{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fbdf2f34-d703-4f48-96bf-5d4c90a2f397",
          "code": "108030-77-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=108030-77-9",
          "code_system": "CAS",
          "references": [
            "294db094-da0c-40a2-8ef1-973b4a857876",
            "19faac3e-1a0d-4bc2-9fec-c7f5e9933081"
          ]
        },
        {
          "uuid": "1d5523cb-3c95-4dac-982e-b8e3f7b86a9d",
          "code": "C1188",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1188",
          "code_system": "NCI_THESAURUS",
          "references": [
            "294db094-da0c-40a2-8ef1-973b4a857876"
          ]
        },
        {
          "uuid": "14e6c0d3-15f5-43de-b082-11a3d0303bcb",
          "code": "C058388",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67058388",
          "code_system": "MESH",
          "references": [
            "294db094-da0c-40a2-8ef1-973b4a857876"
          ]
        },
        {
          "uuid": "1623be17-d475-4c18-9068-ccb543b2f2c9",
          "code": "60203",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/60203",
          "code_system": "PUBCHEM",
          "references": [
            "294db094-da0c-40a2-8ef1-973b4a857876"
          ]
        },
        {
          "uuid": "ba694045-bf1e-0410-db4c-3d1e101e99c3",
          "code": "DTXSID50148365",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50148365",
          "code_system": "EPA CompTox",
          "references": [
            "74a52d30-7357-1755-a398-2fc2572c09f5"
          ]
        },
        {
          "uuid": "4a43e8b2-ef9d-545e-6e10-6e7cc961366e",
          "code": "C746",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Antineoplastic Alkylating Agent[C1590]|Picoline Compound",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C746",
          "code_system": "NCI_THESAURUS",
          "references": [
            "18dcce88-bba5-4c63-fac5-1be0bce36d23"
          ]
        },
        {
          "uuid": "5c1fe6df-f0f6-7bbc-80a2-eda94f94d4ad",
          "code": "DB12987",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB12987",
          "code_system": "DRUG BANK",
          "references": [
            "18dcce88-bba5-4c63-fac5-1be0bce36d23"
          ]
        },
        {
          "uuid": "a3cc893d-8c34-4d42-ad31-67c3079a665a",
          "code": "66Q80IL7CW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3199cddf-b3fc-685d-d3ea-ceb50429fa24",
          "code": "338720",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=338720",
          "code_system": "NSC",
          "references": [
            "2d6fe0b9-b9e8-7f98-c8cf-f785ab8ce50d"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "53966198-0cbb-4039-a947-36a8bb6fbe1f",
          "qualification": "PLASMA",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "4545b592-d134-4770-a60e-032d5477df72"
          ],
          "related_substance": {
            "uuid": "4af7fa19-6900-4ead-8425-cfad108b62de",
            "refuuid": "6cac9551-8bf7-4469-a6f7-f6f425c98254",
            "name": "4-O-DEMETHYLPENCLOMEDINE",
            "unii": "XUK71J2M0Q",
            "linking_id": "XUK71J2M0Q",
            "ref_pname": "4-O-DEMETHYLPENCLOMEDINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f2de8f47-de18-4916-9cd3-503fe9dd18e6",
          "name": "3,5-DICHLORO-2,4-DIMETHOXY-6-(TRICHLOROMETHYL)PYRIDINE",
          "stdName": "3,5-DICHLORO-2,4-DIMETHOXY-6-(TRICHLOROMETHYL)PYRIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7264ee56-dd80-4578-a8f6-a8f11a655fc5",
            "ea69ab03-ee4e-4fc9-88bf-4ee9f4ffbb06"
          ],
          "display_name": false
        },
        {
          "uuid": "7a43db4c-9af3-4767-824b-d277bf20de63",
          "name": "3,5-DICHLORO-2,4-DIMETHYLOXY-6-TRICHLOROMETHYL-PYRIDINE",
          "stdName": "3,5-DICHLORO-2,4-DIMETHYLOXY-6-TRICHLOROMETHYL-PYRIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7264ee56-dd80-4578-a8f6-a8f11a655fc5"
          ],
          "display_name": false
        },
        {
          "uuid": "18b36c9a-7a8a-4e49-889a-fabf924a3fce",
          "name": "NSC-338720",
          "stdName": "NSC-338720",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7264ee56-dd80-4578-a8f6-a8f11a655fc5",
            "ea69ab03-ee4e-4fc9-88bf-4ee9f4ffbb06"
          ],
          "display_name": false
        },
        {
          "uuid": "9f53fdc3-0c34-491e-9ba0-b33889474540",
          "name": "PEN",
          "stdName": "PEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e64d81d-b81b-4dae-b10f-1f40f083ad74",
            "ea69ab03-ee4e-4fc9-88bf-4ee9f4ffbb06"
          ],
          "display_name": false
        },
        {
          "uuid": "10d45049-f62e-4b36-853c-df9fa2b1fb02",
          "name": "PENCLOMEDINE",
          "stdName": "PENCLOMEDINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "014f14ca-5979-44b6-97b7-451c6457da1d",
            "7264ee56-dd80-4578-a8f6-a8f11a655fc5",
            "ea69ab03-ee4e-4fc9-88bf-4ee9f4ffbb06",
            "313880c6-5e75-4d1f-adfc-c8d97b9b629c"
          ],
          "display_name": true
        },
        {
          "uuid": "bba8e8b8-1c70-cd27-f02e-beb7feb1c1e5",
          "name": "Penclomedine [WHO-DD]",
          "stdName": "PENCLOMEDINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b42e56e-2255-76cb-9412-15115e9b5555"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7264ee56-dd80-4578-a8f6-a8f11a655fc5",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ea69ab03-ee4e-4fc9-88bf-4ee9f4ffbb06",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "014f14ca-5979-44b6-97b7-451c6457da1d",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e64d81d-b81b-4dae-b10f-1f40f083ad74",
          "citation": "J. Med. Chem. 2002, 45, 1079-1085",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "294db094-da0c-40a2-8ef1-973b4a857876",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390467000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4545b592-d134-4770-a60e-032d5477df72",
          "citation": "J. MED. CHEM.\\\\n2002,45, 1079-1085",
          "url": "http://pubs.acs.org/doi/pdf/10.1021/jm010334e",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21a34455-ebfc-47d6-b1c8-916798a4e99f",
          "citation": "SRS import [66Q80IL7CW]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=66Q80IL7CW",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390467000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "313880c6-5e75-4d1f-adfc-c8d97b9b629c",
          "citation": "PENCLOMEDINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "74a52d30-7357-1755-a398-2fc2572c09f5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=108030-77-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "18dcce88-bba5-4c63-fac5-1be0bce36d23",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "19faac3e-1a0d-4bc2-9fec-c7f5e9933081",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2d6fe0b9-b9e8-7f98-c8cf-f785ab8ce50d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "5b42e56e-2255-76cb-9412-15115e9b5555",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4d5da226-adac-469d-b896-6cbb2bce38a1",
          "id": "4d5da226-adac-469d-b896-6cbb2bce38a1",
          "molfile": "\n  Marvin  01132104022D          \n\n 16 16  0  0  0  0            999 V2000\n    0.0000   -1.1877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7075   -0.7849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4279   -1.1955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1405   -0.7849    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8505   -1.1955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8505   -2.0243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5657   -2.4400    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.1405   -2.4400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1405   -3.2559    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8428   -3.6638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4279   -2.0243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7075   -2.4400    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.5657   -0.7849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3403   -1.2032    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.4934    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.2448   -0.3408    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 11  2  0  0  0  0\n  4  5  2  0  0  0  0\n  6  5  1  0  0  0  0\n 13  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  2  0  0  0  0\n  9  8  1  0  0  0  0\n 11  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 13  1  0  0  0  0\nM  END",
          "smiles": "COc1c(c(C(Cl)(Cl)Cl)nc(c1Cl)OC)Cl",
          "formula": "C8H6Cl5NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5e45b2d1-c455-4653-a743-27f6086acb5d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "325.4037",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "41f60965-17f8-45a3-a870-e3fdab109108",
      "version": "11",
      "structure": {
        "id": "94919044-02c2-4d44-85fa-68800eebe423",
        "molfile": "\n  Marvin  01132107422D          \n\n 16 16  0  0  0  0            999 V2000\n    2.8505   -1.1955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1405   -0.7849    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8505   -2.0243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4279   -2.0243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1405   -2.4400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4279   -1.1955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5657   -0.7849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7075   -2.4400    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.5657   -2.4400    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.3403   -1.2032    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.4934    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.2448   -0.3408    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.1405   -3.2559    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7075   -0.7849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8428   -3.6638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.1877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  2  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11  7  1  0  0  0  0\n 12  7  1  0  0  0  0\n 13  5  1  0  0  0  0\n 14  6  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 14  1  0  0  0  0\n  6  4  1  0  0  0  0\nM  END",
        "smiles": "COc1c(c(C(Cl)(Cl)Cl)nc(c1Cl)OC)Cl",
        "formula": "C8H6Cl5NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "325.4037",
        "optical_activity": "NONE",
        "references": [
          "7264ee56-dd80-4578-a8f6-a8f11a655fc5",
          "21a34455-ebfc-47d6-b1c8-916798a4e99f"
        ],
        "stereo_centers": 0
      },
      "unii": "66Q80IL7CW"
    }
  ]
}