{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9ea4a991-007d-46a4-9b59-fb8ce3007a15",
          "code": "946578-00-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=946578-00-3",
          "code_system": "CAS",
          "references": [
            "1621c1cc-fa8d-4a6f-a181-9300cd5087a6",
            "a9d17f62-c1de-4ce2-8efc-82ab1c8b6676"
          ]
        },
        {
          "uuid": "07dd2c69-93bd-454b-814a-02ff284528c8",
          "code": "16723172",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16723172",
          "code_system": "PUBCHEM",
          "references": [
            "1621c1cc-fa8d-4a6f-a181-9300cd5087a6"
          ]
        },
        {
          "uuid": "d4915c63-0e84-bbd1-7ebb-38102040336f",
          "code": "8245",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8245",
          "code_system": "HSDB",
          "references": [
            "ba499913-7e9c-5cc0-037d-06ca760f39c6"
          ]
        },
        {
          "uuid": "14d1da03-4aa4-0f66-a744-503d0d2e5ab1",
          "code": "DTXSID0074687",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0074687",
          "code_system": "EPA CompTox",
          "references": [
            "031d1530-ac3c-13d5-3575-11ee67802621"
          ]
        },
        {
          "uuid": "369a8183-2360-e052-3bbe-0be9be6f473f",
          "code": "133305",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:133305",
          "code_system": "CHEBI",
          "references": [
            "7b2e46b3-9768-8beb-be0a-b37efd88d375"
          ]
        },
        {
          "uuid": "49e2eff9-bc77-4f0e-9491-5aa46c5bc0ca",
          "code": "671W88OY8K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "928b6eac-cffd-18bf-6eeb-d0a3bd850090",
          "code": "Sulfoxaflor",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sulfoxaflor",
          "code_system": "WIKIPEDIA",
          "references": [
            "a2f5db23-3da3-1009-8eee-5d9a4a5ab6da"
          ]
        },
        {
          "uuid": "4b257919-e5f4-3307-2b86-458982de04a3",
          "code": "sulfoxaflor",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/sulfoxaflor.html",
          "code_system": "ALANWOOD",
          "references": [
            "301105dc-75cf-4334-6abd-993b4bab4761"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "827af88e-4582-49a3-ac83-15e004accea1",
          "name": "CYANAMIDE, N-(METHYLOXIDO(1-(6-(TRIFLUOROMETHYL)-3-PYRIDINYL)ETHYL)-.LAMBDA.4-SULFANYLIDENE)-",
          "stdName": "CYANAMIDE, N-(METHYLOXIDO(1-(6-(TRIFLUOROMETHYL)-3-PYRIDINYL)ETHYL)-.LAMBDA.4-SULFANYLIDENE)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35490a4e-e961-4f8d-b30a-099cba146d37",
            "1a57a69f-07a8-4028-8bb7-6ce9d70eac2c"
          ],
          "display_name": false
        },
        {
          "uuid": "6e3fef19-f044-4953-8915-2ddf23c400d8",
          "name": "GF-2032",
          "stdName": "GF-2032",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35490a4e-e961-4f8d-b30a-099cba146d37",
            "1a57a69f-07a8-4028-8bb7-6ce9d70eac2c"
          ],
          "display_name": false
        },
        {
          "uuid": "47f6745f-e5ae-49ec-bd73-f155ff124cee",
          "name": "GF-2372",
          "stdName": "GF-2372",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35490a4e-e961-4f8d-b30a-099cba146d37",
            "1a57a69f-07a8-4028-8bb7-6ce9d70eac2c"
          ],
          "display_name": false
        },
        {
          "uuid": "a2c0e6b2-0a40-4ee6-85e1-9a13652df50e",
          "name": "METHYL(1-(2-TRIFLUOROMETHYLPYRIDIN-5-YL)ETHYL)-N-CYANOSULFOXIMINE",
          "stdName": "METHYL(1-(2-TRIFLUOROMETHYLPYRIDIN-5-YL)ETHYL)-N-CYANOSULFOXIMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35490a4e-e961-4f8d-b30a-099cba146d37",
            "1a57a69f-07a8-4028-8bb7-6ce9d70eac2c"
          ],
          "display_name": false
        },
        {
          "uuid": "80e5a2d4-4c70-4fb9-ace4-815fefc4bb8f",
          "name": "SULFOXAFLOR",
          "stdName": "SULFOXAFLOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35490a4e-e961-4f8d-b30a-099cba146d37",
            "48ea08da-4770-454b-b676-941d4247ac61",
            "1a57a69f-07a8-4028-8bb7-6ce9d70eac2c",
            "8a89ab4f-80d7-4313-ac31-bd0ac1f8d89a"
          ],
          "display_name": true
        },
        {
          "uuid": "5694c352-0d88-4ac0-b922-d7b8350e2930",
          "name": "SULFOXAFLOR [ISO]",
          "stdName": "SULFOXAFLOR [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a57a69f-07a8-4028-8bb7-6ce9d70eac2c",
            "8a89ab4f-80d7-4313-ac31-bd0ac1f8d89a"
          ],
          "display_name": false
        },
        {
          "uuid": "7a2e2bf8-1b61-4f2f-a231-49a71b0ec709",
          "name": "TRANSFORM",
          "stdName": "TRANSFORM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35490a4e-e961-4f8d-b30a-099cba146d37",
            "1a57a69f-07a8-4028-8bb7-6ce9d70eac2c"
          ],
          "display_name": false
        },
        {
          "uuid": "184429b3-e495-4328-95c2-9a8655eda290",
          "name": "XDE-208",
          "stdName": "XDE-208",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35490a4e-e961-4f8d-b30a-099cba146d37",
            "1a57a69f-07a8-4028-8bb7-6ce9d70eac2c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "35490a4e-e961-4f8d-b30a-099cba146d37",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1a57a69f-07a8-4028-8bb7-6ce9d70eac2c",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a89ab4f-80d7-4313-ac31-bd0ac1f8d89a",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1621c1cc-fa8d-4a6f-a181-9300cd5087a6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392245000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4336bef1-52eb-4c1b-913f-f30dbae8b088",
          "citation": "SRS import [671W88OY8K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=671W88OY8K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392245000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48ea08da-4770-454b-b676-941d4247ac61",
          "citation": "SULFOXAFLOR [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ba499913-7e9c-5cc0-037d-06ca760f39c6",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+946578-00-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "031d1530-ac3c-13d5-3575-11ee67802621",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=946578-00-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a2f5db23-3da3-1009-8eee-5d9a4a5ab6da",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "301105dc-75cf-4334-6abd-993b4bab4761",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "a9d17f62-c1de-4ce2-8efc-82ab1c8b6676",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7b2e46b3-9768-8beb-be0a-b37efd88d375",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ff27f1d2-0de7-45f1-ab2a-89bb751443d9",
          "id": "ff27f1d2-0de7-45f1-ab2a-89bb751443d9",
          "molfile": "\n  Marvin  01132113122D          \n\n 18 18  0  0  0  0            999 V2000\n    6.9893   -6.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7038   -5.7177    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.4183   -6.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4183   -6.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1327   -7.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8472   -6.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8472   -6.1301    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1327   -5.7177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5617   -7.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2761   -6.9551    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2761   -7.7801    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5617   -8.1927    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7038   -4.8927    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7038   -4.0677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8788   -4.8927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5288   -4.8927    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9413   -4.1782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3538   -3.4637    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 13  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  8  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  6  9  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 13 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  3  0  0  0  0\nM  END",
          "smiles": "CC(c1ccc(C(F)(F)F)nc1)S(=NC#N)(=O)C",
          "formula": "C10H10F3N3OS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2033b05a-6e9c-4ef3-8560-badd644c6463"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "277.2676",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "INCOMPLETE",
      "uuid": "2c6861e5-0c4d-4aa9-a9ac-1bcf2ee2c6a3",
      "version": "7",
      "structure": {
        "id": "704c52f7-635f-4e84-b0c9-eef5fc4aa891",
        "molfile": "\n  Marvin  01132105502D          \n\n 18 18  0  0  0  0            999 V2000\n    7.7038   -5.7177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7038   -4.8927    0.0000 S   0  3  0  0  0  0  0  0  0  0  0  0\n    8.5288   -4.8927    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9413   -4.1782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3538   -3.4637    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7038   -4.0677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8788   -4.8927    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.9893   -6.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4183   -6.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4183   -6.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1327   -7.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8472   -6.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5617   -7.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2761   -6.9551    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2761   -7.7801    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5617   -8.1927    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8472   -6.1301    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1327   -5.7177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  3  0  0  0  0\n  2  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  1  8  1  0  0  0  0\n  1  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 17 12  2  0  0  0  0\n 18 17  1  0  0  0  0\n  9 18  2  0  0  0  0\nM  CHG  2   2   1   7  -1\nM  END",
        "smiles": "CC(c1ccc(C(F)(F)F)nc1)[S+](=NC#N)(C)[O-]",
        "formula": "C10H10F3N3OS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "277.2676",
        "optical_activity": "( + / - )",
        "references": [
          "35490a4e-e961-4f8d-b30a-099cba146d37",
          "4336bef1-52eb-4c1b-913f-f30dbae8b088"
        ],
        "stereo_centers": 1
      },
      "unii": "671W88OY8K"
    }
  ]
}