{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "467467f3-99df-45bd-b00e-9257969a99d5", "code": "78-41-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=78-41-1", "code_system": "CAS", "references": [ "a4a2e09f-ec91-4085-80b9-7b14eed52a50", "0932a504-2864-49f8-9be0-58eb893df415" ] }, { "uuid": "842dd2e8-70a3-450e-bb9e-b132196a4190", "code": "D014308", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68014308", "code_system": "MESH", "references": [ "a4a2e09f-ec91-4085-80b9-7b14eed52a50" ] }, { "uuid": "857c4ad5-5c11-4ae4-8b9e-24de54b492f6", "code": "SUB11321MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "a4a2e09f-ec91-4085-80b9-7b14eed52a50" ] }, { "uuid": "5adccb43-5656-4a3e-91dd-55ec9d3043cd", "code": "1010", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1010", "code_system": "INN", "references": [ "a4a2e09f-ec91-4085-80b9-7b14eed52a50" ] }, { "uuid": "1aaecbb1-e58e-4dea-90c9-a37f8063cdc0", "code": "m979", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m979?q=authorize", "code_system": "MERCK INDEX", "references": [ "a4a2e09f-ec91-4085-80b9-7b14eed52a50" ] }, { "uuid": "eb6b6b23-6aa2-447b-98be-b68c1cb9af73", "code": "CHEMBL187709", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL187709", "code_system": "ChEMBL", "references": [ "a4a2e09f-ec91-4085-80b9-7b14eed52a50" ] }, { "uuid": "07b9561f-352c-4426-8af1-7790b780728b", "code": "6536", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6536", "code_system": "PUBCHEM", "references": [ "a4a2e09f-ec91-4085-80b9-7b14eed52a50" ] }, { "uuid": "91aa8ca2-d10c-40ec-b392-3d0317e80099", "code": "201-115-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.014", "code_system": "ECHA (EC/EINECS)", "references": [ "a4a2e09f-ec91-4085-80b9-7b14eed52a50" ] }, { "uuid": "7c566050-b8f9-c85a-9db5-1f0a83aea81f", "code": "DTXSID6046507", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6046507", "code_system": "EPA CompTox", "references": [ "b3e8a8a4-73e4-fda2-ed62-dc738cacf017" ] }, { "uuid": "2693d56d-4ee5-d234-b9f0-765baa4908c2", "code": "C152752", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C152752", "code_system": "NCI_THESAURUS", "references": [ "a4900af5-9d60-252b-e7c5-ed453f48d9ac" ] }, { "uuid": "8127f1e4-e6a5-9f79-c28f-3ad8a38545e2", "code": "C29703", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism[C78276]|Antilipidemic Agent", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29703", "code_system": "NCI_THESAURUS", "references": [ "80da8f24-a53d-e09c-1336-4a5554491a91" ] }, { "uuid": "641d966b-c6b2-470b-b8ec-136d16088b30", "code": "63S8C3RXGS", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "228f5b82-ebca-874a-c014-6dbd1b5c2b16", "code": "2761", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/2761", "code_system": "DRUG CENTRAL", "references": [ "80da8f24-a53d-e09c-1336-4a5554491a91" ] }, { "uuid": "a910c62f-63d4-8363-7792-092aba4216f5", "code": "Triparanol", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Triparanol", "code_system": "WIKIPEDIA", "references": [ "602c153a-0286-9309-28b2-ed7e8ff6898e" ] }, { "uuid": "2934e767-a147-3de2-2f5e-09595ab8190d", "code": "65345", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=65345", "code_system": "NSC", "references": [ "faddb529-342d-a122-9cd1-029cf9964988" ] }, { "uuid": "254236a8-f9f9-b4c0-7dcc-c6dae1b4f612", "code": "100000076949", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "3795367b-90af-ab31-30f5-fb2cd5613278" ] } ], "relationships": [ { "uuid": "44a02aa5-c38e-407c-a93b-457493286b3c", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "a6a1e5c6-8495-452a-99a1-3f58b902bb69", "refuuid": "6bfe8d47-4abe-4a05-810a-1f67cee11ce4", "name": "TRIPARANOL", "unii": "63S8C3RXGS", "linking_id": "63S8C3RXGS", "ref_pname": "TRIPARANOL", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "843fa3bc-3b92-49cb-a8a0-aa21fc4aef3b", "name": "2-P-CHLOROPHENYL-1-(P-(2-DIETHYLAMINOETHOXY)PHENYL)-1-P-TOLYLETHANOL", "stdName": "2-P-CHLOROPHENYL-1-(P-(2-DIETHYLAMINOETHOXY)PHENYL)-1-P-TOLYLETHANOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "55d574ea-235c-4082-85b6-45f7553c2417" ], "display_name": false }, { "uuid": "7ed38fa1-9e8e-439e-be97-06e72bd56b2c", "name": "NSC-65345", "stdName": "NSC-65345", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "b335375c-f629-4215-83ff-9f2533f8b2c4" ], "display_name": false }, { "uuid": "fb927acd-9aea-41e7-8e78-29409375ed1b", "name": "TRIPARANOL", "stdName": "TRIPARANOL", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "6c43216d-c58a-439e-bb77-98e720336304", "54f823f3-5788-4b35-b6ae-f52b3b886498", "f0e4de88-c522-4e99-a5c3-a15596e1e5d1", "0320746c-1674-491b-86b1-3ba4d71a8b50", "b860dfe3-5e24-43fc-9d4c-3fd4eb70bfe5", "e1cf3ab1-8468-4c0e-a8e5-ec147237fee8", "04831b45-7f28-4e39-8385-ecbe5e15ec87" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "0b5d2d38-371f-4193-b17f-506dec19ab41", "name_org": "INN" } ] }, { "uuid": "647ecbf0-6c1a-4f68-acb1-cd9cb4122fc9", "name": "TRIPARANOL [MI]", "stdName": "TRIPARANOL [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "04831b45-7f28-4e39-8385-ecbe5e15ec87" ], "display_name": false }, { "uuid": "73bede94-a6ca-c58e-e8f8-b654d040f6e2", "name": "Triparanol [WHO-DD]", "stdName": "TRIPARANOL [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2ea96111-eb2e-e383-d186-096e792a7ee2" ], "display_name": false }, { "uuid": "28207317-7f17-4894-9651-ecffa235203a", "name": "triparanol [INN]", "stdName": "TRIPARANOL [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f0e4de88-c522-4e99-a5c3-a15596e1e5d1" ], "display_name": false } ], "references": [ { "uuid": "6c43216d-c58a-439e-bb77-98e720336304", "citation": "USP Dictionary", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "55d574ea-235c-4082-85b6-45f7553c2417", "citation": "USP DICTIONARY 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f0e4de88-c522-4e99-a5c3-a15596e1e5d1", "citation": "INN Proposed List 11", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL11.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b860dfe3-5e24-43fc-9d4c-3fd4eb70bfe5", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "04831b45-7f28-4e39-8385-ecbe5e15ec87", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b335375c-f629-4215-83ff-9f2533f8b2c4", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a4a2e09f-ec91-4085-80b9-7b14eed52a50", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389675000, "tags": [ "NOMEN" ] }, { "uuid": "87c6b489-a05f-490e-a561-0d6d83045024", "citation": "SRS import [63S8C3RXGS]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=63S8C3RXGS", "doc_type": "SRS", "public_domain": true, "document_date": 1493389675000, "tags": [ "NOMEN" ] }, { "uuid": "03494af0-1bc7-496e-aecd-d55d599764d1", "citation": "USP Dictionary; INN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e1cf3ab1-8468-4c0e-a8e5-ec147237fee8", "citation": "TRIPARANOL [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "54f823f3-5788-4b35-b6ae-f52b3b886498", "citation": "TRIPARANOL [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "0320746c-1674-491b-86b1-3ba4d71a8b50", "citation": "TRIPARANOL [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "b3e8a8a4-73e4-fda2-ed62-dc738cacf017", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=78-41-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3795367b-90af-ab31-30f5-fb2cd5613278", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "a4900af5-9d60-252b-e7c5-ed453f48d9ac", "citation": "NCIT", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "80da8f24-a53d-e09c-1336-4a5554491a91", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "0932a504-2864-49f8-9be0-58eb893df415", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "602c153a-0286-9309-28b2-ed7e8ff6898e", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "faddb529-342d-a122-9cd1-029cf9964988", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "2ea96111-eb2e-e383-d186-096e792a7ee2", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a33731c9-7f5c-40e0-98cf-7c10f5feba31", "id": "a33731c9-7f5c-40e0-98cf-7c10f5feba31", "molfile": "\n Marvin 01132108292D \n\n 31 33 0 0 0 0 999 V2000\n 8.2047 -4.5138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4805 -4.9265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7668 -4.5112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7797 -3.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4935 -3.2783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0530 -4.9239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3444 -4.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6410 -4.8927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9453 -4.4878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9505 -3.6780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2445 -3.2679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5333 -3.6573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5307 -4.4827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2342 -4.8901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8117 -3.2393 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.7565 -2.6268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1006 -2.7462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1057 -1.9233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4205 -1.4639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4153 -0.6775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1239 -0.2284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1343 0.6385 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8559 -0.6593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8299 -1.5055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1239 -3.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1239 -4.4723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3634 -4.8979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3193 -4.5112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0564 -4.9421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3452 -3.7169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3997 -3.2809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 6 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 14 9 2 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 2 0 0 0 0\n 12 15 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 15 1 0 0 0 0\n 25 15 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 24 18 2 0 0 0 0\n 20 19 2 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 21 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 31 25 2 0 0 0 0\n 27 26 2 0 0 0 0\n 27 28 1 0 0 0 0\n 29 28 1 0 0 0 0\n 28 30 2 0 0 0 0\n 30 31 1 0 0 0 0\nM END", "smiles": "CCN(CC)CCOc1ccc(cc1)C(Cc2ccc(cc2)Cl)(c3ccc(C)cc3)O", "formula": "C27H32ClNO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "196e88e4-34c3-4499-b8c6-88a20589d9fc" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "438.0024", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "6bfe8d47-4abe-4a05-810a-1f67cee11ce4", "version": "12", "structure": { "id": "690edd05-2f6e-4bbf-9594-82bd5d2a3680", "molfile": "\n Marvin 01132105282D \n\n 31 33 0 0 0 0 999 V2000\n 1.8117 -3.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1239 -3.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5333 -3.6573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1006 -2.7462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1239 -4.4723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3997 -3.2809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5307 -4.4827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2445 -3.2679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7565 -2.6268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1057 -1.9233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1239 -0.2284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7668 -4.5112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9453 -4.4878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9505 -3.6780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2342 -4.8901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3634 -4.8979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3452 -3.7169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3193 -4.5112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1343 0.6385 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4205 -1.4639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8299 -1.5055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4153 -0.6775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8559 -0.6593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6410 -4.8927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3444 -4.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0530 -4.9239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4805 -4.9265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7797 -3.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0564 -4.9421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2047 -4.5138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4935 -3.2783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 2 1 0 0 0 0\n 6 2 2 0 0 0 0\n 7 3 2 0 0 0 0\n 8 3 1 0 0 0 0\n 1 9 1 0 0 0 0\n 10 4 1 0 0 0 0\n 11 23 1 0 0 0 0\n 12 26 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 8 2 0 0 0 0\n 15 7 1 0 0 0 0\n 16 5 2 0 0 0 0\n 17 6 1 0 0 0 0\n 18 17 2 0 0 0 0\n 19 11 1 0 0 0 0\n 20 10 2 0 0 0 0\n 21 10 1 0 0 0 0\n 22 20 1 0 0 0 0\n 23 21 2 0 0 0 0\n 24 13 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 12 1 0 0 0 0\n 28 12 1 0 0 0 0\n 29 18 1 0 0 0 0\n 30 27 1 0 0 0 0\n 31 28 1 0 0 0 0\n 15 13 2 0 0 0 0\n 11 22 2 0 0 0 0\n 16 18 1 0 0 0 0\nM END", "smiles": "CCN(CC)CCOc1ccc(cc1)C(Cc2ccc(cc2)Cl)(c3ccc(C)cc3)O", "formula": "C27H32ClNO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "438.0024", "optical_activity": "( + / - )", "references": [ "87c6b489-a05f-490e-a561-0d6d83045024", "03494af0-1bc7-496e-aecd-d55d599764d1", "f0e4de88-c522-4e99-a5c3-a15596e1e5d1" ], "stereo_centers": 1 }, "unii": "63S8C3RXGS" } ] }