{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f7473139-04ee-4047-bc11-db91fefdf97a",
          "code": "135043-63-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=135043-63-9",
          "code_system": "CAS",
          "references": [
            "0d81e77b-ada6-4510-a2c9-421d1ff09d88",
            "4f805ff6-9fb4-47d5-8861-e57e40c3d1d5"
          ]
        },
        {
          "uuid": "11fceced-9a15-4a80-b689-31ae666c74d8",
          "code": "71587489",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587489",
          "code_system": "PUBCHEM",
          "references": [
            "0d81e77b-ada6-4510-a2c9-421d1ff09d88"
          ]
        },
        {
          "uuid": "9b2ae9b0-666d-d3f8-72ee-0de8f8bf3e09",
          "code": "DTXSID20159226",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20159226",
          "code_system": "EPA CompTox",
          "references": [
            "912f9afe-5328-42c6-4cc5-2ff7fb3ef959"
          ]
        },
        {
          "uuid": "be5f37bf-aab7-4b7a-b6a7-3aa86033b1af",
          "code": "663EY8GGFA",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6ce5d190-c554-4495-ac0f-df6f4bad6898",
          "name": "HYDROXYETHYLAMINOMETHYL-P-AMINOPHENOL HCL",
          "stdName": "HYDROXYETHYLAMINOMETHYL-P-AMINOPHENOL HCL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "4afe0e0a-eda0-4d06-a9ba-05e0ddba92bd",
            "d8291f16-5608-4935-9fa6-e197fb44dd87",
            "36c37c27-05b4-4a25-8c2e-f0e066115dd2"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "07cafc1b-ae1b-44cd-86e6-7dc1c860e022",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "2324d812-2045-4463-893b-976b73af7330",
          "name": "HYDROXYETHYLAMINOMETHYL-P-AMINOPHENOL HYDROCHLORIDE",
          "stdName": "HYDROXYETHYLAMINOMETHYL-P-AMINOPHENOL HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4afe0e0a-eda0-4d06-a9ba-05e0ddba92bd",
            "d8291f16-5608-4935-9fa6-e197fb44dd87"
          ],
          "display_name": true
        },
        {
          "uuid": "ab02fb98-8c59-44b0-9b28-5f24d0cccd6c",
          "name": "PHENOL, 4-AMINO-2-(((2-HYDROXYETHYL)AMINO)METHYL)-, DIHYDROCHLORIDE",
          "stdName": "PHENOL, 4-AMINO-2-(((2-HYDROXYETHYL)AMINO)METHYL)-, DIHYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8291f16-5608-4935-9fa6-e197fb44dd87",
            "71aaa472-2b21-4721-8e53-7a6d024104f4"
          ],
          "display_name": false
        },
        {
          "uuid": "38c7dc82-1abe-4eab-926f-c431ba5600d1",
          "name": "PHENOL, 4-AMINO-2-(((2-HYDROXYETHYL)AMINO)METHYL)-, HYDROCHLORIDE (1:2)",
          "stdName": "PHENOL, 4-AMINO-2-(((2-HYDROXYETHYL)AMINO)METHYL)-, HYDROCHLORIDE (1:2)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8291f16-5608-4935-9fa6-e197fb44dd87",
            "71aaa472-2b21-4721-8e53-7a6d024104f4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4afe0e0a-eda0-4d06-a9ba-05e0ddba92bd",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d8291f16-5608-4935-9fa6-e197fb44dd87",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71aaa472-2b21-4721-8e53-7a6d024104f4",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d81e77b-ada6-4510-a2c9-421d1ff09d88",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391530000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aeaef05a-b4fe-4e5d-8f3d-75be7830d818",
          "citation": "SRS import [663EY8GGFA]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=663EY8GGFA",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391530000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36c37c27-05b4-4a25-8c2e-f0e066115dd2",
          "citation": "HYDROXYETHYLAMINOMETHYL-P-AMINOPHENOL HCL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "912f9afe-5328-42c6-4cc5-2ff7fb3ef959",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=135043-63-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4f805ff6-9fb4-47d5-8861-e57e40c3d1d5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1638d446-cd13-4575-95ae-386b88a6d37c",
          "id": "1638d446-cd13-4575-95ae-386b88a6d37c",
          "molfile": "\n  Marvin  01132101212D          \n\n  1  0  0  0  0  0            999 V2000\n   11.2128   -5.1497    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "b550a989-3554-40b3-9c84-aad7d3a73e20"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "9a508032-8947-4084-b3cb-d04fe406c3ce",
          "id": "9a508032-8947-4084-b3cb-d04fe406c3ce",
          "molfile": "\n  Marvin  01132108012D          \n\n 13 13  0  0  0  0            999 V2000\n    2.1924   -4.3274    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9081   -4.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9081   -5.5670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6237   -5.9774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3394   -5.5670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0532   -5.9805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3394   -4.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0550   -4.3274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7683   -4.7419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4839   -4.3316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1971   -4.7461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9129   -4.3358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6237   -4.3188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n 13  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7 13  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\nM  END",
          "smiles": "c1cc(c(cc1N)CNCCO)O",
          "formula": "C9H14N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "717952c6-05b6-485d-92c2-8a78d955fabb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "182.22",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "55c84c3f-1243-4bfd-b0f5-9a4901e39b7c",
      "version": "4",
      "structure": {
        "id": "8d307e2d-5262-46c7-ac9d-688e999ff6f6",
        "molfile": "\n  Marvin  01132107202D          \n\n 15 13  0  0  0  0            999 V2000\n   11.2128   -5.1497    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.5628   -5.1497    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.0532   -5.9805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6237   -5.9774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9081   -5.5670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9081   -4.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6237   -4.3188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3394   -4.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3394   -5.5670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0550   -4.3274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7683   -4.7419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1971   -4.7461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4839   -4.3316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9129   -4.3358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1924   -4.3274    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n 15  6  1  0  0  0  0\n 10  8  1  0  0  0  0\n  9  3  1  0  0  0  0\n  9  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 11 10  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 12  1  0  0  0  0\n 13 12  1  0  0  0  0\nM  END",
        "smiles": "c1cc(c(cc1N)CNCCO)O.Cl.Cl",
        "formula": "C9H14N2O2.2ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "255.1418",
        "optical_activity": "NONE",
        "references": [
          "aeaef05a-b4fe-4e5d-8f3d-75be7830d818",
          "71aaa472-2b21-4721-8e53-7a6d024104f4"
        ],
        "stereo_centers": 0
      },
      "unii": "663EY8GGFA"
    }
  ]
}