{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2c13d1f3-0a90-4730-bb65-bca5dee76e3a",
          "code": "26266-77-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=26266-77-3",
          "code_system": "CAS",
          "references": [
            "3a1862a1-3385-4543-90f1-db71c074c4ed",
            "b6e723d6-98cd-4a82-aa87-da2cbf76dbb6"
          ]
        },
        {
          "uuid": "74f0f20c-2838-4994-a991-2f8d4043ec17",
          "code": "C024114",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67024114",
          "code_system": "MESH",
          "references": [
            "3a1862a1-3385-4543-90f1-db71c074c4ed"
          ]
        },
        {
          "uuid": "72f8ac1e-2b71-4590-8358-fceda984cff7",
          "code": "SUB169652",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "3a1862a1-3385-4543-90f1-db71c074c4ed"
          ]
        },
        {
          "uuid": "bb179b35-cd09-4d65-85bf-83b561461dfc",
          "code": "247-574-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.043.234",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3a1862a1-3385-4543-90f1-db71c074c4ed"
          ]
        },
        {
          "uuid": "47b71c7b-b14a-4c4a-9e68-a0a9d53ce854",
          "code": "21117614",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21117614",
          "code_system": "PUBCHEM",
          "references": [
            "3a1862a1-3385-4543-90f1-db71c074c4ed"
          ]
        },
        {
          "uuid": "85cd5ae1-383b-b655-a3d9-f5c7e50ed4da",
          "code": "DTXSID6051936",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6051936",
          "code_system": "EPA CompTox",
          "references": [
            "df8c12fa-79eb-ab6b-f5df-1ca89a778320"
          ]
        },
        {
          "uuid": "d27d95fd-1059-41e3-aa8d-0594f74d0708",
          "code": "6770B58N0V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ecf0917e-18c4-6533-aef2-ee8718cca85a",
          "code": "100000159501",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "00b7068e-c43f-389a-1917-a30541da1839"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "76acf39a-d544-42c4-bd09-709c9f246d3f",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "4a50fc65-52b5-4212-a574-f7abb6d25f88",
            "refuuid": "8eebc28f-c022-42d5-9e93-f86ff01849e3",
            "name": "DIHYDROABIETYL ALCOHOL",
            "unii": "6770B58N0V",
            "linking_id": "6770B58N0V",
            "ref_pname": "DIHYDROABIETYL ALCOHOL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e244db02-ab83-4a7a-87a8-d388befad8b1",
          "name": "1-PHENANTHRENEMETHANOL, 1,2,3,4,4A,4B,5,6,7,9,10,10A-DODECAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-, (1R,4AR,4BS,10AR)-",
          "stdName": "1-PHENANTHRENEMETHANOL, 1,2,3,4,4A,4B,5,6,7,9,10,10A-DODECAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-, (1R,4AR,4BS,10AR)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "886848ac-2cff-4c1c-beb5-dc9eb5fabd22",
            "7f036fef-38d2-442c-81bb-497e1b45ca44"
          ],
          "display_name": false
        },
        {
          "uuid": "6c0819c1-2100-4453-bddc-bd9fe63509b5",
          "name": "1-PHENANTHRENEMETHANOL, DODECAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-",
          "stdName": "1-PHENANTHRENEMETHANOL, DODECAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "886848ac-2cff-4c1c-beb5-dc9eb5fabd22",
            "7f036fef-38d2-442c-81bb-497e1b45ca44"
          ],
          "display_name": false
        },
        {
          "uuid": "d67df8f8-1032-41ee-a055-704de7720a0d",
          "name": "ABIETYL ALCOHOL, DIHYDRO-",
          "stdName": "ABIETYL ALCOHOL, DIHYDRO-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "886848ac-2cff-4c1c-beb5-dc9eb5fabd22",
            "7f036fef-38d2-442c-81bb-497e1b45ca44"
          ],
          "display_name": false
        },
        {
          "uuid": "754c95b0-4df7-4808-ab33-e4ff5632771d",
          "name": "ARBITOL E",
          "stdName": "ARBITOL E",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "886848ac-2cff-4c1c-beb5-dc9eb5fabd22",
            "7f036fef-38d2-442c-81bb-497e1b45ca44"
          ],
          "display_name": false
        },
        {
          "uuid": "7b93c445-e74e-42ce-b3d0-e3825dd4508a",
          "name": "DIHYDROABIETYL ALCOHOL",
          "stdName": "DIHYDROABIETYL ALCOHOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "886848ac-2cff-4c1c-beb5-dc9eb5fabd22",
            "1ec857ce-25a7-41ef-b92b-d42531b20950"
          ],
          "display_name": true
        },
        {
          "uuid": "23aa5369-effe-487a-87c7-1e116d5f6242",
          "name": "DODECAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-1-PHENANTHRENEMETHANOL",
          "stdName": "DODECAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-1-PHENANTHRENEMETHANOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "886848ac-2cff-4c1c-beb5-dc9eb5fabd22",
            "1ec857ce-25a7-41ef-b92b-d42531b20950"
          ],
          "display_name": false
        },
        {
          "uuid": "ef53db0f-d4d2-4ce7-b956-4ad94a77727a",
          "name": "HYDROABIETYL ALCOHOL",
          "stdName": "HYDROABIETYL ALCOHOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "96f7b011-e2ea-4ffb-a42e-54aadca87a39",
            "886848ac-2cff-4c1c-beb5-dc9eb5fabd22",
            "0ffa986f-2ad4-4206-85d4-595da1d10efd",
            "1ec857ce-25a7-41ef-b92b-d42531b20950"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "703d4737-0cdf-465d-8f06-bb2b6b71ce4c",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "1ec857ce-25a7-41ef-b92b-d42531b20950",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "886848ac-2cff-4c1c-beb5-dc9eb5fabd22",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f036fef-38d2-442c-81bb-497e1b45ca44",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ffa986f-2ad4-4206-85d4-595da1d10efd",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3a1862a1-3385-4543-90f1-db71c074c4ed",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391383000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf39ab3b-cabe-46a5-9f07-0e85a3baba3a",
          "citation": "SRS import [6770B58N0V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6770B58N0V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391383000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96f7b011-e2ea-4ffb-a42e-54aadca87a39",
          "citation": "HYDROABIETYL ALCOHOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "df8c12fa-79eb-ab6b-f5df-1ca89a778320",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=26266-77-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "00b7068e-c43f-389a-1917-a30541da1839",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "b6e723d6-98cd-4a82-aa87-da2cbf76dbb6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ec5b052e-13db-462e-b420-899535e91baa",
          "id": "ec5b052e-13db-462e-b420-899535e91baa",
          "molfile": "\n  Marvin  01132112132D          \n\n 21 23  0  0  1  0            999 V2000\n    8.6586   -6.3693    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.6586   -5.5548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4086   -5.1477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0999   -5.6018    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   10.0999   -6.3810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3675   -6.7853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3675   -7.5850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6528   -8.0068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9292   -7.5850    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.1851   -7.9921    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.3989   -8.7889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7662   -8.7011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9801   -9.5038    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5025   -7.5644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5025   -6.7325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2525   -6.3312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9292   -6.7617    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.9292   -5.9591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8645   -5.1828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8645   -4.3597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5704   -5.6018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  1  1  0  0  0\n  1 17  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n 19  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  1  0  0  0\n 10  9  1  0  0  0  0\n  9 17  1  0  0  0  0\n 10 11  1  1  0  0  0\n 10 12  1  0  0  0  0\n 14 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  1  0  0  0\n 20 19  1  0  0  0  0\n 21 19  1  0  0  0  0\nM  END",
          "smiles": "CC(C)C1CC[C@H]2C(=C1)CC[C@H]3[C@@](C)(CCC[C@]23C)CO",
          "formula": "C20H34O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f815a36e-12dd-449c-b478-deb27704197c"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "290.4841",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8eebc28f-c022-42d5-9e93-f86ff01849e3",
      "version": "6",
      "structure": {
        "id": "5c58d573-f2dd-476a-b10f-033537bbf1d2",
        "molfile": "\n  Marvin  01132104472D          \n\n 23 25  0  0  1  0            999 V2000\n    7.9440   -6.7743    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.3850   -6.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9440   -7.5991    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.1985   -8.0070    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.6747   -6.3812    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.1187   -6.3929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1187   -5.6122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7788   -8.7173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3850   -7.5991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6689   -8.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6747   -5.5652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4261   -5.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8847   -5.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2660   -6.3430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9931   -9.5215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9440   -5.9702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5146   -7.5785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4127   -8.8053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5146   -6.7450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8847   -4.3678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5920   -5.6122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6747   -7.1970    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9440   -8.4209    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  5  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  2  0  0  0  0\n  7  6  1  0  0  0  0\n  4  8  1  6  0  0  0\n  9  2  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11  5  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13  7  1  0  0  0  0\n 14  1  1  0  0  0  0\n 15  8  1  0  0  0  0\n  1 16  1  1  0  0  0\n 17  4  1  0  0  0  0\n  4 18  1  1  0  0  0\n 19 14  1  0  0  0  0\n 20 13  1  0  0  0  0\n 21 13  1  0  0  0  0\n  5 22  1  6  0  0  0\n  3 23  1  6  0  0  0\n  9 10  1  0  0  0  0\n 19 17  1  0  0  0  0\n 12  7  1  0  0  0  0\nM  END",
        "smiles": "CC(C)C1CC[C@@]2([H])C(=C1)CC[C@@]3([H])[C@@](C)(CCC[C@]23C)CO",
        "formula": "C20H34O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "290.4841",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "cf39ab3b-cabe-46a5-9f07-0e85a3baba3a",
          "7f036fef-38d2-442c-81bb-497e1b45ca44"
        ],
        "stereo_centers": 5
      },
      "unii": "6770B58N0V"
    }
  ]
}