{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "cfedf3de-c766-4abc-ba89-078cb862200e", "code": "68480-21-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=68480-21-7", "code_system": "CAS", "references": [ "b451552f-bd95-4e87-a716-ad8d1d23fb6f", "248e25f0-287b-409b-9127-f6a3d51b7900" ] }, { "uuid": "619b9504-82f1-4a90-9307-87b29436c47a", "code": "270-898-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.064.433", "code_system": "ECHA (EC/EINECS)", "references": [ "b451552f-bd95-4e87-a716-ad8d1d23fb6f" ] }, { "uuid": "9391846d-2f52-41be-8bdb-c75ce9a81619", "code": "110368", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/110368", "code_system": "PUBCHEM", "references": [ "b451552f-bd95-4e87-a716-ad8d1d23fb6f" ] }, { "uuid": "8f0890b4-39c5-5d40-b83d-0bdb95afc7d0", "code": "DTXSID7071571", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7071571", "code_system": "EPA CompTox", "references": [ "bfd0b6f8-f1f2-1d83-4ccb-87b82441b6da" ] }, { "uuid": "4e8cb78d-3186-46aa-8a2b-47834bfe3589", "code": "62564VZ8AZ", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "d834c9a1-44e8-421d-81d4-8d036c5ba21c", "name": "2-METHYLPROPYL 2-(DIMETHYLAMINO)BENZOATE", "stdName": "2-METHYLPROPYL 2-(DIMETHYLAMINO)BENZOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "248e25f0-287b-409b-9127-f6a3d51b7900" ], "display_name": false }, { "uuid": "1c29bb0a-42be-46ce-88af-254c3e868ac6", "name": "BENZOIC ACID, 2-(DIMETHYLAMINO)-, 2-METHYLPROPYL ESTER", "stdName": "BENZOIC ACID, 2-(DIMETHYLAMINO)-, 2-METHYLPROPYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "00ab38d9-da33-402b-9775-30489b290156", "cb33f1b6-e60e-495b-a210-a12010768e82", "248e25f0-287b-409b-9127-f6a3d51b7900" ], "display_name": true } ], "references": [ { "uuid": "cb33f1b6-e60e-495b-a210-a12010768e82", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "00ab38d9-da33-402b-9775-30489b290156", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b451552f-bd95-4e87-a716-ad8d1d23fb6f", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393735000, "tags": [ "NOMEN" ] }, { "uuid": "bfd0b6f8-f1f2-1d83-4ccb-87b82441b6da", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=68480-21-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "248e25f0-287b-409b-9127-f6a3d51b7900", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3e0a1064-8946-4d9e-b6cd-27a89c16aff9", "id": "3e0a1064-8946-4d9e-b6cd-27a89c16aff9", "molfile": "\n Marvin 01132103172D \n\n 16 16 0 0 0 0 999 V2000\n 3.7237 2.1013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0060 1.6878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2916 2.1004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0064 0.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2893 0.4532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2896 -0.3675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0072 -0.7809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4323 -0.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4323 -1.6888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7140 -2.1013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0045 -1.6888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0045 -0.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7140 -0.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7116 0.5391 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1400 0.7884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.9486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 2 0 0 0 0\n 6 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 13 2 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\nM END", "smiles": "CC(C)COC(=O)c1ccccc1N(C)C", "formula": "C13H19NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b2d73248-fdd4-4bcb-81e0-84494e47325d" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "221.296", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "ae5b7732-4c13-45d6-a960-707e8ddf3a17", "version": "5", "structure": { "id": "6f0575d2-dbe9-4f58-8f28-4f22533a3fec", "molfile": "\n Marvin 01132105462D \n\n 16 16 0 0 0 0 999 V2000\n 3.0070 -0.7808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2894 -0.3675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2891 0.4532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0062 0.8671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0058 1.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7234 2.1012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2914 2.1003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4322 -0.8638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7140 -0.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7116 0.5391 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1399 0.7883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.9485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0045 -0.8638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0045 -1.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7140 -2.1012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4322 -1.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 2 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 9 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 8 2 0 0 0 0\nM END", "smiles": "CC(C)COC(=O)c1ccccc1N(C)C", "formula": "C13H19NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "221.296", "optical_activity": "NONE", "references": [ "cb33f1b6-e60e-495b-a210-a12010768e82" ], "stereo_centers": 0 }, "unii": "62564VZ8AZ" } ] }