{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "22352eb0-f280-438c-ab7d-d77ae99fb031",
          "code": "34123-59-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=34123-59-6",
          "code_system": "CAS",
          "references": [
            "d370451a-6511-41c8-b127-1768fae53666",
            "0c32418e-4658-412d-8ea3-dfb28a5fbeea"
          ]
        },
        {
          "uuid": "7c206e89-aea3-4455-bfd6-dc39f5c75b4c",
          "code": "C028904",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67028904",
          "code_system": "MESH",
          "references": [
            "d370451a-6511-41c8-b127-1768fae53666"
          ]
        },
        {
          "uuid": "19d0b87b-2a34-4663-8384-c1a142a4efcd",
          "code": "512200",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:704",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "d370451a-6511-41c8-b127-1768fae53666"
          ]
        },
        {
          "uuid": "2fcdf536-5305-4de3-b993-efe03cf1dae4",
          "code": "m6534",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6534?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d370451a-6511-41c8-b127-1768fae53666"
          ]
        },
        {
          "uuid": "14446110-1847-4436-adf4-d377777f4410",
          "code": "251-835-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.047.108",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d370451a-6511-41c8-b127-1768fae53666"
          ]
        },
        {
          "uuid": "3dc01631-0d46-43e2-b69c-8ef326d04aa8",
          "code": "36679",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/36679",
          "code_system": "PUBCHEM",
          "references": [
            "d370451a-6511-41c8-b127-1768fae53666"
          ]
        },
        {
          "uuid": "00a1e460-fd10-28f5-223f-5f625591b1c5",
          "code": "DTXSID1042077",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1042077",
          "code_system": "EPA CompTox",
          "references": [
            "141d25b7-f8f4-fbad-6abc-1594e53c05d4"
          ]
        },
        {
          "uuid": "6bc591ab-a4c3-451b-879b-931b408e7648",
          "code": "66066K098P",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "970c53ec-b23f-e2ff-52e1-c3bb7910ea4c",
          "code": "6049",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:6049",
          "code_system": "CHEBI",
          "references": [
            "11f64880-2a19-4c3a-3c2a-d445d5c057e5"
          ]
        },
        {
          "uuid": "3278aaf3-2f78-4dab-6fd5-243a9319b879",
          "code": "isoproturon",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/isoproturon.html",
          "code_system": "ALANWOOD",
          "references": [
            "1cda5b81-5e66-e905-a17b-30ab9c31ca8a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ed0d195f-3f53-442f-8354-6c5281914cf8",
          "name": "3-(4-ISOPROPYLPHENYL)-1,1-DIMETHYLUREA",
          "stdName": "3-(4-ISOPROPYLPHENYL)-1,1-DIMETHYLUREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "332488c3-8cd9-474c-90ee-ac44c9b3ea76",
            "18d7639c-5e1f-487b-a4dc-02fcd8b6fea3"
          ],
          "display_name": false
        },
        {
          "uuid": "a95070f6-4df9-4fc2-ad61-1961690d73a2",
          "name": "ISOPROTURON",
          "stdName": "ISOPROTURON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1f68300-29e6-4e56-8e73-cbd4fa33f993",
            "3d367ceb-f492-4cbd-b9f8-ef5528231598",
            "c85fbda3-eeed-421c-8442-94d1ca317239",
            "26f572c7-eac8-4bf5-9295-3e58373e372d",
            "dfa453f7-6617-4f23-99c5-23624ec14966",
            "ba5f56de-485f-4f35-a7db-8095b6fd5aac"
          ],
          "display_name": true
        },
        {
          "uuid": "ca87622d-cc37-4c3d-9b1f-9e86f51b8d98",
          "name": "ISOPROTURON [ISO]",
          "stdName": "ISOPROTURON [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1f68300-29e6-4e56-8e73-cbd4fa33f993",
            "dfa453f7-6617-4f23-99c5-23624ec14966"
          ],
          "display_name": false
        },
        {
          "uuid": "fecf12d5-519a-460c-8cd4-4af8e76fc373",
          "name": "ISOPROTURON [MI]",
          "stdName": "ISOPROTURON [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dfa453f7-6617-4f23-99c5-23624ec14966",
            "ba5f56de-485f-4f35-a7db-8095b6fd5aac"
          ],
          "display_name": false
        },
        {
          "uuid": "41f1320b-5f8a-4dfc-b801-3440f96ab667",
          "name": "N,N-DIMETHYL-N'-(4-(1-METHYLETHYL)PHENYL)UREA",
          "stdName": "N,N-DIMETHYL-N'-(4-(1-METHYLETHYL)PHENYL)UREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da51d5b9-642e-48c9-9d46-3850fc98d164",
            "332488c3-8cd9-474c-90ee-ac44c9b3ea76"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3d367ceb-f492-4cbd-b9f8-ef5528231598",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "332488c3-8cd9-474c-90ee-ac44c9b3ea76",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "18d7639c-5e1f-487b-a4dc-02fcd8b6fea3",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da51d5b9-642e-48c9-9d46-3850fc98d164",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba5f56de-485f-4f35-a7db-8095b6fd5aac",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dfa453f7-6617-4f23-99c5-23624ec14966",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1f68300-29e6-4e56-8e73-cbd4fa33f993",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d370451a-6511-41c8-b127-1768fae53666",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee610d9a-51d3-41ab-938d-64ad52fab0a1",
          "citation": "SRS import [66066K098P]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=66066K098P",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a5a42989-5774-4c2a-baaa-580a4614a0fa",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c85fbda3-eeed-421c-8442-94d1ca317239",
          "citation": "ISOPROTURON [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "26f572c7-eac8-4bf5-9295-3e58373e372d",
          "citation": "ISOPROTURON [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "141d25b7-f8f4-fbad-6abc-1594e53c05d4",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=34123-59-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1cda5b81-5e66-e905-a17b-30ab9c31ca8a",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "11f64880-2a19-4c3a-3c2a-d445d5c057e5",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0c32418e-4658-412d-8ea3-dfb28a5fbeea",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a14644ad-7e3e-4e7b-afa7-51e827a182a2",
          "id": "a14644ad-7e3e-4e7b-afa7-51e827a182a2",
          "molfile": "\n  Marvin  01132108232D          \n\n 15 15  0  0  0  0            999 V2000\n    4.1747   -4.3238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8781   -3.9051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8781   -3.0926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6167   -4.3117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3186   -3.8968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0398   -4.2857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0398   -5.1121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7608   -5.5452    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4727   -5.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4727   -4.3117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1885   -5.5361    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1885   -6.3776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8972   -5.1281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3377   -5.5452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6167   -5.1432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n 15  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 14  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 15  1  0  0  0  0\nM  END",
          "smiles": "CC(C)c1ccc(cc1)NC(=O)N(C)C",
          "formula": "C12H18N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3a4de62e-b58f-495e-b724-f398fc17df71"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "206.2846",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "07b98039-6890-4700-a3dc-5a9d2fb391dc",
      "version": "5",
      "structure": {
        "id": "868fe774-fa8b-4431-8c05-1b030b42d315",
        "molfile": "\n  Marvin  01132106592D          \n\n 15 15  0  0  0  0            999 V2000\n    7.0393   -5.1117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0393   -4.2854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3181   -3.8965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6163   -4.3114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8777   -3.9048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1744   -4.3235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8777   -3.0924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6163   -5.1428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3372   -5.5448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7602   -5.5448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4720   -5.1346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1878   -5.5357    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1878   -6.3771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8964   -5.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4720   -4.3114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9  8  2  0  0  0  0\n  1  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 11 15  2  0  0  0  0\nM  END",
        "smiles": "CC(C)c1ccc(cc1)NC(=O)N(C)C",
        "formula": "C12H18N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "206.2846",
        "optical_activity": "NONE",
        "references": [
          "ee610d9a-51d3-41ab-938d-64ad52fab0a1",
          "a5a42989-5774-4c2a-baaa-580a4614a0fa"
        ],
        "stereo_centers": 0
      },
      "unii": "66066K098P"
    }
  ]
}