{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a6cc1ea9-c960-4ab6-a941-f3282094bb87",
          "code": "618903-56-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=618903-56-3",
          "code_system": "CAS",
          "references": [
            "d0a5df0b-62a9-44ce-a22d-09ec98148ab2",
            "e2237d23-1092-4f9f-84a0-b7dab93fee38"
          ]
        },
        {
          "uuid": "cd534ca9-29ae-411f-9469-5df257677df1",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "d0a5df0b-62a9-44ce-a22d-09ec98148ab2"
          ]
        },
        {
          "uuid": "36a29b34-be04-4b93-a284-98993e861bfb",
          "code": "m10629",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10629?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d0a5df0b-62a9-44ce-a22d-09ec98148ab2"
          ]
        },
        {
          "uuid": "c2c31ef8-1cea-4f72-8be0-a85eb6db73a1",
          "code": "6857686",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6857686",
          "code_system": "PUBCHEM",
          "references": [
            "d0a5df0b-62a9-44ce-a22d-09ec98148ab2"
          ]
        },
        {
          "uuid": "de489513-e361-181c-9230-a50363011be8",
          "code": "Tetrahydrogestrinone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Tetrahydrogestrinone",
          "code_system": "WIKIPEDIA",
          "references": [
            "545bd1f9-feb9-502e-1c81-a23c2d154cae"
          ]
        },
        {
          "uuid": "61c76805-0e3a-2a89-7ccd-6c0c0c8910a1",
          "code": "DTXSID60210901",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60210901",
          "code_system": "EPA CompTox",
          "references": [
            "d113f65d-5cc6-1a9f-85e3-5c4a650958c4"
          ]
        },
        {
          "uuid": "cfe0d776-6238-0e0f-711c-276c4a6ffdfb",
          "code": "DB06870",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB06870",
          "code_system": "DRUG BANK",
          "references": [
            "f67b0877-216a-79d1-ec1f-48635d3ef21c"
          ]
        },
        {
          "uuid": "1047182f-5a49-4c0b-8529-6464143a5779",
          "code": "643MR6L9LB",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "90a6b7eb-7ad1-5190-ffa6-c8282bb864a2",
          "code": "Designer-drugs-Tetrahydrogestrinone",
          "comments": "Wikipedia|List of designer drugs|Androgens|Estranes",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "f67b0877-216a-79d1-ec1f-48635d3ef21c"
          ]
        },
        {
          "uuid": "f9374073-811a-952f-0556-fc9a91428fc8",
          "code": "300000036282",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "6e479c3e-3533-81fc-5460-84622caaadeb"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fa69a233-9cd2-41ad-80e1-096c5631b720",
          "name": "(17.ALPHA.)-13-ETHYL-17-HYDROXY-18,19-DINORPREGNA-4,9,11-TRIEN-3-ONE",
          "stdName": "(17.ALPHA.)-13-ETHYL-17-HYDROXY-18,19-DINORPREGNA-4,9,11-TRIEN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f4eda9b1-1389-4af0-b445-bc1465a508a5",
            "197a487d-a321-4785-97cc-1de5e3f5153e"
          ],
          "display_name": false
        },
        {
          "uuid": "0a855317-695f-43df-ac18-a44a0a73cbed",
          "name": "13.BETA.,17.ALPHA.-DIETHYL-17.BETA.-HYDROXYGON-4,9,11-TRIEN-3-ONE",
          "stdName": "13.BETA.,17.ALPHA.-DIETHYL-17.BETA.-HYDROXYGON-4,9,11-TRIEN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5444f094-8ad8-a09b-ab80-d43a3a563ff7"
          ],
          "display_name": false
        },
        {
          "uuid": "358cb061-eddc-458c-9616-00f76bde858f",
          "name": "18,19-DINORPREGNA-4,9,11-TRIEN-3-ONE, 13-ETHYL-17-HYDROXY-, (17.ALPHA.)-",
          "stdName": "18,19-DINORPREGNA-4,9,11-TRIEN-3-ONE, 13-ETHYL-17-HYDROXY-, (17.ALPHA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f4eda9b1-1389-4af0-b445-bc1465a508a5",
            "8ce5a326-836d-4afe-b000-787b1aa2eaa9"
          ],
          "display_name": false
        },
        {
          "uuid": "cac8bc79-c00b-4a26-9abd-aad3689ae2f9",
          "name": "TETRAHYDROGESTRINONE",
          "stdName": "TETRAHYDROGESTRINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c14d5440-81b0-4b0f-afc3-57caadf21590",
            "c0210545-d1b1-4578-aadf-86e5d2ac7a1d",
            "f4eda9b1-1389-4af0-b445-bc1465a508a5",
            "197a487d-a321-4785-97cc-1de5e3f5153e"
          ],
          "display_name": true
        },
        {
          "uuid": "6262425f-5f49-40cf-9f79-c8e8a465c33c",
          "name": "TETRAHYDROGESTRINONE [MI]",
          "stdName": "TETRAHYDROGESTRINONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f4eda9b1-1389-4af0-b445-bc1465a508a5",
            "197a487d-a321-4785-97cc-1de5e3f5153e"
          ],
          "display_name": false
        },
        {
          "uuid": "8891f04d-a4bc-4e12-bdad-96236acfcf0d",
          "name": "THG",
          "stdName": "THG",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f4eda9b1-1389-4af0-b445-bc1465a508a5",
            "8ce5a326-836d-4afe-b000-787b1aa2eaa9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c0210545-d1b1-4578-aadf-86e5d2ac7a1d",
          "citation": "Merk Index",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f4eda9b1-1389-4af0-b445-bc1465a508a5",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "197a487d-a321-4785-97cc-1de5e3f5153e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ce5a326-836d-4afe-b000-787b1aa2eaa9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0a5df0b-62a9-44ce-a22d-09ec98148ab2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391951000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f388a4d2-172e-44b1-876b-322f6d408b0d",
          "citation": "SRS import [643MR6L9LB]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=643MR6L9LB",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391951000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab2d08f7-a6b3-4214-addd-36fd04d99eb8",
          "citation": "MERK INDEX MONORAPH: MONO1500009359",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c14d5440-81b0-4b0f-afc3-57caadf21590",
          "citation": "TETRAHYDROGESTRINONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "545bd1f9-feb9-502e-1c81-a23c2d154cae",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Tetrahydrogestrinone",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d113f65d-5cc6-1a9f-85e3-5c4a650958c4",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=618903-56-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6e479c3e-3533-81fc-5460-84622caaadeb",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "5444f094-8ad8-a09b-ab80-d43a3a563ff7",
          "citation": "Controlled Substances - by DEA Drug Code Number",
          "url": "https://www.deadiversion.usdoj.gov/schedules/orangebook/d_cs_drugcode.pdf",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "f67b0877-216a-79d1-ec1f-48635d3ef21c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e2237d23-1092-4f9f-84a0-b7dab93fee38",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "76e30298-30f7-46ed-a140-2a7e0f14e12b",
          "id": "76e30298-30f7-46ed-a140-2a7e0f14e12b",
          "molfile": "\n  Marvin  01132106102D          \n\n 23 26  0  0  1  0            999 V2000\n    8.4974   -6.2820    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.2820   -6.0271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7669   -6.6945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2820   -7.3619    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.9465   -8.1156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9965   -7.7745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7110   -7.3619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4974   -7.1070    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.4399   -7.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6983   -8.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7829   -7.5195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0684   -7.1071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0684   -6.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3540   -5.8695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6395   -6.2820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9250   -5.8695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9250   -5.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2106   -4.6320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6395   -4.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3540   -5.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0684   -4.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7829   -5.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7829   -5.8695    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n  1  2  1  6  0  0  0\n  1  8  1  0  0  0  0\n  1 23  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  6  0  0  0\n  4  6  1  0  0  0  0\n  8  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  6  0  0  0\n  8 11  1  0  0  0  0\n  9 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 23 13  1  1  0  0  0\n 15 14  1  0  0  0  0\n 20 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\nM  END",
          "smiles": "CC[C@@]12C=CC3=C4CCC(=O)C=C4CC[C@H]3[C@@H]2CC[C@]1(CC)O",
          "formula": "C21H28O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d44659bb-2d88-4d23-8c99-f9e2a999c9c2"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "312.4466",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0c96e429-b3da-45ac-a4d2-be814dba03ab",
      "version": "8",
      "structure": {
        "id": "ccd74f71-3790-4ef6-90f3-8b751e887bf5",
        "molfile": "\n  Marvin  01132110352D          \n\n 25 28  0  0  1  0            999 V2000\n   10.7110   -7.3619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9965   -7.7745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2820   -7.3619    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.4974   -7.1070    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.4399   -7.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6983   -8.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4974   -6.2820    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.7801   -5.5052    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7829   -5.8695    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.4319   -5.2387    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0684   -6.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0684   -7.1071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7829   -7.5195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3540   -5.8695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3540   -5.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6395   -4.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9250   -5.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9250   -5.8695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6395   -6.2820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2106   -4.6320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0684   -4.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7829   -5.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2820   -6.0271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7669   -6.6945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9465   -8.1156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  6  0  0  0\n  5  6  1  0  0  0  0\n  7  4  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  6  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13  4  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 11  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 14  1  0  0  0  0\n 18 19  1  0  0  0  0\n 17 20  2  0  0  0  0\n 21 15  1  0  0  0  0\n 22 21  1  0  0  0  0\n  9 22  1  0  0  0  0\n  7 23  1  0  0  0  0\n 24 23  1  0  0  0  0\n  3 24  1  0  0  0  0\n  3 25  1  6  0  0  0\nM  END",
        "smiles": "CC[C@@]12C=CC3=C4CCC(=O)C=C4CC[C@@]3([H])[C@]2([H])CC[C@]1(CC)O",
        "formula": "C21H28O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "312.4466",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "f388a4d2-172e-44b1-876b-322f6d408b0d",
          "ab2d08f7-a6b3-4214-addd-36fd04d99eb8"
        ],
        "stereo_centers": 4
      },
      "unii": "643MR6L9LB"
    }
  ]
}