{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "94bb142c-4199-445f-b59e-fbfbb3f018f1",
          "code": "N0000007888",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Inorganic Chemicals [Chemical/Ingredient]|Elements [Chemical/Ingredient]|Metals, Heavy [Chemical/Ingredient]|Bismuth [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000007888",
          "code_system": "NDF-RT",
          "references": [
            "b2a42ee1-c627-41fa-842f-6e3b0abf886a"
          ]
        },
        {
          "uuid": "bb297400-c1d6-4a62-a3de-caa610c31906",
          "code": "N0000007888",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Inorganic Chemicals [Chemical/Ingredient]|Metals [Chemical/Ingredient]|Metals, Heavy [Chemical/Ingredient]|Bismuth [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000007888",
          "code_system": "NDF-RT",
          "references": [
            "b2a42ee1-c627-41fa-842f-6e3b0abf886a"
          ]
        },
        {
          "uuid": "aa213176-fca3-42e9-b74d-90dfed9e2736",
          "code": "N0000180183",
          "comments": "Established Pharmacologic Class [EPC]|Bismuth [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000180183",
          "code_system": "NDF-RT",
          "references": [
            "b2a42ee1-c627-41fa-842f-6e3b0abf886a"
          ]
        },
        {
          "uuid": "6eaabef4-45fc-49d3-aca8-28c74e116a5f",
          "code": "14882-18-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14882-18-9",
          "code_system": "CAS",
          "references": [
            "b2a42ee1-c627-41fa-842f-6e3b0abf886a",
            "01c52cb9-3b62-4960-ac2f-32dae811a571"
          ]
        },
        {
          "uuid": "c84c7d5b-03d5-4562-b571-beabde5da45d",
          "code": "C1020",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1020",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b2a42ee1-c627-41fa-842f-6e3b0abf886a"
          ]
        },
        {
          "uuid": "e7e83b23-b1dd-4d58-9476-414d5825632f",
          "code": "C015715",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67015715",
          "code_system": "MESH",
          "references": [
            "b2a42ee1-c627-41fa-842f-6e3b0abf886a"
          ]
        },
        {
          "uuid": "43b3ed41-658c-43f5-b16f-3d54200881bc",
          "code": "BISMUTH SUBSALICYLATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bismuth_subsalicylate",
          "code_system": "WIKIPEDIA",
          "references": [
            "b2a42ee1-c627-41fa-842f-6e3b0abf886a"
          ]
        },
        {
          "uuid": "221c08be-e0d7-4450-b479-ed2340cbf527",
          "code": "21 CFR 335.10",
          "comments": "PART 335 -- ANTIDIARRHEAL DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE|Subpart B--Active Ingredients|Sec. 335.10 Antidiarrheal active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=335.10",
          "code_system": "CFR",
          "references": [
            "b2a42ee1-c627-41fa-842f-6e3b0abf886a"
          ]
        },
        {
          "uuid": "c0edafa2-c5eb-4094-a30a-f9600397dd93",
          "code": "21 CFR 335.50",
          "comments": "PART 335 -- ANTIDIARRHEAL DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE|Subpart C?Labeling|Sec. 335.50 Labeling of antidiarrheal drug products.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=335.50",
          "code_system": "CFR",
          "references": [
            "b2a42ee1-c627-41fa-842f-6e3b0abf886a"
          ]
        },
        {
          "uuid": "a9203439-967c-4401-a5f7-573e64382d75",
          "code": "19478",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/19478/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "b2a42ee1-c627-41fa-842f-6e3b0abf886a"
          ]
        },
        {
          "uuid": "b5299187-fc66-4539-9262-855f14f0e7e4",
          "code": "m2555",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2555?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b2a42ee1-c627-41fa-842f-6e3b0abf886a"
          ]
        },
        {
          "uuid": "1f67e5d6-c361-412d-948e-827c2f850421",
          "code": "DB01294",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01294",
          "code_system": "DRUG BANK",
          "references": [
            "b2a42ee1-c627-41fa-842f-6e3b0abf886a"
          ]
        },
        {
          "uuid": "4d55e155-0be4-499a-87b6-061f6bb6162e",
          "code": "SUB13093MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b2a42ee1-c627-41fa-842f-6e3b0abf886a"
          ]
        },
        {
          "uuid": "10a993f3-1067-4b61-8033-c5865acd7e44",
          "code": "CHEMBL1120",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1120",
          "code_system": "ChEMBL",
          "references": [
            "b2a42ee1-c627-41fa-842f-6e3b0abf886a"
          ]
        },
        {
          "uuid": "32979322-0ee8-49aa-8bd0-28407c2f9504",
          "code": "238-953-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.035.397",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b2a42ee1-c627-41fa-842f-6e3b0abf886a"
          ]
        },
        {
          "uuid": "c047ea22-0a7d-4907-b6be-1b36116fa750",
          "code": "53629521",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/53629521",
          "code_system": "PUBCHEM",
          "references": [
            "b2a42ee1-c627-41fa-842f-6e3b0abf886a"
          ]
        },
        {
          "uuid": "9580ae98-1d20-a47b-1942-2cd4f2ced124",
          "code": "332",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/332",
          "code_system": "HSDB",
          "references": [
            "12bd98f9-f33d-62c7-56c4-59ebb2bf6898"
          ]
        },
        {
          "uuid": "e12f4493-0c86-dfad-3a79-46ee5ea7adb9",
          "code": "DTXSID6024622",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6024622",
          "code_system": "EPA CompTox",
          "references": [
            "faafd1d4-a7ab-8e38-410a-8c16d93b0e5a"
          ]
        },
        {
          "uuid": "fc739ee6-8994-10c8-be8f-754c516dd822",
          "code": "C2080",
          "comments": "Pharmacologic Substance[C1909]|Protective Agent[C26170]|Chemoprotective Agent[C2459]|Cytoprotective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2080",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8990b639-285d-250e-89f4-499a4d70a275"
          ]
        },
        {
          "uuid": "569f3583-a80f-072a-39cb-ab7b70296b71",
          "code": "C266",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism[C78276]|Antidiarrheal Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C266",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8990b639-285d-250e-89f4-499a4d70a275"
          ]
        },
        {
          "uuid": "59d58b2f-933d-63cb-d9bc-7c3f53186f79",
          "code": "1075553",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1075553",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "8990b639-285d-250e-89f4-499a4d70a275"
          ]
        },
        {
          "uuid": "d1a795d6-c3a5-83ea-3e73-324752d8a8b0",
          "code": "Bismuth Subsalicylate",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM449/",
          "code_system": "LACTMED",
          "references": [
            "8990b639-285d-250e-89f4-499a4d70a275"
          ]
        },
        {
          "uuid": "88b02cf5-f12b-ba5b-f653-ba56a8679e52",
          "code": "4257",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4257",
          "code_system": "DRUG CENTRAL",
          "references": [
            "8990b639-285d-250e-89f4-499a4d70a275"
          ]
        },
        {
          "uuid": "0d35f32f-108a-47db-b505-977637800a76",
          "code": "62TEY51RR1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e0e421dd-ab90-91af-e5fe-41e602531596",
          "code": "261649",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:261649",
          "code_system": "CHEBI",
          "references": [
            "8990b639-285d-250e-89f4-499a4d70a275"
          ]
        },
        {
          "uuid": "e90b11b5-7787-b827-61bc-696dbf30d7eb",
          "code": "100000076869",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d27e8035-7317-e6ea-9f09-54a2e613d734"
          ]
        },
        {
          "uuid": "65c76f25-cc8f-df0b-b091-c7be95e91a78",
          "code": "62TEY51RR1",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=62TEY51RR1",
          "code_system": "DAILYMED",
          "references": [
            "764e9345-0dd0-3c09-4fed-67320dfd7bc1"
          ]
        },
        {
          "uuid": "075cd3e3-b3fe-3bd0-56a6-ce0800f6cc79",
          "code": "759117",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759117",
          "code_system": "NSC",
          "references": [
            "07feef64-b80c-7bcd-21ba-91be93c6a13f"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "2896cf26-9867-4266-974b-5f365605cc44",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d99b2e85-3314-44e4-93a9-b258a4858b14",
            "refuuid": "77ecc185-155e-4f2d-8b74-81c91be840d2",
            "name": "Salicylic acid",
            "unii": "O414PZ4LPZ",
            "linking_id": "O414PZ4LPZ",
            "ref_pname": "Salicylic acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bc9cd589-ba3a-43e1-a6cf-36e48efdf84e",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "f36dd2fc-e5e2-4870-b870-081584c3122b",
            "refuuid": "6735e420-936a-4d22-9c79-4a4ec5b35246",
            "name": "BISMUTH CATION",
            "unii": "ZS9CD1I8YE",
            "linking_id": "ZS9CD1I8YE",
            "ref_pname": "BISMUTH CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6b17e822-6972-4451-9b5d-a0b9a437212c",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "3d52c253-4e8b-4ae6-a226-0a73e32608d3",
            "refuuid": "77ecc185-155e-4f2d-8b74-81c91be840d2",
            "name": "Salicylic acid",
            "unii": "O414PZ4LPZ",
            "linking_id": "O414PZ4LPZ",
            "ref_pname": "Salicylic acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6b96dfda-47b6-4bc3-942e-9e1efa0e5a84",
          "amount": {
            "uuid": "2bb866de-dc0e-4092-a186-ae0ad95481b4",
            "low": 90,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "references": [
            "9356402c-b1a5-a790-29c2-e5b054555c6e"
          ],
          "related_substance": {
            "uuid": "b559047a-8c88-4bff-9811-266f34e69c12",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2573049a-e44d-48d0-a07d-c48e26b186db",
          "name": "(2-HYDROXYBENZOATO-O(SUP 1))-OXOBISMUTH",
          "stdName": "(2-HYDROXYBENZOATO-O(SUP 1))-OXOBISMUTH",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee1c0cba-e337-4090-901e-7a8c2de7cf46",
            "0138f877-79e9-4aca-bc0e-12f7402c048c"
          ],
          "display_name": false
        },
        {
          "uuid": "3fd98daf-e221-47b4-a870-ee7cbe162fcb",
          "name": "2-HYDROXYBENZOIC ACID BISMUTH (3+) SALT",
          "stdName": "2-HYDROXYBENZOIC ACID BISMUTH (3+) SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9d3095a-d571-436b-b020-6757323796d6",
            "0138f877-79e9-4aca-bc0e-12f7402c048c"
          ],
          "display_name": false
        },
        {
          "uuid": "a016e36c-3b6b-4aab-a821-d5f84f32500f",
          "name": "4H-1,3,2-BENZODIOXABISMIN-4-ONE, 2-HYDROXY-",
          "stdName": "4H-1,3,2-BENZODIOXABISMIN-4-ONE, 2-HYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee1c0cba-e337-4090-901e-7a8c2de7cf46",
            "0138f877-79e9-4aca-bc0e-12f7402c048c"
          ],
          "display_name": false
        },
        {
          "uuid": "ef75fa7e-898d-407b-8050-5e898d2b51ad",
          "name": "BISMUTH OXIDE SALICYLATE",
          "stdName": "BISMUTH OXIDE SALICYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee1c0cba-e337-4090-901e-7a8c2de7cf46",
            "0138f877-79e9-4aca-bc0e-12f7402c048c"
          ],
          "display_name": false
        },
        {
          "uuid": "03ce28b2-d9fd-499a-8a0b-4749d38a5ad9",
          "name": "BISMUTH SALICYLATE [MART.]",
          "stdName": "BISMUTH SALICYLATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0adfc186-c3df-426d-882e-51fe8cd48a8b"
          ],
          "display_name": false
        },
        {
          "uuid": "5ff8352b-5fdc-4a1d-aea1-5d21057e69fa",
          "name": "BISMUTH SUBSALICYLATE",
          "stdName": "BISMUTH SUBSALICYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a61e712b-1a50-4cb2-9614-1df154adb832",
            "470c9b43-5509-4106-92b9-6169b8fcda9b",
            "92806e1d-6c66-4ee8-b9de-49425cf51f6c",
            "8c4e1ee6-0807-4353-9a20-4bd2921532aa",
            "9f7f24ae-8c16-46d5-a0c5-b0b513a04622",
            "b03c2c60-3cc7-4078-a3d9-e2bd90a791bd",
            "401badcc-3aad-4be3-bf87-2c2829573fd3",
            "3a04d547-642c-4c3d-99d8-de2affe51dde",
            "16fb1bc1-55ec-4ae8-b1c2-278f39baebc7",
            "5cce6566-1eac-405c-9419-90560fb146ed",
            "c2a32d37-3e37-4fb2-b344-83aae8b44500",
            "a63708e9-91ac-4e42-928c-65ebb149479f",
            "588c056b-b363-425a-81e1-9a03e717c5b8",
            "da31a567-ab88-4425-ba41-d05e51e80a7b",
            "8d882254-b605-484f-af16-6e8e33e95e0f",
            "16d76e95-1745-4766-9029-7466021cf7dd",
            "d666e616-7225-4a9d-bc28-dc49c191806c",
            "3e2c5684-0ec0-438a-98ae-7159155a00bd",
            "7be06f8d-2afc-48bb-aaa7-17e1678d18ab",
            "e71cff38-8f92-4d7a-aafa-96e8845aa164",
            "1c9d5770-4337-426f-aaa0-aecbb7721400",
            "cb165de3-1d4d-4c6f-902b-56910b7c2527",
            "21b60e74-650f-4a33-a46f-9a82cc68b7e3",
            "0138f877-79e9-4aca-bc0e-12f7402c048c"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "77a859ab-be35-4360-bd58-ebd413196c4e",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "900e61ff-e854-0026-289d-66798d9f86c4",
          "name": "BISMUTH SUBSALICYLATE [EP IMPURITY]",
          "stdName": "BISMUTH SUBSALICYLATE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da31a567-ab88-4425-ba41-d05e51e80a7b"
          ],
          "display_name": false
        },
        {
          "uuid": "9297beb2-e80e-d5aa-09af-703742dd98eb",
          "name": "BISMUTH SUBSALICYLATE [EP MONOGRAPH]",
          "stdName": "BISMUTH SUBSALICYLATE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5385d03-18f0-a042-71c2-3c2caa690cf2"
          ],
          "display_name": false
        },
        {
          "uuid": "94cbc4b0-b4ba-449e-9a7c-285c72085f46",
          "name": "BISMUTH SUBSALICYLATE [GREEN BOOK]",
          "stdName": "BISMUTH SUBSALICYLATE [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e71cff38-8f92-4d7a-aafa-96e8845aa164"
          ],
          "display_name": false
        },
        {
          "uuid": "8a5927f4-0e9b-42cc-a35a-b00b1c3411b2",
          "name": "BISMUTH SUBSALICYLATE [HSDB]",
          "stdName": "BISMUTH SUBSALICYLATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f7f24ae-8c16-46d5-a0c5-b0b513a04622",
            "0138f877-79e9-4aca-bc0e-12f7402c048c"
          ],
          "display_name": false
        },
        {
          "uuid": "70abacdd-8888-411e-aac5-48b3ff0b2f6a",
          "name": "BISMUTH SUBSALICYLATE [JAN]",
          "stdName": "BISMUTH SUBSALICYLATE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2a32d37-3e37-4fb2-b344-83aae8b44500",
            "0138f877-79e9-4aca-bc0e-12f7402c048c"
          ],
          "display_name": false
        },
        {
          "uuid": "c9da55c1-75cf-4637-8546-deb13bb34496",
          "name": "BISMUTH SUBSALICYLATE [MI]",
          "stdName": "BISMUTH SUBSALICYLATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "588c056b-b363-425a-81e1-9a03e717c5b8",
            "0138f877-79e9-4aca-bc0e-12f7402c048c"
          ],
          "display_name": false
        },
        {
          "uuid": "c86280bb-5e2a-4108-ae6d-a5c899eb6a24",
          "name": "BISMUTH SUBSALICYLATE [ORANGE BOOK]",
          "stdName": "BISMUTH SUBSALICYLATE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b03c2c60-3cc7-4078-a3d9-e2bd90a791bd"
          ],
          "display_name": false
        },
        {
          "uuid": "8bc6dbbb-36a9-4b8b-8a30-1e0a89c06b6d",
          "name": "BISMUTH SUBSALICYLATE [USAN]",
          "stdName": "BISMUTH SUBSALICYLATE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d882254-b605-484f-af16-6e8e33e95e0f"
          ],
          "display_name": false
        },
        {
          "uuid": "7cbb8a25-b156-a701-273f-16fdbd8349b6",
          "name": "BISMUTH SUBSALICYLATE [USP MONOGRAPH]",
          "stdName": "BISMUTH SUBSALICYLATE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5112de2e-19a8-59f7-f2a2-d97fe80d05e1"
          ],
          "display_name": false
        },
        {
          "uuid": "b6fc3627-0de9-4ce4-b2ea-fa743c92cc46",
          "name": "BISMUTH SUBSALICYLATE [USP-RS]",
          "stdName": "BISMUTH SUBSALICYLATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21b60e74-650f-4a33-a46f-9a82cc68b7e3",
            "0138f877-79e9-4aca-bc0e-12f7402c048c"
          ],
          "display_name": false
        },
        {
          "uuid": "41d5e308-8ad4-4763-a1b6-fd8212bd304b",
          "name": "BISMUTH SUBSALICYLATE [VANDF]",
          "stdName": "BISMUTH SUBSALICYLATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a61e712b-1a50-4cb2-9614-1df154adb832",
            "0138f877-79e9-4aca-bc0e-12f7402c048c"
          ],
          "display_name": false
        },
        {
          "uuid": "29cca09d-97d5-11d6-6006-837985b506d5",
          "name": "Bismuth subsalicylate [WHO-DD]",
          "stdName": "BISMUTH SUBSALICYLATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "adb9e852-eb68-b23c-3da1-4019bb4fef5f"
          ],
          "display_name": false
        },
        {
          "uuid": "fe35efab-944b-43c4-a349-b8879aeb0f0a",
          "name": "HELIDAC COMPONENT BISMUTH SUBSALICYLATE",
          "stdName": "HELIDAC COMPONENT BISMUTH SUBSALICYLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a093c0e-f12c-40f7-8454-04a520ee97a5",
            "4245bc02-66bb-4a7a-8de7-c5fb4f652bf3"
          ],
          "display_name": false
        },
        {
          "uuid": "c38f2599-c3f7-cb8f-bec9-90453375452d",
          "name": "NSC-759117",
          "stdName": "NSC-759117",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07feef64-b80c-7bcd-21ba-91be93c6a13f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "401badcc-3aad-4be3-bf87-2c2829573fd3",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ee1c0cba-e337-4090-901e-7a8c2de7cf46",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0138f877-79e9-4aca-bc0e-12f7402c048c",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9d3095a-d571-436b-b020-6757323796d6",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d882254-b605-484f-af16-6e8e33e95e0f",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da31a567-ab88-4425-ba41-d05e51e80a7b",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "16fb1bc1-55ec-4ae8-b1c2-278f39baebc7",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c2a32d37-3e37-4fb2-b344-83aae8b44500",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4245bc02-66bb-4a7a-8de7-c5fb4f652bf3",
          "citation": "Drugs@FDA 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a093c0e-f12c-40f7-8454-04a520ee97a5",
          "citation": "Drugs@FDA 2012",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b03c2c60-3cc7-4078-a3d9-e2bd90a791bd",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0adfc186-c3df-426d-882e-51fe8cd48a8b",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "588c056b-b363-425a-81e1-9a03e717c5b8",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e71cff38-8f92-4d7a-aafa-96e8845aa164",
          "citation": "FDA SRS 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f7f24ae-8c16-46d5-a0c5-b0b513a04622",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21b60e74-650f-4a33-a46f-9a82cc68b7e3",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "470c9b43-5509-4106-92b9-6169b8fcda9b",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a61e712b-1a50-4cb2-9614-1df154adb832",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b2a42ee1-c627-41fa-842f-6e3b0abf886a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389671000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2bdc8f05-73de-4138-b77e-0303ed8d5d89",
          "citation": "SRS import [62TEY51RR1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=62TEY51RR1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389671000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81e09f81-b545-4b1f-b2ad-066ae42b6eaa",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c4e1ee6-0807-4353-9a20-4bd2921532aa",
          "citation": "BISMUTH SUBSALICYLATE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d666e616-7225-4a9d-bc28-dc49c191806c",
          "citation": "BISMUTH SUBSALICYLATE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a63708e9-91ac-4e42-928c-65ebb149479f",
          "citation": "BISMUTH SUBSALICYLATE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3a04d547-642c-4c3d-99d8-de2affe51dde",
          "citation": "BISMUTH SUBSALICYLATE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "16d76e95-1745-4766-9029-7466021cf7dd",
          "citation": "BISMUTH SUBSALICYLATE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "92806e1d-6c66-4ee8-b9de-49425cf51f6c",
          "citation": "BISMUTH SUBSALICYLATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7be06f8d-2afc-48bb-aaa7-17e1678d18ab",
          "citation": "BISMUTH SUBSALICYLATE [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1c9d5770-4337-426f-aaa0-aecbb7721400",
          "citation": "BISMUTH SUBSALICYLATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3e2c5684-0ec0-438a-98ae-7159155a00bd",
          "citation": "BISMUTH SUBSALICYLATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5cce6566-1eac-405c-9419-90560fb146ed",
          "citation": "BISMUTH SUBSALICYLATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cb165de3-1d4d-4c6f-902b-56910b7c2527",
          "citation": "BISMUTH SUBSALICYLATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "12bd98f9-f33d-62c7-56c4-59ebb2bf6898",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+14882-18-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "faafd1d4-a7ab-8e38-410a-8c16d93b0e5a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=14882-18-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "efb27c7b-88e6-53eb-1034-ac6fc2ddb277",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+14882-18-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9356402c-b1a5-a790-29c2-e5b054555c6e",
          "citation": "http://fco.factsandcomparisons.com/lco/action/doc/retrieve/docid/fc_dfc/5549584#f_pharmacokinetics",
          "doc_type": "LEPINDEX",
          "public_domain": true
        },
        {
          "uuid": "d27e8035-7317-e6ea-9f09-54a2e613d734",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "8990b639-285d-250e-89f4-499a4d70a275",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "01c52cb9-3b62-4960-ac2f-32dae811a571",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f4015105-8c29-31b5-4572-e0cac5f72862",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "07feef64-b80c-7bcd-21ba-91be93c6a13f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b5385d03-18f0-a042-71c2-3c2caa690cf2",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "5112de2e-19a8-59f7-f2a2-d97fe80d05e1",
          "citation": "USP/NF",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "adb9e852-eb68-b23c-3da1-4019bb4fef5f",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "764e9345-0dd0-3c09-4fed-67320dfd7bc1",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f82a0d29-5592-4efb-be9c-fdd5d17edfb9",
          "id": "f82a0d29-5592-4efb-be9c-fdd5d17edfb9",
          "molfile": "\n  Marvin  01132112522D          \n\n 10 10  0  0  0  0            999 V2000\n    4.1711   -0.4885    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.4572   -0.0752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4488    0.7516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7474   -0.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0334   -0.0794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3194   -0.5010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3277   -1.3277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0417   -1.7328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7474   -1.3194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4614   -1.7203    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  9  2  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\nM  CHG  2   1  -1  10  -1\nM  END",
          "smiles": "c1ccc(c(c1)C(=O)[O-])[O-]",
          "formula": "C7H4O3",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6a5ee06b-3e9d-4b49-b0ea-94d6ebefcf4c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "136.1051",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "aff2addc-42c1-4715-a754-610aba8849d5",
          "id": "aff2addc-42c1-4715-a754-610aba8849d5",
          "molfile": "\n  Marvin  01132109072D          \n\n  1  0  0  0  0  0            999 V2000\n    5.6617   -1.3862    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "[OH-]",
          "formula": "HO",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "48f9adff-60bc-4011-9f94-ad41fcdc286d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "17.0073",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "641cda96-2ae6-4b5f-8d3c-9568bfa0700e",
          "id": "641cda96-2ae6-4b5f-8d3c-9568bfa0700e",
          "molfile": "\n  Marvin  01132105122D          \n\n  1  0  0  0  0  0            999 V2000\n    4.4760   -1.3862    0.0000 Bi  0  1  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   3\nM  END",
          "smiles": "[Bi+3]",
          "formula": "Bi",
          "atropisomerism": "No",
          "charge": 3,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fc735e23-2936-4ad2-a013-14d2249bfa54"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "208.9804",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "97fdc6bd-6d59-426b-a691-36e48b970f13",
      "version": "32",
      "structure": {
        "id": "c4ba3533-e972-489f-b797-343149d6d312",
        "molfile": "\n  Marvin  01132110102D          \n\n 12 10  0  0  0  0            999 V2000\n    4.1711   -0.4885    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.4572   -0.0752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7474   -0.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4614   -1.7203    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.7474   -1.3194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4488    0.7516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0334   -0.0794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0417   -1.7328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3194   -0.5010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3277   -1.3277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4760   -1.3862    0.0000 Bi  0  1  0  0  0  0  0  0  0  0  0  0\n    5.6617   -1.3862    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  5  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  2  2  0  0  0  0\n  7  3  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  7  2  0  0  0  0\n 10  8  2  0  0  0  0\n  2  3  1  0  0  0  0\n  9 10  1  0  0  0  0\nM  CHG  4   1  -1   4  -1  11   3  12  -1\nM  END",
        "smiles": "c1ccc(c(c1)C(=O)[O-])[O-].[Bi+3].[OH-]",
        "formula": "C7H4O3.Bi.HO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "362.0929",
        "optical_activity": "NONE",
        "references": [
          "2bdc8f05-73de-4138-b77e-0303ed8d5d89",
          "81e09f81-b545-4b1f-b2ad-066ae42b6eaa"
        ],
        "stereo_centers": 0
      },
      "unii": "62TEY51RR1"
    }
  ]
}