{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "73d37f40-fbb6-421e-a47a-d084546f86fa", "code": "1232681-33-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1232681-33-2", "code_system": "CAS", "references": [ "1a870b1b-8e08-4961-a9c0-d461c44edbee", "eafdac01-85a2-4a6e-993d-f39584792eef" ] }, { "uuid": "4d877a82-6200-4017-aefa-f96e4808a18c", "code": "71587951", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587951", "code_system": "PUBCHEM", "references": [ "1a870b1b-8e08-4961-a9c0-d461c44edbee" ] }, { "uuid": "7238b54d-00a8-47a3-b7da-12e36a19cdbc", "code": "66T0X2BM34", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "e5bbe1d1-0b3f-3739-d190-a3915ab386ae", "code": "DTXSID40153923", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40153923", "code_system": "EPA CompTox", "references": [ "2b4eab36-bb5e-44ae-bf36-7359519fe75d" ] } ], "substance_class": "chemical", "names": [ { "uuid": "1e8c7a04-b22d-4bbf-b68b-b1a03a485795", "name": "1-PROPANONE, 1-(2-((6-O-.ALPHA.-D-GLUCOPYRANOSYL-.BETA.-D-GLUCOPYRANOSYL)OXY)-4,6-DIHYDROXYPHENYL)-3-(4-HYDROXYPHENYL)-", "stdName": "1-PROPANONE, 1-(2-((6-O-.ALPHA.-D-GLUCOPYRANOSYL-.BETA.-D-GLUCOPYRANOSYL)OXY)-4,6-DIHYDROXYPHENYL)-3-(4-HYDROXYPHENYL)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e260ce82-d82d-47bc-ad5f-493d659156ac", "077b8798-978e-4604-b8bc-c9ccb35b0328" ], "display_name": false }, { "uuid": "5103bd50-1afc-4181-96c6-703ddce2702c", "name": "INOVEOL PHLO", "stdName": "INOVEOL PHLO", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "e260ce82-d82d-47bc-ad5f-493d659156ac", "af984005-5c52-4e2f-b34d-19bcdb4700dd" ], "display_name": false }, { "uuid": "625eb1bf-cdf5-4bfd-b1e0-0c5d3cfaf370", "name": "INOVEOL PHLORIDZIN-GLUCOSIDE", "stdName": "INOVEOL PHLORIDZIN-GLUCOSIDE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "036ff7ea-0911-411a-a462-f732ecc92534", "e260ce82-d82d-47bc-ad5f-493d659156ac" ], "display_name": false }, { "uuid": "fb76367d-410f-40ae-b758-72f145401614", "name": "PHLORIDZIN-.ALPHA.-D-GLUCOSIDE", "stdName": "PHLORIDZIN-.ALPHA.-D-GLUCOSIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e260ce82-d82d-47bc-ad5f-493d659156ac", "af984005-5c52-4e2f-b34d-19bcdb4700dd" ], "display_name": false }, { "uuid": "db5f5995-558b-4a31-b38a-60d8891ed166", "name": "PHLORIDZINYL GLUCOSIDE", "stdName": "PHLORIDZINYL GLUCOSIDE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "036ff7ea-0911-411a-a462-f732ecc92534", "0b0c347b-6ee6-4134-ad47-60b50c197763", "e260ce82-d82d-47bc-ad5f-493d659156ac" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "2bcaaa2b-4407-4b93-a696-887f18c17b1b", "name_org": "INCI" } ] } ], "references": [ { "uuid": "036ff7ea-0911-411a-a462-f732ecc92534", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "e260ce82-d82d-47bc-ad5f-493d659156ac", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "077b8798-978e-4604-b8bc-c9ccb35b0328", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "af984005-5c52-4e2f-b34d-19bcdb4700dd", "citation": "http://www.inoveol.com/index.php?option=com_content&view=article&id=15&Itemid=21&lang=en", "url": "http://www.inoveol.com/index.php?option=com_content&view=article&id=15&Itemid=21&lang=en", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1a870b1b-8e08-4961-a9c0-d461c44edbee", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391545000, "tags": [ "NOMEN" ] }, { "uuid": "37ef96e9-1d7a-4020-9693-1e2919911d87", "citation": "SRS import [66T0X2BM34]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=66T0X2BM34", "doc_type": "SRS", "public_domain": true, "document_date": 1493391545000, "tags": [ "NOMEN" ] }, { "uuid": "0b0c347b-6ee6-4134-ad47-60b50c197763", "citation": "PHLORIDZINYL GLUCOSIDE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "5256eaf2-61b1-57ac-1e02-f40a3cd4d0b0", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1232681-33-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "eafdac01-85a2-4a6e-993d-f39584792eef", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "2b4eab36-bb5e-44ae-bf36-7359519fe75d", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "ec9f9f2c-00aa-4326-b12f-15337a9b140a", "id": "ec9f9f2c-00aa-4326-b12f-15337a9b140a", "molfile": "\n Marvin 01132112142D \n\n 42 45 0 0 1 0 999 V2000\n 3.6794 -3.3533 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 3.6794 -2.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9649 -2.1158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3939 -3.7658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3939 -4.5908 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 5.1084 -5.0033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1084 -5.8283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8228 -6.2408 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 6.5373 -5.8283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2518 -6.2408 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 7.9663 -5.8283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6807 -6.2408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6807 -7.0658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3951 -7.4783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3951 -8.3033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1096 -7.0658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1096 -6.2408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8241 -5.8283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3951 -5.8283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3951 -5.0033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6807 -4.5908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1096 -4.5908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1096 -3.7658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8241 -3.3533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5385 -3.7658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2530 -3.3533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2530 -2.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9675 -2.1158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5385 -2.1158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8241 -2.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2518 -7.0658 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.9663 -7.4783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5373 -7.4783 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 6.5373 -8.3033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8228 -7.0658 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 5.1084 -7.4783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6794 -5.0033 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 3.6794 -5.8283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9649 -4.5908 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 2.2504 -5.0033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9649 -3.7658 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 2.2504 -3.3533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 4 1 0 0 0 0\n 41 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 6 0 0 0\n 5 37 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 1 1 0 0 0\n 8 9 1 0 0 0 0\n 35 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 1 0 0 0\n 31 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 19 2 0 0 0 0\n 14 13 2 0 0 0 0\n 14 15 1 0 0 0 0\n 16 14 1 0 0 0 0\n 17 16 2 0 0 0 0\n 17 18 1 0 0 0 0\n 19 17 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 25 24 1 0 0 0 0\n 24 30 2 0 0 0 0\n 26 25 2 0 0 0 0\n 27 26 1 0 0 0 0\n 27 28 1 0 0 0 0\n 29 27 2 0 0 0 0\n 30 29 1 0 0 0 0\n 31 32 1 6 0 0 0\n 31 33 1 0 0 0 0\n 33 34 1 1 0 0 0\n 33 35 1 0 0 0 0\n 35 36 1 6 0 0 0\n 37 38 1 6 0 0 0\n 37 39 1 0 0 0 0\n 39 40 1 1 0 0 0\n 39 41 1 0 0 0 0\n 41 42 1 6 0 0 0\nM END", "smiles": "c1cc(ccc1CCC(=O)c2c(cc(cc2O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO[C@@H]4[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O)O3)O)O)O)O)O)O", "formula": "C27H34O15", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f257ab1b-967b-46a6-9d47-b42283c691f7" }, "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "598.5509", "optical_activity": "UNSPECIFIED", "stereo_centers": 10 } ], "definition_level": "COMPLETE", "uuid": "209c28ac-5d57-4590-87ea-eea62ba7d75b", "version": "6", "structure": { "id": "d38c2a08-7cea-4974-a237-008a57b20ee7", "molfile": "\n Marvin 01132110562D \n\n 42 45 0 0 1 0 999 V2000\n 4.3939 -4.5908 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.1084 -5.0033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1084 -5.8283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8228 -6.2408 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.8228 -7.0658 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.1084 -7.4783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5373 -7.4783 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.5373 -8.3033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2518 -7.0658 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.9663 -7.4783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2518 -6.2408 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.5373 -5.8283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9663 -5.8283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6807 -6.2408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3951 -5.8283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3951 -5.0033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6807 -4.5908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1096 -4.5908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1096 -3.7658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8241 -3.3533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5385 -3.7658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2530 -3.3533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2530 -2.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9675 -2.1158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5385 -2.1158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8241 -2.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1096 -6.2408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8241 -5.8283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1096 -7.0658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3951 -7.4783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3951 -8.3033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6807 -7.0658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6794 -5.0033 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.6794 -5.8283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9649 -4.5908 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.2504 -5.0033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9649 -3.7658 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 2.2504 -3.3533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6794 -3.3533 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.6794 -2.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9649 -2.1158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3939 -3.7658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 2 3 1 0 0 0 0\n 4 3 1 1 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 6 0 0 0\n 7 5 1 0 0 0 0\n 7 8 1 1 0 0 0\n 9 7 1 0 0 0 0\n 9 10 1 6 0 0 0\n 11 9 1 0 0 0 0\n 12 11 1 0 0 0 0\n 4 12 1 0 0 0 0\n 11 13 1 1 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 25 23 2 0 0 0 0\n 26 25 1 0 0 0 0\n 20 26 2 0 0 0 0\n 15 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 30 32 2 0 0 0 0\n 32 14 1 0 0 0 0\n 33 1 1 0 0 0 0\n 33 34 1 6 0 0 0\n 35 33 1 0 0 0 0\n 35 36 1 1 0 0 0\n 35 37 1 0 0 0 0\n 37 38 1 6 0 0 0\n 37 39 1 0 0 0 0\n 39 40 1 1 0 0 0\n 41 40 1 0 0 0 0\n 39 42 1 0 0 0 0\n 42 1 1 0 0 0 0\nM END", "smiles": "c1cc(ccc1CCC(=O)c2c(cc(cc2O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO[C@@H]4[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O)O3)O)O)O)O)O)O", "formula": "C27H34O15", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "598.5509", "optical_activity": "UNSPECIFIED", "references": [ "37ef96e9-1d7a-4020-9693-1e2919911d87", "077b8798-978e-4604-b8bc-c9ccb35b0328" ], "stereo_centers": 10 }, "unii": "66T0X2BM34" } ] }