{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e8f48803-f057-4952-b60a-a46ead9d02ab",
          "code": "1119807-02-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1119807-02-1",
          "code_system": "CAS",
          "references": [
            "a27d7376-4b17-4323-9696-5d26a73b7f6f",
            "8605cd7c-30f2-45c1-90d9-53ff77532b66"
          ]
        },
        {
          "uuid": "0c23742b-afc7-4301-b379-b06fb08b3f19",
          "code": "53342708",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/53342708",
          "code_system": "PUBCHEM",
          "references": [
            "a27d7376-4b17-4323-9696-5d26a73b7f6f"
          ]
        },
        {
          "uuid": "d7828ab1-8bc2-4777-8cde-6b1e6d9f41fd",
          "code": "6553U4VG91",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "8d70bce4-6410-43e0-8187-0eeca1ef128a",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "6c5bb950-d7a2-4ffb-9879-4973d19c422e",
            "refuuid": "8506f88f-44a2-443c-b610-55155e934f31",
            "name": "AZD-5213",
            "unii": "6553U4VG91",
            "linking_id": "6553U4VG91",
            "ref_pname": "AZD-5213",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6994bae4-7144-445e-8fd0-b48f701465ee",
          "name": "4-((1S,2S)-2-(4-CYCLOBUTYLPIPERAZINE-1-CARBONYL)CYCLOPROPYL)BENZAMIDE",
          "stdName": "4-((1S,2S)-2-(4-CYCLOBUTYLPIPERAZINE-1-CARBONYL)CYCLOPROPYL)BENZAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba0ef692-f0bb-4c60-b6c2-ef077256932a"
          ],
          "display_name": false
        },
        {
          "uuid": "fb1e2205-6fc2-da38-e6cb-712b421b4976",
          "name": "AZD 5213 [WHO-DD]",
          "stdName": "AZD 5213 [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "adb020fe-dfba-f90a-0c49-2a3398e0a38d"
          ],
          "display_name": false
        },
        {
          "uuid": "82ecba6d-83d0-474a-827f-9377d8ba3863",
          "name": "AZD-5213",
          "stdName": "AZD-5213",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46544918-dc9b-4db7-93d3-aaeef4768eb9"
          ],
          "display_name": true
        },
        {
          "uuid": "8b83bcaf-24cc-4266-9afc-a32fad5bbb3f",
          "name": "AZI",
          "stdName": "AZI",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba0ef692-f0bb-4c60-b6c2-ef077256932a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "46544918-dc9b-4db7-93d3-aaeef4768eb9",
          "citation": "Pharm Res, 31, 489-99 (2014)",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ba0ef692-f0bb-4c60-b6c2-ef077256932a",
          "citation": "http://link.springer.com/article/10.1007/s11095-013-1177-2",
          "url": "http://link.springer.com/article/10.1007/s11095-013-1177-2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a27d7376-4b17-4323-9696-5d26a73b7f6f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391941000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98484677-4342-4f99-b84b-33c2e32d6553",
          "citation": "SRS import [6553U4VG91]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6553U4VG91",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391941000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "adb020fe-dfba-f90a-0c49-2a3398e0a38d",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8605cd7c-30f2-45c1-90d9-53ff77532b66",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "76e833e9-461e-4238-870c-e53fbcab23ba",
          "id": "76e833e9-461e-4238-870c-e53fbcab23ba",
          "molfile": "\n  Marvin  01132106112D          \n\n 24 27  0  0  1  0            999 V2000\n    7.2317   -6.3008    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.6436   -7.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0554   -6.3008    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.7703   -5.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4851   -6.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1999   -5.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1999   -5.0606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4851   -4.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7703   -5.0606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9101   -4.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6250   -5.0606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9101   -3.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5168   -5.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5168   -5.0606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8020   -6.3008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8020   -7.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0872   -7.5364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3723   -7.1244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3723   -6.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0872   -5.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6622   -7.5364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4481   -8.3335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6510   -8.1195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8651   -7.3224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1 13  1  6  0  0  0\n  3  2  1  1  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  9  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n 10  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 20  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 21  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 24  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "C1CC(C1)N2CCN(CC2)C(=O)[C@H]3C[C@@H]3c4ccc(cc4)C(=O)N",
          "formula": "C19H25N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8edcfe13-c910-4258-81c0-a7d8634208b2"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "327.4214",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8506f88f-44a2-443c-b610-55155e934f31",
      "version": "5",
      "structure": {
        "id": "6b1d4f35-3252-4774-960c-e1e464c84c7c",
        "molfile": "\n  Marvin  01132105342D          \n\n 24 27  0  0  1  0            999 V2000\n   10.9101   -4.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1999   -5.0606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1999   -5.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4851   -6.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7703   -5.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7703   -5.0606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4851   -4.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0554   -6.3008    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.2317   -6.3008    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.6436   -7.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5168   -5.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5168   -5.0606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8020   -6.3008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8020   -7.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0872   -7.5364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3723   -7.1244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3723   -6.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0872   -5.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6622   -7.5364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4481   -8.3335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6510   -8.1195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8651   -7.3224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9101   -3.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6250   -5.0606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  2  7  2  0  0  0  0\n  8  5  1  1  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9 11  1  6  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 13 18  1  0  0  0  0\n 16 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 19 22  1  0  0  0  0\n  1 23  2  0  0  0  0\n  1 24  1  0  0  0  0\nM  END",
        "smiles": "C1CC(C1)N2CCN(CC2)C(=O)[C@H]3C[C@@H]3c4ccc(cc4)C(=O)N",
        "formula": "C19H25N3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "327.4214",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "98484677-4342-4f99-b84b-33c2e32d6553",
          "46544918-dc9b-4db7-93d3-aaeef4768eb9"
        ],
        "stereo_centers": 2
      },
      "unii": "6553U4VG91"
    }
  ]
}