{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "5f1bdf1a-31d8-49bb-bdab-5585f81c5bc8", "code": "17589-24-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=17589-24-1", "code_system": "CAS", "references": [ "e729e2b8-5bef-4c5b-b3ae-f6d2035db13a", "73935701-8168-4b9a-806f-d62510725f16" ] }, { "uuid": "169abdb7-f991-4ddc-a293-7055d0a31731", "code": "241-559-2", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.037.766", "code_system": "ECHA (EC/EINECS)", "references": [ "e729e2b8-5bef-4c5b-b3ae-f6d2035db13a" ] }, { "uuid": "29603de1-ef8c-4b12-ada1-2836bc607225", "code": "87165", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/87165", "code_system": "PUBCHEM", "references": [ "e729e2b8-5bef-4c5b-b3ae-f6d2035db13a" ] }, { "uuid": "ec54ac2a-3c01-2eb6-c725-e887b84f2483", "code": "DTXSID8066216", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8066216", "code_system": "EPA CompTox", "references": [ "e8246b02-19f2-cf11-c2e8-95f475068f9f" ] }, { "uuid": "2a642e6f-ab82-4a3b-98cf-0b304baf8d8a", "code": "64LS3M957X", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "284cc6dd-fd19-40ae-a975-f0e87a622313", "name": "1,3-BIS(4-((4-ISOCYANATOPHENYL)METHYL)PHENYL)-1,3-DIAZETIDINE-2,4-DIONE", "stdName": "1,3-BIS(4-((4-ISOCYANATOPHENYL)METHYL)PHENYL)-1,3-DIAZETIDINE-2,4-DIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "23fdb58e-270b-446b-b6b3-0e97882298c7" ], "display_name": true }, { "uuid": "92a00ac0-dacf-4649-9f9a-ab3cc4896ff2", "name": "1,3-DIAZETIDINE-2,4-DIONE, 1,3-BIS(4-((4-ISOCYANATOPHENYL)METHYL)PHENYL)-", "stdName": "1,3-DIAZETIDINE-2,4-DIONE, 1,3-BIS(4-((4-ISOCYANATOPHENYL)METHYL)PHENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "93ed1e04-333b-4dac-9865-122f70405fd8", "5901409e-8f2c-4016-8c81-310d7553b403" ], "display_name": false }, { "uuid": "f41960ba-73e6-48e8-9c46-a9eee4f7f013", "name": "2,4-DIOXO-1,3-DIAZETIDINE-1,3-DIYLBIS(P-PHENYLENEMETHYLENE-P-PHENYLENE) DIISOCYANATE", "stdName": "2,4-DIOXO-1,3-DIAZETIDINE-1,3-DIYLBIS(P-PHENYLENEMETHYLENE-P-PHENYLENE) DIISOCYANATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "23fdb58e-270b-446b-b6b3-0e97882298c7" ], "display_name": false } ], "references": [ { "uuid": "5901409e-8f2c-4016-8c81-310d7553b403", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "93ed1e04-333b-4dac-9865-122f70405fd8", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e729e2b8-5bef-4c5b-b3ae-f6d2035db13a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393787000, "tags": [ "NOMEN" ] }, { "uuid": "e8246b02-19f2-cf11-c2e8-95f475068f9f", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=17589-24-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "73935701-8168-4b9a-806f-d62510725f16", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "23fdb58e-270b-446b-b6b3-0e97882298c7", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3c57afed-284a-44be-889f-e51f80da19d8", "id": "3c57afed-284a-44be-889f-e51f80da19d8", "molfile": "\n Marvin 01132103122D \n\n 38 42 0 0 0 0 999 V2000\n -2.7627 -4.9190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0408 -4.9196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2948 -4.9133 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9339 -4.2745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3475 -3.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9403 -2.8480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1125 -2.8451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2982 -2.1296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1232 -2.1276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5328 -1.4114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3535 -1.4056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7717 -2.1201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3621 -2.8362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5342 -2.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5967 -2.1160 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1830 -2.6963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1871 -3.5213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7634 -2.1101 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1771 -1.5296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1730 -0.7047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5884 -2.1060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0066 -2.8204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8273 -2.8146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2369 -2.0985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0619 -2.0964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4762 -2.8099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0648 -3.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4783 -4.2371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3033 -4.2359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7148 -3.5257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3012 -2.8086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7158 -4.9503 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5359 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3540 -4.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8259 -1.3881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9980 -1.3899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3010 -3.5590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1132 -4.2757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 2 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 4 38 2 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 37 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 9 14 2 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 2 0 0 0 0\n 15 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 16 1 0 0 0 0\n 19 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 21 1 0 0 0 0\n 19 20 2 0 0 0 0\n 21 22 1 0 0 0 0\n 36 21 2 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 35 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 31 26 2 0 0 0 0\n 27 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 29 32 1 0 0 0 0\n 30 31 1 0 0 0 0\n 32 33 2 0 0 0 0\n 33 34 2 0 0 0 0\n 35 36 1 0 0 0 0\n 38 37 1 0 0 0 0\nM END", "smiles": "c1cc(ccc1Cc2ccc(cc2)N3C(=O)N(c4ccc(cc4)Cc5ccc(cc5)N=C=O)C3=O)N=C=O", "formula": "C30H20N4O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "03c0ba42-7f73-4e90-bd5e-3a04103b8893" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "500.5053", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "6bfde7f9-6d92-4a48-9f79-b2482dc41b6a", "version": "5", "structure": { "id": "5ce3756d-6b6b-417c-89ed-635b1a43af43", "molfile": "\n Marvin 01132104492D \n\n 38 42 0 0 0 0 999 V2000\n 4.1871 -3.5213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1830 -2.6963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7634 -2.1101 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5884 -2.1060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0066 -2.8204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8273 -2.8146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2369 -2.0985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8259 -1.3881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9980 -1.3899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0619 -2.0964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4762 -2.8099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0648 -3.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4783 -4.2371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3033 -4.2359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7158 -4.9503 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7148 -3.5257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3012 -2.8086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1771 -1.5296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1730 -0.7047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5967 -2.1160 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7717 -2.1201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3535 -1.4056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5328 -1.4114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1232 -2.1276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5342 -2.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3621 -2.8362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2982 -2.1296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1125 -2.8451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9403 -2.8480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3475 -3.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9339 -4.2745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2948 -4.9133 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0408 -4.9196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7627 -4.9190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1132 -4.2757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3010 -3.5590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5359 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3540 -4.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 4 2 0 0 0 0\n 7 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 11 2 0 0 0 0\n 3 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 20 2 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 21 2 0 0 0 0\n 24 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 33 34 2 0 0 0 0\n 31 35 2 0 0 0 0\n 35 36 1 0 0 0 0\n 36 28 2 0 0 0 0\n 15 37 2 0 0 0 0\n 1 2 2 0 0 0 0\n 37 38 2 0 0 0 0\nM END", "smiles": "c1cc(ccc1Cc2ccc(cc2)N3C(=O)N(c4ccc(cc4)Cc5ccc(cc5)N=C=O)C3=O)N=C=O", "formula": "C30H20N4O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "500.5053", "optical_activity": "NONE", "references": [ "5901409e-8f2c-4016-8c81-310d7553b403" ], "stereo_centers": 0 }, "unii": "64LS3M957X" } ] }