{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c9303c50-389d-40b3-b656-b0a76ffdf1a0",
          "code": "69-79-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=69-79-4",
          "code_system": "CAS",
          "references": [
            "5341cd90-62b1-4943-b25c-621d4f598563",
            "fb5e0b9a-24de-4450-a522-17abf453d9dc"
          ]
        },
        {
          "uuid": "2145d575-b284-458f-ba95-080240479804",
          "code": "C81933",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81933",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5341cd90-62b1-4943-b25c-621d4f598563"
          ]
        },
        {
          "uuid": "cba28059-c028-41dc-a982-394020a293d7",
          "code": "m7048",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7048?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "5341cd90-62b1-4943-b25c-621d4f598563"
          ]
        },
        {
          "uuid": "f1af8f3f-f6d9-43e5-9160-f0ddf836a440",
          "code": "200-716-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.651",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "5341cd90-62b1-4943-b25c-621d4f598563"
          ]
        },
        {
          "uuid": "b79390c5-5b13-48b2-b3f1-6100cb539fbe",
          "code": "181526",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/181526",
          "code_system": "PUBCHEM",
          "references": [
            "5341cd90-62b1-4943-b25c-621d4f598563"
          ]
        },
        {
          "uuid": "1bfbb0e5-019c-843c-9bbc-e61c89a19496",
          "code": "DTXSID1023233",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1023233",
          "code_system": "EPA CompTox",
          "references": [
            "8c120683-83f5-bc44-f5ae-5488a9afb097"
          ]
        },
        {
          "uuid": "17c7eb79-ced5-ac0f-b418-8ed3ff5cc225",
          "code": "C68472",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Dietary Carbohydrate[C68470]|Disaccharide",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68472",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b2612a61-a5f6-3bee-9621-bf3ba365cda5"
          ]
        },
        {
          "uuid": "fddd9524-a85e-4c8c-a1df-5b957e634cb7",
          "code": "66Y63L379N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e8dfe60d-0d28-27dc-61f2-fba291fcb0f8",
          "code": "17306",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17306",
          "code_system": "CHEBI",
          "references": [
            "b2612a61-a5f6-3bee-9621-bf3ba365cda5"
          ]
        },
        {
          "uuid": "871d3b1d-f307-c0c0-c2d0-85302b9131d2",
          "code": "66Y63L379N",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=66Y63L379N",
          "code_system": "DAILYMED",
          "references": [
            "89eae2e9-5003-8d49-b4d3-51b2acd62218"
          ]
        },
        {
          "uuid": "69a0b786-a57c-c36e-bf93-233b1d76f40e",
          "code": "2590661",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2590661/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "05b6d1cb-f3f3-1f66-f995-050efb947fcc"
          ]
        },
        {
          "uuid": "d59c49a7-1a8e-d8a2-7a48-4dc4a656aca9",
          "code": "100000093003",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "1bb1e2b5-7be1-168c-6346-1ab0520586dd"
          ]
        },
        {
          "uuid": "f6d6d05a-d8f2-80ee-f21f-9cd979a02ef2",
          "code": "760396",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=760396",
          "code_system": "NSC",
          "references": [
            "83822c6e-79f6-d729-592a-479b53baa66a"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "1d7dacad-c3a0-4c2d-a3f7-c62d52f34872",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "09a7912a-cfce-4428-af59-9706388dbe5e",
            "refuuid": "21d61400-d579-49e4-965f-cea87f215dcb",
            "name": "MALTOSE ANHYDROUS",
            "unii": "66Y63L379N",
            "linking_id": "66Y63L379N",
            "ref_pname": "MALTOSE ANHYDROUS",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7395e3a6-28f6-4fa1-aeb5-fab6ccd15025",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "bc3a9245-68bd-424f-b7d1-41c26f757569",
            "refuuid": "3f486e74-b826-4458-90df-cacf879f76c8",
            "name": "MALTOSE MONOHYDRATE",
            "unii": "DM477EE40D",
            "linking_id": "DM477EE40D",
            "ref_pname": "MALTOSE MONOHYDRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9704b59a-839d-4dba-b39b-c862a1472789",
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "4ec4d51f-c2ab-4f8a-88c4-b4a2751bc77e",
            "refuuid": "eaae4a0e-8cb0-4956-8725-fa697f300833",
            "name": "ALTERNATIVE DEFINITION for [MALTOSE ANHYDROUS]",
            "linking_id": "eaae4a0e-8cb0-4956-8725-fa697f300833",
            "ref_pname": "NO NAME"
          }
        },
        {
          "uuid": "c5465459-f581-96df-bca5-3be542582e4e",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "fb5e0b9a-24de-4450-a522-17abf453d9dc"
          ],
          "related_substance": {
            "uuid": "b9b202d9-e53e-4791-8ee8-c37e61fcfece",
            "refuuid": "3f486e74-b826-4458-90df-cacf879f76c8",
            "name": "MALTOSE MONOHYDRATE",
            "unii": "DM477EE40D",
            "linking_id": "DM477EE40D",
            "ref_pname": "MALTOSE MONOHYDRATE"
          }
        },
        {
          "uuid": "e0315196-839a-4c22-a006-a12940de84f4",
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "f2c62791-3880-4000-a390-ae91ae17e642",
            "refuuid": "f2a049d2-8aae-4516-ac80-8e5fc808f316",
            "name": "ALTERNATIVE DEFINITION for [MALTOSE ANHYDROUS]",
            "linking_id": "f2a049d2-8aae-4516-ac80-8e5fc808f316",
            "ref_pname": "NO NAME"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8721a926-456e-4805-a652-3df00360a674",
          "name": "4-O-.ALPHA.-D-GLUCOPYRANOSYL-D-GLUCOSE",
          "stdName": "4-O-.ALPHA.-D-GLUCOPYRANOSYL-D-GLUCOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c3882cb-c237-4b1d-aca4-6fe916e7ccce"
          ],
          "display_name": false
        },
        {
          "uuid": "a968be29-6540-4c0d-be5f-7c1671bdd374",
          "name": "D-(+)-MALTOSE",
          "stdName": "D-(+)-MALTOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c3882cb-c237-4b1d-aca4-6fe916e7ccce"
          ],
          "display_name": false
        },
        {
          "uuid": "0dc9cbae-454c-40a8-b1a5-9e885141b3b1",
          "name": "D-GLUCOSE, 4-O-.ALPHA.-D-GLUCOPYRANOSYL-",
          "stdName": "D-GLUCOSE, 4-O-.ALPHA.-D-GLUCOPYRANOSYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c3882cb-c237-4b1d-aca4-6fe916e7ccce"
          ],
          "display_name": false
        },
        {
          "uuid": "91e46ad3-f239-4513-9016-e6b6f9cf6c0b",
          "name": "MALTOSE ANHYDROUS",
          "stdName": "MALTOSE ANHYDROUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "52876baf-eb68-4eec-ab89-d30b71be147a",
            "cdb2d9ac-5965-4b82-81be-76413108b3f0"
          ],
          "display_name": true
        },
        {
          "uuid": "6b494017-ad9f-4b53-934a-1f33fd8f8ff7",
          "name": "MALTOSE ANHYDROUS [II]",
          "stdName": "MALTOSE ANHYDROUS [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "52876baf-eb68-4eec-ab89-d30b71be147a"
          ],
          "display_name": false
        },
        {
          "uuid": "d0a19482-e10d-4d16-bc09-7130fbc96761",
          "name": "MALTOSE [MI]",
          "stdName": "MALTOSE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2c1a1c0-46b5-4a91-a90c-ee7d5dd2ec96"
          ],
          "display_name": false
        },
        {
          "uuid": "78bb2f86-1d2c-f7e3-e77e-0bdea7af91fa",
          "name": "NSC-760396",
          "stdName": "NSC-760396",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83822c6e-79f6-d729-592a-479b53baa66a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "52876baf-eb68-4eec-ab89-d30b71be147a",
          "citation": "NF 27",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d2c1a1c0-46b5-4a91-a90c-ee7d5dd2ec96",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c3882cb-c237-4b1d-aca4-6fe916e7ccce",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5341cd90-62b1-4943-b25c-621d4f598563",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389695000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25241e7d-edca-480f-af61-93229f4fce32",
          "citation": "SRS import [66Y63L379N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=66Y63L379N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389695000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cdb2d9ac-5965-4b82-81be-76413108b3f0",
          "citation": "MALTOSE ANHYDROUS [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8c120683-83f5-bc44-f5ae-5488a9afb097",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=69-79-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1bb1e2b5-7be1-168c-6346-1ab0520586dd",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "05b6d1cb-f3f3-1f66-f995-050efb947fcc",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "b2612a61-a5f6-3bee-9621-bf3ba365cda5",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "fb5e0b9a-24de-4450-a522-17abf453d9dc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "83822c6e-79f6-d729-592a-479b53baa66a",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "89eae2e9-5003-8d49-b4d3-51b2acd62218",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "a2809844-9775-49a9-96e5-12d642c314a5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c31f6506-d92b-48da-afd5-d5cc32ae7582",
          "id": "c31f6506-d92b-48da-afd5-d5cc32ae7582",
          "molfile": "\n  Marvin  01132110052D          \n\n 23 23  0  0  1  0            999 V2000\n   11.6617   -6.4842    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   12.3739   -6.0676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9494   -6.0676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3164   -6.6008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6617   -7.3088    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.9536   -7.7254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2373   -8.1418    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.5125   -7.7254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8003   -8.1418    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.0881   -7.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4550   -8.2585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8003   -8.9666    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.0881   -9.3789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5125   -9.3789    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.5208  -10.2078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2373   -8.9666    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.9536   -9.3789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3739   -7.7212    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   12.3822   -8.5501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0987   -7.3088    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   13.1592   -6.4405    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7234   -7.7650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7526   -8.5979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5 18  1  0  0  0  0\n  7  6  1  6  0  0  0\n  7  8  1  0  0  0  0\n 16  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  1  0  0  0\n 12  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 13  1  6  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  1  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  6  0  0  0\n 18 19  1  1  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  1  0  0  0\n 20 22  1  0  0  0  0\n 22 23  2  0  0  0  0\nM  END",
          "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O[C@@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O",
          "formula": "C12H22O11",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "33106979-4e88-4055-abf7-2ef32fee4e40"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "342.297",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "21d61400-d579-49e4-965f-cea87f215dcb",
      "version": "21",
      "structure": {
        "id": "978b714c-584f-4615-bb88-b11117d79370",
        "molfile": "\n  Marvin  01132107522D          \n\n 24 24  0  0  1  0            999 V2000\n   10.2389   -8.1431    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.2389   -8.9680    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.5140   -9.3804    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.8017   -8.9680    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.8017   -8.1431    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.6636   -7.3100    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.3759   -7.7224    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.1008   -7.3100    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.6636   -6.4852    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.0894   -9.3804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5140   -7.7266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0894   -7.7266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4562   -8.2598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5223  -10.2094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9554   -9.3804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9554   -7.7266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1613   -6.4415    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7256   -7.7662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3759   -6.0686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9512   -6.0686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3181   -6.6019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7548   -8.5993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3842   -8.5515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9470   -8.5515    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  6  1  0  0  0  0\n  4 10  1  6  0  0  0\n 11  1  1  0  0  0  0\n  5 11  1  0  0  0  0\n  5 12  1  1  0  0  0\n 13 12  1  0  0  0  0\n  3 14  1  1  0  0  0\n  2 15  1  6  0  0  0\n  6 16  1  6  0  0  0\n 16  1  1  0  0  0  0\n  8 17  1  1  0  0  0\n  8 18  1  0  0  0  0\n 19  9  1  0  0  0  0\n  9 20  1  1  0  0  0\n 21 20  1  0  0  0  0\n 18 22  2  0  0  0  0\n  7 23  1  1  0  0  0\n  1 24  1  1  0  0  0\nM  END",
        "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O[C@]1([H])[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O",
        "formula": "C12H22O11",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 9,
        "ez_centers": 0,
        "molecular_weight": "342.297",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "52876baf-eb68-4eec-ab89-d30b71be147a",
          "25241e7d-edca-480f-af61-93229f4fce32"
        ],
        "stereo_centers": 9
      },
      "unii": "66Y63L379N"
    }
  ]
}