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7716 -8.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2886 -9.0149 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 2 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 18 23 2 0 0 0 0\n 17 24 1 0 0 0 0\n 25 16 2 0 0 0 0\n 11 25 1 0 0 0 0\n 9 26 1 0 0 0 0\n 27 26 2 0 0 0 0\n 28 27 1 0 0 0 0\n 7 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 2 0 0 0 0\n 29 32 2 0 0 0 0\n 4 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 35 33 2 0 0 0 0\n 36 35 1 0 0 0 0\n 3 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 2 0 0 0 0\n 39 40 1 0 0 0 0\n 41 40 2 0 0 0 0\n 42 41 1 0 0 0 0\n 37 42 2 0 0 0 0\n 42 43 1 0 0 0 0\nM CHG 2 1 1 30 -1\nM END", "smiles": "Cc1c(c(n(-c2ccccc2Cl)n1)O)/N=N/c3cc(ccc3S(=O)(=O)[O-])Nc4nc(Cl)nc(n4)N(C)c5ccccc5.[Na+]", "formula": "C26H20Cl2N9O4S.Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "648.4576", "optical_activity": "NONE", "references": [ "a3550401-3718-4315-a975-560416855610", "63a2b5f5-aeb1-4e14-a812-83615321380b" ], "stereo_centers": 0 }, "unii": "67SL5C598T" } ] }