{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e12a7d76-f755-4a34-be2a-546342a20190",
          "code": "126-44-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=126-44-3",
          "code_system": "CAS",
          "references": [
            "e7805735-c484-79f1-dff1-2bc1bd5b7703"
          ]
        },
        {
          "uuid": "38f2ca82-2830-4352-8d7d-707fb383623a",
          "code": "31348",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/31348",
          "code_system": "PUBCHEM",
          "references": [
            "34a0a20b-1b26-c912-dd79-2a8a4ebf498e"
          ]
        },
        {
          "uuid": "681ccb00-b2af-4de9-92b3-15fcce6fad4a",
          "code": "664CCH53PI",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "19d48a60-e804-1c8a-1300-89a38683af52",
          "code": "DTXSID30155037",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30155037",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "2edf429c-5dee-73a6-3a7a-3bb17cabdb32",
          "code": "100000085415",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9a2bca6c-fd7c-c871-1d3b-473b2e497482"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "9e6794a1-aab6-4202-bbf7-9a43e4e180fb",
          "type": "IONIC MOIETY",
          "references": [
            "e7805735-c484-79f1-dff1-2bc1bd5b7703"
          ],
          "related_substance": {
            "uuid": "89472173-bd20-42a8-b985-999fd25b08c7",
            "refuuid": "272ad34e-8073-4377-b7c9-2fea221f9861",
            "name": "CITRATE ION",
            "unii": "664CCH53PI",
            "linking_id": "664CCH53PI",
            "ref_pname": "CITRATE ION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0f32d6ac-cb46-cfd9-bf62-5ee5302f7688",
          "name": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, ION(3-)",
          "stdName": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, ION(3-)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7805735-c484-79f1-dff1-2bc1bd5b7703"
          ],
          "display_name": false
        },
        {
          "uuid": "0361e650-9f2a-327c-41ab-89dcccfcc8da",
          "name": "CITRATE ION",
          "stdName": "CITRATE ION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7805735-c484-79f1-dff1-2bc1bd5b7703"
          ],
          "display_name": true
        },
        {
          "uuid": "e4b182a9-6572-908a-cd2f-ca6d0132a16d",
          "name": "CITRATE TRIANION",
          "stdName": "CITRATE TRIANION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7805735-c484-79f1-dff1-2bc1bd5b7703"
          ],
          "display_name": false
        },
        {
          "uuid": "3954019e-69f9-a7b8-1465-a63151fab1a7",
          "name": "CITRIC ACID, ION(3-)",
          "stdName": "CITRIC ACID, ION(3-)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7805735-c484-79f1-dff1-2bc1bd5b7703"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e7805735-c484-79f1-dff1-2bc1bd5b7703",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "34a0a20b-1b26-c912-dd79-2a8a4ebf498e",
          "citation": "PUBCHEM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "213e7b73-4454-679f-d7d4-8ebcd14849f2",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "5b039ad8-4057-4a0a-b08e-8938ccb4a5eb",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        },
        {
          "uuid": "9a2bca6c-fd7c-c871-1d3b-473b2e497482",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "022abfda-5417-0e5c-d498-dc1217dd6268",
          "id": "022abfda-5417-0e5c-d498-dc1217dd6268",
          "molfile": "\n  Marvin  01132100262D          \n\n 13 12  0  0  0  0            999 V2000\n   17.4059   -4.8950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6914   -4.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6914   -3.6574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9769   -4.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2625   -4.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5480   -4.0700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5480   -4.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8335   -4.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1191   -4.8950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8335   -3.6574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2625   -3.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9769   -3.2450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5480   -3.2450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5 11  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\nM  END",
          "smiles": "C(C(=O)O)C(CC(=O)O)(C(=O)O)O",
          "formula": "C6H8O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6b35137a-2c22-4d58-bb92-a4d88d86fed2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "192.1238",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "272ad34e-8073-4377-b7c9-2fea221f9861",
      "version": "10",
      "structure": {
        "id": "a092fa3a-658b-5f7e-fdbc-6466288a7d65",
        "molfile": "1,2,3-Propanetricarboxylic acid, 2-hydroxy-, ion(3-)\n  Marvin  01132108202D          \n\n 13 12  0  0  0  0            999 V2000\n   15.2625   -4.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9769   -4.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6914   -4.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4059   -4.8950    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   16.6914   -3.6574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5480   -4.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8335   -4.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1191   -4.8950    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   13.8335   -3.6574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2625   -3.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9769   -3.2450    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   14.5480   -3.2450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5480   -4.0700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n  1 13  1  0  0  0  0\nM  CHG  3   4  -1   8  -1  11  -1\nM  END",
        "smiles": "C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O",
        "formula": "C6H5O7",
        "atropisomerism": "No",
        "charge": -3,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "189.1",
        "optical_activity": "NONE",
        "references": [
          "e7805735-c484-79f1-dff1-2bc1bd5b7703"
        ],
        "stereo_centers": 0
      },
      "unii": "664CCH53PI"
    }
  ]
}