{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "82daf017-04c5-4133-8001-d87b0fb157cf",
          "code": "83881-52-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=83881-52-1",
          "code_system": "CAS",
          "references": [
            "e6c6a954-ed74-443b-9208-31f9c4326735",
            "4ae1381c-b54a-4f54-b741-6dfdd962c166"
          ]
        },
        {
          "uuid": "a12401e2-a3dc-45d6-816a-bb9a7e8bd930",
          "code": "C28920",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28920",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e6c6a954-ed74-443b-9208-31f9c4326735"
          ]
        },
        {
          "uuid": "0aa84276-1c5c-49e3-8ae9-a4f32728e7c4",
          "code": "203150",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/203150/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e6c6a954-ed74-443b-9208-31f9c4326735"
          ]
        },
        {
          "uuid": "7ba81fc5-35a6-4870-b7ff-d537bc12b1db",
          "code": "m3291",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3291?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e6c6a954-ed74-443b-9208-31f9c4326735"
          ]
        },
        {
          "uuid": "0bfc1089-5bdd-4217-993e-c1c5f8c5508d",
          "code": "SUB11803MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e6c6a954-ed74-443b-9208-31f9c4326735"
          ]
        },
        {
          "uuid": "fe8b8635-0d9f-410c-b523-525042ada009",
          "code": "CHEMBL1000",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1000",
          "code_system": "ChEMBL",
          "references": [
            "e6c6a954-ed74-443b-9208-31f9c4326735"
          ]
        },
        {
          "uuid": "21104546-f407-4d6c-d5ed-1a71f41373dc",
          "code": "DTXSID2044268",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2044268",
          "code_system": "EPA CompTox",
          "references": [
            "fc681300-b748-cc87-d30e-90343d0ec992"
          ]
        },
        {
          "uuid": "79ae0cbc-e85c-da08-8cb6-8d563a0d6cd4",
          "code": "C29578",
          "comments": "Pharmacologic Substance[C1909]|Immunotherapeutic Agent[C308]|Histamine-1 Receptor Antagonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29578",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7a5590a3-24a5-5aea-6341-92ceaa39f70f"
          ]
        },
        {
          "uuid": "b4e0d356-a5df-1a03-74ea-fe54fb7d231e",
          "code": "55182",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/55182",
          "code_system": "PUBCHEM",
          "references": [
            "e5025651-a334-6823-450d-87b8d452fcaf"
          ]
        },
        {
          "uuid": "b7cae27c-18dd-4b50-95bc-490ed03cd58c",
          "code": "64O047KTOA",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f5b1ef3d-c78f-77f7-aa0b-e68c626f5b70",
          "code": "DBSALT001214",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DBSALT001214",
          "code_system": "DRUG BANK",
          "references": [
            "7a5590a3-24a5-5aea-6341-92ceaa39f70f"
          ]
        },
        {
          "uuid": "2e0af1c8-c46c-b216-6309-9fb0b91fc305",
          "code": "1102929",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1102929",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "7a5590a3-24a5-5aea-6341-92ceaa39f70f"
          ]
        },
        {
          "uuid": "4468d1e8-bc62-c22d-fd3c-6608fbd7c472",
          "code": "100000091468",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "27b20aa5-5803-9f36-3bfd-7f4e8f7857fd"
          ]
        },
        {
          "uuid": "6831e8c0-13d9-4981-b050-d4323aac5c82",
          "code": "X-17",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/X-17/relevant/1/",
          "code_system": "USAN",
          "references": [
            "ce53222d-ce29-eaa5-6e04-3aae992d24c1"
          ]
        },
        {
          "uuid": "0eba28c5-69ad-a91d-08a5-03883d36d2e3",
          "code": "64O047KTOA",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=64O047KTOA",
          "code_system": "DAILYMED",
          "references": [
            "57cbfb7b-3bee-a600-89d9-ff705fb1a4ae"
          ]
        },
        {
          "uuid": "f83a1afc-4462-6242-b8d7-39ac4b53d562",
          "code": "759102",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759102",
          "code_system": "NSC",
          "references": [
            "56fbc0f4-b0b2-8935-3cb7-17db9b3ae7e6"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f8a66bf7-82dd-43be-9852-22caf6312de7",
          "amount": {
            "uuid": "56f24099-fb39-4929-9aa1-19e6a3f4fc01"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ac898ee0-1edc-41c7-b243-c465a5dbbd4a",
            "refuuid": "ea63ab44-6e32-4768-abef-1cf36299ab68",
            "name": "CETIRIZINE",
            "unii": "YO7261ME24",
            "linking_id": "YO7261ME24",
            "ref_pname": "CETIRIZINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9c70b283-1365-47e8-9ac9-60417a06a269",
          "amount": {
            "uuid": "14928b34-5449-4465-9ca0-b05a370cc5d1"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "839fbb70-3ed0-4527-87d6-bd386a8dd569",
            "refuuid": "ea63ab44-6e32-4768-abef-1cf36299ab68",
            "name": "CETIRIZINE",
            "unii": "YO7261ME24",
            "linking_id": "YO7261ME24",
            "ref_pname": "CETIRIZINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "eb1fe23a-40b4-49d6-887e-c5724470d411",
          "amount": {
            "uuid": "8280bf97-88d3-44c1-a3c8-c1103bef6a98",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.15
          },
          "comments": "For the calculation of content, multiply the peak areas by 1.3",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "a0643cd6-e811-48f1-b1ee-b64c6766f465"
          ],
          "related_substance": {
            "uuid": "706b6b78-e68a-45b9-89aa-e09ce0a5c470",
            "refuuid": "ab8ffc0a-3e0e-493b-92ef-911e5a7049b4",
            "name": "2-[2-[2-[4-[(4-Chlorophenyl)phenylmethyl]-1-piperazinyl]ethoxy]ethoxy]acetic acid",
            "unii": "S9EW59C6GN",
            "linking_id": "S9EW59C6GN",
            "ref_pname": "2-[2-[2-[4-[(4-Chlorophenyl)phenylmethyl]-1-piperazinyl]ethoxy]ethoxy]acetic acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d3156c94-362c-44af-9140-8a85ff43b045",
          "amount": {
            "uuid": "5e2b40ba-23e3-4d7c-8b3a-4b3bc875c403",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.15
          },
          "comments": "For the calculation of content, multiply the peak areas by 1.9",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "a0643cd6-e811-48f1-b1ee-b64c6766f465"
          ],
          "related_substance": {
            "uuid": "b2d996cd-e75c-47b8-a238-35fba7a3034a",
            "refuuid": "66e4d9e2-2587-410f-b537-80407b1623c2",
            "name": "DESCHLOROCETIRIZINE",
            "unii": "VL4BXF63VB",
            "linking_id": "VL4BXF63VB",
            "ref_pname": "DESCHLOROCETIRIZINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4f03e7a4-0390-4d22-9a38-b074997a0425",
          "amount": {
            "uuid": "8215d696-68a3-47b9-9d05-57d27aacd0ec",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "7e942e53-799c-4027-a693-1a4fa3490a50"
          ],
          "related_substance": {
            "uuid": "05024ac2-ed49-4a74-8215-68990196a541",
            "refuuid": "66e4d9e2-2587-410f-b537-80407b1623c2",
            "name": "DESCHLOROCETIRIZINE",
            "unii": "VL4BXF63VB",
            "linking_id": "VL4BXF63VB",
            "ref_pname": "DESCHLOROCETIRIZINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "939f4c6c-c7a4-40c4-a229-201dc4211125",
          "amount": {
            "uuid": "bb1c0f67-13d3-4184-8dcb-6752882ddc6d",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "7e942e53-799c-4027-a693-1a4fa3490a50"
          ],
          "related_substance": {
            "uuid": "bc6112dd-bcb8-440f-b23f-6b9867b52647",
            "refuuid": "3dbe521b-0cc8-4b41-a3b1-e576a694baea",
            "name": "4-((4-CHLOROPHENYL)PHENYLMETHYL)-1-PIPERAZINEETHANOL",
            "unii": "PGV947X9B1",
            "linking_id": "PGV947X9B1",
            "ref_pname": "4-((4-CHLOROPHENYL)PHENYLMETHYL)-1-PIPERAZINEETHANOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "29ad5949-19f1-4e6d-895a-f50a68ff8a1e",
          "amount": {
            "uuid": "f0780fe9-dc00-42d9-bbf8-0245965ffa7a",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "7e942e53-799c-4027-a693-1a4fa3490a50"
          ],
          "related_substance": {
            "uuid": "443bbef8-d298-4333-989d-d0ca71cc62c9",
            "refuuid": "312f9252-e9af-4095-a6c1-78c7c762f6db",
            "name": "CETIRIZINE METHYL ESTER",
            "unii": "3IBM2U5K9C",
            "linking_id": "3IBM2U5K9C",
            "ref_pname": "CETIRIZINE METHYL ESTER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ac95070a-b782-4707-ad0a-dc06274e82aa",
          "amount": {
            "uuid": "ea693607-1a6d-49b5-b0c7-daaa9cbbead1",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "7e942e53-799c-4027-a693-1a4fa3490a50"
          ],
          "related_substance": {
            "uuid": "566b5671-d069-4980-a482-3853cc58187e",
            "refuuid": "3b432d4a-868b-4d61-9d79-122b73efbc32",
            "name": "CETIRIZINE N-OXIDE",
            "unii": "GU9Z3NRN9V",
            "linking_id": "GU9Z3NRN9V",
            "ref_pname": "CETIRIZINE N-OXIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "effd3149-5000-4b73-a873-81b16ee3c34d",
          "amount": {
            "uuid": "ea1a4cdc-153b-4ec2-8089-d3e6c1d88f99",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "7e942e53-799c-4027-a693-1a4fa3490a50"
          ],
          "related_substance": {
            "uuid": "4752b9f4-9cc9-430e-8a4a-f5de22ee926e",
            "refuuid": "82d21fdd-2c7c-4e2b-bd68-73e235c722e5",
            "name": "4-CHLOROBENZHYDROL",
            "unii": "V5V8VYQ65X",
            "linking_id": "V5V8VYQ65X",
            "ref_pname": "4-CHLOROBENZHYDROL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3369652d-d43e-4209-b34b-e36882c5459a",
          "amount": {
            "uuid": "422996e0-0f42-4ebe-8fec-e4fb71b5ade9",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "7e942e53-799c-4027-a693-1a4fa3490a50"
          ],
          "related_substance": {
            "uuid": "73939e06-6372-4a74-8049-c98e6565e766",
            "refuuid": "90195975-6245-4e39-8b48-946a14dbd598",
            "name": "4-CHLOROBENZOPHENONE",
            "unii": "WIH1IZ728U",
            "linking_id": "WIH1IZ728U",
            "ref_pname": "4-CHLOROBENZOPHENONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e44dfdae-5724-4dae-92a6-f7d93eeda0dc",
          "amount": {
            "uuid": "37fd5033-2655-4827-9431-bd69803628a1",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 102,
            "low_limit": 98
          },
          "qualification": "USP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (HPLC)",
          "references": [
            "7e942e53-799c-4027-a693-1a4fa3490a50"
          ],
          "related_substance": {
            "uuid": "ec700c14-5418-4c75-92b3-36b06d30b004",
            "refuuid": "58aa462d-af3a-41ac-9b3d-1963efb81bd1",
            "name": "Cetirizine hydrochloride",
            "unii": "64O047KTOA",
            "linking_id": "64O047KTOA",
            "ref_pname": "Cetirizine hydrochloride",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9cfa5228-0cbe-48bd-ab79-1b9485d4a48c",
          "amount": {
            "uuid": "5ee90431-a5b7-476d-a7d2-9b368f653715",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.15
          },
          "comments": "For the calculation of content, multiply the peak areas by 0.7",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "a0643cd6-e811-48f1-b1ee-b64c6766f465"
          ],
          "related_substance": {
            "uuid": "cbf20f93-cf4b-4b95-a6f1-f835b2ef32b0",
            "refuuid": "3461b82a-552c-4eed-b79f-ad21660dbf9f",
            "name": "NORCHLORCYCLIZINE",
            "unii": "T875VN0D6E",
            "linking_id": "T875VN0D6E",
            "ref_pname": "NORCHLORCYCLIZINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "cd92c7ca-8627-4346-9eb1-62f801fa9d58",
          "amount": {
            "uuid": "7ea88b7f-a004-492c-b296-252e46602f97",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "7e942e53-799c-4027-a693-1a4fa3490a50"
          ],
          "related_substance": {
            "uuid": "75d3087a-0de5-4dce-8f4e-849f9715a7d7",
            "refuuid": "3461b82a-552c-4eed-b79f-ad21660dbf9f",
            "name": "NORCHLORCYCLIZINE",
            "unii": "T875VN0D6E",
            "linking_id": "T875VN0D6E",
            "ref_pname": "NORCHLORCYCLIZINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "cb1dc5bb-cc2c-4062-bd90-4934601a2c86",
          "amount": {
            "uuid": "4f2bb386-e4bb-4fdd-aa3b-ebc64811b6b4",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.15
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "a0643cd6-e811-48f1-b1ee-b64c6766f465"
          ],
          "related_substance": {
            "uuid": "f7c7d17a-faec-4f42-b313-326d728a561c",
            "refuuid": "a98924b8-b2ca-4fc1-ae83-92e21f30e217",
            "name": "DE(CARBOXYMETHOXY) CETIRIZINE ACETIC ACID",
            "unii": "8AO4AEB0V4",
            "linking_id": "8AO4AEB0V4",
            "ref_pname": "DE(CARBOXYMETHOXY) CETIRIZINE ACETIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c628b1e8-26f0-499a-8fa4-83e274cd9981",
          "amount": {
            "uuid": "41b53f4f-4a91-4ac1-a553-985232ed2ebd",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "7e942e53-799c-4027-a693-1a4fa3490a50"
          ],
          "related_substance": {
            "uuid": "39f520e1-ea14-48e8-91ab-bf8c197a6a8e",
            "refuuid": "a98924b8-b2ca-4fc1-ae83-92e21f30e217",
            "name": "DE(CARBOXYMETHOXY) CETIRIZINE ACETIC ACID",
            "unii": "8AO4AEB0V4",
            "linking_id": "8AO4AEB0V4",
            "ref_pname": "DE(CARBOXYMETHOXY) CETIRIZINE ACETIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7c71e1fd-022a-4dc1-a618-d47172d5729f",
          "amount": {
            "uuid": "3bac7554-668c-490f-a58a-1978f268e582",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.15
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "a0643cd6-e811-48f1-b1ee-b64c6766f465"
          ],
          "related_substance": {
            "uuid": "6c145b6e-178f-4631-9cf6-8d3f90390c4b",
            "refuuid": "71de049a-2987-4ae4-aae0-4734f0e35d78",
            "name": "2-CHLOROCETIRIZINE",
            "unii": "4DG59P89YF",
            "linking_id": "4DG59P89YF",
            "ref_pname": "2-CHLOROCETIRIZINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "37de3852-dc83-4bff-b4d9-6c80a5ae20b6",
          "amount": {
            "uuid": "99855ad3-c6f3-47ad-b8db-45a81d137331",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "7e942e53-799c-4027-a693-1a4fa3490a50"
          ],
          "related_substance": {
            "uuid": "7554c7fb-bc77-42e9-ae77-a60cc2bd5875",
            "refuuid": "71de049a-2987-4ae4-aae0-4734f0e35d78",
            "name": "2-CHLOROCETIRIZINE",
            "unii": "4DG59P89YF",
            "linking_id": "4DG59P89YF",
            "ref_pname": "2-CHLOROCETIRIZINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b65a3d81-792c-44ea-a431-dff11e4b0732",
          "amount": {
            "uuid": "3fc39d52-e170-480c-842e-3685c6ec5bc9",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.15
          },
          "comments": "For the calculation of content, multiply the peak areas by 0.6",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "a0643cd6-e811-48f1-b1ee-b64c6766f465"
          ],
          "related_substance": {
            "uuid": "6c2da562-6136-46a7-8541-258adb90ed13",
            "refuuid": "86c80aed-8170-4fab-9429-a5bd9b83b702",
            "name": "1,4-BIS((4-CHLOROPHENYL)PHENYLMETHYL)PIPERAZINE",
            "unii": "5K68SCT4TX",
            "linking_id": "5K68SCT4TX",
            "ref_pname": "1,4-BIS((4-CHLOROPHENYL)PHENYLMETHYL)PIPERAZINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "06fb89c9-8a24-4ea6-8ef9-01ee27f2441d",
          "amount": {
            "uuid": "9b8750c6-4d22-4f52-9125-87a151f13399",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "7e942e53-799c-4027-a693-1a4fa3490a50"
          ],
          "related_substance": {
            "uuid": "3b05f9e1-e372-475d-8ed0-c50320cdf9ca",
            "refuuid": "86c80aed-8170-4fab-9429-a5bd9b83b702",
            "name": "1,4-BIS((4-CHLOROPHENYL)PHENYLMETHYL)PIPERAZINE",
            "unii": "5K68SCT4TX",
            "linking_id": "5K68SCT4TX",
            "ref_pname": "1,4-BIS((4-CHLOROPHENYL)PHENYLMETHYL)PIPERAZINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4a181759-799b-4d1d-9b6b-a8136e0cbbbe",
          "name": "(±)-(2-(4-(P-Chloro-a-phenylbenzyl)-1-piperazinyl)ethoxy)acetic acid, dihydrochloride",
          "stdName": "(+/-)-(2-(4-(P-CHLORO-A-PHENYLBENZYL)-1-PIPERAZINYL)ETHOXY)ACETIC ACID, DIHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7333469b-7f05-4c90-a215-499b15e55619"
          ],
          "display_name": false
        },
        {
          "uuid": "a768ed88-0a46-4355-8f57-35e1aef9e3cf",
          "name": "2-(2-[4-[(4-Chlorophenyl)(phenyl)methyl]piperazin-1-yl]ethoxy)acetic acid dihydrochloride",
          "stdName": "2-(2-(4-((4-CHLOROPHENYL)(PHENYL)METHYL)PIPERAZIN-1-YL)ETHOXY)ACETIC ACID DIHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "252e4aca-4b44-422a-b1bb-9179c7897a3f"
          ],
          "display_name": false
        },
        {
          "uuid": "18e6d153-5047-4afd-af93-5482f27e9024",
          "name": "Acetic acid, [2-[4-[(4-chlorophenyl)phenylmethyl]-1-piperazinyl]ethoxy]-, dihydrochloride, (±)-",
          "stdName": "ACETIC ACID, (2-(4-((4-CHLOROPHENYL)PHENYLMETHYL)-1-PIPERAZINYL)ETHOXY)-, DIHYDROCHLORIDE, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7333469b-7f05-4c90-a215-499b15e55619"
          ],
          "display_name": false
        },
        {
          "uuid": "15d22820-dd61-40d4-8b6f-180ed147141f",
          "name": "Cetirizine HCL",
          "stdName": "CETIRIZINE HCL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "80a371d4-0ec1-4016-9a4e-4a9239dcbf4a"
          ],
          "display_name": false
        },
        {
          "uuid": "c1872c5c-f31d-4f2d-b96a-c60b50aa9166",
          "name": "Cetirizine dihydrochloride",
          "stdName": "CETIRIZINE DIHYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f98cf45-b7a4-4c7b-9fbb-81cd31765276",
            "99dcf325-5046-4a37-bd15-fe0ee4f2296f",
            "dfbf9806-ba61-43cb-88c6-4a91493fda17",
            "e01bd983-2f07-4b2d-b48a-12efa3fd1c1d",
            "15818d24-ccb6-40e5-8193-fc99a31f0a85",
            "edbcf172-d2b3-4b85-9eb1-57ceee2c1a16"
          ],
          "display_name": false
        },
        {
          "uuid": "1d339847-c583-e912-278b-5f91da4befd6",
          "name": "Cetirizine dihydrochloride [EP MONOGRAPH]",
          "stdName": "CETIRIZINE DIHYDROCHLORIDE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67629229-889b-756d-974a-a67d0d5796bd"
          ],
          "display_name": false
        },
        {
          "uuid": "9d7c4565-92e6-4eff-b25b-2def96980fb2",
          "name": "Cetirizine dihydrochloride [MI]",
          "stdName": "CETIRIZINE DIHYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99dcf325-5046-4a37-bd15-fe0ee4f2296f"
          ],
          "display_name": false
        },
        {
          "uuid": "ac452a24-ca68-4075-9bba-67e388258a13",
          "name": "Cetirizine hydrochloride",
          "stdName": "CETIRIZINE HYDROCHLORIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2eb26d67-c3a3-4fbf-ab56-f1682dd21ecd",
            "b0ec14cd-821c-4a72-839c-7331929cc8a6",
            "69df32bc-32e7-4345-a756-70c094b0188c",
            "95b23f9b-ec58-46dc-a0a7-30551dc4d414",
            "abca8b4f-a5b0-47f0-9876-dc3f88ee8a85",
            "7b310a35-d7e5-4931-9c7b-552c7aab94e2",
            "9d38d2b2-ef76-4b33-80ba-8574dad07293",
            "d4c63dcb-c4c3-4283-a12f-d11db6bb12fd",
            "2b1afc02-5b01-4a1f-bbe9-7af4811b1bd9",
            "e87dcf15-fd76-439d-9774-5682c4d03768",
            "e5410df9-3f3e-4290-941a-0347e04a03d5",
            "9205ada1-7029-402e-9e3d-00e5492c5943",
            "c66c0a2c-4ab7-4d54-bc9e-3c48c0c29959",
            "6f80634a-4cfd-4f76-a7e8-463f5619b511",
            "8ac70189-b28b-4c6f-9761-08979ff2214d",
            "6f1c5156-b4cd-4d59-a15f-47cef7ff689e",
            "426872e7-d0f0-41d2-88b5-2b2bac4c9da9"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "ff4a4693-fdab-4269-9f69-23b3d9bc27fb",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "a3174b39-1b00-4610-8ff1-e2f80fa2cf9b",
          "name": "Cetirizine hydrochloride [JAN]",
          "stdName": "CETIRIZINE HYDROCHLORIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0ec14cd-821c-4a72-839c-7331929cc8a6"
          ],
          "display_name": false
        },
        {
          "uuid": "a0b4e277-d625-4152-b548-48ad9e06df77",
          "name": "Cetirizine hydrochloride [MART.]",
          "stdName": "CETIRIZINE HYDROCHLORIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abca8b4f-a5b0-47f0-9876-dc3f88ee8a85"
          ],
          "display_name": false
        },
        {
          "uuid": "88083275-5960-415a-a870-cfa5e636b66d",
          "name": "Cetirizine hydrochloride [ORANGE BOOK]",
          "stdName": "CETIRIZINE HYDROCHLORIDE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b310a35-d7e5-4931-9c7b-552c7aab94e2"
          ],
          "display_name": false
        },
        {
          "uuid": "a8326d4c-ac8a-477b-9e07-e608f98aef3a",
          "name": "Cetirizine hydrochloride [USAN]",
          "stdName": "CETIRIZINE HYDROCHLORIDE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9205ada1-7029-402e-9e3d-00e5492c5943"
          ],
          "display_name": false
        },
        {
          "uuid": "097ef7ae-52aa-5ab9-728b-97b3d7f85893",
          "name": "Cetirizine hydrochloride [USP MONOGRAPH]",
          "stdName": "CETIRIZINE HYDROCHLORIDE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53c0fe4c-e8af-048f-ac49-f1adcb57a517"
          ],
          "display_name": false
        },
        {
          "uuid": "1ec999f2-941e-4ae1-a805-3a04714ff91c",
          "name": "Cetirizine hydrochloride [USP-RS]",
          "stdName": "CETIRIZINE HYDROCHLORIDE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e87dcf15-fd76-439d-9774-5682c4d03768"
          ],
          "display_name": false
        },
        {
          "uuid": "10d343e7-7dc6-4329-8415-73967170c219",
          "name": "Cetirizine hydrochloride [VANDF]",
          "stdName": "CETIRIZINE HYDROCHLORIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "426872e7-d0f0-41d2-88b5-2b2bac4c9da9"
          ],
          "display_name": false
        },
        {
          "uuid": "c33d65cf-7811-7592-7c39-a01abb2bb922",
          "name": "Cetirizine hydrochloride [WHO-DD]",
          "stdName": "CETIRIZINE HYDROCHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6887954-f687-83ce-6684-ce904d336238"
          ],
          "display_name": false
        },
        {
          "uuid": "9f377101-0aec-4e01-885c-56aaceda714d",
          "name": "Cetrine",
          "stdName": "CETRINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab2c2317-c5c3-4210-856d-1180fa029032"
          ],
          "display_name": false
        },
        {
          "uuid": "3802b659-007a-5c61-6f9b-728f8947bff6",
          "name": "NSC-759102",
          "stdName": "NSC-759102",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56fbc0f4-b0b2-8935-3cb7-17db9b3ae7e6"
          ],
          "display_name": false
        },
        {
          "uuid": "a4ceb269-515b-409e-afb9-813a7015ba8d",
          "name": "P-071",
          "stdName": "P-071",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "252e4aca-4b44-422a-b1bb-9179c7897a3f"
          ],
          "display_name": false
        },
        {
          "uuid": "e264ede9-12d2-484a-9b07-fc1db0a8fb3d",
          "name": "P071",
          "stdName": "P071",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7333469b-7f05-4c90-a215-499b15e55619"
          ],
          "display_name": false
        },
        {
          "uuid": "1ccaa915-94e1-0dd9-d9ec-beaed9eb81a6",
          "name": "QUZYTTIR",
          "stdName": "QUZYTTIR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "434bc864-6923-76e9-43ac-31820886a37d"
          ],
          "display_name": false
        },
        {
          "uuid": "acd6f3ac-659a-4155-a5c0-320cdb3f502d",
          "name": "ZERVIATE",
          "stdName": "ZERVIATE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c7268266-09c4-1071-1226-e4e910fa1a03"
          ],
          "display_name": false
        },
        {
          "uuid": "4fc044a4-59d9-402b-95cb-ad9634d64a62",
          "name": "ZYRTEC",
          "stdName": "ZYRTEC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ac70189-b28b-4c6f-9761-08979ff2214d"
          ],
          "display_name": false
        },
        {
          "uuid": "e8fc024e-8882-4d3d-b346-471c1a9e4633",
          "name": "ZYRTEC-D COMPONENT CETIRIZINE HYDROCHLORIDE",
          "stdName": "ZYRTEC-D COMPONENT CETIRIZINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93b73cc8-b3ab-4af6-885b-331ae69c0a82",
            "59b25fb1-f23f-4139-9435-bcdfd58a35d2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "15818d24-ccb6-40e5-8193-fc99a31f0a85",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "edbcf172-d2b3-4b85-9eb1-57ceee2c1a16",
          "citation": "DMF 19273",
          "doc_type": "DMF",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7333469b-7f05-4c90-a215-499b15e55619",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "252e4aca-4b44-422a-b1bb-9179c7897a3f",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ac70189-b28b-4c6f-9761-08979ff2214d",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "80a371d4-0ec1-4016-9a4e-4a9239dcbf4a",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9205ada1-7029-402e-9e3d-00e5492c5943",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e01bd983-2f07-4b2d-b48a-12efa3fd1c1d",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2eb26d67-c3a3-4fbf-ab56-f1682dd21ecd",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0ec14cd-821c-4a72-839c-7331929cc8a6",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93b73cc8-b3ab-4af6-885b-331ae69c0a82",
          "citation": "Drugs@FDA 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59b25fb1-f23f-4139-9435-bcdfd58a35d2",
          "citation": "Drugs@FDA 2012",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab2c2317-c5c3-4210-856d-1180fa029032",
          "citation": "http://www.drugsupdate.com/brand/generic/Cetirizine%20Hydrochloride/9164/none/6",
          "url": "http://www.drugsupdate.com/brand/generic/Cetirizine%20Hydrochloride/9164/none/6",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b310a35-d7e5-4931-9c7b-552c7aab94e2",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "abca8b4f-a5b0-47f0-9876-dc3f88ee8a85",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e87dcf15-fd76-439d-9774-5682c4d03768",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c66c0a2c-4ab7-4d54-bc9e-3c48c0c29959",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "426872e7-d0f0-41d2-88b5-2b2bac4c9da9",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99dcf325-5046-4a37-bd15-fe0ee4f2296f",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6c6a954-ed74-443b-9208-31f9c4326735",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390761000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0643cd6-e811-48f1-b1ee-b64c6766f465",
          "citation": "EP 7.8 CETIRIZINE DIHYDROCHLORIDE MONOGRAPH",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e942e53-799c-4027-a693-1a4fa3490a50",
          "citation": "USP 35 CETIRIZINE HYDROCHLORIDE MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0442d2d7-4448-4dd2-abd2-a7e58bf4851a",
          "citation": "SRS import [64O047KTOA]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=64O047KTOA",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390761000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5eb5e5d0-18a0-4daa-ab49-ce762a242a71",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d38d2b2-ef76-4b33-80ba-8574dad07293",
          "citation": "CETIRIZINE HYDROCHLORIDE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7f98cf45-b7a4-4c7b-9fbb-81cd31765276",
          "citation": "CETIRIZINE DIHYDROCHLORIDE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d4c63dcb-c4c3-4283-a12f-d11db6bb12fd",
          "citation": "CETIRIZINE HYDROCHLORIDE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "69df32bc-32e7-4345-a756-70c094b0188c",
          "citation": "CETIRIZINE HYDROCHLORIDE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "95b23f9b-ec58-46dc-a0a7-30551dc4d414",
          "citation": "CETIRIZINE HYDROCHLORIDE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2b1afc02-5b01-4a1f-bbe9-7af4811b1bd9",
          "citation": "CETIRIZINE HYDROCHLORIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6f1c5156-b4cd-4d59-a15f-47cef7ff689e",
          "citation": "CETIRIZINE HYDROCHLORIDE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6f80634a-4cfd-4f76-a7e8-463f5619b511",
          "citation": "CETIRIZINE HYDROCHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e5410df9-3f3e-4290-941a-0347e04a03d5",
          "citation": "CETIRIZINE HYDROCHLORIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dfbf9806-ba61-43cb-88c6-4a91493fda17",
          "citation": "CETIRIZINE DIHYDROCHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c7268266-09c4-1071-1226-e4e910fa1a03",
          "citation": "Drugs@FDA",
          "url": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2017/208694s000lbl.pdf",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "fc681300-b748-cc87-d30e-90343d0ec992",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=83881-52-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "27b20aa5-5803-9f36-3bfd-7f4e8f7857fd",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "7a5590a3-24a5-5aea-6341-92ceaa39f70f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ce53222d-ce29-eaa5-6e04-3aae992d24c1",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "434bc864-6923-76e9-43ac-31820886a37d",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2019/211415s000lbl.pdf",
          "doc_type": "DRUGS@FDA",
          "public_domain": true
        },
        {
          "uuid": "4ae1381c-b54a-4f54-b741-6dfdd962c166",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9d460221-704d-4bf3-ae67-95daf5b450b3",
          "citation": "USP-NF",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "e5025651-a334-6823-450d-87b8d452fcaf",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "53c0fe4c-e8af-048f-ac49-f1adcb57a517",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "56fbc0f4-b0b2-8935-3cb7-17db9b3ae7e6",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "67629229-889b-756d-974a-a67d0d5796bd",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "57cbfb7b-3bee-a600-89d9-ff705fb1a4ae",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e6887954-f687-83ce-6684-ce904d336238",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "dab799a8-e7c8-4ae6-8a81-1cc069f825ac",
          "citation": "USP-NF",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ef5d84f9-11b3-49b8-9d8e-93ff9e701a6f",
          "id": "ef5d84f9-11b3-49b8-9d8e-93ff9e701a6f",
          "molfile": "\n  Marvin  01132112252D          \n\n  1  0  0  0  0  0            999 V2000\n    6.2863   -6.4476    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "29471680-92a6-4067-b31f-04f5fe9c05b8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "5f1d0709-d782-4280-accb-88c505aebb5c",
          "id": "5f1d0709-d782-4280-accb-88c505aebb5c",
          "molfile": "\n  Marvin  01132104552D          \n\n 27 29  0  0  0  0            999 V2000\n    7.7466   -2.2308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3223   -2.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7466   -3.6650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5050   -2.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0755   -3.6650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2243   -3.6650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8312   -4.3782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9827   -4.3782    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5844   -5.0940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7332   -5.0940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3401   -4.3782    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7332   -3.6650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5844   -3.6650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4916   -4.3782    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.0933   -5.0940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2421   -5.0940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1587   -5.8151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2421   -6.5309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0933   -6.5309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4916   -5.8151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0933   -3.6650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2421   -3.6650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1587   -2.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2421   -2.2308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1822   -1.5175    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.0933   -2.2308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4916   -2.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 13  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 14 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 15  1  0  0  0  0\n 21 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 20 15  2  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 27 21  2  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 24 26  2  0  0  0  0\n 26 27  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C(c2ccc(cc2)Cl)N3CCN(CC3)CCOCC(=O)O",
          "formula": "C21H25ClN2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e364aaf8-6bd3-4277-948c-aaeb1d57e562"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "388.8885",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "58aa462d-af3a-41ac-9b3d-1963efb81bd1",
      "version": "52",
      "structure": {
        "id": "23fca103-cbfb-4f3d-9a0a-62c3d5e00278",
        "molfile": "\n  Marvin  01132102002D          \n\n 29 29  0  0  0  0            999 V2000\n    2.3401   -4.3782    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4916   -4.3782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9827   -4.3782    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3223   -2.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0933   -3.6650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7332   -5.0940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7332   -3.6650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7466   -2.2308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0933   -5.0940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2421   -3.6650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4916   -2.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5844   -5.0940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5844   -3.6650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2421   -2.2308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7466   -3.6650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1587   -2.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0933   -2.2308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1822   -1.5175    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.8312   -4.3782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5050   -2.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0755   -3.6650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2421   -5.0940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4916   -5.8151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2243   -3.6650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0933   -6.5309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1587   -5.8151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2421   -6.5309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2863   -6.4476    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.2863   -6.4476    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3 13  1  0  0  0  0\n  4 20  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  4  2  0  0  0  0\n  2  9  1  0  0  0  0\n 10  5  2  0  0  0  0\n 11  5  1  0  0  0  0\n 12  6  1  0  0  0  0\n 13  7  1  0  0  0  0\n 14 17  1  0  0  0  0\n 15  4  1  0  0  0  0\n 16 10  1  0  0  0  0\n 17 11  2  0  0  0  0\n 18 14  1  0  0  0  0\n 19  3  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 24  1  0  0  0  0\n 22  9  1  0  0  0  0\n 23  9  2  0  0  0  0\n 24 19  1  0  0  0  0\n 25 23  1  0  0  0  0\n 26 22  2  0  0  0  0\n 27 26  1  0  0  0  0\n 12  3  1  0  0  0  0\n 14 16  2  0  0  0  0\n 25 27  2  0  0  0  0\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  28  29\nM  SPA   1  1  28\nM  SDI   1  4    5.8663   -6.8676    5.8663   -6.0276\nM  SDI   1  4    6.7063   -6.0276    6.7063   -6.8676\nM  SMT   1 2\nM  END",
        "smiles": "c1ccc(cc1)C(c2ccc(cc2)Cl)N3CCN(CC3)CCOCC(=O)O.Cl.Cl",
        "formula": "C21H25ClN2O3.2ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "461.8103",
        "optical_activity": "( + / - )",
        "references": [
          "0442d2d7-4448-4dd2-abd2-a7e58bf4851a",
          "5eb5e5d0-18a0-4daa-ab49-ce762a242a71"
        ],
        "stereo_centers": 1
      },
      "unii": "64O047KTOA"
    }
  ]
}