{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "126a8f39-6a35-44be-a41d-0fc15974cc5e",
          "code": "74578-10-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=74578-10-2",
          "code_system": "CAS",
          "references": [
            "8f4a3c6d-f389-4fd9-be15-4d4b5402221d",
            "b2c07c9d-5ba6-4ace-b8bb-869ec5665e32"
          ]
        },
        {
          "uuid": "43d9f1f1-8f18-4fb1-9f6e-8f3c17f07de0",
          "code": "277-929-5",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8f4a3c6d-f389-4fd9-be15-4d4b5402221d"
          ]
        },
        {
          "uuid": "1940cd52-d088-1cf6-549a-aa431dfb2f33",
          "code": "DTXSID3072793",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3072793",
          "code_system": "EPA CompTox",
          "references": [
            "6690fb30-0983-f926-b68f-33d2853250df"
          ]
        },
        {
          "uuid": "8dd21255-057a-4632-9858-700687bf7440",
          "code": "62LA9436UJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9eeb985b-68b4-4efa-ae9d-ee6d1c4acb33",
          "name": "BENZENAMINE, 4-((2,6-DICHLOROPHENYL)(4-IMINO-3,5-DIMETHYL-2,5-CYCLOHEXADIEN-1-YLIDENE)METHYL)-2,6-DIMETHYL-, PHOSPHATE (1:1)",
          "stdName": "BENZENAMINE, 4-((2,6-DICHLOROPHENYL)(4-IMINO-3,5-DIMETHYL-2,5-CYCLOHEXADIEN-1-YLIDENE)METHYL)-2,6-DIMETHYL-, PHOSPHATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53d51f3d-1889-40c2-a6ad-eddbd761a014",
            "6546514e-f44d-4e17-9a75-11d6d6867459"
          ],
          "display_name": false
        },
        {
          "uuid": "9eedb1b0-1db4-4e73-9c52-011cc5c25ab5",
          "name": "HC BLUE NO. 15",
          "stdName": "HC BLUE NO. 15",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6770e42-f9bd-45d2-98f5-b3037c2df901",
            "b3f7bce4-332a-40d3-bb6d-f24ef6bea51c",
            "6546514e-f44d-4e17-9a75-11d6d6867459"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "32714718-7421-40ea-9fcf-e3a583889d05",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "b3f7bce4-332a-40d3-bb6d-f24ef6bea51c",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6546514e-f44d-4e17-9a75-11d6d6867459",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53d51f3d-1889-40c2-a6ad-eddbd761a014",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f4a3c6d-f389-4fd9-be15-4d4b5402221d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391501000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "250ca12c-5808-4e8d-bda9-56bd20b8fb9a",
          "citation": "SRS import [62LA9436UJ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=62LA9436UJ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391501000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6770e42-f9bd-45d2-98f5-b3037c2df901",
          "citation": "HC BLUE NO. 15 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6690fb30-0983-f926-b68f-33d2853250df",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=74578-10-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b2c07c9d-5ba6-4ace-b8bb-869ec5665e32",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "dcd4eeb0-5200-4661-aa5e-69b61bf870a2",
          "id": "dcd4eeb0-5200-4661-aa5e-69b61bf870a2",
          "molfile": "\n  Marvin  01132111272D          \n\n  5  4  0  0  0  0            999 V2000\n    9.2437   -0.4956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6562   -1.2102    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9417   -1.6226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3707   -0.7976    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0687   -1.9246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  2  0  0  0  0\nM  END",
          "smiles": "OP(=O)(O)O",
          "formula": "H3O4P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "db86157d-d44e-4e53-8da7-b68bd01045c4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "97.9952",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "eb829062-b14e-4f3c-9e40-74c65d3628f9",
          "id": "eb829062-b14e-4f3c-9e40-74c65d3628f9",
          "molfile": "\n  Marvin  01132112112D          \n\n 27 29  0  0  0  0            999 V2000\n   11.4424   -9.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7279   -8.6236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7279   -7.7986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0134   -7.3861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2990   -7.7986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2990   -8.6236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5845   -9.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0134   -9.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0134   -9.8611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0134   -6.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2990   -6.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2990   -5.3236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5845   -4.9111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5845   -4.0861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8701   -5.3236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1555   -4.9111    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8701   -6.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1555   -6.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5845   -6.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7279   -6.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7279   -5.3236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0134   -4.9111    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   11.4424   -4.9111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1569   -5.3236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1569   -6.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4424   -6.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4424   -7.3861    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  8  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n 10  4  2  3  0  0  0\n  5  6  2  3  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 20  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 19  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 26  2  0  0  0  0\n 22 21  1  0  0  0  0\n 21 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\nM  END",
          "smiles": "CC1=CC(=C(c2cc(C)c(c(C)c2)N)c3c(cccc3Cl)Cl)C=C(C)C1=N",
          "formula": "C23H22Cl2N2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5eb2373a-5e65-4d6d-a781-1c2a780b1b5d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "397.3409",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "449eb1ed-b1c3-4ad8-b962-99186e2b4e66",
      "version": "4",
      "structure": {
        "id": "6cded5e3-728e-4ba6-bce5-40969338c1aa",
        "molfile": "\n  Marvin  01132105392D          \n\n 32 33  0  0  0  0            999 V2000\n   12.1569   -5.3236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4424   -4.9111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1569   -6.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5845   -4.0861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1555   -6.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4424   -9.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5845   -9.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7279   -5.3236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4424   -6.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8701   -5.3236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5845   -4.9111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8701   -6.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2990   -5.3236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5845   -6.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0134   -9.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7279   -8.6236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2990   -8.6236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7279   -7.7986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2990   -7.7986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7279   -6.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2990   -6.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0134   -7.3861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0134   -6.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1555   -4.9111    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0134   -9.8611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0687   -1.9246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2437   -0.4956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9417   -1.6226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3707   -0.7976    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6562   -1.2102    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0134   -4.9111    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   11.4424   -7.3861    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  8  2  2  0  0  0  0\n  9  3  1  0  0  0  0\n 11  4  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12  5  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13 11  2  0  0  0  0\n 14 12  2  0  0  0  0\n 16  6  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17  7  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18 16  2  0  0  0  0\n 19 17  1  0  0  0  0\n 20  8  1  0  0  0  0\n 20  9  2  0  0  0  0\n 21 13  1  0  0  0  0\n 21 14  1  0  0  0  0\n 22 18  1  0  0  0  0\n 22 19  2  0  0  0  0\n 23 20  1  0  0  0  0\n 23 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 10  2  0  0  0  0\n 25 15  1  0  0  0  0\n 30 26  2  0  0  0  0\n 30 27  1  0  0  0  0\n 30 28  1  0  0  0  0\n 30 29  1  0  0  0  0\n 31  8  1  0  0  0  0\n 32  9  1  0  0  0  0\nM  END",
        "smiles": "CC1=C/C(=C(\\c2cc(C)c(c(C)c2)N)/c3c(cccc3Cl)Cl)/C=C(C)C1=N.OP(=O)(O)O",
        "formula": "C23H22Cl2N2.H3O4P",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "495.3361",
        "optical_activity": "NONE",
        "references": [
          "250ca12c-5808-4e8d-bda9-56bd20b8fb9a",
          "53d51f3d-1889-40c2-a6ad-eddbd761a014"
        ],
        "stereo_centers": 0
      },
      "unii": "62LA9436UJ"
    }
  ]
}