{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bb0d7d23-77cc-4919-aef2-aa5bd38814af",
          "code": "2457-80-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2457-80-9",
          "code_system": "CAS",
          "references": [
            "02f4d0af-f4f0-4889-bb6c-55d97be76337",
            "1cf4a046-2100-4e90-bbc6-27f95c5538df"
          ]
        },
        {
          "uuid": "53f4e3d1-a568-4ade-b3f5-052dccb89360",
          "code": "C008500",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67008500",
          "code_system": "MESH",
          "references": [
            "02f4d0af-f4f0-4889-bb6c-55d97be76337"
          ]
        },
        {
          "uuid": "b10d02ce-7879-4a8c-9dd8-cab2ccb86b75",
          "code": "439176",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439176",
          "code_system": "PUBCHEM",
          "references": [
            "02f4d0af-f4f0-4889-bb6c-55d97be76337"
          ]
        },
        {
          "uuid": "12e6c062-fbd7-19f2-66f1-0642dfd836d9",
          "code": "DB02282",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB02282",
          "code_system": "DRUG BANK",
          "references": [
            "5ddbd3ab-426e-7a05-ff50-6ad610ac4126"
          ]
        },
        {
          "uuid": "9ad08c5c-4a9f-463f-b959-0d780b17fc69",
          "code": "634Z2VK3UQ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c9b78693-af14-3890-ac9b-289e94afed95",
          "code": "17509",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17509",
          "code_system": "CHEBI",
          "references": [
            "5ddbd3ab-426e-7a05-ff50-6ad610ac4126"
          ]
        },
        {
          "uuid": "2a5ccbca-5817-591b-4fa5-502aae7f9998",
          "code": "5′-Methylthioadenosine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/5%E2%80%B2-Methylthioadenosine",
          "code_system": "WIKIPEDIA",
          "references": [
            "18ddc816-46ad-be7b-0b4d-040191da2e4b"
          ]
        },
        {
          "uuid": "b483a233-7845-2d4c-4fd9-39d89b7e0fb5",
          "code": "DTXSID20179308",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20179308",
          "code_system": "EPA CompTox",
          "references": [
            "86b68660-ef55-6b79-84f9-2223e9fe40e8"
          ]
        },
        {
          "uuid": "85289813-a17e-d863-20fa-c70ff8ef897e",
          "code": "335422",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=335422",
          "code_system": "NSC",
          "references": [
            "232b6f19-ee57-30f6-30ea-6da4e2a5835c"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "ac92c3d0-0fe1-4639-8fd3-133de443f6f8",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "deebb9ff-3128-42da-b5f5-6e8f5b068745",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04925e73-e327-44b4-8d21-d6639ac1f62d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35748ff4-7a02-46a9-9a99-2f866b3093ca",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "891246ca-2e76-43bd-b0a2-fe5c02718841",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "491d44c4-7f05-45f9-a678-11be7d843506",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02f4d0af-f4f0-4889-bb6c-55d97be76337",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391325000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "41ca1920-a599-4a03-8e86-f68567928b07",
          "citation": "SRS import [634Z2VK3UQ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=634Z2VK3UQ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391325000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b1691ae-9994-4875-8eb9-84cb72940f33",
          "citation": "METHYLTHIOADENOSINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bcfd7183-63ae-ad16-0469-f34efebfed00",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2457-80-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "18ddc816-46ad-be7b-0b4d-040191da2e4b",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "b70bea9b-8bcf-459f-b1d7-87b822cd7777",
          "citation": "https://en.wikipedia.org/wiki/5%E2%80%B2-Methylthioadenosine",
          "url": "https://en.wikipedia.org/wiki/5%E2%80%B2-Methylthioadenosine",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "5ddbd3ab-426e-7a05-ff50-6ad610ac4126",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "1cf4a046-2100-4e90-bbc6-27f95c5538df",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "232b6f19-ee57-30f6-30ea-6da4e2a5835c",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "86b68660-ef55-6b79-84f9-2223e9fe40e8",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "44a0a114-7920-449d-a32b-f8bac7d12519",
          "id": "44a0a114-7920-449d-a32b-f8bac7d12519",
          "molfile": "\n  Marvin  01132103372D          \n\n 20 22  0  0  1  0            999 V2000\n   17.6409  -10.4288    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   16.9478  -10.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1660  -10.0862    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3001  -10.5862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3036   -9.9452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9691  -10.4336    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   19.4326   -8.7303    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4326   -7.8738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.8230   -7.4001    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.2183   -7.8587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4725   -7.4254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4725   -6.5435    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7118   -7.8587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7118   -8.7303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4725   -9.1636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.2183   -8.7303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7336  -11.2035    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   19.3565  -11.8372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9086  -11.2035    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   17.4233  -11.8609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  5  1  0  0  0  0\n 19  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  6  5  1  6  0  0  0\n  6  7  1  0  0  0  0\n 17  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 16  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 16  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  6  0  0  0\n 19 17  1  0  0  0  0\n 19 20  1  6  0  0  0\nM  END",
          "smiles": "CSC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc32)O1)O)O",
          "formula": "C11H15N5O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7dae7673-6ac7-47f5-8981-34c8986ea62c"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "297.335",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "756a9bd5-8e7b-41ca-bb0e-659b7b5c133e",
      "version": "13",
      "structure": {
        "id": "9295e778-3d1e-4866-b7d6-419ff14fee72",
        "molfile": "\n  Marvin  01132107362D          \n\n 20 22  0  0  1  0            999 V2000\n   16.1660  -10.0862    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4326   -8.7303    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n   18.9691  -10.4336    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   18.2183   -8.7303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.2183   -7.8587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.8230   -7.4001    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4326   -7.8738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4725   -7.4254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4725   -9.1636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7118   -7.8587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7118   -8.7303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4725   -6.5435    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3565  -11.8372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4233  -11.8609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3036   -9.9452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7336  -11.2035    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   17.9086  -11.2035    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   17.6409  -10.4288    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.9478  -10.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3001  -10.5862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  7  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n 15  3  1  0  0  0  0\n  3 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 15  1  0  0  0  0\n  9  4  1  0  0  0  0\n  8  5  1  0  0  0  0\n  8 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11  9  2  0  0  0  0\n 12  8  1  0  0  0  0\n  3  2  1  1  0  0  0\n 18 19  1  1  0  0  0\n 19  1  1  0  0  0  0\n 16 13  1  6  0  0  0\n 17 14  1  6  0  0  0\n  1 20  1  0  0  0  0\nM  END",
        "smiles": "CSC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc32)O1)O)O",
        "formula": "C11H15N5O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "297.335",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "41ca1920-a599-4a03-8e86-f68567928b07",
          "35748ff4-7a02-46a9-9a99-2f866b3093ca"
        ],
        "stereo_centers": 4
      },
      "unii": "634Z2VK3UQ",
      "relationships": [
        {
          "uuid": "90e2b496-b10e-4c5e-8a9e-aa1748f5edd6",
          "amount": {
            "uuid": "a4538216-713e-4800-8b28-59df8bbc1ea6"
          },
          "comments": "MTA competes with the activating cofactor S-adenosyl-l-methionine (SAM), causing a decrease in PRMT5 activity and sensitizes the MTAP-del cells to further loss of PRMT5 activity. ",
          "type": "TARGET->INHIBITOR",
          "related_substance": {
            "uuid": "dd0ce797-1897-4f70-b66d-277d006667f7",
            "refuuid": "45e7d5a2-07fa-4c0b-bf59-64f412485b8e",
            "name": "PROTEIN ARGININE N-METHYLTRANSFERASE 5",
            "unii": "T3CA3UN9ZA",
            "linking_id": "T3CA3UN9ZA",
            "ref_pname": "PROTEIN ARGININE N-METHYLTRANSFERASE 5",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0c95dfd5-73c1-422a-83d0-2d74151a23ef",
          "amount": {
            "uuid": "7bc4d048-7ae8-48d0-aa03-d068eccefcc9"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "b70bea9b-8bcf-459f-b1d7-87b822cd7777"
          ],
          "related_substance": {
            "uuid": "18f3257b-ce94-417e-b394-d3572f6833a7",
            "refuuid": "4edd6b33-0f30-4b26-8042-fd5548ff033f",
            "name": "S-METHYL-5'-THIOADENOSINE PHOSPHORYLASE",
            "unii": "3GAS7DA7UG",
            "linking_id": "3GAS7DA7UG",
            "ref_pname": "S-METHYL-5'-THIOADENOSINE PHOSPHORYLASE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0b4c6d36-7b0b-4619-a9b6-3054c80fb43c",
          "amount": {
            "uuid": "f83a4efc-9bd6-4ae6-b143-3d2591962999"
          },
          "type": "PARENT->METABOLITE",
          "references": [
            "b70bea9b-8bcf-459f-b1d7-87b822cd7777"
          ],
          "related_substance": {
            "uuid": "6663b805-284a-44a0-bed4-da51f6e249fb",
            "refuuid": "2ba2fda3-d656-4f99-b51c-7f9283bf7277",
            "name": "ADEMETIONINE",
            "unii": "7LP2MPO46S",
            "linking_id": "7LP2MPO46S",
            "ref_pname": "ADEMETIONINE",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "99cbbc53-fc89-438c-ba6f-43fb7cfda97c",
          "name": ".BETA.-D-RIBOFURANOSE, 1-(6-AMINO-9H-PURIN-9-YL)-1-DEOXY-5-S-METHYL-5-THIO-",
          "stdName": ".BETA.-D-RIBOFURANOSE, 1-(6-AMINO-9H-PURIN-9-YL)-1-DEOXY-5-S-METHYL-5-THIO-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04925e73-e327-44b4-8d21-d6639ac1f62d",
            "deebb9ff-3128-42da-b5f5-6e8f5b068745"
          ],
          "display_name": false
        },
        {
          "uuid": "45f8d106-6447-4c38-9a45-939974ab350c",
          "name": "5'-(METHYLTHIO)-5'-DEOXYADENOSINE",
          "stdName": "5'-(METHYLTHIO)-5'-DEOXYADENOSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04925e73-e327-44b4-8d21-d6639ac1f62d",
            "deebb9ff-3128-42da-b5f5-6e8f5b068745"
          ],
          "display_name": false
        },
        {
          "uuid": "7470b797-e89c-4125-9053-63af9d1a4978",
          "name": "5'-(METHYLTHIO)ADENOSINE",
          "stdName": "5'-(METHYLTHIO)ADENOSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04925e73-e327-44b4-8d21-d6639ac1f62d",
            "deebb9ff-3128-42da-b5f5-6e8f5b068745"
          ],
          "display_name": false
        },
        {
          "uuid": "6c5e08a0-1e17-48eb-8b8b-cf7b87066c16",
          "name": "5'-DEOXY(METHYLTHIO)ADENOSINE",
          "stdName": "5'-DEOXY(METHYLTHIO)ADENOSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04925e73-e327-44b4-8d21-d6639ac1f62d",
            "deebb9ff-3128-42da-b5f5-6e8f5b068745"
          ],
          "display_name": false
        },
        {
          "uuid": "ce569ac4-9749-408e-bfd8-f5870cd19878",
          "name": "5'-DEOXY-5'-(METHYLTHIO)ADENOSINE",
          "stdName": "5'-DEOXY-5'-(METHYLTHIO)ADENOSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04925e73-e327-44b4-8d21-d6639ac1f62d",
            "deebb9ff-3128-42da-b5f5-6e8f5b068745"
          ],
          "display_name": false
        },
        {
          "uuid": "1311b29c-4aff-4378-92d3-aaa2ffea5ed5",
          "name": "5'-DEOXY-5'-METHYLTHIOADENOSINE",
          "stdName": "5'-DEOXY-5'-METHYLTHIOADENOSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "491d44c4-7f05-45f9-a678-11be7d843506",
            "deebb9ff-3128-42da-b5f5-6e8f5b068745"
          ],
          "display_name": false
        },
        {
          "uuid": "ac9fc871-1df3-4a07-8fd2-31391aa2aef8",
          "name": "5'-METHYLTHIOADENOSINE",
          "stdName": "5'-METHYLTHIOADENOSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac92c3d0-0fe1-4639-8fd3-133de443f6f8",
            "deebb9ff-3128-42da-b5f5-6e8f5b068745"
          ],
          "display_name": true
        },
        {
          "uuid": "d41abe1f-00fc-46fe-9040-a52bae407fbf",
          "name": "5'-S-METHYL-5'-THIOADENOSINE",
          "stdName": "5'-S-METHYL-5'-THIOADENOSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04925e73-e327-44b4-8d21-d6639ac1f62d",
            "deebb9ff-3128-42da-b5f5-6e8f5b068745"
          ],
          "display_name": false
        },
        {
          "uuid": "c37eb9e5-7ec3-4c94-bc52-98e1569ba126",
          "name": "5'-S-METHYLTHIOADENOSINE",
          "stdName": "5'-S-METHYLTHIOADENOSINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04925e73-e327-44b4-8d21-d6639ac1f62d",
            "deebb9ff-3128-42da-b5f5-6e8f5b068745"
          ],
          "display_name": false
        },
        {
          "uuid": "192e06ae-18ad-4891-98c1-41e12a6a2ab1",
          "name": "7-(TETRAHYDRO-3,4-DIHYDROXY-5-(METHYLMERCAPTOMETHYL)-2-FURYL)ADENINE",
          "stdName": "7-(TETRAHYDRO-3,4-DIHYDROXY-5-(METHYLMERCAPTOMETHYL)-2-FURYL)ADENINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35748ff4-7a02-46a9-9a99-2f866b3093ca",
            "deebb9ff-3128-42da-b5f5-6e8f5b068745"
          ],
          "display_name": false
        },
        {
          "uuid": "8cf01c5a-ab58-43c0-8fb4-7acf8ed6a0d2",
          "name": "ADENOSINE, 5'-S-METHYL-5'-THIO-",
          "stdName": "ADENOSINE, 5'-S-METHYL-5'-THIO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04925e73-e327-44b4-8d21-d6639ac1f62d",
            "deebb9ff-3128-42da-b5f5-6e8f5b068745"
          ],
          "display_name": false
        },
        {
          "uuid": "207d265d-4e38-4180-aa4b-6ff397867893",
          "name": "METHYLTHIOADENOSINE",
          "stdName": "METHYLTHIOADENOSINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "ac92c3d0-0fe1-4639-8fd3-133de443f6f8",
            "891246ca-2e76-43bd-b0a2-fe5c02718841",
            "1b1691ae-9994-4875-8eb9-84cb72940f33",
            "deebb9ff-3128-42da-b5f5-6e8f5b068745"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "aafdb5cb-9dc8-4324-93b2-f5117397a31f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e6357a86-1eca-4cd3-9ad6-d04985bfac2d",
          "name": "NSC-335422",
          "stdName": "NSC-335422",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04925e73-e327-44b4-8d21-d6639ac1f62d",
            "deebb9ff-3128-42da-b5f5-6e8f5b068745"
          ],
          "display_name": false
        },
        {
          "uuid": "88f657f5-2914-4f7f-ba6c-6d23b901d81c",
          "name": "VITAMIN L(SUB 2)",
          "stdName": "VITAMIN L(SUB 2)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac92c3d0-0fe1-4639-8fd3-133de443f6f8",
            "deebb9ff-3128-42da-b5f5-6e8f5b068745"
          ],
          "display_name": false
        },
        {
          "uuid": "c1d32270-7e12-4b45-87bf-cca470bb17b4",
          "name": "VITAMIN L2",
          "stdName": "VITAMIN L2",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35748ff4-7a02-46a9-9a99-2f866b3093ca",
            "deebb9ff-3128-42da-b5f5-6e8f5b068745"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "cfb303e9-59fc-47d0-885c-09af852de077"
      }
    }
  ]
}