{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6c779736-56f5-4385-9b33-2abc9611858f",
          "code": "D11AC09",
          "comments": "ATC|DERMATOLOGICALS|OTHER DERMATOLOGICAL PREPARATIONS|OTHER DERMATOLOGICAL PREPARATIONS|Medicated shampoos|xenysalate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=D11AC09&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "a06792fb-6121-429c-98ed-0efe3a19c4b0"
          ]
        },
        {
          "uuid": "321f986e-367f-4c93-b84e-50cb6ded8c63",
          "code": "QD11AC09",
          "comments": "VATC|OTHER DERMATOLOGICAL PREPARATIONS|OTHER DERMATOLOGICAL PREPARATIONS|Medicated shampoos|xenysalate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QD11AC09&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "a06792fb-6121-429c-98ed-0efe3a19c4b0"
          ]
        },
        {
          "uuid": "e12275ec-5345-4fa0-bdb5-21a53da020e5",
          "code": "3572-52-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3572-52-9",
          "code_system": "CAS",
          "references": [
            "a06792fb-6121-429c-98ed-0efe3a19c4b0",
            "df9f968a-c249-4b6b-a83d-cf3c621aa3d2"
          ]
        },
        {
          "uuid": "7b8fd3b8-a65b-4043-b0fa-8a874ba4d2b4",
          "code": "C79881",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C79881",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a06792fb-6121-429c-98ed-0efe3a19c4b0"
          ]
        },
        {
          "uuid": "48ed8e25-1363-489f-9895-20d1b74e720b",
          "code": "SUB00108MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a06792fb-6121-429c-98ed-0efe3a19c4b0"
          ]
        },
        {
          "uuid": "90ed25e2-c1df-453d-bc8b-e9ee326d6c70",
          "code": "1254",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1254",
          "code_system": "INN",
          "references": [
            "a06792fb-6121-429c-98ed-0efe3a19c4b0"
          ]
        },
        {
          "uuid": "d118600d-8722-4518-b0ba-f7212d469e2f",
          "code": "222-686-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.624",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a06792fb-6121-429c-98ed-0efe3a19c4b0"
          ]
        },
        {
          "uuid": "c83464ea-ba17-4e5d-b035-f273b9703ebe",
          "code": "m1026",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1026?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a06792fb-6121-429c-98ed-0efe3a19c4b0"
          ]
        },
        {
          "uuid": "917d28b5-15cd-4839-bdc5-d49f30a11d97",
          "code": "CHEMBL2110895",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2110895",
          "code_system": "ChEMBL",
          "references": [
            "a06792fb-6121-429c-98ed-0efe3a19c4b0"
          ]
        },
        {
          "uuid": "f8de39db-c9d6-401e-866b-6070f8bb9aa7",
          "code": "21720",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21720",
          "code_system": "PUBCHEM",
          "references": [
            "a06792fb-6121-429c-98ed-0efe3a19c4b0"
          ]
        },
        {
          "uuid": "a151785b-4ccc-3480-166c-31506d04a7d6",
          "code": "DTXSID4063086",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4063086",
          "code_system": "EPA CompTox",
          "references": [
            "7e44aceb-e157-9d04-615e-23f289d5f5b7"
          ]
        },
        {
          "uuid": "8155e8d3-4021-09c3-04bb-3a5aa4cc48e5",
          "code": "C29700",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Integumentary System[C78284]|Astringent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29700",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e69c2d80-9daf-1277-f1ad-34885647b8df"
          ]
        },
        {
          "uuid": "63131f5b-31f5-49e5-a4ee-cd7b1cef9da0",
          "code": "65X88IL51X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "adff800f-68f7-854b-178a-f8a00660fae8",
          "code": "3027",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3027",
          "code_system": "DRUG CENTRAL",
          "references": [
            "e69c2d80-9daf-1277-f1ad-34885647b8df"
          ]
        },
        {
          "uuid": "9d0df345-2062-aa3d-4bc2-f0791399d75f",
          "code": "DB13815",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13815",
          "code_system": "DRUG BANK",
          "references": [
            "e69c2d80-9daf-1277-f1ad-34885647b8df"
          ]
        },
        {
          "uuid": "ce0b2b0e-8e0a-4086-8d8e-d8fb441b2461",
          "code": "100000079356",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ff9e8b08-a099-2642-1be6-3dd4b7612271"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "cc8857d2-b740-47fb-9a8d-6c74a53aa63a",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "62bbce95-0fc8-4889-a55b-3b8eb2de3c5e",
            "refuuid": "52444aba-de73-402e-b334-837de0ae6d65",
            "name": "BIPHENAMINE",
            "unii": "65X88IL51X",
            "linking_id": "65X88IL51X",
            "ref_pname": "BIPHENAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a1f28df2-12b1-4fe4-8f51-c3258a0a70bd",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "512b539e-96d3-40be-9766-878d794d9b19",
            "refuuid": "1c80f55b-e541-441f-8a9d-714024608770",
            "name": "BIPHENAMINE HYDROCHLORIDE",
            "unii": "0WN4KYJ0C0",
            "linking_id": "0WN4KYJ0C0",
            "ref_pname": "BIPHENAMINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "51a8e414-1560-4a52-a1cb-97b772abca6b",
          "name": "(1,1'-BIPHENYL)-3-CARBOXYLIC ACID, 2-HYDROXY-2-(DIETHYLAMINO)ETHYL ESTER",
          "stdName": "(1,1'-BIPHENYL)-3-CARBOXYLIC ACID, 2-HYDROXY-2-(DIETHYLAMINO)ETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5bace217-c98c-4996-ba01-0977732c8917"
          ],
          "display_name": false
        },
        {
          "uuid": "b08d7157-797b-4e69-a78e-fbb453bc3007",
          "name": "2-(DIETHYLAMINO)ETHYL 2-HYDROXY-3-BIPHENYLCARBOXYLATE",
          "stdName": "2-(DIETHYLAMINO)ETHYL 2-HYDROXY-3-BIPHENYLCARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5bace217-c98c-4996-ba01-0977732c8917"
          ],
          "display_name": false
        },
        {
          "uuid": "ce64e5d6-2ddf-4778-89dc-14b1889eb3bd",
          "name": "BIPHENAMINE",
          "stdName": "BIPHENAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5bace217-c98c-4996-ba01-0977732c8917",
            "284378c2-5aaa-490d-bf6a-b0d11a47d2a0",
            "a38f514c-3cce-4ba9-ba5b-0a5c5141158e",
            "d4da0864-f139-4f82-ae3e-0a07400b4b20"
          ],
          "display_name": true
        },
        {
          "uuid": "a6d2fa9e-5ffa-4ac2-879b-bdcf48ad19fd",
          "name": "BIPHENAMINE [MI]",
          "stdName": "BIPHENAMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "284378c2-5aaa-490d-bf6a-b0d11a47d2a0",
            "d4da0864-f139-4f82-ae3e-0a07400b4b20"
          ],
          "display_name": false
        },
        {
          "uuid": "48f0372d-698b-40aa-abd5-0cd36cf8e635",
          "name": "XENYSALATE",
          "stdName": "XENYSALATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d3cc699-04c2-453e-a2e6-89d329be08d3",
            "ffd45b1e-8887-4667-8959-5c9045f2030b",
            "0f65bb70-892e-4194-a315-3e575e666feb",
            "d973f238-b7bf-4708-ac87-25e2c904a74d",
            "2841fe11-40be-4523-ab3d-181702a43293",
            "d4da0864-f139-4f82-ae3e-0a07400b4b20"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "f726b933-5ab5-46dd-952a-5ecdc6d9fa26",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "239a4205-4bd3-7d31-1210-aa7911536853",
          "name": "Xenysalate [WHO-DD]",
          "stdName": "XENYSALATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a29f681-576c-4fee-8b98-08b54c504fba"
          ],
          "display_name": false
        },
        {
          "uuid": "6b2aa5d4-0c06-4ca1-9779-0c9392cde1cd",
          "name": "xenysalate [INN]",
          "stdName": "XENYSALATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ffd45b1e-8887-4667-8959-5c9045f2030b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5bace217-c98c-4996-ba01-0977732c8917",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0f65bb70-892e-4194-a315-3e575e666feb",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ffd45b1e-8887-4667-8959-5c9045f2030b",
          "citation": "INN Proposed List 12",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL12.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "284378c2-5aaa-490d-bf6a-b0d11a47d2a0",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4da0864-f139-4f82-ae3e-0a07400b4b20",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d973f238-b7bf-4708-ac87-25e2c904a74d",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a06792fb-6121-429c-98ed-0efe3a19c4b0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390767000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3839a1c-1a73-4577-956a-c85402632a5a",
          "citation": "SRS import [65X88IL51X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=65X88IL51X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390767000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2841fe11-40be-4523-ab3d-181702a43293",
          "citation": "XENYSALATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a38f514c-3cce-4ba9-ba5b-0a5c5141158e",
          "citation": "BIPHENAMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7d3cc699-04c2-453e-a2e6-89d329be08d3",
          "citation": "XENYSALATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7e44aceb-e157-9d04-615e-23f289d5f5b7",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3572-52-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ff9e8b08-a099-2642-1be6-3dd4b7612271",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "e69c2d80-9daf-1277-f1ad-34885647b8df",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "df9f968a-c249-4b6b-a83d-cf3c621aa3d2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6a29f681-576c-4fee-8b98-08b54c504fba",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ed9ab821-bf75-4c86-9bc1-29168bbd88bb",
          "id": "ed9ab821-bf75-4c86-9bc1-29168bbd88bb",
          "molfile": "\n  Marvin  01132112172D          \n\n 23 24  0  0  0  0            999 V2000\n    9.1577   -2.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4417   -3.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7314   -2.6721    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7314   -1.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4534   -1.4433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0066   -3.0758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2935   -2.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5774   -3.0670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8702   -2.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8820   -1.8293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1572   -3.0464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1542   -3.8802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4322   -4.2839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7281   -3.8684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7339   -3.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0208   -2.6191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0326   -1.8058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3165   -1.3814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5917   -1.7940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5917   -2.6161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3047   -3.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4528   -2.6397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4587   -1.8175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  6  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 22 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 22  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 21  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "CCN(CC)CCOC(=O)c1cccc(-c2ccccc2)c1O",
          "formula": "C19H23NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "193e74b4-0e44-483d-b194-d2d454f5e6ba"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "313.3915",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "52444aba-de73-402e-b334-837de0ae6d65",
      "version": "11",
      "structure": {
        "id": "09acf958-229d-405c-8295-829cb0e3388c",
        "molfile": "\n  Marvin  01132100462D          \n\n 23 24  0  0  0  0            999 V2000\n    2.7339   -3.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0208   -2.6191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4528   -2.6397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7281   -3.8684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0326   -1.8058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3047   -3.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1572   -3.0464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4587   -1.8175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4322   -4.2839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3165   -1.3814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5917   -2.6161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8702   -2.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1542   -3.8802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5917   -1.7940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5774   -3.0670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8820   -1.8293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2935   -2.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0066   -3.0758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7314   -2.6721    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4417   -3.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7314   -1.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1577   -2.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4534   -1.4433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  2  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  4  9  2  0  0  0  0\n  5 10  1  0  0  0  0\n  6 11  2  0  0  0  0\n  7 12  1  0  0  0  0\n  7 13  2  0  0  0  0\n 10 14  2  0  0  0  0\n 12 15  1  0  0  0  0\n 12 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n  9 13  1  0  0  0  0\n 11 14  1  0  0  0  0\nM  END",
        "smiles": "CCN(CC)CCOC(=O)c1cccc(-c2ccccc2)c1O",
        "formula": "C19H23NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "313.3915",
        "optical_activity": "NONE",
        "references": [
          "b3839a1c-1a73-4577-956a-c85402632a5a",
          "5bace217-c98c-4996-ba01-0977732c8917",
          "ffd45b1e-8887-4667-8959-5c9045f2030b"
        ],
        "stereo_centers": 0
      },
      "unii": "65X88IL51X"
    }
  ]
}