{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2c114b43-ea43-47ba-b54e-cb7ae4fdc194",
          "code": "54774-45-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=54774-45-7",
          "code_system": "CAS",
          "references": [
            "d651da35-9351-4267-a9e5-68bb931d275b",
            "fced6fd0-7d60-4e6e-aa0f-c8c98e3850a6"
          ]
        },
        {
          "uuid": "c666e00a-b458-111a-3936-54225c1404f5",
          "code": "DTXSID5052208",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5052208",
          "code_system": "EPA CompTox",
          "references": [
            "a61906cc-c9f1-8a0d-b9db-16b911900ba5"
          ]
        },
        {
          "uuid": "f300f618-62b4-46a0-9ab5-1ea25ca7134a",
          "code": "40463",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/40463",
          "code_system": "PUBCHEM"
        },
        {
          "uuid": "d2245ead-266a-443c-90c5-88dee389c32c",
          "code": "620Q217008",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "f456dc3d-e44b-42ae-9b0b-bb9f2a7b53e3",
          "amount": {
            "uuid": "7ad08cb2-f351-4bc2-8bb9-b6b0302c6f47"
          },
          "type": "ENANTIOMER->ENANTIOMER",
          "related_substance": {
            "uuid": "6476d1e9-7030-4e06-bf42-c53bb543bb6b",
            "refuuid": "06437d8f-179f-4935-a6a8-e682f0e396e3",
            "name": "PERMETHRIN, CIS-(-)-",
            "unii": "TVC0CLY3DB",
            "linking_id": "TVC0CLY3DB",
            "ref_pname": "PERMETHRIN, CIS-(-)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a0b67fdb-a1df-4b8e-a2a3-d1c94df5d133",
          "amount": {
            "uuid": "a00f45c7-176d-42cb-82ca-9a5c3b363ec5"
          },
          "type": "RACEMATE->ENANTIOMER",
          "related_substance": {
            "uuid": "a8d544f4-8eb8-438e-a8ce-f23f1cc3e2b2",
            "refuuid": "7de18dad-8c11-431b-a9f0-ed222e22651f",
            "name": "PERMETHRIN, CIS-",
            "unii": "GC30YV53C8",
            "linking_id": "GC30YV53C8",
            "ref_pname": "PERMETHRIN, CIS-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e9f429a6-c2fb-44c1-8ca6-8085081f26a2",
          "name": "(+)-CIS-PERMETHRIN",
          "stdName": "(+)-CIS-PERMETHRIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da0a2ee1-b2ad-41a0-bb09-4832c74e9e11",
            "ceec7bda-33f9-4388-94bd-a7adea9b57a5"
          ],
          "display_name": false
        },
        {
          "uuid": "50129e60-215b-4904-81c8-0e4dc2e19af9",
          "name": "1R-CIS-PERMETHRIN",
          "stdName": "1R-CIS-PERMETHRIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da0a2ee1-b2ad-41a0-bb09-4832c74e9e11",
            "ceec7bda-33f9-4388-94bd-a7adea9b57a5"
          ],
          "display_name": false
        },
        {
          "uuid": "c3455d77-5abf-4209-b7f7-f57da8bfb2d1",
          "name": "CYCLOPROPANECARBOXYLIC ACID, 3-(2,2-DICHLOROETHENYL)-2,2-DIMETHYL-, (3-PHENOXYPHENYL)METHYL ESTER, (1R,3R)-",
          "stdName": "CYCLOPROPANECARBOXYLIC ACID, 3-(2,2-DICHLOROETHENYL)-2,2-DIMETHYL-, (3-PHENOXYPHENYL)METHYL ESTER, (1R,3R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da0a2ee1-b2ad-41a0-bb09-4832c74e9e11",
            "ceec7bda-33f9-4388-94bd-a7adea9b57a5"
          ],
          "display_name": false
        },
        {
          "uuid": "33f7dfe1-1995-47c2-a9ee-4930022fe953",
          "name": "CYCLOPROPANECARBOXYLIC ACID, 3-(2,2-DICHLOROETHENYL)-2,2-DIMETHYL-, (3-PHENOXYPHENYL)METHYL ESTER, (1R-CIS)-",
          "stdName": "CYCLOPROPANECARBOXYLIC ACID, 3-(2,2-DICHLOROETHENYL)-2,2-DIMETHYL-, (3-PHENOXYPHENYL)METHYL ESTER, (1R-CIS)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da0a2ee1-b2ad-41a0-bb09-4832c74e9e11",
            "ceec7bda-33f9-4388-94bd-a7adea9b57a5"
          ],
          "display_name": false
        },
        {
          "uuid": "d108e0e0-82bf-425c-9eda-3fa617c202bb",
          "name": "NRDC-167",
          "stdName": "NRDC-167",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da0a2ee1-b2ad-41a0-bb09-4832c74e9e11",
            "ceec7bda-33f9-4388-94bd-a7adea9b57a5"
          ],
          "display_name": false
        },
        {
          "uuid": "a7c7b612-0d39-4d53-a383-f330f71b0ac0",
          "name": "PERMETHRIN, CIS-(+)-",
          "stdName": "PERMETHRIN, CIS-(+)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da0a2ee1-b2ad-41a0-bb09-4832c74e9e11",
            "ceec7bda-33f9-4388-94bd-a7adea9b57a5"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "ceec7bda-33f9-4388-94bd-a7adea9b57a5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "da0a2ee1-b2ad-41a0-bb09-4832c74e9e11",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d651da35-9351-4267-a9e5-68bb931d275b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392699000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b090452b-3d60-4eb0-a769-7970b573a349",
          "citation": "SRS import [620Q217008]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=620Q217008",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392699000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a61906cc-c9f1-8a0d-b9db-16b911900ba5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=54774-45-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fced6fd0-7d60-4e6e-aa0f-c8c98e3850a6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f856e9e9-a94a-4ed6-836c-37c6dd563aea",
          "id": "f856e9e9-a94a-4ed6-836c-37c6dd563aea",
          "molfile": "\n  Marvin  01132112522D          \n\n 26 28  0  0  1  0            999 V2000\n   10.4077   -4.8662    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.7900   -5.4192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9421   -6.2212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3337   -6.7697    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   10.7350   -6.4333    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.9790   -4.1517    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.2692   -3.7738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2692   -2.9441    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5640   -4.2024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8358   -3.7968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1260   -4.2301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1260   -5.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4300   -5.4654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6926   -5.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6926   -4.2577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9736   -3.8429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2729   -4.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2729   -5.0827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5723   -5.5252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8487   -5.1242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8487   -4.2992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5354   -3.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4115   -3.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8087   -4.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9424   -3.3451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6014   -4.4237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  6  1  0  0  0  0\n  1 24  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  7  1  1  0  0  0\n  6 24  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 23 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 15  1  0  0  0  0\n 15 23  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 22 17  2  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 24  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)[C@@H](C=C(Cl)Cl)[C@H]1C(=O)OCc2cccc(c2)Oc3ccccc3",
          "formula": "C21H20Cl2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ffe254d9-d6b1-42c1-9d14-10642ce34609"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "391.2884",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3f6bb900-f25d-4365-b96a-c93aad8dd075",
      "version": "8",
      "structure": {
        "id": "a916df41-70a7-47b4-bba6-b93ff68fb000",
        "molfile": "\n  Marvin  01132108472D          \n\n 26 28  0  0  1  0            999 V2000\n   10.8087   -4.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4077   -4.8662    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.7900   -5.4192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9421   -6.2212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3337   -6.7697    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   10.7350   -6.4333    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.9790   -4.1517    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.2692   -3.7738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5640   -4.2024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8358   -3.7968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1260   -4.2301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4115   -3.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6926   -4.2577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9736   -3.8429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2729   -4.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2729   -5.0827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5723   -5.5252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8487   -5.1242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8487   -4.2992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5354   -3.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6926   -5.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4300   -5.4654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1260   -5.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2692   -2.9441    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9424   -3.3451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6014   -4.4237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  1  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  1  1  0  0  0  0\n  7  8  1  1  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 15  2  0  0  0  0\n 21 13  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 11  2  0  0  0  0\n 24  8  2  0  0  0  0\n 25  1  1  0  0  0  0\n 26  1  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)[C@@H](C=C(Cl)Cl)[C@H]1C(=O)OCc2cccc(c2)Oc3ccccc3",
        "formula": "C21H20Cl2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "391.2884",
        "optical_activity": "( + )",
        "references": [
          "b090452b-3d60-4eb0-a769-7970b573a349",
          "ceec7bda-33f9-4388-94bd-a7adea9b57a5"
        ],
        "stereo_centers": 2
      },
      "unii": "620Q217008"
    }
  ]
}