{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7efd66d2-92dc-43e5-a4ef-b57e8cc0ed6b", "code": "4051-63-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=4051-63-2", "code_system": "CAS", "references": [ "77c4586f-32d6-4de5-8bfc-8b020a45ad9b", "986fc807-b2b6-4c7f-ab33-00f55654034f" ] }, { "uuid": "85361cfb-0809-4d86-8da1-88b4d327258e", "code": "21 CFR 176.170", "comments": "PART 176 -- INDIRECT FOOD ADDITIVES: PAPER AND PAPERBOARD COMPONENTS|Subpart B--Substances for Use Only as Components of Paper and Paperboard|Sec. 176.170 Components of paper and paperboard in contact with aqueous and fatty foods.", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/cfrsearch.cfm?fr=176.170", "code_system": "CFR", "references": [ "77c4586f-32d6-4de5-8bfc-8b020a45ad9b" ] }, { "uuid": "a6030de3-f057-4c41-b808-1081561ed192", "code": "21 CFR 178.3297", "comments": "PART 178 -- INDIRECT FOOD ADDITIVES: ADJUVANTS, PRODUCTION AIDS, AND SANITIZERS|Subpart D--Certain Adjuvants and Production Aids|Sec. 178.3297 Colorants for polymers.", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/cfrsearch.cfm?fr=178.3297", "code_system": "CFR", "references": [ "77c4586f-32d6-4de5-8bfc-8b020a45ad9b" ] }, { "uuid": "03f10dd2-34ca-4a2f-8892-0a52a7d3ae39", "code": "223-754-4", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.021.596", "code_system": "ECHA (EC/EINECS)", "references": [ "77c4586f-32d6-4de5-8bfc-8b020a45ad9b" ] }, { "uuid": "5ef11397-8611-4f65-8aee-bb7794015294", "code": "77669", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/77669", "code_system": "PUBCHEM", "references": [ "77c4586f-32d6-4de5-8bfc-8b020a45ad9b" ] }, { "uuid": "8b5905ed-4a22-2287-7e85-8f43a92cdce5", "code": "DTXSID2052079", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2052079", "code_system": "EPA CompTox", "references": [ "00d2f1d4-0f7d-1088-7acb-9b3d59b7aa00" ] }, { "uuid": "b42d5f5c-798b-499b-a868-48c1d05d30d6", "code": "66S4IFF43R", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "8e6f0b0c-3e6c-4f6e-ae14-4b17ca195d46", "name": "(1,1'-BIANTHRACENE)-9,9',10,10'-TETRONE, 4,4'-DIAMINO-", "stdName": "(1,1'-BIANTHRACENE)-9,9',10,10'-TETRONE, 4,4'-DIAMINO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3ae20945-e48f-4a2e-bf91-87d4ba7cd925", "dcebcef7-7a0a-4a7b-9b40-94f72dfc2abe" ], "display_name": false }, { "uuid": "f98ad2bb-fd2b-451e-ace6-0684ec601443", "name": "4,4'-DIAMINO(1,1'-BIANTHRACENE)-9,9',10,10'-TETRAONE", "stdName": "4,4'-DIAMINO(1,1'-BIANTHRACENE)-9,9',10,10'-TETRAONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3ae20945-e48f-4a2e-bf91-87d4ba7cd925", "dcebcef7-7a0a-4a7b-9b40-94f72dfc2abe" ], "display_name": false }, { "uuid": "bc9a67ec-b00d-4fd7-baa8-4e158b0c075d", "name": "C.I. 65300", "stdName": "C.I. 65300", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b8de14f9-8dca-42f7-b17f-034ca548c902", "dcebcef7-7a0a-4a7b-9b40-94f72dfc2abe" ], "display_name": false }, { "uuid": "4998bbf3-665c-4bf6-a0d9-d39a2ed58d28", "name": "C.I. PIGMENT RED 177", "stdName": "C.I. PIGMENT RED 177", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e9bb3abc-9f68-4c0c-9638-b859085d2eac" ], "display_name": false }, { "uuid": "6383fc4b-d649-4c62-bbac-2f4cd87604bb", "name": "CI 65300", "stdName": "CI 65300", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b8de14f9-8dca-42f7-b17f-034ca548c902", "dcebcef7-7a0a-4a7b-9b40-94f72dfc2abe" ], "display_name": false }, { "uuid": "168bab4e-1cc7-4f7f-90fa-47c7c9ad6204", "name": "PIGMENT RED 177", "stdName": "PIGMENT RED 177", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b8de14f9-8dca-42f7-b17f-034ca548c902", "dcebcef7-7a0a-4a7b-9b40-94f72dfc2abe" ], "display_name": true } ], "references": [ { "uuid": "e9bb3abc-9f68-4c0c-9638-b859085d2eac", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "3ae20945-e48f-4a2e-bf91-87d4ba7cd925", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dcebcef7-7a0a-4a7b-9b40-94f72dfc2abe", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b8de14f9-8dca-42f7-b17f-034ca548c902", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "77c4586f-32d6-4de5-8bfc-8b020a45ad9b", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390999000, "tags": [ "NOMEN" ] }, { "uuid": "642bdc4a-9a1c-4669-8355-6303cfb7c2f9", "citation": "SRS import [66S4IFF43R]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=66S4IFF43R", "doc_type": "SRS", "public_domain": true, "document_date": 1493390999000, "tags": [ "NOMEN" ] }, { "uuid": "82c2641d-f1dd-4ecf-be19-c89eeec5d7c2", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "00d2f1d4-0f7d-1088-7acb-9b3d59b7aa00", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4051-63-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "986fc807-b2b6-4c7f-ab33-00f55654034f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "ffec1ad6-1e4c-4fd6-928e-8702f2b4fc8f", "id": "ffec1ad6-1e4c-4fd6-928e-8702f2b4fc8f", "molfile": "\n Marvin 01132113152D \n\n 34 39 0 0 0 0 999 V2000\n 4.5232 -6.7823 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2378 -6.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9556 -6.7796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6669 -6.3631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6669 -5.5452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3808 -5.1329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3808 -4.3048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0998 -3.8934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8069 -4.3055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5270 -3.8953 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8069 -5.1290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5298 -5.5454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2436 -5.1331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5298 -6.3689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2440 -6.7823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2440 -7.6046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5282 -8.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8108 -7.6098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8108 -6.7804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0988 -6.3684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6696 -6.6162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0988 -5.5448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9562 -5.1322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9562 -4.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3845 -4.0593 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2378 -3.8924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2378 -3.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5256 -2.6526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8071 -3.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8071 -3.8924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5256 -4.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5256 -5.1322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8106 -5.5425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2378 -5.5439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 34 2 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 23 2 0 0 0 0\n 7 6 1 0 0 0 0\n 6 22 2 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 9 2 0 0 0 0\n 11 12 1 0 0 0 0\n 22 11 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 15 14 1 0 0 0 0\n 14 19 2 0 0 0 0\n 16 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 34 1 0 0 0 0\n 25 24 2 0 0 0 0\n 24 26 1 0 0 0 0\n 27 26 1 0 0 0 0\n 26 31 2 0 0 0 0\n 28 27 2 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 2 0 0 0 0\n 31 30 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 32 34 1 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)C(=O)c3c(ccc(c3C2=O)N)-c4ccc(c5c4C(=O)c6ccccc6C5=O)N", "formula": "C28H16N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "fb7a53b1-742d-4875-bcba-29323e67c923" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "444.4387", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "b8b34a05-ed1c-4344-84ea-544a24f09d89", "version": "3", "structure": { "id": "0ddda6d7-0803-420b-b8d8-f0d880f5528b", "molfile": "\n Marvin 01132100572D \n\n 34 39 0 0 0 0 999 V2000\n 6.3845 -4.0593 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9562 -4.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2378 -3.8924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5256 -4.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5256 -5.1322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8106 -5.5425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2378 -5.5439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2378 -6.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5232 -6.7823 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9556 -6.7796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6669 -6.3631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6669 -5.5452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3808 -5.1329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0988 -5.5448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8069 -5.1290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5298 -5.5454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2436 -5.1331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5298 -6.3689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8108 -6.7804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8108 -7.6098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5282 -8.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2440 -7.6046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2440 -6.7823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0988 -6.3684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6696 -6.6162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8069 -4.3055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5270 -3.8953 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0998 -3.8934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3808 -4.3048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9562 -5.1322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8071 -3.8924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8071 -3.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5256 -2.6526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2378 -3.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 18 2 0 0 0 0\n 19 24 1 0 0 0 0\n 24 14 1 0 0 0 0\n 24 25 2 0 0 0 0\n 15 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 13 2 0 0 0 0\n 12 30 1 0 0 0 0\n 30 2 1 0 0 0 0\n 30 7 2 0 0 0 0\n 4 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 33 34 1 0 0 0 0\n 34 3 2 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)C(=O)c3c(ccc(c3C2=O)N)-c4ccc(c5c4C(=O)c6ccccc6C5=O)N", "formula": "C28H16N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "444.4387", "optical_activity": "NONE", "references": [ "82c2641d-f1dd-4ecf-be19-c89eeec5d7c2", "642bdc4a-9a1c-4669-8355-6303cfb7c2f9" ], "stereo_centers": 0 }, "unii": "66S4IFF43R" } ] }