{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0db0eef7-8e03-464d-b84e-d0630ffd5d82",
          "code": "769122-28-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=769122-28-3",
          "code_system": "CAS",
          "references": [
            "e096f2e4-e657-4b0a-bbd3-14e21ecdea24",
            "74c8bc34-6ab7-4182-8023-5dd60ebb0a13"
          ]
        },
        {
          "uuid": "bd12ba55-2c07-41cb-a575-038ca541d3cf",
          "code": "71587797",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587797",
          "code_system": "PUBCHEM",
          "references": [
            "e096f2e4-e657-4b0a-bbd3-14e21ecdea24"
          ]
        },
        {
          "uuid": "8619fab5-16c7-42de-a939-48aabadd3cf8",
          "code": "65S1E58YIB",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "38478646-c9a7-f45f-0c51-d467463db049",
          "code": "DTXSID70998203",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70998203",
          "code_system": "EPA CompTox",
          "references": [
            "2b99634b-7b49-5e38-8a84-5f92935ee33f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6015496f-f118-4e80-9bf0-891b8a677746",
          "name": "(±)-DIMETHOXYPHENYL PHENYLOXOETHYL ETHYLCARBONATE",
          "stdName": "(+/-)-DIMETHOXYPHENYL PHENYLOXOETHYL ETHYLCARBONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6248ef9-f4dd-4878-8c5b-515e86661ab4",
            "b79477d4-d4c0-4f17-9cca-85987ab93686"
          ],
          "display_name": false
        },
        {
          "uuid": "dd4a2348-09a6-4d32-a827-9862f65901af",
          "name": "DIMETHOXYPHENYL PHENYLOXOETHYL ETHYLCARBONATE",
          "stdName": "DIMETHOXYPHENYL PHENYLOXOETHYL ETHYLCARBONATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "402412ac-5331-45b1-a2b8-31a1239320c3",
            "372b8907-7a45-4a2b-8fc6-9f9d77fccc0b",
            "a6248ef9-f4dd-4878-8c5b-515e86661ab4"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "26be5c20-7dfe-41e3-9b47-480303c2505b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "bb611712-7bf8-4a36-8acd-9a73d08ae8aa",
          "name": "PHODERMA A",
          "stdName": "PHODERMA A",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "372b8907-7a45-4a2b-8fc6-9f9d77fccc0b",
            "a6248ef9-f4dd-4878-8c5b-515e86661ab4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "372b8907-7a45-4a2b-8fc6-9f9d77fccc0b",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a6248ef9-f4dd-4878-8c5b-515e86661ab4",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b79477d4-d4c0-4f17-9cca-85987ab93686",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e096f2e4-e657-4b0a-bbd3-14e21ecdea24",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392041000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "650894de-33b8-4f79-8d6b-e71cc58ebdb8",
          "citation": "SRS import [65S1E58YIB]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=65S1E58YIB",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392041000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "567a253f-b363-4186-897c-13e17e7a455b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "402412ac-5331-45b1-a2b8-31a1239320c3",
          "citation": "DIMETHOXYPHENYL PHENYLOXOETHYL ETHYLCARBONATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "74c8bc34-6ab7-4182-8023-5dd60ebb0a13",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2b99634b-7b49-5e38-8a84-5f92935ee33f",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f7ecb755-1aed-4ff8-becd-16ffd2fe2514",
          "id": "f7ecb755-1aed-4ff8-becd-16ffd2fe2514",
          "molfile": "\n  Marvin  01132112512D          \n\n 25 26  0  0  0  0            999 V2000\n   11.6159   -3.6982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9012   -4.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1866   -3.6982    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4720   -4.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4720   -4.9350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7574   -3.6982    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0428   -4.1105    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.3282   -3.6982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3282   -2.8736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6135   -4.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6135   -4.9350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8989   -5.3473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1843   -4.9350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1843   -4.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8989   -3.6982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0428   -4.9350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3282   -5.3473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3282   -6.1719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6135   -6.5842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8989   -6.1719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0428   -6.5842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7574   -6.1719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4720   -6.5842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1866   -6.1719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7574   -5.3473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 16  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 15  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 25  2  0  0  0  0\n 18 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 21 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 22 23  1  0  0  0  0\n 25 22  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)OC(c1cc(cc(c1)OC)OC)C(=O)c2ccccc2",
          "formula": "C19H20O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8fb047ed-87e0-4eaf-ac08-fda52188867c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "344.3592",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1479d5b3-ceb5-4a19-958b-53b1ba8a1960",
      "version": "6",
      "structure": {
        "id": "8dcd1885-0652-4e85-91d9-dce4df401c4d",
        "molfile": "\n  Marvin  01132107212D          \n\n 25 26  0  0  0  0            999 V2000\n    9.4720   -4.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7574   -3.6982    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0428   -4.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3282   -3.6982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6135   -4.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6135   -4.9350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8989   -5.3473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1843   -4.9350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1843   -4.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8989   -3.6982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3282   -2.8736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0428   -4.9350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7574   -5.3473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7574   -6.1719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0428   -6.5842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3282   -6.1719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3282   -5.3473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6135   -6.5842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8989   -6.1719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4720   -6.5842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1866   -6.1719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4720   -4.9350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1866   -3.6982    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9012   -4.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6159   -3.6982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  5 10  2  0  0  0  0\n  4 11  2  0  0  0  0\n  3 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 12 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 14 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n  1 22  2  0  0  0  0\n  1 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)OC(c1cc(cc(c1)OC)OC)C(=O)c2ccccc2",
        "formula": "C19H20O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "344.3592",
        "optical_activity": "( + / - )",
        "references": [
          "567a253f-b363-4186-897c-13e17e7a455b",
          "650894de-33b8-4f79-8d6b-e71cc58ebdb8"
        ],
        "stereo_centers": 1
      },
      "unii": "65S1E58YIB"
    }
  ]
}