{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9200b1f8-4d10-4e41-90b6-c556925be866",
          "code": "486-66-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=486-66-8",
          "code_system": "CAS",
          "references": [
            "d1f5ea8c-5135-4ea6-8536-489195240a46",
            "faeae99d-d6b3-4f6a-9642-eb3ae4eb9203"
          ]
        },
        {
          "uuid": "59cdad85-6dfd-4d45-a4fc-2c035b825c52",
          "code": "C1060",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1060",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d1f5ea8c-5135-4ea6-8536-489195240a46"
          ]
        },
        {
          "uuid": "46192eb8-6ba1-4180-8a6a-dced8386a349",
          "code": "C004742",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67004742",
          "code_system": "MESH",
          "references": [
            "d1f5ea8c-5135-4ea6-8536-489195240a46"
          ]
        },
        {
          "uuid": "cace9088-b011-4666-8128-a1b8ce94c972",
          "code": "DAIDZEIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Daidzein",
          "code_system": "WIKIPEDIA",
          "references": [
            "d1f5ea8c-5135-4ea6-8536-489195240a46"
          ]
        },
        {
          "uuid": "c85a4ea6-6e6c-4964-a8bf-875472c569aa",
          "code": "m4068",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4068?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d1f5ea8c-5135-4ea6-8536-489195240a46"
          ]
        },
        {
          "uuid": "943472f0-a4de-4271-861c-5f9ab66d9303",
          "code": "SUB13529MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d1f5ea8c-5135-4ea6-8536-489195240a46"
          ]
        },
        {
          "uuid": "c9f5b2e2-1ce8-49c4-b8ea-730209705643",
          "code": "207-635-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.942",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d1f5ea8c-5135-4ea6-8536-489195240a46"
          ]
        },
        {
          "uuid": "18467cab-a72f-49bc-9a28-874f8c313c02",
          "code": "5281708",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5281708",
          "code_system": "PUBCHEM",
          "references": [
            "d1f5ea8c-5135-4ea6-8536-489195240a46"
          ]
        },
        {
          "uuid": "2dcc6c3c-2dab-0b62-d7cc-7f16ec3eb678",
          "code": "DTXSID9022310",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9022310",
          "code_system": "EPA CompTox",
          "references": [
            "a9ed6b2a-5c0f-6909-03aa-919b9a1d8c5a"
          ]
        },
        {
          "uuid": "1ecbd6b1-fc7c-e102-4adc-bd87b56764ea",
          "code": "C599",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Dietary Polyphenol[C70553]|Dietary Flavonoid[C70554]|Flavone[C68464]|Isoflavone",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C599",
          "code_system": "NCI_THESAURUS",
          "references": [
            "de520734-449f-79ab-3884-5a9ff8f3a24f"
          ]
        },
        {
          "uuid": "f1df54cf-ae65-95b9-afd2-375bdc187a15",
          "code": "C1967",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor[C471]|Protein Kinase Inhibitor[C1404]|Tyrosine Kinase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1967",
          "code_system": "NCI_THESAURUS",
          "references": [
            "de520734-449f-79ab-3884-5a9ff8f3a24f"
          ]
        },
        {
          "uuid": "55fa43a7-2e0b-ee29-5242-b494071d61c8",
          "code": "2780 (Number of products:39)",
          "comments": "Dietary Supplement Label Database|chemical|Daidzein",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2780&item=Daidzein",
          "code_system": "DSLD",
          "references": [
            "de520734-449f-79ab-3884-5a9ff8f3a24f"
          ]
        },
        {
          "uuid": "52175077-c640-a0d0-854b-a0b18b612556",
          "code": "DB13182",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13182",
          "code_system": "DRUG BANK",
          "references": [
            "de520734-449f-79ab-3884-5a9ff8f3a24f"
          ]
        },
        {
          "uuid": "387c126c-9ad0-4297-a880-18cf985db416",
          "code": "6287WC5J2L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c2f28852-25c6-56f7-66e8-cfcc0c4c6a02",
          "code": "77764",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:77764",
          "code_system": "CHEBI",
          "references": [
            "de520734-449f-79ab-3884-5a9ff8f3a24f"
          ]
        },
        {
          "uuid": "dbbdd07b-14c0-be8d-876a-323ca347f67a",
          "code": "28197",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28197",
          "code_system": "CHEBI",
          "references": [
            "de520734-449f-79ab-3884-5a9ff8f3a24f"
          ]
        },
        {
          "uuid": "5337cac4-b472-7463-7f28-dd06fa8dd461",
          "code": "1162421",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1162421",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "de520734-449f-79ab-3884-5a9ff8f3a24f"
          ]
        },
        {
          "uuid": "8785df3b-6378-3f35-a2cd-5ef66775e9fd",
          "code": "100000079515",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "fedb3748-21db-9dbc-1024-930a0a1d1a42"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8e712840-8a13-4060-91c1-5887fe641e6c",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "6e12a579-5944-453f-b486-2c626eecdab5"
          ],
          "related_substance": {
            "uuid": "5860afb7-efa6-4965-9a24-1d1f54b02c3a",
            "refuuid": "0031fcdf-5484-4514-b957-0eaa62aa418d",
            "name": "MEDICAGO SATIVA WHOLE",
            "unii": "DJO934BRBD",
            "linking_id": "DJO934BRBD",
            "ref_pname": "MEDICAGO SATIVA WHOLE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "91b71008-b518-4dac-b4c3-8a652adc5335",
          "comments": "Produced by intestinal microbiota. Similar activity as estrodiol",
          "type": "METABOLITE ACTIVE->PARENT",
          "mediator_substance": {
            "uuid": "12d45b2f-fe93-45ea-b55a-de082aa63f49",
            "refuuid": "972618ba-8691-475a-8b8a-c1b9009f5946",
            "name": "FECAL MICROBIOTA",
            "unii": "Q805XO2F7C",
            "linking_id": "Q805XO2F7C",
            "ref_pname": "FECAL MICROBIOTA",
            "substance_class": "reference"
          },
          "references": [
            "f6e323bb-5f56-7ac9-478e-f9683d85ab76"
          ],
          "related_substance": {
            "uuid": "e7aed8e0-8fc2-4261-9ee0-a6941ad4f30d",
            "refuuid": "a0887d60-01fc-43eb-a61c-2bddcdb003fe",
            "name": "EQUOL",
            "unii": "2T6D2HPX7Q",
            "linking_id": "2T6D2HPX7Q",
            "ref_pname": "EQUOL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d8b54251-69ea-42b9-8a8a-6297c5c836b2",
          "name": "4',7-DIHYDROXYISOFLAVONE",
          "stdName": "4',7-DIHYDROXYISOFLAVONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0feb149c-70b3-43da-90db-33f28f5029bb",
            "8c4fc96f-e88e-44ab-9c39-8a25efbf0df2"
          ],
          "display_name": false
        },
        {
          "uuid": "4e3c3981-abbd-47b9-89ba-8552811294be",
          "name": "7-HYDROXY-3-(4-HYDROXYPHENYL)-4H-1-BENZOPYRAN-4-ONE",
          "stdName": "7-HYDROXY-3-(4-HYDROXYPHENYL)-4H-1-BENZOPYRAN-4-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0feb149c-70b3-43da-90db-33f28f5029bb",
            "8c4fc96f-e88e-44ab-9c39-8a25efbf0df2"
          ],
          "display_name": false
        },
        {
          "uuid": "78c0460d-945a-4975-87a8-8420f8382b88",
          "name": "DAIDZEIN",
          "stdName": "DAIDZEIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42d025d2-ea0e-47f7-9b73-be9a99534dcd",
            "f597d79e-c62b-497d-baaf-6610ff57e84f",
            "0feb149c-70b3-43da-90db-33f28f5029bb",
            "ba1ed621-6ceb-4428-833f-aaf243ef9459",
            "541c3433-27f2-4c3c-a147-9fbe5cceef7b",
            "34bb3747-6c23-4786-b548-bd2f675f0308",
            "ae095f83-331e-48b5-abc0-eeb6193e13d8",
            "8c4fc96f-e88e-44ab-9c39-8a25efbf0df2",
            "682af3b7-d07c-4603-b9da-0909ac1a20e3",
            "8a14705e-2398-4b18-8f78-c8ae7673a608",
            "ac00af53-9ae1-4ae8-b5c2-2fd9d52916a8",
            "3fcbfd19-58a4-4ff9-9fe9-e77aabf0e69f"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d056ebad-402e-448d-ade7-404f01f24962",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "aa72a7b2-aed6-444a-b7c9-13439ee1225e",
          "name": "DAIDZEIN (CONSTITUENT OF ASTRAGALUS) [DSC]",
          "stdName": "DAIDZEIN (CONSTITUENT OF ASTRAGALUS) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0feb149c-70b3-43da-90db-33f28f5029bb",
            "7e4fc63e-edf7-49bc-9614-c79a7ae02877"
          ],
          "display_name": false
        },
        {
          "uuid": "4e383525-c8d5-4447-816e-ab6df4a1a2c0",
          "name": "DAIDZEIN (CONSTITUENT OF RED CLOVER) [DSC]",
          "stdName": "DAIDZEIN (CONSTITUENT OF RED CLOVER) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0feb149c-70b3-43da-90db-33f28f5029bb",
            "1c92baac-5957-4989-bb5b-2aaa44a2ce63"
          ],
          "display_name": false
        },
        {
          "uuid": "0eaa99e4-a0f7-4c80-ab3b-763050a60fed",
          "name": "DAIDZEIN (CONSTITUENT OF SOY ISOFLAVONES) [DSC]",
          "stdName": "DAIDZEIN (CONSTITUENT OF SOY ISOFLAVONES) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0feb149c-70b3-43da-90db-33f28f5029bb",
            "5c4c7a45-db60-4729-884c-3447d9e1d7fa"
          ],
          "display_name": false
        },
        {
          "uuid": "973b7f91-dde7-4310-818f-c84f946d0563",
          "name": "DAIDZEIN [MART.]",
          "stdName": "DAIDZEIN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0feb149c-70b3-43da-90db-33f28f5029bb",
            "8a14705e-2398-4b18-8f78-c8ae7673a608"
          ],
          "display_name": false
        },
        {
          "uuid": "16771706-6cb7-4c75-bd2a-d397702a8385",
          "name": "DAIDZEIN [MI]",
          "stdName": "DAIDZEIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0feb149c-70b3-43da-90db-33f28f5029bb",
            "682af3b7-d07c-4603-b9da-0909ac1a20e3"
          ],
          "display_name": false
        },
        {
          "uuid": "fe4fb5e8-f1ed-4340-845c-bcb5456ca954",
          "name": "DAIDZEIN [USP-RS]",
          "stdName": "DAIDZEIN [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42d025d2-ea0e-47f7-9b73-be9a99534dcd",
            "0feb149c-70b3-43da-90db-33f28f5029bb"
          ],
          "display_name": false
        },
        {
          "uuid": "2fdb22f8-78de-ade6-7a77-3bf4a67417d9",
          "name": "Daidzein [WHO-DD]",
          "stdName": "DAIDZEIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91f5b34d-9e13-413f-7205-4a74eb264b40"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8c4fc96f-e88e-44ab-9c39-8a25efbf0df2",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0feb149c-70b3-43da-90db-33f28f5029bb",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "682af3b7-d07c-4603-b9da-0909ac1a20e3",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a14705e-2398-4b18-8f78-c8ae7673a608",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42d025d2-ea0e-47f7-9b73-be9a99534dcd",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34bb3747-6c23-4786-b548-bd2f675f0308",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae095f83-331e-48b5-abc0-eeb6193e13d8",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c92baac-5957-4989-bb5b-2aaa44a2ce63",
          "citation": "USP-DSC, VOL.2, 2015",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e4fc63e-edf7-49bc-9614-c79a7ae02877",
          "citation": "DSC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c4c7a45-db60-4729-884c-3447d9e1d7fa",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1f5ea8c-5135-4ea6-8536-489195240a46",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389856000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c72de29a-04e5-49b4-9a22-77f1bdbf3c27",
          "citation": "USP-DSC",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e12a579-5944-453f-b486-2c626eecdab5",
          "citation": "HERBAL MEDICINES 3RD ED 2007",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "44f7ecde-ccb6-4369-8beb-7d6f1ae62a45",
          "citation": "SRS import [6287WC5J2L]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6287WC5J2L",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389856000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba1ed621-6ceb-4428-833f-aaf243ef9459",
          "citation": "DAIDZEIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "541c3433-27f2-4c3c-a147-9fbe5cceef7b",
          "citation": "DAIDZEIN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3fcbfd19-58a4-4ff9-9fe9-e77aabf0e69f",
          "citation": "DAIDZEIN [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ac00af53-9ae1-4ae8-b5c2-2fd9d52916a8",
          "citation": "DAIDZEIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f597d79e-c62b-497d-baaf-6610ff57e84f",
          "citation": "DAIDZEIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a9ed6b2a-5c0f-6909-03aa-919b9a1d8c5a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=486-66-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fedb3748-21db-9dbc-1024-930a0a1d1a42",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "de520734-449f-79ab-3884-5a9ff8f3a24f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "faeae99d-d6b3-4f6a-9642-eb3ae4eb9203",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f6e323bb-5f56-7ac9-478e-f9683d85ab76",
          "citation": "https://en.wikipedia.org/wiki/Equol#:~:text=Equol%20(4'%2C7%2D,equol%20is%20a%20nonsteroidal%20estrogen.",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "91f5b34d-9e13-413f-7205-4a74eb264b40",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "246d3718-952f-4f6e-b9b1-1ccd9cc8364f",
          "id": "246d3718-952f-4f6e-b9b1-1ccd9cc8364f",
          "molfile": "\n  Marvin  01132102022D          \n\n 19 21  0  0  0  0            999 V2000\n    6.5273   -2.4310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8184   -2.0366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8184   -1.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0966   -0.7992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3928   -1.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4031   -2.0366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1146   -2.4671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5679   -1.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5679   -2.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8460   -2.4671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1345   -2.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4256   -2.4671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7218   -2.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7218   -1.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4256   -0.8352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1345   -1.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8460   -0.8352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8460    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  7  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  2  0  0  0  0\n 18  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 17  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  2  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1-c2coc3cc(ccc3c2=O)O)O",
          "formula": "C15H10O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f47e6fc1-4664-4e20-87ed-112df46774c4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "254.2381",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d3c67d86-2d2d-46a5-b542-310c18702cde",
      "version": "22",
      "structure": {
        "id": "b416cbdc-66fa-4652-8788-a419cd6760ec",
        "molfile": "\n  Marvin  01132109202D          \n\n 19 21  0  0  0  0            999 V2000\n    3.5679   -1.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8460   -0.8352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1345   -1.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5679   -2.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1345   -2.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8460   -2.4671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3928   -1.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4256   -0.8352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4256   -2.4671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8460    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4031   -2.0366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0966   -0.7992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7218   -2.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7218   -1.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8184   -2.0366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8184   -1.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1146   -2.4671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5273   -2.4310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  3  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  2  2  0  0  0  0\n 11  7  2  0  0  0  0\n 12  7  1  0  0  0  0\n 13  9  2  0  0  0  0\n 14  8  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 12  2  0  0  0  0\n 17 11  1  0  0  0  0\n 18 13  1  0  0  0  0\n 19 15  1  0  0  0  0\n 17 15  2  0  0  0  0\n  5  3  2  0  0  0  0\n 13 14  1  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1-c2coc3cc(ccc3c2=O)O)O",
        "formula": "C15H10O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "254.2381",
        "optical_activity": "NONE",
        "references": [
          "44f7ecde-ccb6-4369-8beb-7d6f1ae62a45",
          "8c4fc96f-e88e-44ab-9c39-8a25efbf0df2"
        ],
        "stereo_centers": 0
      },
      "unii": "6287WC5J2L"
    }
  ]
}