{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "aced9624-e665-40d1-8afd-9091489bf3f2",
          "code": "5590-18-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5590-18-1",
          "code_system": "CAS",
          "references": [
            "bbccf4a6-9a61-4523-8c0d-0773a005f5ba",
            "dd561a5d-b7ec-4b39-8d3d-503cc5f067f0"
          ]
        },
        {
          "uuid": "0e16a60b-b006-4154-973d-e65d88fa25a2",
          "code": "226-999-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.024.545",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "bbccf4a6-9a61-4523-8c0d-0773a005f5ba"
          ]
        },
        {
          "uuid": "2d39474a-2dc1-6aef-3a29-c556b5519a63",
          "code": "DTXSID4052219",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4052219",
          "code_system": "EPA CompTox",
          "references": [
            "976edd51-deea-0eea-2177-5f0c07cea94c"
          ]
        },
        {
          "uuid": "d17de860-5190-bc06-f603-6e76c99fafe4",
          "code": "135481899",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135481899",
          "code_system": "PUBCHEM",
          "references": [
            "cbc206ed-593d-2d05-285b-e2bbfadd004b"
          ]
        },
        {
          "uuid": "fe54fbfd-e884-4bdf-b20f-3a790daab29b",
          "code": "64U4JIR8EM",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "07ac5da6-ef3e-483c-8c47-57d05076beb2",
          "name": "3,3'-(1,4-PHENYLENEDIIMINO)BIS(4,5,6,7-TETRACHLORO-1H-ISOINDOL-1-ONE",
          "stdName": "3,3'-(1,4-PHENYLENEDIIMINO)BIS(4,5,6,7-TETRACHLORO-1H-ISOINDOL-1-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3612d939-0876-487a-98cc-5dac688b62c5",
            "7ae5799f-b304-4448-a486-297edf9dea32"
          ],
          "display_name": false
        },
        {
          "uuid": "c50ee7ff-68c6-466f-9090-bfb6a003c9dd",
          "name": "BIS(4,5,6,7-TETRACHLORO-3-OXOISOINDOLIN-1-YLIDENE)-1,4-PHENYLENEDIAMINE",
          "stdName": "BIS(4,5,6,7-TETRACHLORO-3-OXOISOINDOLIN-1-YLIDENE)-1,4-PHENYLENEDIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3612d939-0876-487a-98cc-5dac688b62c5",
            "7ae5799f-b304-4448-a486-297edf9dea32"
          ],
          "display_name": false
        },
        {
          "uuid": "1a3b693f-7447-4f4c-961f-a06133a072b6",
          "name": "C.I. 56280",
          "stdName": "C.I. 56280",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3612d939-0876-487a-98cc-5dac688b62c5",
            "7ae5799f-b304-4448-a486-297edf9dea32"
          ],
          "display_name": false
        },
        {
          "uuid": "1cdc5413-f8ad-4d19-99ea-dec7c4e2a38e",
          "name": "C.I. PIGMENT YELLOW 110",
          "stdName": "C.I. PIGMENT YELLOW 110",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43a6b3fa-71b9-479c-afee-44ded196a9ad"
          ],
          "display_name": false
        },
        {
          "uuid": "449baac2-bcda-4296-b6d1-535d6db81817",
          "name": "C.I. PIGMENT YELLOW 137",
          "stdName": "C.I. PIGMENT YELLOW 137",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3612d939-0876-487a-98cc-5dac688b62c5",
            "7ae5799f-b304-4448-a486-297edf9dea32"
          ],
          "display_name": false
        },
        {
          "uuid": "8118cbda-a49e-4cd0-bdb8-bbcf0c157a93",
          "name": "CI 56280",
          "stdName": "CI 56280",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4aafeba-f959-47bb-9018-02c915b46ec9",
            "7ae5799f-b304-4448-a486-297edf9dea32"
          ],
          "display_name": false
        },
        {
          "uuid": "925eff45-2251-4979-93e7-60e7d956ed0a",
          "name": "ISOINDOLINONE YELLOW 3R",
          "stdName": "ISOINDOLINONE YELLOW 3R",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ae5799f-b304-4448-a486-297edf9dea32",
            "22745b32-53c7-4cb2-9baf-0271f6fcf6e1"
          ],
          "display_name": false
        },
        {
          "uuid": "258777f6-02fd-4d4b-b3a9-9aa6d982f0c5",
          "name": "MBR 443",
          "stdName": "MBR 443",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ae5799f-b304-4448-a486-297edf9dea32",
            "22745b32-53c7-4cb2-9baf-0271f6fcf6e1"
          ],
          "display_name": false
        },
        {
          "uuid": "9811dd42-abcd-4b32-91fa-579dcc9ed2c8",
          "name": "PIGMENT YELLOW 110",
          "stdName": "PIGMENT YELLOW 110",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ae5799f-b304-4448-a486-297edf9dea32",
            "22745b32-53c7-4cb2-9baf-0271f6fcf6e1"
          ],
          "display_name": true
        },
        {
          "uuid": "c27f0b04-9358-4928-b529-1bb9236b2897",
          "name": "TETRACHLOROISOINDOLINONE YELLOW 2RLTS",
          "stdName": "TETRACHLOROISOINDOLINONE YELLOW 2RLTS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95f06f61-b6b3-4b73-a09e-9d9d4115009c",
            "7ae5799f-b304-4448-a486-297edf9dea32"
          ],
          "display_name": false
        },
        {
          "uuid": "a71a573f-7566-4903-a6d3-3c8a74ef9701",
          "name": "YELLOW 2RLP",
          "stdName": "YELLOW 2RLP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ae5799f-b304-4448-a486-297edf9dea32",
            "22745b32-53c7-4cb2-9baf-0271f6fcf6e1"
          ],
          "display_name": false
        },
        {
          "uuid": "23c8a3a9-08fb-4980-ba97-c02e9ee7fe92",
          "name": "YELLOW 2RLT",
          "stdName": "YELLOW 2RLT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ae5799f-b304-4448-a486-297edf9dea32",
            "22745b32-53c7-4cb2-9baf-0271f6fcf6e1"
          ],
          "display_name": false
        },
        {
          "uuid": "10a53a10-3d1c-4b44-8751-a646afc75c37",
          "name": "YELLOW 3RLT",
          "stdName": "YELLOW 3RLT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ae5799f-b304-4448-a486-297edf9dea32",
            "22745b32-53c7-4cb2-9baf-0271f6fcf6e1"
          ],
          "display_name": false
        },
        {
          "uuid": "fe9fd447-170d-41e2-a017-644cdc61ad98",
          "name": "YELLOW E 2RL",
          "stdName": "YELLOW E 2RL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ae5799f-b304-4448-a486-297edf9dea32",
            "22745b32-53c7-4cb2-9baf-0271f6fcf6e1"
          ],
          "display_name": false
        },
        {
          "uuid": "4e6cc7d4-5b8b-4bb1-b7c3-d50a07e9e5e4",
          "name": "YELLOW E 3RL",
          "stdName": "YELLOW E 3RL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ae5799f-b304-4448-a486-297edf9dea32",
            "22745b32-53c7-4cb2-9baf-0271f6fcf6e1"
          ],
          "display_name": false
        },
        {
          "uuid": "dcf9ec29-2d6a-4edf-bd0b-eb026348a90d",
          "name": "YELLOW RLT",
          "stdName": "YELLOW RLT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3612d939-0876-487a-98cc-5dac688b62c5",
            "7ae5799f-b304-4448-a486-297edf9dea32"
          ],
          "display_name": false
        },
        {
          "uuid": "30a75ffb-2993-4b89-9cab-87f0612533e7",
          "name": "YELLOW RX",
          "stdName": "YELLOW RX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ae5799f-b304-4448-a486-297edf9dea32",
            "22745b32-53c7-4cb2-9baf-0271f6fcf6e1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "43a6b3fa-71b9-479c-afee-44ded196a9ad",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3612d939-0876-487a-98cc-5dac688b62c5",
          "citation": "http://www.chemblink.com/products/5590-18-1.htm",
          "url": "http://www.chemblink.com/products/5590-18-1.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ae5799f-b304-4448-a486-297edf9dea32",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22745b32-53c7-4cb2-9baf-0271f6fcf6e1",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4aafeba-f959-47bb-9018-02c915b46ec9",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95f06f61-b6b3-4b73-a09e-9d9d4115009c",
          "citation": "SC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bbccf4a6-9a61-4523-8c0d-0773a005f5ba",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391007000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "386a1893-9573-47ea-b2d8-37d78cdead6b",
          "citation": "SRS import [64U4JIR8EM]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=64U4JIR8EM",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391007000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "676470f2-1fb2-4a87-b08a-2d5cbb1641a6",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "976edd51-deea-0eea-2177-5f0c07cea94c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5590-18-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dd561a5d-b7ec-4b39-8d3d-503cc5f067f0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "cbc206ed-593d-2d05-285b-e2bbfadd004b",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "dd76ac3d-aa38-4012-8c9e-7abae6be0e24",
          "id": "dd76ac3d-aa38-4012-8c9e-7abae6be0e24",
          "molfile": "\n  Marvin  01132111292D          \n\n 36 40  0  0  0  0            999 V2000\n    7.0133   -2.7591    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.6778   -2.0055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8573   -1.9192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2442   -2.4712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3305   -3.2917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5297   -2.0588    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7013   -1.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1492   -0.6387    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3423   -0.8102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0873   -1.5949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2804   -1.7664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7283   -1.1533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9214   -1.3248    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6664   -2.1094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1513   -2.7769    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6664   -3.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9214   -4.2289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1182   -3.1893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1182   -2.3643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8327   -1.9519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8327   -1.1269    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5471   -2.3643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2616   -1.9519    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5471   -3.1893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2616   -3.6019    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8327   -3.6019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8327   -4.4269    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.9833   -0.3687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7902   -0.1971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5217   -1.1655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0066   -0.4981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6711    0.2555    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.8271   -0.5843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3121    0.0831    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.1627   -1.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9831   -1.4242    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 35  2  0  0  0  0\n  4  3  1  0  0  0  0\n 30  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n 30  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 29  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 28 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  2  0  0  0  0\n 14 19  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 16  1  0  0  0  0\n 18 19  1  0  0  0  0\n 26 18  2  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 29 28  1  0  0  0  0\n 31 30  1  0  0  0  0\n 31 32  1  0  0  0  0\n 33 31  2  0  0  0  0\n 33 34  1  0  0  0  0\n 35 33  1  0  0  0  0\n 35 36  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1NC2=NC(=O)c3c2c(c(c(c3Cl)Cl)Cl)Cl)NC4=NC(=O)c5c4c(c(c(c5Cl)Cl)Cl)Cl",
          "formula": "C22H6Cl8N4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1d9b82c2-38c0-4e55-8cda-ea79ac5ca153"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "641.933",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a93854fc-450a-4ecd-9bca-1982cc091e50",
      "version": "7",
      "structure": {
        "id": "2fd42a02-059f-4688-aa52-1ee99bc3be0f",
        "molfile": "\n  Marvin  01132102342D          \n\n 36 40  0  0  0  0            999 V2000\n    4.7013   -1.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5217   -1.1655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0066   -0.4981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8271   -0.5843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1627   -1.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9831   -1.4242    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.6778   -2.0055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0133   -2.7591    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.8573   -1.9192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2442   -2.4712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3305   -3.2917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5297   -2.0588    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3121    0.0831    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.6711    0.2555    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.1492   -0.6387    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3423   -0.8102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0873   -1.5949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2804   -1.7664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7283   -1.1533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9833   -0.3687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7902   -0.1971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9214   -1.3248    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6664   -2.1094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1513   -2.7769    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6664   -3.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1182   -3.1893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1182   -2.3643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8327   -1.9519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5471   -2.3643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5471   -3.1893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8327   -3.6019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8327   -4.4269    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2616   -3.6019    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2616   -1.9519    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8327   -1.1269    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.9214   -4.2289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n  1 12  2  0  0  0  0\n  2  9  2  0  0  0  0\n  4 13  1  0  0  0  0\n  3 14  1  0  0  0  0\n 15  1  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 16 21  2  0  0  0  0\n 19 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  2  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  2  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  2  0  0  0  0\n 31 26  1  0  0  0  0\n 31 32  1  0  0  0  0\n 30 33  1  0  0  0  0\n 29 34  1  0  0  0  0\n 28 35  1  0  0  0  0\n 23 27  1  0  0  0  0\n 25 36  2  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1NC2=NC(=O)c3c2c(c(c(c3Cl)Cl)Cl)Cl)NC4=NC(=O)c5c4c(c(c(c5Cl)Cl)Cl)Cl",
        "formula": "C22H6Cl8N4O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "641.933",
        "optical_activity": "NONE",
        "references": [
          "676470f2-1fb2-4a87-b08a-2d5cbb1641a6",
          "386a1893-9573-47ea-b2d8-37d78cdead6b"
        ],
        "stereo_centers": 0
      },
      "unii": "64U4JIR8EM"
    }
  ]
}