{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a05ab4eb-0113-47dd-891d-c0336e1aa931",
          "code": "B01AC07",
          "comments": "ATC|BLOOD AND BLOOD FORMING ORGANS|ANTITHROMBOTIC AGENTS|ANTITHROMBOTIC AGENTS|Platelet aggregation inhibitors excl. heparin|dipyridamole",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=B01AC07&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "dc9db14c-907f-4298-8b76-9af96b64917e"
          ]
        },
        {
          "uuid": "6ebded8c-330d-4bb4-81c8-b5a153cabc76",
          "code": "N0000175578",
          "comments": "Established Pharmacologic Class [EPC]|Platelet Aggregation Inhibitor [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175578",
          "code_system": "NDF-RT",
          "references": [
            "dc9db14c-907f-4298-8b76-9af96b64917e"
          ]
        },
        {
          "uuid": "43403875-bb03-45cd-973e-6707c44e79ad",
          "code": "N0000008832",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Hemic/Lymphatic Activity Alteration [PE]|Hematologic Activity Alteration [PE]|Hemostasis Alteration [PE]|Coagulation Activity Alteration [PE]|Decreased Coagulation Activity [PE]|Decreased Platelet Aggregation [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000008832",
          "code_system": "NDF-RT",
          "references": [
            "dc9db14c-907f-4298-8b76-9af96b64917e"
          ]
        },
        {
          "uuid": "9476f0d7-8d1f-4292-bd4f-b2e4d1933b19",
          "code": "N0000008832",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Hemic/Lymphatic Activity Alteration [PE]|Hematologic Activity Alteration [PE]|Hemostasis Alteration [PE]|Platelet Aggregation Alteration [PE]|Decreased Platelet Aggregation [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000008832",
          "code_system": "NDF-RT",
          "references": [
            "dc9db14c-907f-4298-8b76-9af96b64917e"
          ]
        },
        {
          "uuid": "ddd8a49a-785b-4d2a-91ea-25d828cc0855",
          "code": "58-32-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=58-32-2",
          "code_system": "CAS",
          "references": [
            "dc9db14c-907f-4298-8b76-9af96b64917e",
            "f1e16839-0568-4287-b223-13a273e1bd07"
          ]
        },
        {
          "uuid": "280c5434-ec5c-434c-a339-bae63c63b9a2",
          "code": "C445",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C445",
          "code_system": "NCI_THESAURUS",
          "references": [
            "dc9db14c-907f-4298-8b76-9af96b64917e"
          ]
        },
        {
          "uuid": "8846d61f-a0e5-4847-80ed-dd3c8b78ab0a",
          "code": "D004176",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68004176",
          "code_system": "MESH",
          "references": [
            "dc9db14c-907f-4298-8b76-9af96b64917e"
          ]
        },
        {
          "uuid": "e1aad633-4cda-4b73-a829-d9874085fef5",
          "code": "DIPYRIDAMOLE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Dipyridamole",
          "code_system": "WIKIPEDIA",
          "references": [
            "dc9db14c-907f-4298-8b76-9af96b64917e"
          ]
        },
        {
          "uuid": "d27ed335-ba67-4aba-b29c-97b92dba4a5d",
          "code": "QB01AC07",
          "comments": "VATC|ANTITHROMBOTIC AGENTS|ANTITHROMBOTIC AGENTS|Platelet aggregation inhibitors, excl. heparin|dipyridamole",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QB01AC07&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "dc9db14c-907f-4298-8b76-9af96b64917e"
          ]
        },
        {
          "uuid": "a6f8d958-bc7a-4297-8516-3e60b1e6ce41",
          "code": "SUB07229MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "dc9db14c-907f-4298-8b76-9af96b64917e"
          ]
        },
        {
          "uuid": "ca65e0f6-474c-4fe8-842f-2b11fefc2a72",
          "code": "1545",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1545",
          "code_system": "INN",
          "references": [
            "dc9db14c-907f-4298-8b76-9af96b64917e"
          ]
        },
        {
          "uuid": "3e3e30bc-3f0e-40fa-bef1-b0e7454fe9a2",
          "code": "4807",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=4807",
          "code_system": "IUPHAR",
          "references": [
            "dc9db14c-907f-4298-8b76-9af96b64917e"
          ]
        },
        {
          "uuid": "ba9c1fb7-977c-4192-ba9f-0ce1164ff160",
          "code": "3521",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/3521/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "dc9db14c-907f-4298-8b76-9af96b64917e"
          ]
        },
        {
          "uuid": "ae77a0cc-f90b-41c3-a7ac-b12aeabab441",
          "code": "m4658",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4658?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "dc9db14c-907f-4298-8b76-9af96b64917e"
          ]
        },
        {
          "uuid": "3483e502-9b10-4d5a-b184-f862d0b50e70",
          "code": "DB00975",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00975",
          "code_system": "DRUG BANK",
          "references": [
            "dc9db14c-907f-4298-8b76-9af96b64917e"
          ]
        },
        {
          "uuid": "02f15e04-9401-4635-9579-0735eac7760d",
          "code": "CHEMBL932",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL932",
          "code_system": "ChEMBL",
          "references": [
            "dc9db14c-907f-4298-8b76-9af96b64917e"
          ]
        },
        {
          "uuid": "448c25dd-71a4-4a59-a50b-aca7d1e4c6b8",
          "code": "200-374-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.340",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "dc9db14c-907f-4298-8b76-9af96b64917e"
          ]
        },
        {
          "uuid": "d7214275-a60f-4217-a793-9bba17028433",
          "code": "3108",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3108",
          "code_system": "PUBCHEM",
          "references": [
            "dc9db14c-907f-4298-8b76-9af96b64917e"
          ]
        },
        {
          "uuid": "fd22963f-84f0-e5e1-e436-bad2d943aab8",
          "code": "DTXSID6040668",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6040668",
          "code_system": "EPA CompTox",
          "references": [
            "7bcd6aeb-41b9-e9dd-5e4d-30752532c261"
          ]
        },
        {
          "uuid": "faef775b-a7c0-73fd-b9dc-4418f7af35f4",
          "code": "Dipyridamole",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM1484/",
          "code_system": "LACTMED",
          "references": [
            "29d769f9-449c-90b9-b1d1-23bbb12fd922"
          ]
        },
        {
          "uuid": "0a119f41-2648-3762-19a8-b528b3edc766",
          "code": "C744",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor[C471]|Phosphodiesterase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C744",
          "code_system": "NCI_THESAURUS",
          "references": [
            "29d769f9-449c-90b9-b1d1-23bbb12fd922"
          ]
        },
        {
          "uuid": "55b4e38a-05ad-4e69-b407-a68baa6297e1",
          "code": "64ALC7F90C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a2e86bf5-8ed9-a84f-2199-011bcf438e13",
          "code": "924",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/924",
          "code_system": "DRUG CENTRAL",
          "references": [
            "29d769f9-449c-90b9-b1d1-23bbb12fd922"
          ]
        },
        {
          "uuid": "48e98c79-9c92-bd16-4b43-3ab07090d1df",
          "code": "4653",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:4653",
          "code_system": "CHEBI",
          "references": [
            "29d769f9-449c-90b9-b1d1-23bbb12fd922"
          ]
        },
        {
          "uuid": "6ac0b373-279c-6f74-7b4a-27e35ebd2f3f",
          "code": "1220506",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1220506",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "29d769f9-449c-90b9-b1d1-23bbb12fd922"
          ]
        },
        {
          "uuid": "f0a830f4-d405-8ac7-d39a-a921560255dc",
          "code": "100000091735",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9fd81fdc-d50d-f2fa-9d86-a53726158ae9"
          ]
        },
        {
          "uuid": "7e6b9451-262c-214d-46ab-2239cb8a40ee",
          "code": "64ALC7F90C",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=64ALC7F90C",
          "code_system": "DAILYMED",
          "references": [
            "2d29007e-b5cb-54dd-6ebd-97b176da3301"
          ]
        },
        {
          "uuid": "c2ff8fad-5b3a-6afe-ffd8-2e2ec7f3c1d4",
          "code": "515776",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=515776",
          "code_system": "NSC",
          "references": [
            "9744743c-7aea-28c7-f17d-9ec90b51cbcf"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "82ea583f-8fcb-4e5c-be47-785d7222f25a",
          "amount": {
            "uuid": "73332133-3963-454e-945a-37edac37fc1e"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "4ba8bfab-2f03-4737-bfa7-149bf1787b71",
            "refuuid": "48320a72-182a-4a53-94e4-002d2e4bee0d",
            "name": "DIPYRIDAMOLE",
            "unii": "64ALC7F90C",
            "linking_id": "64ALC7F90C",
            "ref_pname": "DIPYRIDAMOLE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "73645de1-2ae7-4508-9173-05f963e83629",
          "amount": {
            "uuid": "f6b72b8f-207e-47a3-ac0e-f261967552fe",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 101.5,
            "low_limit": 98.5
          },
          "qualification": "EP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (HPLC)",
          "references": [
            "d4051110-1081-4ee2-a5fd-bd74f6c6ef4a"
          ],
          "related_substance": {
            "uuid": "8b67b6d4-3d88-4541-96ad-493542efbaef",
            "refuuid": "48320a72-182a-4a53-94e4-002d2e4bee0d",
            "name": "DIPYRIDAMOLE",
            "unii": "64ALC7F90C",
            "linking_id": "64ALC7F90C",
            "ref_pname": "DIPYRIDAMOLE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "72a33f0c-9601-430f-a237-33974c085752",
          "amount": {
            "uuid": "43af9090-282b-4d9c-895e-7f23411e6187",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 102,
            "low_limit": 98
          },
          "qualification": "USP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (TITRATION)",
          "references": [
            "25ef5faa-7460-43b9-aa70-55b9a22e4ee7"
          ],
          "related_substance": {
            "uuid": "d1db6257-2a5c-4838-bd93-e825bceb9aa1",
            "refuuid": "48320a72-182a-4a53-94e4-002d2e4bee0d",
            "name": "DIPYRIDAMOLE",
            "unii": "64ALC7F90C",
            "linking_id": "64ALC7F90C",
            "ref_pname": "DIPYRIDAMOLE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1bbdd8c2-8c3d-4cf1-8cfc-ba694a4abb19",
          "amount": {
            "uuid": "c51258c7-8756-4fec-8725-41cb06830d45",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "125daa18-9f65-41f2-a869-40616b4f6879"
          ],
          "related_substance": {
            "uuid": "9cb12a3d-f8f2-4be0-8338-42628887b990",
            "refuuid": "7618cd6b-3f62-42fa-8554-dffc1fa7957a",
            "name": "6-DES(DIETHANOLAMINO)-6-CHLORO DIPYRIDAMOLE",
            "unii": "AL4Z465RFJ",
            "linking_id": "AL4Z465RFJ",
            "ref_pname": "6-DES(DIETHANOLAMINO)-6-CHLORO DIPYRIDAMOLE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "cdd4dc80-3328-412a-a056-e4b541e08365",
          "amount": {
            "uuid": "9ba2fbf4-4792-4aad-94b0-dff3298f8a8c",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "87f9cdc1-74b6-4457-9900-eef90946df50"
          ],
          "related_substance": {
            "uuid": "29466098-2d0a-4ff3-96e0-6e85dda04c74",
            "refuuid": "96abf0cf-b548-4d0d-a6c0-04d3f8f09f66",
            "name": "2,2',2'',2'''-((4-((2-HYDROXYETHYL)AMINO)-8-(PIPERIDIN-1-YL)PYRIMIDO(5,4-D)PYRIMIDINE-2,6-DIYL)DINITRILO)TETRAETHANOL",
            "unii": "9HOE8AZZ8G",
            "linking_id": "9HOE8AZZ8G",
            "ref_pname": "2,2',2'',2'''-((4-((2-HYDROXYETHYL)AMINO)-8-(PIPERIDIN-1-YL)PYRIMIDO(5,4-D)PYRIMIDINE-2,6-DIYL)DINITRILO)TETRAETHANOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8246d0b1-cebc-4f92-891b-249975098eea",
          "amount": {
            "uuid": "dc4c72b2-366e-4501-9f9b-7169ead958f8",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.5
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "87f9cdc1-74b6-4457-9900-eef90946df50"
          ],
          "related_substance": {
            "uuid": "e48a1174-32f4-4c50-82ae-95603dece67c",
            "refuuid": "dd226de3-1271-4fef-a15b-9beb0015bc70",
            "name": "RA-136",
            "unii": "VP11YEX8WZ",
            "linking_id": "VP11YEX8WZ",
            "ref_pname": "RA-136",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4d11e651-ce5b-47d8-a1d4-cff833134fe2",
          "amount": {
            "uuid": "4451f983-f5ff-4ec5-9563-0412fc8a7991",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "87f9cdc1-74b6-4457-9900-eef90946df50"
          ],
          "related_substance": {
            "uuid": "6cce5bf7-9eb2-4036-83f1-13dccb88e9d5",
            "refuuid": "107c6f8b-e426-404d-a708-573536422d3a",
            "name": "DESETHANOL DIPYRIDAMOLE",
            "unii": "VX0Y19727G",
            "linking_id": "VX0Y19727G",
            "ref_pname": "DESETHANOL DIPYRIDAMOLE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c9ef3d67-f812-4725-b098-2d8c93ba0806",
          "amount": {
            "uuid": "875d7530-4a70-4717-9cea-1ce3e2d94db5",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "87f9cdc1-74b6-4457-9900-eef90946df50"
          ],
          "related_substance": {
            "uuid": "a2dd68a0-631a-4a41-86ae-6366bc0e7986",
            "refuuid": "d5b0d847-18c2-4123-8420-e780c69c944f",
            "name": "2,2',2'',2'''-((6,8-DI(PIPERIDIN-1-YL)PYRIMIDO(5,4-D)PYRIMIDINE-2,4-DIYL)DINITRILO)TETRAETHANOL",
            "unii": "QC1WTB23HP",
            "linking_id": "QC1WTB23HP",
            "ref_pname": "2,2',2'',2'''-((6,8-DI(PIPERIDIN-1-YL)PYRIMIDO(5,4-D)PYRIMIDINE-2,4-DIYL)DINITRILO)TETRAETHANOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "943cbdc6-b878-40ac-9e0f-95fb010acf21",
          "amount": {
            "uuid": "28b39224-4035-4cce-b6be-bc014de9792b",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.5
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "87f9cdc1-74b6-4457-9900-eef90946df50"
          ],
          "related_substance": {
            "uuid": "620b0a36-f26a-417a-aecf-0cf96603686c",
            "refuuid": "9a1b4c14-f05e-43cb-b0ee-546c9a77284f",
            "name": "DIPYRIDAMOLE TRIPIPERIDINE",
            "unii": "KH5E8A3VNN",
            "linking_id": "KH5E8A3VNN",
            "ref_pname": "DIPYRIDAMOLE TRIPIPERIDINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c0c51f12-5a8a-44d4-b128-c74e519b70ee",
          "amount": {
            "uuid": "bcbfcdbc-c21c-4089-8282-6108a70a79e0"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "857f3e33-b458-44ac-824e-0802e7660eb7"
          ],
          "related_substance": {
            "uuid": "471dc4e5-9635-42ad-9bff-fffc40562268",
            "refuuid": "332c5f16-96a9-4247-a3cf-f27f4a80416f",
            "name": "DIPYRIDAMOLE DITOSYLATE",
            "unii": "832L5C4A2V",
            "linking_id": "832L5C4A2V",
            "ref_pname": "DIPYRIDAMOLE DITOSYLATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e3f5ca1a-e6e2-4ee6-ba95-58acb4560511",
          "amount": {
            "uuid": "eca4abd3-f9de-427b-a060-23df54606d2c"
          },
          "type": "TARGET->INHIBITOR",
          "references": [
            "eb634881-e4f9-4180-b649-db43e9441079",
            "6e7e6432-48d3-4f8a-af10-31dcbc565008"
          ],
          "related_substance": {
            "uuid": "a71d55e6-f6b7-46e3-af5e-27ab8d288a79",
            "refuuid": "ca731da8-8121-4f36-a982-3df89e890256",
            "name": "CGMP-INHIBITED 3',5'-CYCLIC PHOSPHODIESTERASE A",
            "unii": "JOC85XIO65",
            "linking_id": "JOC85XIO65",
            "ref_pname": "CGMP-INHIBITED 3',5'-CYCLIC PHOSPHODIESTERASE A",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a57ad452-3df3-466d-8b97-eeefd60ca261",
          "amount": {
            "uuid": "d635bc15-7986-4593-9cff-8a1ca9f7b274",
            "high": 9200,
            "low": 300,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "references": [
            "eb634881-e4f9-4180-b649-db43e9441079",
            "6e7e6432-48d3-4f8a-af10-31dcbc565008"
          ],
          "related_substance": {
            "uuid": "f0234c47-28a5-46ba-bcaa-4b6a2b400044",
            "refuuid": "fd43e7a3-238b-4b0a-8528-3d2a230185f0",
            "name": "PHOSPHODIESTERASE 5A, HUMAN",
            "unii": "KT6HT14BLU",
            "linking_id": "KT6HT14BLU",
            "ref_pname": "PHOSPHODIESTERASE 5A, HUMAN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "28430f75-661c-404e-b21d-89cbf737d4df",
          "name": "AGGRENOX COMPONENT DIPYRIDAMOLE",
          "stdName": "AGGRENOX COMPONENT DIPYRIDAMOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60581927-0edf-4267-8103-10ad5e0ab2e7",
            "bbf4ce65-9920-42d8-a3df-7c767cca42ab"
          ],
          "display_name": false
        },
        {
          "uuid": "10a2ee30-1ae7-4389-b66f-23785038c5f0",
          "name": "B01AC07",
          "stdName": "B01AC07",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6133527c-b955-40cd-85da-c5122ad2862a",
            "c024f0d6-4a85-4cf3-a87c-af715816226c"
          ],
          "display_name": false
        },
        {
          "uuid": "d559ad6c-dc9a-486d-91bd-c451cae77366",
          "name": "DIPYRIDAMOLE",
          "stdName": "DIPYRIDAMOLE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb480e01-ae1a-415a-ba5b-d98bb2838d8f",
            "c396f475-5275-4627-8bcc-7fffe143d362",
            "220f2b70-c2ba-4f83-b41c-aad39bf00f56",
            "e528b4a2-42c2-4586-a695-4080830b8bbf",
            "20f3e7b7-adee-4cac-9b30-23bf97b108c3",
            "9a89f3fb-34d3-4bd0-8e2c-8f5cfd937188",
            "54d34339-afdc-405b-a1c4-63417bee640a",
            "f8d05265-f91e-44fe-81bb-bfa0b3cd9ce6",
            "768b282a-35cc-40c7-82f8-58d7da82834c",
            "ad2d561d-1ea1-46ba-9db2-356c31974a32",
            "652e7ddf-8a64-4b81-ac78-35184809f290",
            "f93ef854-7149-4388-8d6e-a8a212197ef1",
            "9f2c5129-4fd6-4beb-a25e-15ff7d914d21",
            "9c69a415-5596-4202-99c2-303660185902",
            "c5ac49d9-48e5-4fe7-ace6-1d5b70b035aa",
            "ff56c1fa-8f86-42bb-b075-778750164bce",
            "acc0384b-6be7-4bb8-a35b-1fae55992285",
            "772acc70-8e16-4938-a806-68cf4580d3b4",
            "473a7dae-ea72-4ccc-a6ed-96e70e3059b4",
            "9651b0c0-f362-4738-af7a-d489c094501f",
            "4d39eebb-a43d-405e-b7a3-8b9ff4217c5d"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "69013e12-6b7e-45ee-b83b-966ea5b12faf",
              "name_org": "INN"
            },
            {
              "uuid": "df1ebb35-1122-4ca1-8918-5000fc2556a0",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "45c58592-e173-f2a5-4208-dc712c940df4",
          "name": "DIPYRIDAMOLE [EP MONOGRAPH]",
          "stdName": "DIPYRIDAMOLE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fdca4f5f-6cb6-9e74-1c2e-17df13d107a3"
          ],
          "display_name": false
        },
        {
          "uuid": "f5385eb2-98a5-4047-bc59-2a4a207c0477",
          "name": "DIPYRIDAMOLE [JAN]",
          "stdName": "DIPYRIDAMOLE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "838f615b-c95c-2869-5ff1-0d74b29260e7"
          ],
          "display_name": false
        },
        {
          "uuid": "21b59128-f983-4216-9a6c-f97aa26e80cf",
          "name": "DIPYRIDAMOLE [MART.]",
          "stdName": "DIPYRIDAMOLE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f2c5129-4fd6-4beb-a25e-15ff7d914d21"
          ],
          "display_name": false
        },
        {
          "uuid": "d48f08ec-423c-4742-ad06-854cbb2f8f67",
          "name": "DIPYRIDAMOLE [MI]",
          "stdName": "DIPYRIDAMOLE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8d05265-f91e-44fe-81bb-bfa0b3cd9ce6"
          ],
          "display_name": false
        },
        {
          "uuid": "009e3b0a-0d60-437e-a444-1ccd37f685c5",
          "name": "DIPYRIDAMOLE [ORANGE BOOK]",
          "stdName": "DIPYRIDAMOLE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "768b282a-35cc-40c7-82f8-58d7da82834c"
          ],
          "display_name": false
        },
        {
          "uuid": "6f088eae-37f2-4477-94f5-647994308cb1",
          "name": "DIPYRIDAMOLE [USAN]",
          "stdName": "DIPYRIDAMOLE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5ac49d9-48e5-4fe7-ace6-1d5b70b035aa"
          ],
          "display_name": false
        },
        {
          "uuid": "cb380cd4-4093-dc68-9add-c2a72da60654",
          "name": "DIPYRIDAMOLE [USP MONOGRAPH]",
          "stdName": "DIPYRIDAMOLE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0633cdb-56e9-06c8-78fd-01c2caecb3e2"
          ],
          "display_name": false
        },
        {
          "uuid": "e8b9574c-6284-4d41-9f9e-00c8daba4078",
          "name": "DIPYRIDAMOLE [USP-RS]",
          "stdName": "DIPYRIDAMOLE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c396f475-5275-4627-8bcc-7fffe143d362"
          ],
          "display_name": false
        },
        {
          "uuid": "31fae88c-c58d-4ab9-85f9-743944c8f796",
          "name": "DIPYRIDAMOLE [VANDF]",
          "stdName": "DIPYRIDAMOLE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4d39eebb-a43d-405e-b7a3-8b9ff4217c5d"
          ],
          "display_name": false
        },
        {
          "uuid": "3eded7dd-55e7-e4bb-425f-13230095de9e",
          "name": "Dipyridamole [WHO-DD]",
          "stdName": "DIPYRIDAMOLE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88a475c8-8e69-d99d-9f80-fe9802fa340a"
          ],
          "display_name": false
        },
        {
          "uuid": "fc052131-fb1c-4690-be0a-6e6b71811079",
          "name": "NSC-515776",
          "stdName": "NSC-515776",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a774aeaa-2802-4673-9b25-c495da677e99"
          ],
          "display_name": false
        },
        {
          "uuid": "8f40934a-e6d0-46d4-9d6a-537a59701054",
          "name": "PERSANTINE",
          "stdName": "PERSANTINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a774aeaa-2802-4673-9b25-c495da677e99"
          ],
          "display_name": false
        },
        {
          "uuid": "4f9c35b5-947f-44c3-9619-56e67343e9e4",
          "name": "RA-8",
          "stdName": "RA-8",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a774aeaa-2802-4673-9b25-c495da677e99"
          ],
          "display_name": false
        },
        {
          "uuid": "4daad0be-a859-43e8-9c64-12b66abd2f40",
          "name": "dipyridamole [INN]",
          "stdName": "DIPYRIDAMOLE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acc0384b-6be7-4bb8-a35b-1fae55992285",
            "2213f707-beb3-4b4b-b15f-ba24ed01ba0e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "772acc70-8e16-4938-a806-68cf4580d3b4",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c024f0d6-4a85-4cf3-a87c-af715816226c",
          "citation": "ATC CODE 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6133527c-b955-40cd-85da-c5122ad2862a",
          "citation": "WHO 2009",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a774aeaa-2802-4673-9b25-c495da677e99",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acc0384b-6be7-4bb8-a35b-1fae55992285",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c5ac49d9-48e5-4fe7-ace6-1d5b70b035aa",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f93ef854-7149-4388-8d6e-a8a212197ef1",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "220f2b70-c2ba-4f83-b41c-aad39bf00f56",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60581927-0edf-4267-8103-10ad5e0ab2e7",
          "citation": "Drugs@FDA 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bbf4ce65-9920-42d8-a3df-7c767cca42ab",
          "citation": "Drugs@FDA 2012",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "768b282a-35cc-40c7-82f8-58d7da82834c",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f2c5129-4fd6-4beb-a25e-15ff7d914d21",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8d05265-f91e-44fe-81bb-bfa0b3cd9ce6",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c396f475-5275-4627-8bcc-7fffe143d362",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20f3e7b7-adee-4cac-9b30-23bf97b108c3",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4d39eebb-a43d-405e-b7a3-8b9ff4217c5d",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc9db14c-907f-4298-8b76-9af96b64917e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389715000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4051110-1081-4ee2-a5fd-bd74f6c6ef4a",
          "citation": "EP 7.8 DIPYRIDAMOLE MONOGRAPH",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25ef5faa-7460-43b9-aa70-55b9a22e4ee7",
          "citation": "USP 35 DIPYRIDAMOLE MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1032bf4-108e-4893-a124-ae0d108acc9e",
          "citation": "SRS import [64ALC7F90C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=64ALC7F90C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389715000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad2d561d-1ea1-46ba-9db2-356c31974a32",
          "citation": "DIPYRIDAMOLE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9a89f3fb-34d3-4bd0-8e2c-8f5cfd937188",
          "citation": "DIPYRIDAMOLE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "54d34339-afdc-405b-a1c4-63417bee640a",
          "citation": "DIPYRIDAMOLE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ff56c1fa-8f86-42bb-b075-778750164bce",
          "citation": "DIPYRIDAMOLE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9651b0c0-f362-4738-af7a-d489c094501f",
          "citation": "DIPYRIDAMOLE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e528b4a2-42c2-4586-a695-4080830b8bbf",
          "citation": "DIPYRIDAMOLE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fb480e01-ae1a-415a-ba5b-d98bb2838d8f",
          "citation": "DIPYRIDAMOLE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "652e7ddf-8a64-4b81-ac78-35184809f290",
          "citation": "DIPYRIDAMOLE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9c69a415-5596-4202-99c2-303660185902",
          "citation": "DIPYRIDAMOLE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "473a7dae-ea72-4ccc-a6ed-96e70e3059b4",
          "citation": "DIPYRIDAMOLE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "838f615b-c95c-2869-5ff1-0d74b29260e7",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7bcd6aeb-41b9-e9dd-5e4d-30752532c261",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=58-32-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9fd81fdc-d50d-f2fa-9d86-a53726158ae9",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "29d769f9-449c-90b9-b1d1-23bbb12fd922",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "f1e16839-0568-4287-b223-13a273e1bd07",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "87f9cdc1-74b6-4457-9900-eef90946df50",
          "citation": "USP42-NF37 - 1414, Dipyridamole Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "125daa18-9f65-41f2-a869-40616b4f6879",
          "citation": "European Pharmacopoeia Online 9.8, Dipyridamole Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1e96fe96-cd88-4fc5-a981-38206ec3c404",
          "citation": "European Pharmacopoeia Online 9.8, Dipyridamole Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b9752419-44ca-4698-8e05-761a7dd6d31f",
          "citation": "European Pharmacopoeia Online 9.8, Dipyridamole Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "029a0fbe-492e-4362-b9b9-511af2ad891c",
          "citation": "European Pharmacopoeia Online 9.8, Dipyridamole Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "256e4bb1-fda5-49b6-b0e0-713184273fc6",
          "citation": "European Pharmacopoeia Online 9.8, Dipyridamole Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2213f707-beb3-4b4b-b15f-ba24ed01ba0e",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f0633cdb-56e9-06c8-78fd-01c2caecb3e2",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "fdca4f5f-6cb6-9e74-1c2e-17df13d107a3",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "9744743c-7aea-28c7-f17d-9ec90b51cbcf",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "eb634881-e4f9-4180-b649-db43e9441079",
          "citation": "Degjoni, Anisa, et al. \"The NO/cGMP/PKG pathway in platelets: The therapeutic potential of PDE5 inhibitors in platelet disorders.\" Journal of Thrombosis and Haemostasis 20.11 (2022): 2465-2474.",
          "url": "https://www.sciencedirect.com/science/article/pii/S1538783622184746",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "2d29007e-b5cb-54dd-6ebd-97b176da3301",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "88a475c8-8e69-d99d-9f80-fe9802fa340a",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "857f3e33-b458-44ac-824e-0802e7660eb7",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=49845-74-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6e7e6432-48d3-4f8a-af10-31dcbc565008",
          "citation": "Zhuplatov, Sergey B., et al. \"Mechanism of dipyridamole's action in inhibition of venous and arterial smooth muscle cell proliferation.\" Basic & clinical pharmacology & toxicology 99.6 (2006): 431-439.",
          "url": "https://onlinelibrary.wiley.com/doi/pdfdirect/10.1111/j.1742-7843.2006.pto_516.x",
          "doc_type": "JA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "54110ce4-3e56-4100-a3d3-1bdd5cbd095e",
          "id": "54110ce4-3e56-4100-a3d3-1bdd5cbd095e",
          "molfile": "\n  Marvin  01132104222D          \n\n 36 39  0  0  0  0            999 V2000\n   -0.0388   -4.4220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7215   -4.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4378   -4.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4378   -3.6385    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7215   -3.2195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0026   -3.6385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6956   -3.2195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1516   -3.2195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1516   -2.4153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8704   -2.0016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8704   -1.1818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1516   -0.7629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1516    0.0672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8704    0.4629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5687    0.0672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5687   -0.7629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5687   -2.4153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2695   -2.0016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9832   -2.4153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9832   -3.2195    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2695   -3.6385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2695   -4.4557    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9832   -4.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9832   -5.7021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2695   -6.1004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5687   -5.7021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5687   -4.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5687   -3.2195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8704   -3.6385    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7021   -2.0016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4184   -2.4153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1322   -2.0016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8304   -2.4153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7021   -1.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4184   -0.7629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2873   -1.1198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  8  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 29  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 10 17  1  0  0  0  0\n 12 11  1  0  0  0  0\n 16 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 28  2  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 30 19  1  0  0  0  0\n 20 21  2  0  0  0  0\n 22 21  1  0  0  0  0\n 21 28  1  0  0  0  0\n 23 22  1  0  0  0  0\n 27 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 29 28  1  0  0  0  0\n 31 30  1  0  0  0  0\n 34 30  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33 32  1  0  0  0  0\n 35 34  1  0  0  0  0\n 36 35  1  0  0  0  0\nM  END",
          "smiles": "C1CCN(CC1)c2c3c(c(nc(n3)N(CCO)CCO)N4CCCCC4)nc(n2)N(CCO)CCO",
          "formula": "C24H40N8O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0f0b2162-463c-4be9-a94a-4989d31470fc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "504.6265",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "48320a72-182a-4a53-94e4-002d2e4bee0d",
      "version": "42",
      "structure": {
        "id": "09c3b376-fa70-4595-9aa2-07c14030714d",
        "molfile": "\n  Marvin  01132100462D          \n\n 36 39  0  0  0  0            999 V2000\n    3.5687   -3.2195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5687   -2.4153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1516   -2.4153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9832   -3.2195    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8704   -2.0016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2695   -3.6385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1516   -3.2195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9832   -2.4153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2695   -2.0016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8704   -3.6385    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8704   -1.1818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2695   -4.4557    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4378   -3.6385    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7021   -2.0016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5687   -0.7629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1516   -0.7629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9832   -4.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5687   -4.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0388   -4.4220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6956   -3.2195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8304   -2.4153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2873   -1.1198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4184   -2.4153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7215   -3.2195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7021   -1.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4378   -4.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7215   -4.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0026   -3.6385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4184   -0.7629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1322   -2.0016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1516    0.0672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9832   -5.7021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5687   -5.7021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5687    0.0672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8704    0.4629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2695   -6.1004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  7  2  0  0  0  0\n  4  6  2  0  0  0  0\n  5  2  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7 10  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9  2  1  0  0  0  0\n 10  1  2  0  0  0  0\n 11  5  1  0  0  0  0\n 12  6  1  0  0  0  0\n 13  7  1  0  0  0  0\n 14  8  1  0  0  0  0\n 15 11  1  0  0  0  0\n 16 11  1  0  0  0  0\n 17 12  1  0  0  0  0\n 18 12  1  0  0  0  0\n 19 27  1  0  0  0  0\n 20 28  1  0  0  0  0\n 21 30  1  0  0  0  0\n 22 29  1  0  0  0  0\n 23 14  1  0  0  0  0\n 24 13  1  0  0  0  0\n 25 14  1  0  0  0  0\n 26 13  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 24  1  0  0  0  0\n 29 25  1  0  0  0  0\n 30 23  1  0  0  0  0\n 31 16  1  0  0  0  0\n 32 17  1  0  0  0  0\n 33 18  1  0  0  0  0\n 34 15  1  0  0  0  0\n 35 31  1  0  0  0  0\n 36 33  1  0  0  0  0\n  9  8  2  0  0  0  0\n  5  3  1  0  0  0  0\n 36 32  1  0  0  0  0\n 35 34  1  0  0  0  0\nM  END",
        "smiles": "C1CCN(CC1)c2c3c(c(nc(n3)N(CCO)CCO)N4CCCCC4)nc(n2)N(CCO)CCO",
        "formula": "C24H40N8O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "504.6265",
        "optical_activity": "NONE",
        "references": [
          "c1032bf4-108e-4893-a124-ae0d108acc9e",
          "772acc70-8e16-4938-a806-68cf4580d3b4",
          "2213f707-beb3-4b4b-b15f-ba24ed01ba0e"
        ],
        "stereo_centers": 0
      },
      "unii": "64ALC7F90C"
    }
  ]
}