{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2fd92e2b-5d49-4bb6-9c31-e628ff940643",
          "code": "89-88-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=89-88-3",
          "code_system": "CAS",
          "references": [
            "5515b56e-d7da-41f9-9636-caf2548aa2a6",
            "2b951527-879e-4874-9bc0-69c5af36769d"
          ]
        },
        {
          "uuid": "04ed0f7b-b3d0-4f7f-80e9-c3094c14f3af",
          "code": "C534326",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67534326",
          "code_system": "MESH",
          "references": [
            "5515b56e-d7da-41f9-9636-caf2548aa2a6"
          ]
        },
        {
          "uuid": "89d3b079-dc6f-4cea-ad7c-40b22471a9c1",
          "code": "201-949-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.772",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "5515b56e-d7da-41f9-9636-caf2548aa2a6"
          ]
        },
        {
          "uuid": "bf96f8e6-f370-4ef1-ae39-aa920bdd3f5f",
          "code": "101549",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/101549",
          "code_system": "PUBCHEM",
          "references": [
            "5515b56e-d7da-41f9-9636-caf2548aa2a6"
          ]
        },
        {
          "uuid": "ce8bad78-73ee-4e84-8da7-53b7d9b133fd",
          "code": "627QG30491",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a603af5b-7577-2dd5-c67e-5a5fec388d35",
          "code": "DTXSID70861680",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70861680",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "abb12401-e5c7-d88d-4e00-568b01d1aa45",
          "code": "1844",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1844/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "77f6aae0-ac40-81e8-60c1-3ac26aa232f2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "249cb332-9afd-4de4-a372-8bce692eeac2",
          "name": "(±)-VETIVEROL",
          "stdName": "(+/-)-VETIVEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a69af53-6932-4302-82be-45eb9113df29",
            "acabfc9c-db7c-4b3d-99ce-6cc936ca64c9"
          ],
          "display_name": false
        },
        {
          "uuid": "eb4c4f45-3a2a-4151-b020-703fedb755e2",
          "name": "1,2,3,3A,4,5,6,8A-OCTAHYDRO-2-ISOPROPYLIDENE-4,8-DIMETHYL-6-AZULENOL",
          "stdName": "1,2,3,3A,4,5,6,8A-OCTAHYDRO-2-ISOPROPYLIDENE-4,8-DIMETHYL-6-AZULENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a69af53-6932-4302-82be-45eb9113df29",
            "a9bdd160-2fe9-435b-9ecf-54b62e75abd8"
          ],
          "display_name": false
        },
        {
          "uuid": "2bdad9c3-da31-46eb-9e15-900944eac230",
          "name": "1,2,3,3A,4,5,6,8A-OCTAHYDRO-4,8-DIMETHYL-2-(1-METHYLETHYLIDENE)-6-AZULENOL",
          "stdName": "1,2,3,3A,4,5,6,8A-OCTAHYDRO-4,8-DIMETHYL-2-(1-METHYLETHYLIDENE)-6-AZULENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a69af53-6932-4302-82be-45eb9113df29",
            "dbac45a9-29ee-480c-9dff-ff6373c82b4f"
          ],
          "display_name": false
        },
        {
          "uuid": "28301463-fb5c-44ee-8838-b8006cb43d39",
          "name": "6-AZULENOL, 1,2,3,3A,4,5,6,8A-OCTAHYDRO-2-ISOPROPYLIDENE-4,8-DIMETHYL-",
          "stdName": "6-AZULENOL, 1,2,3,3A,4,5,6,8A-OCTAHYDRO-2-ISOPROPYLIDENE-4,8-DIMETHYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a69af53-6932-4302-82be-45eb9113df29",
            "a9bdd160-2fe9-435b-9ecf-54b62e75abd8"
          ],
          "display_name": false
        },
        {
          "uuid": "03304a77-6d9b-462e-855f-346f0ab11c64",
          "name": "6-AZULENOL, 1,2,3,3A,4,5,6,8A-OCTAHYDRO-4,8-DIMETHYL-2-(1-METHYLETHYLIDENE)-",
          "stdName": "6-AZULENOL, 1,2,3,3A,4,5,6,8A-OCTAHYDRO-4,8-DIMETHYL-2-(1-METHYLETHYLIDENE)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a69af53-6932-4302-82be-45eb9113df29",
            "a9bdd160-2fe9-435b-9ecf-54b62e75abd8"
          ],
          "display_name": false
        },
        {
          "uuid": "f9025f12-b641-4df9-9fbf-7431cb28a9b0",
          "name": "FEMA NO. 4217",
          "stdName": "FEMA NO. 4217",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a69af53-6932-4302-82be-45eb9113df29",
            "02825454-0f92-4098-af24-eaca8bd371e0"
          ],
          "display_name": false
        },
        {
          "uuid": "dc50713a-c700-411e-90ac-4f6bbccc5747",
          "name": "VETIVEROL",
          "stdName": "VETIVEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a69af53-6932-4302-82be-45eb9113df29",
            "02825454-0f92-4098-af24-eaca8bd371e0",
            "60177c56-1422-476d-82a9-f060024d668b",
            "dbac45a9-29ee-480c-9dff-ff6373c82b4f"
          ],
          "display_name": true
        },
        {
          "uuid": "fd16b242-04ae-44ac-b0d9-c03a0731a3f8",
          "name": "VETIVEROL [FHFI]",
          "stdName": "VETIVEROL [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a69af53-6932-4302-82be-45eb9113df29",
            "02825454-0f92-4098-af24-eaca8bd371e0"
          ],
          "display_name": false
        },
        {
          "uuid": "2144d8cd-f1ad-4bfe-be20-950ceeac961d",
          "name": "VETIVEROL, (±)-",
          "stdName": "VETIVEROL, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a69af53-6932-4302-82be-45eb9113df29",
            "acabfc9c-db7c-4b3d-99ce-6cc936ca64c9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "dbac45a9-29ee-480c-9dff-ff6373c82b4f",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8a69af53-6932-4302-82be-45eb9113df29",
          "citation": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "doc_type": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9bdd160-2fe9-435b-9ecf-54b62e75abd8",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02825454-0f92-4098-af24-eaca8bd371e0",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acabfc9c-db7c-4b3d-99ce-6cc936ca64c9",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5515b56e-d7da-41f9-9636-caf2548aa2a6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391401000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fde22374-e5e0-4cd0-9d12-b49d5ad30423",
          "citation": "SRS import [627QG30491]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=627QG30491",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391401000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e6b9dc5-4341-48e7-8378-2b2b2d9512ca",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60177c56-1422-476d-82a9-f060024d668b",
          "citation": "VETIVEROL [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2b951527-879e-4874-9bc0-69c5af36769d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "77f6aae0-ac40-81e8-60c1-3ac26aa232f2",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1a18f659-7cd5-4288-a63c-19706c214cdf",
          "id": "1a18f659-7cd5-4288-a63c-19706c214cdf",
          "molfile": "\n  Marvin  01132101322D          \n\n 16 17  0  0  0  0            999 V2000\n    5.5239   -2.3870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5239   -3.2096    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.7781   -3.5565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5850   -4.3620    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.7854   -4.5762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0947   -5.0142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9221   -5.0142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3323   -5.7249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4451   -4.3819    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.2663   -4.4609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5953   -3.7044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9774   -3.1577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2665   -3.5763    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.3922   -3.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6057   -2.6940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9755   -4.0742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 13  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  0  0  0  0\n 13  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 14  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
          "smiles": "CC(=C1CC2C(=CC(CC(C)C2C1)O)C)C",
          "formula": "C15H24O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "96d5669e-c118-4c94-a743-4fd1277bdfc3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "220.351",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6bdcbb1f-7232-4fb8-8ef1-d1e19dac828b",
      "version": "4",
      "structure": {
        "id": "1440be8e-e298-4f59-8bca-bd3842c70573",
        "molfile": "\n  Marvin  01132101152D          \n\n 16 17  0  0  0  0            999 V2000\n    4.7781   -3.5565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5239   -3.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2665   -3.5763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5850   -4.3620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4451   -4.3819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0947   -5.0142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9221   -5.0142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3323   -5.7249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5239   -2.3870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2663   -4.4609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9774   -3.1577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5953   -3.7044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3922   -3.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6057   -2.6940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9755   -4.0742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7854   -4.5762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  6  7  2  0  0  0  0\n  5  7  1  0  0  0  0\n  1  2  1  0  0  0  0\n  4  6  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  5  1  0  0  0  0\n  1  4  1  0  0  0  0\n  7  8  1  0  0  0  0\n  2  9  1  0  0  0  0\n 12 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n  5 10  1  0  0  0  0\n  3 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n  4 16  1  0  0  0  0\nM  END",
        "smiles": "CC(=C1CC2C(=CC(CC(C)C2C1)O)C)C",
        "formula": "C15H24O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "220.351",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "7e6b9dc5-4341-48e7-8378-2b2b2d9512ca",
          "fde22374-e5e0-4cd0-9d12-b49d5ad30423"
        ],
        "stereo_centers": 4
      },
      "unii": "627QG30491"
    }
  ]
}