{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "66e343bc-b625-42d3-85c9-8326f89f0728",
          "code": "14984-34-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14984-34-0",
          "code_system": "CAS",
          "references": [
            "4a5dca8a-672e-4f3f-8fda-a22483d932c9",
            "4a9118db-03a7-4717-a311-fa8bc70de015"
          ]
        },
        {
          "uuid": "e446413d-8a1c-4fb0-8d1d-3be65e9bad39",
          "code": "239-065-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.035.499",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4a5dca8a-672e-4f3f-8fda-a22483d932c9"
          ]
        },
        {
          "uuid": "b68eb52a-9b5c-4d71-9578-e3542affd6f9",
          "code": "SUB13987MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4a5dca8a-672e-4f3f-8fda-a22483d932c9"
          ]
        },
        {
          "uuid": "14e9aacc-ea3b-4540-83c0-92056490ccf9",
          "code": "CHEMBL2104556",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104556",
          "code_system": "ChEMBL",
          "references": [
            "4a5dca8a-672e-4f3f-8fda-a22483d932c9"
          ]
        },
        {
          "uuid": "ec51cecb-b03c-4577-9e8e-42d3c0ff1159",
          "code": "23677976",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23677976",
          "code_system": "PUBCHEM",
          "references": [
            "4a5dca8a-672e-4f3f-8fda-a22483d932c9"
          ]
        },
        {
          "uuid": "f3a4bef3-bbb1-4445-8439-39566d054084",
          "code": "631391W27S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2727fb55-074e-3cfd-20d1-2ebcda1c2b87",
          "code": "DTXSID40933767",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40933767",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "136183ea-e9fc-1c12-475a-91d4b27fb362",
          "code": "100000078193",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "1f593bac-9b02-15f1-d3d2-caf53eab98b2"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "eae48442-6e40-450a-9bda-2d7727135d8d",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "82242309-edf8-49f8-a7e7-b30af9a73b38",
            "refuuid": "e0e303e5-bcda-4865-999c-ec4004f1ce80",
            "name": "GLUCURONIC ACID",
            "unii": "8A5D83Q4RW",
            "linking_id": "8A5D83Q4RW",
            "ref_pname": "GLUCURONIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "060f5e60-6013-447f-9973-2b68cdea91d3",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "42ee39cf-a649-4f33-a4d3-795a8ab4d17e",
            "refuuid": "e0e303e5-bcda-4865-999c-ec4004f1ce80",
            "name": "GLUCURONIC ACID",
            "unii": "8A5D83Q4RW",
            "linking_id": "8A5D83Q4RW",
            "ref_pname": "GLUCURONIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "06994155-8e1f-8baf-c745-bd91ea358d16",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "4a9118db-03a7-4717-a311-fa8bc70de015"
          ],
          "related_substance": {
            "uuid": "298bdae7-fa23-436e-a2c8-d75e388f99a8",
            "refuuid": "5e5c93d1-42ed-455d-aef1-546972d813cc",
            "name": "SODIUM GLUCURONATE MONOHYDRATE",
            "unii": "GLV8D2BUPD",
            "linking_id": "GLV8D2BUPD",
            "ref_pname": "SODIUM GLUCURONATE MONOHYDRATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ee4a8c13-d595-45ca-94d3-9ef76275d698",
          "name": "GLUCURONATE SODIUM",
          "stdName": "GLUCURONATE SODIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60779645-3b0e-4f1f-8b1e-574639965cbb",
            "6951b55c-3c94-4512-be66-ea4722a58286"
          ],
          "display_name": false
        },
        {
          "uuid": "ceb48ca9-b0c9-4a7e-b1e5-34c213069f75",
          "name": "GLUCURONIC ACID SODIUM",
          "stdName": "GLUCURONIC ACID SODIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e9cfd53-fc53-4404-a847-81d905519cf9",
            "0123cb02-0404-466a-b5de-5c85f0cdee09",
            "6951b55c-3c94-4512-be66-ea4722a58286"
          ],
          "display_name": false
        },
        {
          "uuid": "1b90c6ba-a683-ea1f-1cf1-e8e1b11d0c05",
          "name": "Glucuronic acid sodium [WHO-DD]",
          "stdName": "GLUCURONIC ACID SODIUM [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e71e887-2a7f-57db-baa2-0cc238d7760e"
          ],
          "display_name": false
        },
        {
          "uuid": "ce101fed-e9aa-40ca-9c8e-6b4f46aa9bf5",
          "name": "SODIUM D-GLUCURONATE",
          "stdName": "SODIUM D-GLUCURONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c94a936-dfcd-4f13-a92f-9ac86a35d4c1",
            "6951b55c-3c94-4512-be66-ea4722a58286"
          ],
          "display_name": false
        },
        {
          "uuid": "348b95ef-6ea6-4576-8ba9-1d83457672c7",
          "name": "SODIUM GLUCURONATE",
          "stdName": "SODIUM GLUCURONATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d349cb2-e55e-453b-83b4-35992f824eb5",
            "e934dd98-026d-47a0-bf9f-e65750e3c454",
            "c1f7df6f-eac5-4bbb-8bd0-47dc3c798ad1",
            "e924d198-c661-46ed-9baa-1a824cea1643",
            "7dc325b4-697e-4836-8b4b-e275720beea7",
            "6951b55c-3c94-4512-be66-ea4722a58286"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "59a3b372-0894-4f2f-8ae2-36f798dd2d09",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "ba698f4d-a97f-458a-89b5-8ec9c40b5a86",
          "name": "SODIUM GLUCURONATE [MART.]",
          "stdName": "SODIUM GLUCURONATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e924d198-c661-46ed-9baa-1a824cea1643"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e934dd98-026d-47a0-bf9f-e65750e3c454",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3c94a936-dfcd-4f13-a92f-9ac86a35d4c1",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6951b55c-3c94-4512-be66-ea4722a58286",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e924d198-c661-46ed-9baa-1a824cea1643",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7dc325b4-697e-4836-8b4b-e275720beea7",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0123cb02-0404-466a-b5de-5c85f0cdee09",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60779645-3b0e-4f1f-8b1e-574639965cbb",
          "citation": "evmpd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a5dca8a-672e-4f3f-8fda-a22483d932c9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389754000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb0589c8-e81f-49d0-b018-77fe3aa105ba",
          "citation": "SRS import [631391W27S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=631391W27S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389754000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1f7df6f-eac5-4bbb-8bd0-47dc3c798ad1",
          "citation": "SODIUM GLUCURONATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8d349cb2-e55e-453b-83b4-35992f824eb5",
          "citation": "SODIUM GLUCURONATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3e9cfd53-fc53-4404-a847-81d905519cf9",
          "citation": "GLUCURONIC ACID SODIUM [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d2a01678-2675-1679-f8fd-e16e5c3103db",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1f593bac-9b02-15f1-d3d2-caf53eab98b2",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "4a9118db-03a7-4717-a311-fa8bc70de015",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4e71e887-2a7f-57db-baa2-0cc238d7760e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bb830e90-91c6-4326-b466-c71c4509ac21",
          "id": "bb830e90-91c6-4326-b466-c71c4509ac21",
          "molfile": "\n  Marvin  01132109422D          \n\n  1  0  0  0  1  0            999 V2000\n   10.6304   -3.7436    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1d7886a9-386a-492b-98a5-24b3ba4095fa"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "a7a073d3-bec2-4d7f-a6c9-f634827b6f2a",
          "id": "a7a073d3-bec2-4d7f-a6c9-f634827b6f2a",
          "molfile": "\n  Marvin  01132108422D          \n\n 13 12  0  0  1  0            999 V2000\n    7.2748   -3.8917    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.2748   -4.7202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9922   -3.4798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7097   -3.8871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9922   -2.6514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5576   -3.4845    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.5576   -2.6560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8495   -3.8963    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.8495   -4.7248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1320   -3.4891    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.1320   -2.6607    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.4146   -3.9010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6974   -3.4937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  6  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  6  7  1  6  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  6  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  6  0  0  0\n 10 12  1  0  0  0  0\n 13 12  2  0  0  0  0\nM  CHG  1  11  -1\nM  END",
          "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O)O)O)[O-]",
          "formula": "C6H9O7",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e26bc934-1a47-4602-a250-7fbe222b223c"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "193.1317",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "81215e36-8dc0-4aa1-8be0-ae610b2d3bc2",
      "version": "10",
      "structure": {
        "id": "a5066467-ee1f-4cac-a88a-1d03ad16608c",
        "molfile": "\n  Marvin  01132108342D          \n\n 14 12  0  0  1  0            999 V2000\n    3.6974   -3.4937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4146   -3.9010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1320   -3.4891    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.8495   -3.8963    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.8495   -4.7248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5576   -3.4845    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.5576   -2.6560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2748   -3.8917    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.9922   -3.4798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7097   -3.8871    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.9922   -2.6514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2748   -4.7202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1320   -2.6607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6304   -3.7436    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  6  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n  8 12  1  1  0  0  0\n  3 13  1  6  0  0  0\nM  CHG  2  10  -1  14   1\nM  END",
        "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](C(=O)[O-])O)O)O)O.[Na+]",
        "formula": "C6H9O7.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "216.1215",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e934dd98-026d-47a0-bf9f-e65750e3c454",
          "fb0589c8-e81f-49d0-b018-77fe3aa105ba"
        ],
        "stereo_centers": 4
      },
      "unii": "631391W27S"
    }
  ]
}