{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b92109a2-d6eb-456e-b945-64673fdb609e",
          "code": "195863-84-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=195863-84-4",
          "code_system": "CAS",
          "references": [
            "2fe16234-ae23-4699-ab28-75be320a5c56",
            "11423f0a-4510-4ef5-8223-bf7a7d6515a2"
          ]
        },
        {
          "uuid": "f8a640ab-7948-4638-bd41-aa72a93f5b37",
          "code": "9834711",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9834711",
          "code_system": "PUBCHEM",
          "references": [
            "2fe16234-ae23-4699-ab28-75be320a5c56"
          ]
        },
        {
          "uuid": "1e02bbc5-0a0f-6fe0-31b6-2f30f2730ce2",
          "code": "1944955",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1944955/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "390050c6-e0c9-3b26-59db-64d599d8ade6"
          ]
        },
        {
          "uuid": "2b5555e5-a638-4c03-ab17-95c14f3b50e9",
          "code": "649M1Y2P72",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "dd7ce8b9-3b82-e50f-7556-d85605863fd9",
          "code": "649M1Y2P72",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=649M1Y2P72",
          "code_system": "DAILYMED",
          "references": [
            "23142f3f-389a-a17f-6132-0ed5c08a0813"
          ]
        },
        {
          "uuid": "d88eb83f-307f-2697-c47e-046c604a3fb0",
          "code": "1200",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1200/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "776f7557-7fe3-b52e-2d4b-3bfffabdf52c"
          ]
        },
        {
          "uuid": "e856d394-ae5f-f099-8c18-c43de9afb72e",
          "code": "DTXSID7074585",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7074585",
          "code_system": "EPA CompTox",
          "references": [
            "9a07668d-cdf5-a9f2-e87c-44beeae0b5d8"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a48b7467-04d0-4e09-ae8f-452ee2ae07d4",
          "name": "1,2-PROPANEDIOL, 2-METHYL-3-(((1R,2S,5R)-5-METHYL-2-(1-METHYLETHYL)CYCLOHEXYL)OXY)-",
          "stdName": "1,2-PROPANEDIOL, 2-METHYL-3-(((1R,2S,5R)-5-METHYL-2-(1-METHYLETHYL)CYCLOHEXYL)OXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f030b382-e478-4433-b8e5-c3846bc84429"
          ],
          "display_name": false
        },
        {
          "uuid": "ee4ddc44-7690-45a9-9dc7-f35f16b97291",
          "name": "1,2-PROPANEDIOL, 2-METHYL-3-((5-METHYL-2-(1-METHYLETHYL)CYCLOHEXYL)OXY)-,(1R-(1.ALPHA.,2.BETA.,5.ALPHA.))-(PARTIAL)-",
          "stdName": "1,2-PROPANEDIOL, 2-METHYL-3-((5-METHYL-2-(1-METHYLETHYL)CYCLOHEXYL)OXY)-,(1R-(1.ALPHA.,2.BETA.,5.ALPHA.))-(PARTIAL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f030b382-e478-4433-b8e5-c3846bc84429"
          ],
          "display_name": false
        },
        {
          "uuid": "63607eea-25fc-4549-aeb4-e14ee7367f34",
          "name": "3-((1R,2S,5R)-2-ISOPROPYL-5-METHYL-CYCLOHEXOXY)-(±)-2-METHYL-PROPANE-1,2-DIOL",
          "stdName": "3-((1R,2S,5R)-2-ISOPROPYL-5-METHYL-CYCLOHEXOXY)-(+/-)-2-METHYL-PROPANE-1,2-DIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "32d83912-2799-4cb3-a804-71d10e7ca32c"
          ],
          "display_name": false
        },
        {
          "uuid": "94670ee8-4d02-4816-89ae-0db85aa2d1bc",
          "name": "3-((1R,2S,5R)-2-ISOPROPYL-5-METHYL-CYCLOHEXOXY)-2-METHYL-PROPANE-1,2-DIOL",
          "stdName": "3-((1R,2S,5R)-2-ISOPROPYL-5-METHYL-CYCLOHEXOXY)-2-METHYL-PROPANE-1,2-DIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "32d83912-2799-4cb3-a804-71d10e7ca32c"
          ],
          "display_name": false
        },
        {
          "uuid": "da5c2e37-5119-46cd-88e3-d1f1a069aaf5",
          "name": "3-((1R,2S,5R)-2-ISOPROPYL-5-METHYL-CYCLOHEXOXY)-2-METHYL-PROPANE-1,2-DIOL, (±)-",
          "stdName": "3-((1R,2S,5R)-2-ISOPROPYL-5-METHYL-CYCLOHEXOXY)-2-METHYL-PROPANE-1,2-DIOL, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "32d83912-2799-4cb3-a804-71d10e7ca32c"
          ],
          "display_name": false
        },
        {
          "uuid": "6732886e-852e-4d5b-a0ca-0f4cdca17701",
          "name": "3-(L-MENTHOXY)-2-METHYLPROPANE-1,2-DIOL",
          "stdName": "3-(L-MENTHOXY)-2-METHYLPROPANE-1,2-DIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9d7fb51-3517-4e16-9bd8-8e51ba135289",
            "36493dba-93cd-42c6-afe9-8f71f43662f7",
            "31405541-674f-484e-be3d-014de77c630e"
          ],
          "display_name": true
        },
        {
          "uuid": "1b1d10ab-c475-453d-a83f-425bb1abd556",
          "name": "3-(L-MENTHOXY)-2-METHYLPROPANE-1,2-DIOL [FHFI]",
          "stdName": "3-(L-MENTHOXY)-2-METHYLPROPANE-1,2-DIOL [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9d7fb51-3517-4e16-9bd8-8e51ba135289"
          ],
          "display_name": false
        },
        {
          "uuid": "73c1cc44-d6cc-4030-bc7c-8f2d3ed1783d",
          "name": "3-(L-MENTHOXY)-2-METHYLPROPYLENE GLYCOL",
          "stdName": "3-(L-MENTHOXY)-2-METHYLPROPYLENE GLYCOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f92d1d2-5231-4863-b69c-bc11ed9c14ad"
          ],
          "display_name": false
        },
        {
          "uuid": "b6933699-c381-41c2-9dcc-966138a00f89",
          "name": "COOLACT 1",
          "stdName": "COOLACT 1",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f030b382-e478-4433-b8e5-c3846bc84429"
          ],
          "display_name": false
        },
        {
          "uuid": "789f5e84-b56e-44a5-84e1-5fa6b1aafd5f",
          "name": "FEMA NO. 3849",
          "stdName": "FEMA NO. 3849",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9d7fb51-3517-4e16-9bd8-8e51ba135289"
          ],
          "display_name": false
        },
        {
          "uuid": "c002c067-d12d-491d-abeb-b3e3faf46e29",
          "name": "TPG 1",
          "stdName": "TPG 1",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f030b382-e478-4433-b8e5-c3846bc84429"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "32d83912-2799-4cb3-a804-71d10e7ca32c",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "36493dba-93cd-42c6-afe9-8f71f43662f7",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f030b382-e478-4433-b8e5-c3846bc84429",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9d7fb51-3517-4e16-9bd8-8e51ba135289",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f92d1d2-5231-4863-b69c-bc11ed9c14ad",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2fe16234-ae23-4699-ab28-75be320a5c56",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391328000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15ff62d5-1784-482f-a797-d6c6a152274b",
          "citation": "SRS import [649M1Y2P72]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=649M1Y2P72",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391328000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31405541-674f-484e-be3d-014de77c630e",
          "citation": "3-(L-MENTHOXY)-2-METHYLPROPANE-1,2-DIOL [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9ed67dfd-227b-43a4-c3f4-97d020475647",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=195863-84-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "390050c6-e0c9-3b26-59db-64d599d8ade6",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "11423f0a-4510-4ef5-8223-bf7a7d6515a2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "23142f3f-389a-a17f-6132-0ed5c08a0813",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "9a07668d-cdf5-a9f2-e87c-44beeae0b5d8",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "776f7557-7fe3-b52e-2d4b-3bfffabdf52c",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8d719cb1-180a-469b-bd18-1212881823eb",
          "id": "8d719cb1-180a-469b-bd18-1212881823eb",
          "molfile": "\n  Marvin  01132107202D          \n\n 17 17  0  0  1  0            999 V2000\n    4.2060   -4.1313    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.4924   -3.7172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2060   -4.9594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9195   -5.3734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6331   -4.9594    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.3467   -5.3734    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.0603   -4.9594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3467   -6.1927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6331   -4.1313    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.9195   -3.7172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3467   -3.7172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0603   -4.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7738   -3.7172    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.1967   -3.0213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3686   -3.0125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4874   -4.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4874   -4.9594    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1 10  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  9  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  1  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 13  1  0  0  0  0\n 17 16  1  0  0  0  0\nM  END",
          "smiles": "CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OCC(C)(CO)O",
          "formula": "C14H28O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "09fc2ca6-d7bf-44d1-819f-be05ee64597b"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "244.3709",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "INCOMPLETE",
      "uuid": "10d3c424-de54-493e-b291-a33ea409fafc",
      "version": "9",
      "structure": {
        "id": "97d668b2-5cbd-428a-b0f6-1c35f00e803d",
        "molfile": "\n  Marvin  01132107532D          \n\n 17 17  0  0  1  0            999 V2000\n    3.4924   -3.7172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0603   -4.9594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3467   -6.1927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1967   -3.0213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4874   -4.9594    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4874   -4.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2060   -4.1313    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.3686   -3.0125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2060   -4.9594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3467   -5.3734    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.0603   -4.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9195   -3.7172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3467   -3.7172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7738   -3.7172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9195   -5.3734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6331   -4.9594    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.6331   -4.1313    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n  9 15  1  0  0  0  0\n  7  1  1  1  0  0  0\n  2 10  1  0  0  0  0\n  3 10  1  0  0  0  0\n  4 14  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6 14  1  0  0  0  0\n  7 12  1  0  0  0  0\n  8 14  1  0  0  0  0\n  9  7  1  0  0  0  0\n 16 10  1  6  0  0  0\n 11 13  1  0  0  0  0\n 12 17  1  0  0  0  0\n 17 13  1  1  0  0  0\n 14 11  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
        "smiles": "C[C@H](C)[C@@H]1CC[C@@H](C)C[C@H]1OCC(C)(CO)O",
        "formula": "C14H28O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "244.3709",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "15ff62d5-1784-482f-a797-d6c6a152274b",
          "f030b382-e478-4433-b8e5-c3846bc84429"
        ],
        "stereo_centers": 4
      },
      "unii": "649M1Y2P72"
    }
  ]
}