{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d0016dd3-c56c-4ad1-a22f-e625bd570c41", "code": "5567-15-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=5567-15-7", "code_system": "CAS", "references": [ "3e4a1940-efa2-492a-b304-793ad1372efe", "66134d2a-b100-4699-85c0-d087fd62e58f" ] }, { "uuid": "8f7cfcfc-6753-4f69-957c-4b6b73495fd5", "code": "226-939-8", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.024.491", "code_system": "ECHA (EC/EINECS)", "references": [ "3e4a1940-efa2-492a-b304-793ad1372efe" ] }, { "uuid": "da3a2b7d-993f-3ca7-1ea5-42dbfe59b7dc", "code": "DTXSID1021453", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1021453", "code_system": "EPA CompTox", "references": [ "55e58424-9605-ac86-22d4-675df72eddac" ] }, { "uuid": "ea19f21f-fa12-46f3-9173-6f21d3894005", "code": "67HO7X7FV3", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "b29a664e-9b4f-29ed-f6eb-bd0858417d3b", "code": "Pigment yellow 83", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Pigment_yellow_83", "code_system": "WIKIPEDIA", "references": [ "791f3788-e07f-a2ae-611d-5ec2f5b467dd" ] } ], "substance_class": "chemical", "names": [ { "uuid": "ca3a6a6c-5c2c-43ef-a988-7dcf746aaba0", "name": "ACETOACETANILIDE, 2,2''-((3,3'-DICHLORO-4,4'-BIPHENYLYLENE)BIS(AZO))BIS(4'-CHLORO-2',5'-DIMETHOXY-", "stdName": "ACETOACETANILIDE, 2,2''-((3,3'-DICHLORO-4,4'-BIPHENYLYLENE)BIS(AZO))BIS(4'-CHLORO-2',5'-DIMETHOXY-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5e77d047-7731-4b5b-9d58-cffa574bd3fb", "29df0863-955f-41f4-8071-d8dc5e9b06c0" ], "display_name": false }, { "uuid": "de38d5cb-e490-4b93-b850-b2ababc4fa77", "name": "BUTANAMIDE, 2,2'-((3,3'-DICHLORO(1,1'-BIPHENYL)-4,4'-DIYL)BIS(2,1-DIAZENEDIYL))BIS(N-(4-CHLORO-2,5-DIMETHOXYPHENYL)-3-OXO-", "stdName": "BUTANAMIDE, 2,2'-((3,3'-DICHLORO(1,1'-BIPHENYL)-4,4'-DIYL)BIS(2,1-DIAZENEDIYL))BIS(N-(4-CHLORO-2,5-DIMETHOXYPHENYL)-3-OXO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5e77d047-7731-4b5b-9d58-cffa574bd3fb", "29df0863-955f-41f4-8071-d8dc5e9b06c0" ], "display_name": false }, { "uuid": "3544d78b-5ee2-4da7-8258-112400586681", "name": "C.I. 21108", "stdName": "C.I. 21108", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5e77d047-7731-4b5b-9d58-cffa574bd3fb", "29df0863-955f-41f4-8071-d8dc5e9b06c0" ], "display_name": false }, { "uuid": "010a88c4-958a-493c-83cf-53044c32e239", "name": "C.I. PIGMENT YELLOW 83", "stdName": "C.I. PIGMENT YELLOW 83", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5e77d047-7731-4b5b-9d58-cffa574bd3fb", "29df0863-955f-41f4-8071-d8dc5e9b06c0" ], "display_name": false }, { "uuid": "f451b504-8107-4aa9-8e1a-152f72b3df8b", "name": "CI 21108", "stdName": "CI 21108", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "80b779bb-24c3-4801-8e81-eaeb2f7d86a8", "5e77d047-7731-4b5b-9d58-cffa574bd3fb", "7335dba2-b07c-473a-9cec-fb5df4a2f665", "45b64d4f-949f-40b0-8099-69888bbe5510" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "259ae87e-375f-4fc9-8833-aab395310a7c", "name_org": "INCI" } ] }, { "uuid": "3f9579c8-9654-47c3-8f96-11d3b56e5163", "name": "PIGMENT YELLOW 83", "stdName": "PIGMENT YELLOW 83", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "80b779bb-24c3-4801-8e81-eaeb2f7d86a8", "5e77d047-7731-4b5b-9d58-cffa574bd3fb" ], "display_name": true } ], "references": [ { "uuid": "45b64d4f-949f-40b0-8099-69888bbe5510", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "5e77d047-7731-4b5b-9d58-cffa574bd3fb", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "80b779bb-24c3-4801-8e81-eaeb2f7d86a8", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "29df0863-955f-41f4-8071-d8dc5e9b06c0", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3e4a1940-efa2-492a-b304-793ad1372efe", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392057000, "tags": [ "NOMEN" ] }, { "uuid": "30a19a5d-ff38-4f05-9d3f-2720e89872e4", "citation": "SRS import [67HO7X7FV3]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=67HO7X7FV3", "doc_type": "SRS", "public_domain": true, "document_date": 1493392057000, "tags": [ "NOMEN" ] }, { "uuid": "7335dba2-b07c-473a-9cec-fb5df4a2f665", "citation": "CI 21108 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "55e58424-9605-ac86-22d4-675df72eddac", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5567-15-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "791f3788-e07f-a2ae-611d-5ec2f5b467dd", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "66134d2a-b100-4699-85c0-d087fd62e58f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "1407b2db-8274-4077-803a-e7fce0b72fd2", "id": "1407b2db-8274-4077-803a-e7fce0b72fd2", "molfile": "\n Marvin 01132101152D \n\n 54 57 0 0 0 0 999 V2000\n -8.9309 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.2164 -1.4438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5019 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7875 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.0730 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3585 -1.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6441 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6441 -0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n -3.2151 -1.0313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -1.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 0.2062 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 1.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 1.0313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9296 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 3.9296 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6441 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 2.6812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6441 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6441 0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3585 1.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0730 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7875 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5019 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2164 1.4438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9309 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5019 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2164 -0.2062 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7875 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0730 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3585 -0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3585 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 -0.2062 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6441 -2.6812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -6.0730 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3585 0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3585 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7875 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5019 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.2164 0.2062 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 53 3 2 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 5 49 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 10 9 1 0 0 0 0\n 9 46 1 0 0 0 0\n 10 11 2 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 17 12 2 0 0 0 0\n 13 14 2 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 19 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 45 2 0 0 0 0\n 21 20 2 0 0 0 0\n 22 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 43 22 2 0 0 0 0\n 24 23 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 29 25 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 2 0 0 0 0\n 29 30 2 0 0 0 0\n 29 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 32 40 2 0 0 0 0\n 34 33 2 0 0 0 0\n 34 35 1 0 0 0 0\n 37 34 1 0 0 0 0\n 35 36 1 0 0 0 0\n 37 38 1 0 0 0 0\n 39 37 2 0 0 0 0\n 40 39 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 43 44 1 0 0 0 0\n 45 43 1 0 0 0 0\n 46 47 1 0 0 0 0\n 46 48 2 0 0 0 0\n 49 50 1 0 0 0 0\n 49 52 2 0 0 0 0\n 50 51 1 0 0 0 0\n 52 53 1 0 0 0 0\n 53 54 1 0 0 0 0\nM END", "smiles": "CC(=O)C(C(=O)Nc1cc(c(cc1OC)Cl)OC)/N=N/c2ccc(cc2Cl)-c3ccc(c(c3)Cl)/N=N/C(C(=O)C)C(=O)Nc4cc(c(cc4OC)Cl)OC", "formula": "C36H32Cl4N6O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "244b2dca-0852-4772-a851-6685fddc662e" }, "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "818.4878", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "2ffc60ce-ab73-444f-a1ae-a19fd36a7ed4", "version": "5", "structure": { "id": "237ff04a-9dcf-40aa-83b3-4bc47fae4e6c", "molfile": "\n Marvin 01132101592D \n\n 54 57 0 0 0 0 999 V2000\n -0.3572 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 -0.2062 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 0.2062 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -1.0313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -1.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 1.0313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 1.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6441 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6441 -0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3585 -1.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6441 -2.6812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -6.0730 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.0730 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7875 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5019 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5019 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7875 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.2164 -1.4438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -8.9309 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3585 0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3585 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.2164 0.2062 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6441 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9296 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9296 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6441 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6441 0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3585 1.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 2.6812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0730 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0730 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7875 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5019 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5019 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7875 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2164 1.4438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9309 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3585 -0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3585 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2164 -0.2062 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 1 6 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 7 12 2 0 0 0 0\n 1 7 1 0 0 0 0\n 9 13 1 0 0 0 0\n 3 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 4 16 1 0 0 0 0\n 17 18 2 0 0 0 0\n 10 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 19 23 2 0 0 0 0\n 19 24 1 0 0 0 0\n 21 25 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 30 31 1 0 0 0 0\n 26 31 2 0 0 0 0\n 32 33 1 0 0 0 0\n 30 32 1 0 0 0 0\n 34 35 1 0 0 0 0\n 27 34 1 0 0 0 0\n 29 36 1 0 0 0 0\n 24 26 1 0 0 0 0\n 15 20 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 37 41 2 0 0 0 0\n 37 42 1 0 0 0 0\n 39 43 2 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 2 0 0 0 0\n 46 47 1 0 0 0 0\n 47 48 2 0 0 0 0\n 48 49 1 0 0 0 0\n 44 49 2 0 0 0 0\n 50 51 1 0 0 0 0\n 48 50 1 0 0 0 0\n 52 53 1 0 0 0 0\n 45 52 1 0 0 0 0\n 47 54 1 0 0 0 0\n 42 44 1 0 0 0 0\n 17 38 1 0 0 0 0\nM END", "smiles": "CC(=O)C(C(=O)Nc1cc(c(cc1OC)Cl)OC)/N=N/c2ccc(cc2Cl)-c3ccc(c(c3)Cl)/N=N/C(C(=O)C)C(=O)Nc4cc(c(cc4OC)Cl)OC", "formula": "C36H32Cl4N6O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "818.4878", "optical_activity": "UNSPECIFIED", "references": [ "29df0863-955f-41f4-8071-d8dc5e9b06c0", "30a19a5d-ff38-4f05-9d3f-2720e89872e4" ], "stereo_centers": 2 }, "unii": "67HO7X7FV3" } ] }