{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6d254576-7174-4f07-953e-27d9dfca8dd4",
          "code": "89740-11-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=89740-11-4",
          "code_system": "CAS",
          "references": [
            "19297d70-f1e3-4fce-8c84-409dd46b8a2d",
            "fd1c6ca4-ff43-483f-b60a-e378af16dadc"
          ]
        },
        {
          "uuid": "1eb91b69-9e77-4121-93d5-eba4c6aca5d1",
          "code": "23673620",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23673620",
          "code_system": "PUBCHEM",
          "references": [
            "19297d70-f1e3-4fce-8c84-409dd46b8a2d"
          ]
        },
        {
          "uuid": "035a6927-920f-f781-6a47-c8910b13d826",
          "code": "DTXSID4029064",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4029064",
          "code_system": "EPA CompTox",
          "references": [
            "8157d9a0-44d7-c022-57cb-9e738976eb62"
          ]
        },
        {
          "uuid": "a4ebdbbc-8fb0-4e99-acf1-7191b59bd92a",
          "code": "642JLH7JVI",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d1065a83-f712-5b75-3f25-fa1c1d956b4a",
          "code": "Sodium nonanoyloxybenzenesulfonate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sodium_nonanoyloxybenzenesulfonate",
          "code_system": "WIKIPEDIA",
          "references": [
            "e1889930-343d-38af-9148-e770f8338d7e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "491b94c4-88c4-4cfd-9a7a-c3bf8988d875",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "791490ed-3cc2-4a7f-9c50-36b9669f48dd",
            "refuuid": "805d10fa-014d-4514-9864-b489b6bd549b",
            "name": "NONANOIC ACID, 4-SULFOPHENYL ESTER",
            "unii": "OE4Q2PUW6J",
            "linking_id": "OE4Q2PUW6J",
            "ref_pname": "NONANOIC ACID, 4-SULFOPHENYL ESTER",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "928f26f5-bd5e-4e14-a1ed-1b5b37237df0",
          "name": "4-(NONANOYLOXY)BENZENESULFONIC ACID SODIUM SALT",
          "stdName": "4-(NONANOYLOXY)BENZENESULFONIC ACID SODIUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74669992-7414-4b0a-9360-08d3d53257f1"
          ],
          "display_name": false
        },
        {
          "uuid": "235742ae-f300-415d-a7c6-749ad62a4103",
          "name": "4-SULFOPHENYL NONANOATE SODIUM SALT",
          "stdName": "4-SULFOPHENYL NONANOATE SODIUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f9df0b8-fc1b-4d6a-b311-bfa35dcaea4f"
          ],
          "display_name": false
        },
        {
          "uuid": "e36e3f21-1f0c-432e-8520-9fa4c5a32847",
          "name": "J86.506K",
          "stdName": "J86.506K",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74669992-7414-4b0a-9360-08d3d53257f1"
          ],
          "display_name": false
        },
        {
          "uuid": "281b031e-f274-4b83-b226-1f66970752da",
          "name": "NONANOIC ACID 4-((SODIOOXY)SULFONYL)PHENYL ESTER",
          "stdName": "NONANOIC ACID 4-((SODIOOXY)SULFONYL)PHENYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74669992-7414-4b0a-9360-08d3d53257f1"
          ],
          "display_name": false
        },
        {
          "uuid": "2ff210a0-d338-4ceb-a899-9d6b00980ef4",
          "name": "NONANOIC ACID, 4-SULFOPHENYL ESTER, SODIUM SALT",
          "stdName": "NONANOIC ACID, 4-SULFOPHENYL ESTER, SODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39c9212d-f651-4fb4-88b5-4057ca09d735"
          ],
          "display_name": false
        },
        {
          "uuid": "a52bb82d-b48e-422a-a3cf-cb1c9c9a50ea",
          "name": "NONANOIC ACID, 4-SULFOPHENYL ESTER, SODIUM SALT (1:1)",
          "stdName": "NONANOIC ACID, 4-SULFOPHENYL ESTER, SODIUM SALT (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f9df0b8-fc1b-4d6a-b311-bfa35dcaea4f"
          ],
          "display_name": false
        },
        {
          "uuid": "bb16efaf-0d4e-4cf3-8602-b71a9decf81f",
          "name": "P-(NONANOYLOXY)BENZENESULFONIC ACID SODIUM SALT",
          "stdName": "P-(NONANOYLOXY)BENZENESULFONIC ACID SODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f9df0b8-fc1b-4d6a-b311-bfa35dcaea4f"
          ],
          "display_name": false
        },
        {
          "uuid": "e24336c7-eef1-43ac-b3b9-0d37db90aa22",
          "name": "P-SODIOSULFOPHENYL NONANOATE",
          "stdName": "P-SODIOSULFOPHENYL NONANOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f9df0b8-fc1b-4d6a-b311-bfa35dcaea4f"
          ],
          "display_name": false
        },
        {
          "uuid": "6e3a5b56-92a5-4a6d-bdbf-7b7e8cc23e81",
          "name": "SODIUM 4-(NONANOYLOXY)BENZENESULFONATE",
          "stdName": "SODIUM 4-(NONANOYLOXY)BENZENESULFONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f9df0b8-fc1b-4d6a-b311-bfa35dcaea4f"
          ],
          "display_name": true
        },
        {
          "uuid": "78112dee-d7f5-4f9e-b222-811c3aa3026b",
          "name": "SODIUM P-NONANOYLOXYBENZENESULFONATE",
          "stdName": "SODIUM P-NONANOYLOXYBENZENESULFONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f9df0b8-fc1b-4d6a-b311-bfa35dcaea4f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "39c9212d-f651-4fb4-88b5-4057ca09d735",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4f9df0b8-fc1b-4d6a-b311-bfa35dcaea4f",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74669992-7414-4b0a-9360-08d3d53257f1",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J86.506K",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J86.506K",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19297d70-f1e3-4fce-8c84-409dd46b8a2d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392095000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b09d1cb6-f365-4be1-92b5-3b74c5ee3294",
          "citation": "SRS import [642JLH7JVI]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=642JLH7JVI",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392095000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8157d9a0-44d7-c022-57cb-9e738976eb62",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=89740-11-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e1889930-343d-38af-9148-e770f8338d7e",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "fd1c6ca4-ff43-483f-b60a-e378af16dadc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bacdb2db-2998-4b51-9eeb-68d6e4fb70b9",
          "id": "bacdb2db-2998-4b51-9eeb-68d6e4fb70b9",
          "molfile": "\n  Marvin  01132109402D          \n\n  1  0  0  0  0  0            999 V2000\n    0.0000   -0.3290    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c4c7392e-89b0-4e2e-848b-26c3535fc1fc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "fbc72550-267b-4d34-96bd-50e3941fa36a",
          "id": "fbc72550-267b-4d34-96bd-50e3941fa36a",
          "molfile": "\n  Marvin  01132113022D          \n\n 21 21  0  0  0  0            999 V2000\n   11.3453   -1.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6419   -2.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9045   -1.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2010   -2.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4976   -1.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7602   -2.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0454   -1.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3193   -2.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6159   -1.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6159   -1.1119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9125   -2.3485    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1637   -1.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4717   -2.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7342   -1.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7342   -1.1119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4717   -0.7034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1637   -1.1119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9967   -0.7034    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2934   -0.3063    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.4279    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5883   -1.4068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 17  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 15 18  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 18 21  2  0  0  0  0\nM  CHG  1  19  -1\nM  END",
          "smiles": "CCCCCCCCC(=O)Oc1ccc(cc1)S(=O)(=O)[O-]",
          "formula": "C15H21O5S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4729f713-388a-499a-becf-347e3aab7501"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "313.3909",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c93e91e4-a358-43dc-bf31-c205c876615c",
      "version": "4",
      "structure": {
        "id": "6070e65b-bc6d-4442-9922-b7eb14f6b603",
        "molfile": "\n  Marvin  01132104592D          \n\n 22 21  0  0  0  0            999 V2000\n    5.6159   -1.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3193   -2.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0454   -1.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7602   -2.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4976   -1.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2010   -2.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9045   -1.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6419   -2.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3453   -1.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6159   -1.1119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9125   -2.3485    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1637   -1.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1637   -1.1119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4717   -2.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4717   -0.7034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7342   -1.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7342   -1.1119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9967   -0.7034    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4279    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5883   -1.4068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2934   -0.3063    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.3290    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 11  1  0  0  0  0\n  1 10  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 15 17  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  2  0  0  0  0\n 18 21  1  0  0  0  0\nM  CHG  2  21  -1  22   1\nM  END",
        "smiles": "CCCCCCCCC(=O)Oc1ccc(cc1)S(=O)(=O)[O-].[Na+]",
        "formula": "C15H21O5S.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "336.3807",
        "optical_activity": "NONE",
        "references": [
          "b09d1cb6-f365-4be1-92b5-3b74c5ee3294",
          "39c9212d-f651-4fb4-88b5-4057ca09d735"
        ],
        "stereo_centers": 0
      },
      "unii": "642JLH7JVI"
    }
  ]
}