{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ba35fb58-dd3e-4fff-bf5d-d6531e2eb4c3", "code": "127061-56-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=127061-56-7", "code_system": "CAS", "references": [ "3df6ad31-9e6a-451b-99e1-772d43b421ca", "30efb64f-78b7-4355-9b6a-1e9c76dc30ed" ] }, { "uuid": "931a9296-e852-4d00-a050-a2eb65a70276", "code": "C066638", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67066638", "code_system": "MESH", "references": [ "3df6ad31-9e6a-451b-99e1-772d43b421ca" ] }, { "uuid": "eb9a8dc2-be3c-430d-9cf3-df1a385bd52d", "code": "1427199", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1427199/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "3df6ad31-9e6a-451b-99e1-772d43b421ca" ] }, { "uuid": "9ad958e3-0e66-7772-f891-465878004c7a", "code": "DTXSID10155398", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10155398", "code_system": "EPA CompTox", "references": [ "a34854e7-9b93-1b40-c3eb-b616fabe49a0" ] }, { "uuid": "a6b38f00-bb58-9d79-cc4c-824337989fdd", "code": "54715165", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/54715165", "code_system": "PUBCHEM", "references": [ "e6f287e8-7727-6970-39c6-9ea321cc9d58" ] }, { "uuid": "ea486da1-12e7-41ad-98d5-5066687fceaa", "code": "61R4GJ48ER", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "d164e0c2-e2f0-bb64-f6c5-5db768c43b48", "code": "61R4GJ48ER", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=61R4GJ48ER", "code_system": "DAILYMED", "references": [ "7c7b9691-1567-32e0-c2d7-43b48a77b174" ] } ], "substance_class": "chemical", "names": [ { "uuid": "b20dee7b-c434-4e10-83e0-34a00d43ee44", "name": "EPC-K", "stdName": "EPC-K", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "77bd7be4-6787-4498-aa27-bc45a0b59a44", "8f4764eb-0cad-4dc4-a897-e94ad270382b" ], "display_name": false }, { "uuid": "870d057c-c59a-4c25-a78f-582adb7963e7", "name": "EPC-K1", "stdName": "EPC-K1", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c9708035-c4f1-4a78-a042-ceba1b36a1c9", "09bed268-680f-4d4a-8c6c-8b51dc832559" ], "display_name": false }, { "uuid": "48fbe250-05f1-4594-8267-3e53047e7c6e", "name": "L-ASCORBIC ACID, 2-((2R)-3,4-DIHYDRO-2,5,7,8-TETRAMETHYL-2-((4R,8R)-4,8,12-TRIMETHYLTRIDECYL)-2H-1-BENZOPYRAN-6-YL HYDROGEN PHOSPHATE), POTASSIUM SALT (1:1)", "stdName": "L-ASCORBIC ACID, 2-((2R)-3,4-DIHYDRO-2,5,7,8-TETRAMETHYL-2-((4R,8R)-4,8,12-TRIMETHYLTRIDECYL)-2H-1-BENZOPYRAN-6-YL HYDROGEN PHOSPHATE), POTASSIUM SALT (1:1)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c9708035-c4f1-4a78-a042-ceba1b36a1c9", "09bed268-680f-4d4a-8c6c-8b51dc832559" ], "display_name": false }, { "uuid": "c836d1f6-654d-4be9-bd3d-52d57bab54ae", "name": "POTASSIUM ASCORBYL TOCOPHERYL PHOSPHATE", "stdName": "POTASSIUM ASCORBYL TOCOPHERYL PHOSPHATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "77bd7be4-6787-4498-aa27-bc45a0b59a44", "8eb293e5-bc57-4656-84c5-5ae6f43004b6", "ba7d7974-ce8a-457d-9baa-abd52ccba67e", "09bed268-680f-4d4a-8c6c-8b51dc832559" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "46d1e963-31ff-4430-b4ef-3e823637334b", "name_org": "INCI" } ] }, { "uuid": "d56c9a0f-b1a8-4d6e-b845-a4c350807930", "name": "POTASSIUM ASCORBYL TOCOPHERYL PHOSPHATE, D-", "stdName": "POTASSIUM ASCORBYL TOCOPHERYL PHOSPHATE, D-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "12b31a72-5a52-42b2-8e8f-0c90d58a0a21", "09bed268-680f-4d4a-8c6c-8b51dc832559" ], "display_name": false }, { "uuid": "6e412847-dbcf-46c1-b72d-4cc71519785a", "name": "SEPIVITAL", "stdName": "SEPIVITAL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "77bd7be4-6787-4498-aa27-bc45a0b59a44", "09bed268-680f-4d4a-8c6c-8b51dc832559" ], "display_name": false } ], "references": [ { "uuid": "77bd7be4-6787-4498-aa27-bc45a0b59a44", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "09bed268-680f-4d4a-8c6c-8b51dc832559", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8f4764eb-0cad-4dc4-a897-e94ad270382b", "citation": "CTFA", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c9708035-c4f1-4a78-a042-ceba1b36a1c9", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "12b31a72-5a52-42b2-8e8f-0c90d58a0a21", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8eb293e5-bc57-4656-84c5-5ae6f43004b6", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3df6ad31-9e6a-451b-99e1-772d43b421ca", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390291000, "tags": [ "NOMEN" ] }, { "uuid": "fc8cecf5-abd2-49ad-b316-1549ca2947ef", "citation": "SRS import [61R4GJ48ER]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=61R4GJ48ER", "doc_type": "SRS", "public_domain": true, "document_date": 1493390291000, "tags": [ "NOMEN" ] }, { "uuid": "ba7d7974-ce8a-457d-9baa-abd52ccba67e", "citation": "POTASSIUM ASCORBYL TOCOPHERYL PHOSPHATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "a34854e7-9b93-1b40-c3eb-b616fabe49a0", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=127061-56-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e6f287e8-7727-6970-39c6-9ea321cc9d58", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "30efb64f-78b7-4355-9b6a-1e9c76dc30ed", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "7c7b9691-1567-32e0-c2d7-43b48a77b174", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "1c367e19-4123-42c5-a5f3-318975763761", "id": "1c367e19-4123-42c5-a5f3-318975763761", "molfile": "\n Marvin 01132101382D \n\n 1 0 0 0 1 0 999 V2000\n -4.4390 -3.7637 0.0000 K 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[K+]", "formula": "K", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "dc9bd51a-b41d-4dbf-a884-1247161d9c94" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "39.0983", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "7b1771a6-f582-46e0-9c29-386838f8b978", "id": "7b1771a6-f582-46e0-9c29-386838f8b978", "molfile": "\n Marvin 01132106242D \n\n 46 48 0 0 1 0 999 V2000\n 5.8362 -1.3448 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 5.8362 -2.1686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5522 -0.9315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2683 -1.3448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9786 -0.9286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6946 -1.3419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6917 -2.1657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4049 -0.9228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1172 -0.9402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4012 -1.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6822 -0.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9661 -1.3623 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 2.9661 -2.1861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2472 -0.9577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5311 -1.3710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8121 -0.9664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0989 -1.3826 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 0.8121 -1.7931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3202 -0.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1498 -0.6724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5514 -1.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3752 -1.3972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7973 -0.6899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7857 -2.1133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6123 -2.1162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4361 -2.1162 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4390 -2.9400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4390 -1.2924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2599 -2.1162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -6.0837 -2.1365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.5610 -2.8148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2699 -3.5919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3557 -2.5848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3731 -1.7610 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n -6.5872 -1.4816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.3601 -0.6841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -8.1416 -1.4554 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n -8.1678 -0.6316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7936 -1.9561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.5649 -1.6650 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n -2.3694 -2.8235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7827 -3.5396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5456 -2.8206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1382 -3.5367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1382 -2.1045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3172 -2.1016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 3 1 1 0 0 0 0\n 1 9 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 6 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 1 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 6 0 0 0\n 17 19 1 0 0 0 0\n 17 46 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 45 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 22 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 41 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 26 2 0 0 0 0\n 26 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 31 30 2 3 0 0 0\n 35 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 31 1 0 0 0 0\n 34 33 1 6 0 0 0\n 34 35 1 0 0 0 0\n 37 34 1 0 0 0 0\n 36 35 2 0 0 0 0\n 37 38 1 6 0 0 0\n 37 39 1 0 0 0 0\n 40 39 1 0 0 0 0\n 42 41 1 0 0 0 0\n 43 41 2 0 0 0 0\n 44 43 1 0 0 0 0\n 45 43 1 0 0 0 0\n 46 45 1 0 0 0 0\nM CHG 1 40 -1\nM END", "smiles": "CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(C)c(c(C)c(C)c2O1)OP(=O)(O)OC3=C(O)O[C@H]([C@H](C[O-])O)C3=O", "formula": "C35H56O10P", "atropisomerism": "No", "charge": -1, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "83070364-d9e9-44aa-b38d-5f5879dc3ce4" }, "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "667.7882", "optical_activity": "UNSPECIFIED", "stereo_centers": 5 } ], "definition_level": "COMPLETE", "uuid": "954fb175-c499-4198-9762-d275bb28b049", "version": "6", "structure": { "id": "075f0ffe-79d6-42c1-9b2b-6231db464fc0", "molfile": "\n Marvin 01132100402D \n\n 48 49 0 0 1 0 999 V2000\n -6.0837 -2.1365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.5872 -1.4816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.5610 -2.8148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1382 -2.1045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4361 -2.1162 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3731 -1.7610 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -7.3557 -2.5848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7857 -2.1133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5514 -1.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3752 -1.3972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5456 -2.8206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3694 -2.8235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.2599 -2.1162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3172 -2.1016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6123 -2.1162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1498 -0.6724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4390 -2.9400 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 0.0989 -1.3826 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -8.1416 -1.4554 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -4.4390 -1.2924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2699 -3.5919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -6.3601 -0.6841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3202 -0.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.1678 -0.6316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7973 -0.6899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1382 -3.5367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7827 -3.5396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -9.5649 -1.6650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8121 -0.9664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.7936 -1.9561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5311 -1.3710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4012 -1.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2683 -1.3448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8121 -1.7931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9786 -0.9286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1172 -0.9402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5522 -0.9315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6822 -0.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2472 -0.9577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8362 -1.3448 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.9661 -1.3623 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.6946 -1.3419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6917 -2.1657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4049 -0.9228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8362 -2.1686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9661 -2.1861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.3731 -0.9402 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4390 -3.7637 0.0000 K 0 3 0 0 0 0 0 0 0 0 0 0\n 4 9 1 0 0 0 0\n 5 13 1 0 0 0 0\n 6 2 1 0 0 0 0\n 7 3 1 0 0 0 0\n 8 15 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 8 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 8 2 0 0 0 0\n 13 1 1 0 0 0 0\n 14 4 1 0 0 0 0\n 15 5 1 0 0 0 0\n 16 9 1 0 0 0 0\n 17 5 1 0 0 0 0\n 18 23 1 0 0 0 0\n 19 6 1 0 0 0 0\n 20 5 2 0 0 0 0\n 21 3 2 0 0 0 0\n 22 2 1 0 0 0 0\n 23 16 1 0 0 0 0\n 24 19 1 0 0 0 0\n 25 10 1 0 0 0 0\n 26 11 1 0 0 0 0\n 27 12 1 0 0 0 0\n 28 30 1 0 0 0 0\n 18 29 1 1 0 0 0\n 19 30 1 6 0 0 0\n 31 29 1 0 0 0 0\n 32 38 1 0 0 0 0\n 33 37 1 0 0 0 0\n 18 34 1 6 0 0 0\n 35 33 1 0 0 0 0\n 36 32 1 0 0 0 0\n 37 40 1 0 0 0 0\n 38 41 1 0 0 0 0\n 39 31 1 0 0 0 0\n 40 36 1 0 0 0 0\n 41 39 1 0 0 0 0\n 42 35 1 0 0 0 0\n 43 42 1 0 0 0 0\n 44 42 1 0 0 0 0\n 40 45 1 1 0 0 0\n 41 46 1 1 0 0 0\n 6 47 1 1 0 0 0\n 7 6 1 0 0 0 0\n 4 11 2 0 0 0 0\n 18 14 1 0 0 0 0\n 2 1 2 0 0 0 0\n 3 1 1 0 0 0 0\nM CHG 2 17 -1 48 1\nM END", "smiles": "CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(C)c(c(C)c(C)c2O1)OP(=O)([O-])OC3=C([C@@]([H])([C@H](CO)O)OC3=O)O.[K+]", "formula": "C35H56O10P.K", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "706.8866", "optical_activity": "UNSPECIFIED", "references": [ "fc8cecf5-abd2-49ad-b316-1549ca2947ef", "77bd7be4-6787-4498-aa27-bc45a0b59a44" ], "stereo_centers": 5 }, "unii": "61R4GJ48ER" } ] }