{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "dc1a357f-92a8-4989-af41-d42cd1474831",
          "code": "161050-58-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=161050-58-4",
          "code_system": "CAS",
          "references": [
            "aa8cb032-65d9-423b-a5f7-43513046ed24",
            "9abab570-c227-442e-8c97-144c6dcf50a9"
          ]
        },
        {
          "uuid": "0f4ef1f1-6eac-405c-8a3e-8644c2acd20d",
          "code": "121027",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2858",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "aa8cb032-65d9-423b-a5f7-43513046ed24"
          ]
        },
        {
          "uuid": "3d427373-b9a2-4b3b-a243-bda819581393",
          "code": "m7336",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7336?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "aa8cb032-65d9-423b-a5f7-43513046ed24"
          ]
        },
        {
          "uuid": "e52ca0cb-58fb-4b95-a571-50c9241891f6",
          "code": "105010",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/105010",
          "code_system": "PUBCHEM",
          "references": [
            "aa8cb032-65d9-423b-a5f7-43513046ed24"
          ]
        },
        {
          "uuid": "307891c9-8596-b8aa-f638-3bfcf2a8407e",
          "code": "7936",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7936",
          "code_system": "HSDB",
          "references": [
            "9edf397e-b2f5-e7c9-f5ab-772846e60d85"
          ]
        },
        {
          "uuid": "8da9dc2a-4201-71bd-d0df-6bc6a2ab2602",
          "code": "DTXSID3032628",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3032628",
          "code_system": "EPA CompTox",
          "references": [
            "58ce644d-1aa7-a4ed-226b-a4d180171795"
          ]
        },
        {
          "uuid": "66970ebe-c2d4-48ac-ab10-a7c49dbc67c9",
          "code": "62A22651ZX",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b31f1060-80e9-f92d-82ba-236d0b782eeb",
          "code": "38449",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:38449",
          "code_system": "CHEBI",
          "references": [
            "c2e21454-f09f-e82c-ff4e-3d07f938d486"
          ]
        },
        {
          "uuid": "d137bab9-0adb-a3f6-988b-e15b448a0327",
          "code": "methoxyfenozide",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/methoxyfenozide.html",
          "code_system": "ALANWOOD",
          "references": [
            "5cc2bac9-1720-9770-488e-81e63a118866"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1a6a4b58-b33a-4ec2-ad31-461bb7deab97",
          "name": "3-METHOXY-2-METHYLBENZOIC ACID 2-(3,5-DIMETHYLBENZOYL)-2-(1,1-DIMETHYLETHYL)HYDRAZIDE",
          "stdName": "3-METHOXY-2-METHYLBENZOIC ACID 2-(3,5-DIMETHYLBENZOYL)-2-(1,1-DIMETHYLETHYL)HYDRAZIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bfdf016e-5c2d-4523-80dc-b25a5111ff19",
            "2e8c1324-ffd2-4a38-9e9a-a91162755b27"
          ],
          "display_name": false
        },
        {
          "uuid": "428dbbe4-1926-4d23-8e9d-09c8d0af9c4c",
          "name": "INTREPID",
          "stdName": "INTREPID",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83f5adec-719d-49cb-b963-22995993be17",
            "eb613cc1-ad00-4b5d-af76-08287c87b8da"
          ],
          "display_name": false
        },
        {
          "uuid": "9dc8b168-65c2-441c-9328-57ab32d55472",
          "name": "METHOXYFENOZIDE",
          "stdName": "METHOXYFENOZIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a52a263c-bf01-4c20-8a7b-05ddaddfa35c",
            "1a4bccdb-3ba6-47cb-8f17-49f3dd5a422c",
            "a0864d73-ed94-4c97-a0de-c7f05f984bb6",
            "f5f208b6-31fc-4f76-808f-a5dd21188be5",
            "eb613cc1-ad00-4b5d-af76-08287c87b8da",
            "06c5b18e-c028-422a-a69f-d19c1a8c8cec"
          ],
          "display_name": true
        },
        {
          "uuid": "dbf7be88-7299-419b-92ae-ed3a8c1802ca",
          "name": "METHOXYFENOZIDE [ISO]",
          "stdName": "METHOXYFENOZIDE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a4bccdb-3ba6-47cb-8f17-49f3dd5a422c",
            "eb613cc1-ad00-4b5d-af76-08287c87b8da"
          ],
          "display_name": false
        },
        {
          "uuid": "86aa9852-fc36-4b9e-b659-89c53b21f8c5",
          "name": "METHOXYFENOZIDE [MI]",
          "stdName": "METHOXYFENOZIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f5f208b6-31fc-4f76-808f-a5dd21188be5",
            "eb613cc1-ad00-4b5d-af76-08287c87b8da"
          ],
          "display_name": false
        },
        {
          "uuid": "6ce55679-f890-4a48-bbb8-4f403610d332",
          "name": "N'-TERT-BUTYL-N'-(3,5-DIMETHYLBENZOYL)-3-METHOXY-2-METHYLBENZOHYDRAZIDE",
          "stdName": "N'-TERT-BUTYL-N'-(3,5-DIMETHYLBENZOYL)-3-METHOXY-2-METHYLBENZOHYDRAZIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10c6e612-d94b-4935-b8c3-ea8fe6819b69",
            "eb613cc1-ad00-4b5d-af76-08287c87b8da"
          ],
          "display_name": false
        },
        {
          "uuid": "8e989ce8-722f-49fa-b6d8-093224ca46c0",
          "name": "N-TERT-BUTYL-N'-(3-METHOXY-O-TOLUOYL)-3,5-XYLOHYDRAZIDE",
          "stdName": "N-TERT-BUTYL-N'-(3-METHOXY-O-TOLUOYL)-3,5-XYLOHYDRAZIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f0142e5-b55a-4aeb-8729-4ade6fcd84db",
            "bfdf016e-5c2d-4523-80dc-b25a5111ff19"
          ],
          "display_name": false
        },
        {
          "uuid": "550ecab8-95e9-47f9-af90-68fd2c128ed1",
          "name": "PRODIGY",
          "stdName": "PRODIGY",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83f5adec-719d-49cb-b963-22995993be17",
            "eb613cc1-ad00-4b5d-af76-08287c87b8da"
          ],
          "display_name": false
        },
        {
          "uuid": "36546be4-9901-4680-bd50-9c0ab59db586",
          "name": "RH-112485",
          "stdName": "RH-112485",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10c6e612-d94b-4935-b8c3-ea8fe6819b69",
            "eb613cc1-ad00-4b5d-af76-08287c87b8da"
          ],
          "display_name": false
        },
        {
          "uuid": "7bca0661-53b1-4fba-8e42-ae801e4d4b4b",
          "name": "RH-2485",
          "stdName": "RH-2485",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10c6e612-d94b-4935-b8c3-ea8fe6819b69",
            "eb613cc1-ad00-4b5d-af76-08287c87b8da"
          ],
          "display_name": false
        },
        {
          "uuid": "374d1073-f9b7-4276-ac78-0eeb1ef242d6",
          "name": "RUNNER",
          "stdName": "RUNNER",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83f5adec-719d-49cb-b963-22995993be17",
            "eb613cc1-ad00-4b5d-af76-08287c87b8da"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a0864d73-ed94-4c97-a0de-c7f05f984bb6",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bfdf016e-5c2d-4523-80dc-b25a5111ff19",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f0142e5-b55a-4aeb-8729-4ade6fcd84db",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e8c1324-ffd2-4a38-9e9a-a91162755b27",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5f208b6-31fc-4f76-808f-a5dd21188be5",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb613cc1-ad00-4b5d-af76-08287c87b8da",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10c6e612-d94b-4935-b8c3-ea8fe6819b69",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83f5adec-719d-49cb-b963-22995993be17",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a4bccdb-3ba6-47cb-8f17-49f3dd5a422c",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa8cb032-65d9-423b-a5f7-43513046ed24",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d0265d2-824a-4695-8656-1b086d0d2f6c",
          "citation": "SRS import [62A22651ZX]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=62A22651ZX",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee45dd06-b1fb-4f6a-8c42-fd59ceab4cc1",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "06c5b18e-c028-422a-a69f-d19c1a8c8cec",
          "citation": "METHOXYFENOZIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a52a263c-bf01-4c20-8a7b-05ddaddfa35c",
          "citation": "METHOXYFENOZIDE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9edf397e-b2f5-e7c9-f5ab-772846e60d85",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+161050-58-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "58ce644d-1aa7-a4ed-226b-a4d180171795",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=161050-58-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5cc2bac9-1720-9770-488e-81e63a118866",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "c2e21454-f09f-e82c-ff4e-3d07f938d486",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9abab570-c227-442e-8c97-144c6dcf50a9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f592fbfa-22c4-406b-86b7-bd6ab43d56e1",
          "id": "f592fbfa-22c4-406b-86b7-bd6ab43d56e1",
          "molfile": "\n  Marvin  01132112442D          \n\n 27 28  0  0  0  0            999 V2000\n    2.9751   -4.2151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6995   -4.6182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4068   -4.2151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4068   -3.4155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1313   -2.9841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8560   -3.4155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8560   -4.2151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5694   -4.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5694   -5.4571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3174   -4.1916    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0294   -4.6056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7429   -4.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7429   -3.3699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4565   -4.6056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1701   -4.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8882   -4.6056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5908   -4.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8882   -5.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1701   -5.8320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1701   -6.6647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4565   -5.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0294   -5.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3295   -6.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8377   -5.9599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0294   -6.4261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1313   -4.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1313   -5.4571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 26  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n 26  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 22 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 21 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 16  1  0  0  0  0\n 18 19  2  0  0  0  0\n 20 19  1  0  0  0  0\n 19 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 22  1  0  0  0  0\n 25 22  1  0  0  0  0\n 27 26  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(C)cc(c1)C(=O)N(C(C)(C)C)NC(=O)c2cccc(c2C)OC",
          "formula": "C22H28N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9fd659a2-43f0-43f1-8344-a84a48cc0438"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "368.4702",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "781e078c-43bb-4532-b766-0b246ac39a13",
      "version": "6",
      "structure": {
        "id": "5a98ed5b-4241-4357-93a7-fda46b4c51f1",
        "molfile": "\n  Marvin  01132104422D          \n\n 27 28  0  0  0  0            999 V2000\n    6.5694   -4.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5694   -5.4571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8560   -4.2151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1313   -4.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4068   -4.2151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4068   -3.4155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1313   -2.9841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8560   -3.4155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6995   -4.6182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9751   -4.2151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1313   -5.4571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3174   -4.1916    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0294   -4.6056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7429   -4.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7429   -3.3699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4565   -4.6056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4565   -5.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1701   -5.8320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8882   -5.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8882   -4.6056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1701   -4.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5908   -4.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1701   -6.6647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0294   -5.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3295   -6.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8377   -5.9599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0294   -6.4261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  3  2  0  0  0  0\n  9  5  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  1  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 16  1  0  0  0  0\n 22 20  1  0  0  0  0\n 23 18  1  0  0  0  0\n 24 13  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 24  1  0  0  0  0\n 27 24  1  0  0  0  0\nM  END",
        "smiles": "Cc1cc(C)cc(c1)C(=O)N(C(C)(C)C)NC(=O)c2cccc(c2C)OC",
        "formula": "C22H28N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "368.4702",
        "optical_activity": "NONE",
        "references": [
          "6d0265d2-824a-4695-8656-1b086d0d2f6c",
          "ee45dd06-b1fb-4f6a-8c42-fd59ceab4cc1"
        ],
        "stereo_centers": 0
      },
      "unii": "62A22651ZX"
    }
  ]
}