{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ca35534e-373a-4ae9-ba5f-b9027affa3e1",
          "code": "17670-95-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=17670-95-0",
          "code_system": "CAS",
          "references": [
            "a2f55d20-c54b-4924-97c1-a5a6963567a8",
            "ec00063e-8735-4e2e-99a9-f18bf9166a70"
          ]
        },
        {
          "uuid": "e3160208-5f7e-4512-8334-877aaf58d555",
          "code": "241-643-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.037.842",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a2f55d20-c54b-4924-97c1-a5a6963567a8"
          ]
        },
        {
          "uuid": "b6c10748-c2ad-49c1-a089-4d29f358b099",
          "code": "87219",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/87219",
          "code_system": "PUBCHEM",
          "references": [
            "a2f55d20-c54b-4924-97c1-a5a6963567a8"
          ]
        },
        {
          "uuid": "91508816-875b-7a90-d607-4947a8918b8e",
          "code": "DTXSID80170174",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80170174",
          "code_system": "EPA CompTox",
          "references": [
            "5f982289-0cb8-88ff-1d5b-c8af061f60f3"
          ]
        },
        {
          "uuid": "b2c82b9b-f116-43a9-af21-74ee57f2dd92",
          "code": "6331LJQ1Y6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8496762c-9a45-4846-b379-7204d9be6f11",
          "name": "BIS-CAPRYLYLAMINOETHYL GLYCINE",
          "stdName": "BIS-CAPRYLYLAMINOETHYL GLYCINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e141c28b-d23d-4845-ae9a-dba1b8ef6bbf",
            "b002c37a-aed3-4aad-9981-15397c76e0fa",
            "e58763c1-d77c-4a83-ae25-4ee253806a8d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "63349141-711e-4556-ab74-50b99a8de1de",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "6682b36b-a5ba-4f71-b68b-3827dd7e5290",
          "name": "GLYCINE, N,N-BIS(2-(OCTYLAMINO)ETHYL)-",
          "stdName": "GLYCINE, N,N-BIS(2-(OCTYLAMINO)ETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "001defa3-d01a-4b20-96e6-ae52fb1a9de1",
            "e58763c1-d77c-4a83-ae25-4ee253806a8d"
          ],
          "display_name": false
        },
        {
          "uuid": "0b11ced8-2f5f-4887-b1a3-4d095ede5474",
          "name": "N,N-BIS(2-(OCTYLAMINO)ETHYL)GLYCINE",
          "stdName": "N,N-BIS(2-(OCTYLAMINO)ETHYL)GLYCINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "001defa3-d01a-4b20-96e6-ae52fb1a9de1",
            "e58763c1-d77c-4a83-ae25-4ee253806a8d"
          ],
          "display_name": false
        },
        {
          "uuid": "a576e8cd-8d0e-4e50-979e-95db6252d555",
          "name": "OBANOL 516",
          "stdName": "OBANOL 516",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b002c37a-aed3-4aad-9981-15397c76e0fa",
            "e58763c1-d77c-4a83-ae25-4ee253806a8d"
          ],
          "display_name": false
        },
        {
          "uuid": "9afc0008-6365-489d-9f4e-729b45488239",
          "name": "OBANOL MEIJI",
          "stdName": "OBANOL MEIJI",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "001defa3-d01a-4b20-96e6-ae52fb1a9de1",
            "e58763c1-d77c-4a83-ae25-4ee253806a8d"
          ],
          "display_name": false
        },
        {
          "uuid": "80ecb272-b199-4912-a9ec-b14bb47d2944",
          "name": "OBAZOLIN 516",
          "stdName": "OBAZOLIN 516",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b002c37a-aed3-4aad-9981-15397c76e0fa",
            "e58763c1-d77c-4a83-ae25-4ee253806a8d"
          ],
          "display_name": false
        },
        {
          "uuid": "a12448c9-bb43-4bfb-b76c-f8bc681b85be",
          "name": "OBAZOLIN 516S",
          "stdName": "OBAZOLIN 516S",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b002c37a-aed3-4aad-9981-15397c76e0fa",
            "e58763c1-d77c-4a83-ae25-4ee253806a8d"
          ],
          "display_name": false
        },
        {
          "uuid": "452e1b77-7fc5-485b-913a-4b1f8d24e8e8",
          "name": "TG 580 (AMINO ACID)",
          "stdName": "TG 580 (AMINO ACID)",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "001defa3-d01a-4b20-96e6-ae52fb1a9de1",
            "e58763c1-d77c-4a83-ae25-4ee253806a8d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b002c37a-aed3-4aad-9981-15397c76e0fa",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e58763c1-d77c-4a83-ae25-4ee253806a8d",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "001defa3-d01a-4b20-96e6-ae52fb1a9de1",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a2f55d20-c54b-4924-97c1-a5a6963567a8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391419000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad974863-cb7a-4627-a531-ef1f5ef35b63",
          "citation": "SRS import [6331LJQ1Y6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6331LJQ1Y6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391419000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e141c28b-d23d-4845-ae9a-dba1b8ef6bbf",
          "citation": "BIS-CAPRYLYLAMINOETHYL GLYCINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5f982289-0cb8-88ff-1d5b-c8af061f60f3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=17670-95-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ec00063e-8735-4e2e-99a9-f18bf9166a70",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "42870b1f-97fa-4fbe-9438-ee9a13df7274",
          "id": "42870b1f-97fa-4fbe-9438-ee9a13df7274",
          "molfile": "\n  Marvin  01132103312D          \n\n 27 26  0  0  0  0            999 V2000\n    2.9767   -1.3606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3892   -2.0751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2142   -2.0751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6267   -2.7895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4517   -2.7895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8643   -3.5040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6893   -3.5040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1017   -4.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9267   -4.2185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3393   -4.9330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9267   -5.6475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3393   -6.3620    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1643   -6.3620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5767   -7.0764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4017   -7.0764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8143   -7.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6393   -7.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0517   -8.5053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8767   -8.5053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2893   -9.2198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1143   -9.2198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5267   -9.9343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3517   -9.9343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9267   -7.0764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3393   -7.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9267   -8.5054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1643   -7.7909    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 24  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  2  0  0  0  0\nM  END",
          "smiles": "CCCCCCCCNCCN(CCNCCCCCCCC)CC(=O)O",
          "formula": "C22H47N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "de50a93b-8e9d-4727-9e6c-c2392344f188"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "385.6283",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0d54b5da-e557-4a2b-a523-15eb4a374125",
      "version": "4",
      "structure": {
        "id": "a135f73b-c349-4c5d-a28d-5155f7065bf1",
        "molfile": "\n  Marvin  01132108222D          \n\n 27 26  0  0  0  0            999 V2000\n    8.3393   -6.3620    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9267   -7.0764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3393   -7.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9267   -8.5054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1643   -7.7909    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9267   -5.6475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3393   -4.9330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9767   -1.3606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3892   -2.0751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2142   -2.0751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6267   -2.7895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4517   -2.7895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8643   -3.5040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6893   -3.5040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1017   -4.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9267   -4.2185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1643   -6.3620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5767   -7.0764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3517   -9.9343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5267   -9.9343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1143   -9.2198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2893   -9.2198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8767   -8.5053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0517   -8.5053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6393   -7.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8143   -7.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4017   -7.0764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n 16  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n  6  1  1  0  0  0  0\n 18 17  1  0  0  0  0\n 27 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n  1 17  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCCNCCN(CCNCCCCCCCC)CC(=O)O",
        "formula": "C22H47N3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "385.6283",
        "optical_activity": "NONE",
        "references": [
          "001defa3-d01a-4b20-96e6-ae52fb1a9de1",
          "ad974863-cb7a-4627-a531-ef1f5ef35b63"
        ],
        "stereo_centers": 0
      },
      "unii": "6331LJQ1Y6"
    }
  ]
}