{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "faf95da6-d8a6-47cd-bc00-989041e6ffd6", "code": "1261353-24-5", "type": "MAJOR COMPONENT STRUCTURE/SEQUENCE", "url": "https://commonchemistry.cas.org/detail?cas_rn=1261353-24-5", "code_system": "CAS", "references": [ "bef0cdeb-45bf-4893-b719-d28f58eba5d2", "832faf00-11bd-4b2b-bcbc-cd415653d5bd" ] }, { "uuid": "6e897e25-6d83-b4b7-71ec-1e7b0a00a3b6", "code": "87763942", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/87763942", "code_system": "PUBCHEM", "references": [ "b471f1f3-c1bd-48b8-7d25-c9330a060e52" ] }, { "uuid": "8ae0b0c3-58a0-4e0f-9367-35d0d2ffa156", "code": "624590TD62", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "c1805252-ebf3-4a0b-8364-3320c5ee4814", "name": "BIOSTINE HYDROXIDE-GSA", "stdName": "BIOSTINE HYDROXIDE-GSA", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "ed3ea3a6-e376-4409-8f9c-f6422ac5a602", "e94fde2f-ff49-4882-86e4-028564e0b110" ], "display_name": false }, { "uuid": "88fa7277-eb38-4a97-b3bc-1d9863fcf1aa", "name": "GALACTOSE, 6-(2-HYDROXYBENZOATE)", "stdName": "GALACTOSE, 6-(2-HYDROXYBENZOATE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ed3ea3a6-e376-4409-8f9c-f6422ac5a602", "e94fde2f-ff49-4882-86e4-028564e0b110" ], "display_name": false }, { "uuid": "27f0af09-372a-42f1-a1a1-bccd70a44f8f", "name": "GALACTOSYL SALICYLATE", "stdName": "GALACTOSYL SALICYLATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "ed3ea3a6-e376-4409-8f9c-f6422ac5a602", "e94fde2f-ff49-4882-86e4-028564e0b110", "ce2e5898-33c2-47f8-b2b8-62e44a9b8d55" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "7cf1af54-a528-412e-90a5-d7843fd353bc", "name_org": "INCI" } ] }, { "uuid": "992fa200-2bad-49f2-85b8-ebb4a15dbef9", "name": "HAVARDIA POLYPHENOL", "stdName": "HAVARDIA POLYPHENOL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "ed3ea3a6-e376-4409-8f9c-f6422ac5a602", "e94fde2f-ff49-4882-86e4-028564e0b110" ], "display_name": false } ], "references": [ { "uuid": "ed3ea3a6-e376-4409-8f9c-f6422ac5a602", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "e94fde2f-ff49-4882-86e4-028564e0b110", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bef0cdeb-45bf-4893-b719-d28f58eba5d2", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393212000, "tags": [ "NOMEN" ] }, { "uuid": "a54e9d87-9e1a-4ff8-8024-4e3aa91cb05e", "citation": "SRS import [624590TD62]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=624590TD62", "doc_type": "SRS", "public_domain": true, "document_date": 1493393212000, "tags": [ "NOMEN" ] }, { "uuid": "ce2e5898-33c2-47f8-b2b8-62e44a9b8d55", "citation": "GALACTOSYL SALICYLATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "b471f1f3-c1bd-48b8-7d25-c9330a060e52", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "832faf00-11bd-4b2b-bcbc-cd415653d5bd", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "6d1ada46-e297-4b82-9291-41fd40d841ae", "id": "6d1ada46-e297-4b82-9291-41fd40d841ae", "molfile": "\n Marvin 01132105402D \n\n 21 21 0 0 1 0 999 V2000\n 13.7556 -7.9689 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 13.7556 -8.7938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0412 -7.5564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3267 -7.9689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6123 -7.5564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6123 -6.7314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8978 -7.9689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8978 -8.7938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1834 -9.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4689 -8.7938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4689 -7.9689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1834 -7.5564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1834 -6.7314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4701 -7.5564 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 14.4701 -6.7314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1846 -7.9689 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 15.1846 -8.7938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8990 -7.5564 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 15.8990 -6.7314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6135 -7.9689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3278 -7.5564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 14 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 12 2 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 15 1 6 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 1 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 1 0 0 0\n 18 20 1 0 0 0 0\n 20 21 2 0 0 0 0\nM END", "smiles": "c1ccc(c(c1)C(=O)OC[C@H]([C@@H]([C@@H]([C@H](C=O)O)O)O)O)O", "formula": "C13H16O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e11c7da7-6940-4cca-b876-1362f09916aa" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "300.2619", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "REPRESENTATIVE", "uuid": "e44e15bd-8ef4-46ef-99d5-499b17a160d4", "version": "5", "structure": { "id": "7ae14662-33ed-4be8-a9cb-dbe29affffd0", "molfile": "\n Marvin 01132106232D \n\n 21 21 0 0 1 0 999 V2000\n 11.6123 -7.5564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8978 -7.9689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8978 -8.7938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1834 -9.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4689 -8.7938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4689 -7.9689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1834 -7.5564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1834 -6.7314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6123 -6.7314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3267 -7.9689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0412 -7.5564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7556 -7.9689 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.7556 -8.7938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4701 -7.5564 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.4701 -6.7314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1846 -7.9689 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.1846 -8.7938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8990 -7.5564 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 15.8990 -6.7314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6135 -7.9689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3278 -7.5564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 2 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 1 9 2 0 0 0 0\n 1 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 6 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 6 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 1 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 1 0 0 0\n 18 20 1 0 0 0 0\n 20 21 2 0 0 0 0\nM END", "smiles": "c1ccc(c(c1)C(=O)OC[C@H]([C@@H]([C@@H]([C@H](C=O)O)O)O)O)O", "formula": "C13H16O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "300.2619", "optical_activity": "UNSPECIFIED", "references": [ "ed3ea3a6-e376-4409-8f9c-f6422ac5a602", "a54e9d87-9e1a-4ff8-8024-4e3aa91cb05e" ], "stereo_centers": 4 }, "unii": "624590TD62" } ] }