{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "894fd7c2-84aa-46cf-9482-6937b81dc7cd",
          "code": "65-86-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=65-86-1",
          "code_system": "CAS",
          "references": [
            "0e5840db-487e-4cbc-9074-d563933ae7c1",
            "04190ed8-dd54-45ec-acc9-540184eacf80"
          ]
        },
        {
          "uuid": "0358e0fb-e3a8-4e59-95bb-1cda95f721fc",
          "code": "C81628",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81628",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0e5840db-487e-4cbc-9074-d563933ae7c1"
          ]
        },
        {
          "uuid": "b40df435-807f-4645-886a-6f62f39cddeb",
          "code": "D009963",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68009963",
          "code_system": "MESH",
          "references": [
            "0e5840db-487e-4cbc-9074-d563933ae7c1"
          ]
        },
        {
          "uuid": "fd51907f-2b91-4ab6-aaab-7804f9269e93",
          "code": "OROTIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Orotic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "0e5840db-487e-4cbc-9074-d563933ae7c1"
          ]
        },
        {
          "uuid": "235f49ea-ae51-4e15-84e2-816600bd03e3",
          "code": "SUB09468MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0e5840db-487e-4cbc-9074-d563933ae7c1"
          ]
        },
        {
          "uuid": "3290ca47-8618-4e8d-a637-9d909ccd8c48",
          "code": "3502",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3502",
          "code_system": "INN",
          "references": [
            "0e5840db-487e-4cbc-9074-d563933ae7c1"
          ]
        },
        {
          "uuid": "0f72abf3-5edf-4c87-8bbe-78afb79baad8",
          "code": "200-619-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.563",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0e5840db-487e-4cbc-9074-d563933ae7c1"
          ]
        },
        {
          "uuid": "f9d9ee62-73e7-411e-804c-9ebd736aa590",
          "code": "7712",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/7712/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0e5840db-487e-4cbc-9074-d563933ae7c1"
          ]
        },
        {
          "uuid": "b41ab16e-ff08-4284-ad45-4943be95bbfc",
          "code": "m8242",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8242?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0e5840db-487e-4cbc-9074-d563933ae7c1"
          ]
        },
        {
          "uuid": "1c810468-8e59-4011-820f-b8a7e1c27c25",
          "code": "CHEMBL1235017",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1235017",
          "code_system": "ChEMBL",
          "references": [
            "0e5840db-487e-4cbc-9074-d563933ae7c1"
          ]
        },
        {
          "uuid": "c755d719-22e3-451a-a926-d68a74ba0100",
          "code": "967",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/967",
          "code_system": "PUBCHEM",
          "references": [
            "0e5840db-487e-4cbc-9074-d563933ae7c1"
          ]
        },
        {
          "uuid": "5f3ebd85-e764-c774-0dcb-f0a27f7fb276",
          "code": "6377",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6377",
          "code_system": "HSDB",
          "references": [
            "a25a537c-f3d9-6439-a638-f5c34f3b9a43"
          ]
        },
        {
          "uuid": "50edd9aa-0c3f-9fd0-dc41-77db87a477c8",
          "code": "DTXSID0025814",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0025814",
          "code_system": "EPA CompTox",
          "references": [
            "ed52247d-07a9-de5f-ae19-33dfe7e49b82"
          ]
        },
        {
          "uuid": "eb0cd1d4-a816-92ca-4ae2-442c1ab6f845",
          "code": "C45812",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Vitamin[C944]|Water-Soluble Vitamin[C1551]|B Vitamin",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45812",
          "code_system": "NCI_THESAURUS",
          "references": [
            "58bf950f-c0cf-18d9-0c4c-4dd3f3670517"
          ]
        },
        {
          "uuid": "e8758e30-827a-4960-8ef0-d3d418e25ab8",
          "code": "61H4T033E5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0896fef5-7927-8921-2eed-fb5afda46e93",
          "code": "3402",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3402",
          "code_system": "DRUG CENTRAL",
          "references": [
            "58bf950f-c0cf-18d9-0c4c-4dd3f3670517"
          ]
        },
        {
          "uuid": "4855285b-13c0-ddc0-eaa0-49c51ab0c49c",
          "code": "DB02262",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB02262",
          "code_system": "DRUG BANK",
          "references": [
            "58bf950f-c0cf-18d9-0c4c-4dd3f3670517"
          ]
        },
        {
          "uuid": "1effb78a-5448-38f6-e365-52178d61155b",
          "code": "1822 (Number of products:5)",
          "comments": "Dietary Supplement Label Database|Chemical|Orotic Acid",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1822&item=Orotic Acid",
          "code_system": "DSLD",
          "references": [
            "58bf950f-c0cf-18d9-0c4c-4dd3f3670517"
          ]
        },
        {
          "uuid": "01091c63-e52b-eba9-6cb9-21578ff272e9",
          "code": "16742",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16742",
          "code_system": "CHEBI",
          "references": [
            "58bf950f-c0cf-18d9-0c4c-4dd3f3670517"
          ]
        },
        {
          "uuid": "c7e50f02-9d9e-7fa2-8fa1-10d7d48b2770",
          "code": "61H4T033E5",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=61H4T033E5",
          "code_system": "DAILYMED",
          "references": [
            "18a97813-4524-e147-66ce-e9cdcc6a63f7"
          ]
        },
        {
          "uuid": "c0314eaf-a9bc-740d-0781-300665ea2a8e",
          "code": "100000083330",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2d4fa134-4703-f1b0-44df-fa2aa09211fb"
          ]
        },
        {
          "uuid": "93d1a498-7f6f-6a3d-6530-ccde071a5e34",
          "code": "9791",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=9791",
          "code_system": "NSC",
          "references": [
            "e24dd8db-42e0-e34f-06eb-7aa1f6e098d7"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b5747018-8d09-4552-aa29-bbaa6b51fda3",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "2445ba95-ea0c-48d0-8a1c-a62759682d5a",
            "refuuid": "dacb276e-6e39-4105-a024-50d14279c4f2",
            "name": "Orotic acid",
            "unii": "61H4T033E5",
            "linking_id": "61H4T033E5",
            "ref_pname": "Orotic acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "20a539fb-a2f5-40c5-bf0e-9cb432fe71aa",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "f4a80c8d-d11e-4c47-bad7-79fb625a3bf2",
            "refuuid": "15b3d643-2be7-4233-bbd4-de09c0620813",
            "name": "SODIUM OROTATE",
            "unii": "1K54797G2Z",
            "linking_id": "1K54797G2Z",
            "ref_pname": "SODIUM OROTATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "39948cf6-a94c-458a-a1ff-18a7623940bc",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "41cd0afa-704b-4267-9ee0-441c526c9707",
            "refuuid": "acf68134-011e-42eb-9e4e-3d6e8ec13d59",
            "name": "POTASSIUM OROTATE",
            "unii": "6ZDN9W1C9W",
            "linking_id": "6ZDN9W1C9W",
            "ref_pname": "POTASSIUM OROTATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "801e3eab-ba42-4f54-bf11-6eef93cde5fe",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "41642f4a-c4e4-4242-ae04-c21d1bdf8928",
            "refuuid": "6ca198c8-c1ba-422a-a0a5-611a8266351c",
            "name": "ZINC OROTATE",
            "unii": "Z722242H10",
            "linking_id": "Z722242H10",
            "ref_pname": "ZINC OROTATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "54188a36-d47d-4b7c-a72d-f7350035a3d0",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "d090f2f6-2be4-4d8d-bde1-66f830ac0147",
            "refuuid": "f5d95a6a-7826-4ce7-a522-48eba0400141",
            "name": "LITHIUM OROTATE",
            "unii": "L2N7Z24B30",
            "linking_id": "L2N7Z24B30",
            "ref_pname": "LITHIUM OROTATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "38334370-520b-4cb6-b29f-25d262268081",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "174e957f-f6c3-44ed-b099-0e51c98e2ae2",
            "refuuid": "a8cfecd6-8039-48a2-bfed-73767f981a93",
            "name": "LYSINE OROTATE",
            "unii": "782D931P40",
            "linking_id": "782D931P40",
            "ref_pname": "LYSINE OROTATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "205ee8fe-1e18-4e35-9679-bcbfdc36cdeb",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "4d684847-3e1d-4215-a8a2-bcae4904375a",
            "refuuid": "09e1b909-d9d1-4357-94ea-983b1c5eee21",
            "name": "MAGNESIUM OROTATE",
            "unii": "GI96W46M5A",
            "linking_id": "GI96W46M5A",
            "ref_pname": "MAGNESIUM OROTATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "49da997f-8a05-489c-8e8b-65b7d28a07ed",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "bc14eaef-6c0a-4191-b1e9-696f8bf86025",
            "refuuid": "d1fddc81-4cde-4e04-af58-ec5ec02a581f",
            "name": "ORAZAMIDE",
            "unii": "CLY9MRR8FV",
            "linking_id": "CLY9MRR8FV",
            "ref_pname": "ORAZAMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a43ec9e7-6ca1-4b6e-b2fe-750528767ee9",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "e1751b5a-750d-4974-8ca6-c96a874080b3",
            "refuuid": "999b84a5-0b15-44e7-8f6c-b2b703cbd030",
            "name": "OROTIC ACID MONOHYDRATE",
            "unii": "91532S02AO",
            "linking_id": "91532S02AO",
            "ref_pname": "OROTIC ACID MONOHYDRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a4c56d2a-bb98-45b6-9fe8-798878626834",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "cec35040-eead-49a3-9260-95ceee5df746",
            "refuuid": "c181499b-2786-49df-9bdc-e2497ad20afd",
            "name": "MAGNESIUM OROTATE DIHYDRATE",
            "unii": "VQ922CRY87",
            "linking_id": "VQ922CRY87",
            "ref_pname": "MAGNESIUM OROTATE DIHYDRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b0cd4385-bd78-4c0b-8845-11bb20229e7c",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "1dd28924-f6da-4ce3-903f-9ece9fda4636",
            "refuuid": "b4fba2d6-aef3-4761-8f36-4fc537fd017b",
            "name": "METFORMIN OROTATE",
            "unii": "KE1D8AP3J5",
            "linking_id": "KE1D8AP3J5",
            "ref_pname": "METFORMIN OROTATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4ff8b625-c934-4a45-a191-8b9f651bf1bb",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "07c8bdde-0e26-48e1-8ef8-210fe31b6d2b",
            "refuuid": "fabf4be6-00dd-4735-af56-5b8e7f1a9906",
            "name": "CHOLINE OROTATE",
            "unii": "7TA4XO49BN",
            "linking_id": "7TA4XO49BN",
            "ref_pname": "CHOLINE OROTATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1b20564f-243f-4326-ae28-f6021de1db2a",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "2c6053e8-c328-45a7-ac6d-f53b609524d7",
            "refuuid": "d6fe00ce-0533-4d80-8092-17f44cdb31c3",
            "name": "CALCIUM OROTATE",
            "unii": "990GJM86HY",
            "linking_id": "990GJM86HY",
            "ref_pname": "CALCIUM OROTATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1f38fec2-eb7a-4405-a61f-37df4fbf7ace",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "19b12b97-4fcb-45b4-a524-07716b3d900a",
            "refuuid": "90a4c4f1-a95e-4089-8cf0-06707b3b8f05",
            "name": "CARBOXYAMIDOTRIAZOLE OROTATE",
            "unii": "776C212QQH",
            "linking_id": "776C212QQH",
            "ref_pname": "CARBOXYAMIDOTRIAZOLE OROTATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "aa93054e-4f27-4ba8-a922-fb962e8a23cf",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "b047ed9f-b09f-4c8f-8d26-f0715eba3fb3"
          ],
          "related_substance": {
            "uuid": "9b1b4e67-f2d0-44b8-977c-e7a02f9f3366",
            "refuuid": "999b84a5-0b15-44e7-8f6c-b2b703cbd030",
            "name": "OROTIC ACID MONOHYDRATE",
            "unii": "91532S02AO",
            "linking_id": "91532S02AO",
            "ref_pname": "OROTIC ACID MONOHYDRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2607ce53-f860-4a87-a14f-df723532a357",
          "amount": {
            "uuid": "8be41842-6e54-440f-82c7-44e8a246dcf8"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "1186105d-255c-4004-9aa2-c88f28a828ed"
          ],
          "related_substance": {
            "uuid": "baf71734-dc39-4629-9d3a-4049f2439aa9",
            "refuuid": "1dc994cf-8f9e-434a-8d3f-e9d12f3d3243",
            "name": "CALCIUM OROTATE TETRAHYDRATE",
            "unii": "X84S5Z7BK7",
            "linking_id": "X84S5Z7BK7",
            "ref_pname": "CALCIUM OROTATE TETRAHYDRATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d7e48149-723a-4916-b608-d6928b8264e8",
          "name": "1,2,3,4-TETRAHYDRO-2,6-DIOXOPYRIMIDINE-4-CARBOXYLIC ACID",
          "stdName": "1,2,3,4-TETRAHYDRO-2,6-DIOXOPYRIMIDINE-4-CARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4062a0a0-5005-4fda-9d50-d28296d73940"
          ],
          "display_name": false
        },
        {
          "uuid": "2e0ff4ee-ac2e-4c82-bdc1-afb7453f1f29",
          "name": "1,2,3,6-TETRAHYDRO-2,6-DIOXO-4-PYRIMIDINECARBOXYLIC ACID",
          "stdName": "1,2,3,6-TETRAHYDRO-2,6-DIOXO-4-PYRIMIDINECARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e73f943-7f4d-427f-a648-c622ccaa2caf"
          ],
          "display_name": false
        },
        {
          "uuid": "8308dc7c-9098-4b0d-9995-b106fd27b953",
          "name": "ANIMAL GALACTOSE FACTOR",
          "stdName": "ANIMAL GALACTOSE FACTOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e73f943-7f4d-427f-a648-c622ccaa2caf"
          ],
          "display_name": false
        },
        {
          "uuid": "e5bbb3d8-64de-47a6-894f-e24477716c5a",
          "name": "NSC-9791",
          "stdName": "NSC-9791",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1eccfcfa-7ee5-4c10-aa5b-4d9e2c9c23f0"
          ],
          "display_name": false
        },
        {
          "uuid": "fa9210c9-86ae-4b06-9e3a-4d95246a3070",
          "name": "OROPUR",
          "stdName": "OROPUR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e73f943-7f4d-427f-a648-c622ccaa2caf"
          ],
          "display_name": false
        },
        {
          "uuid": "d440051e-b87e-43b1-aea2-1639dd667422",
          "name": "OROTIC ACID [HSDB]",
          "stdName": "OROTIC ACID [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e361340-a6e1-4489-a0a1-f13d621dbde1"
          ],
          "display_name": false
        },
        {
          "uuid": "8af32189-bd74-4525-8e49-98f896091587",
          "name": "OROTIC ACID [JAN]",
          "stdName": "OROTIC ACID [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf85c29a-817f-44ef-8484-81d476abbf80"
          ],
          "display_name": false
        },
        {
          "uuid": "71d0f394-ad52-475d-a711-04f6603a25b1",
          "name": "OROTIC ACID [MART.]",
          "stdName": "OROTIC ACID [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f98a78ce-3dd2-45c7-9433-10d92a6cb52a"
          ],
          "display_name": false
        },
        {
          "uuid": "194b07c5-9cf2-4ea4-8d3f-0cdee9bfb13b",
          "name": "OROTIC ACID [MI]",
          "stdName": "OROTIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f375608-9c78-4da3-b7a1-4285af06ae5a"
          ],
          "display_name": false
        },
        {
          "uuid": "e1acc4f1-ae73-4c05-9286-6bdccd956cda",
          "name": "OROTYL",
          "stdName": "OROTYL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e73f943-7f4d-427f-a648-c622ccaa2caf"
          ],
          "display_name": false
        },
        {
          "uuid": "efb79e57-8dde-41af-bf8d-94c27d8c6d9e",
          "name": "Orotic acid",
          "stdName": "OROTIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1de876f9-f84f-4916-8e80-31900f4ba6b8",
            "26ff93d3-ebbe-4fbd-a911-08db3b598776",
            "fb40dfc3-12a5-4723-8fa5-a278aae00923",
            "f389ee11-e190-4833-8322-9a2ce27b8e20",
            "0f375608-9c78-4da3-b7a1-4285af06ae5a",
            "c99207f4-4145-46ba-8d5e-055017b4de27",
            "ecd0f95e-fad0-48eb-b82a-8b0b10371d8a",
            "b5069c8a-ef94-45c4-be72-99b474a390d3",
            "86b6fbdd-1cf3-47fe-b453-23e374c4d9f0",
            "cf85c29a-817f-44ef-8484-81d476abbf80",
            "66bbb038-9067-48b3-9171-b74c7525c7f6",
            "f98a78ce-3dd2-45c7-9433-10d92a6cb52a",
            "b5ca3e11-6952-447d-8b68-ee5f563f527b",
            "5e361340-a6e1-4489-a0a1-f13d621dbde1",
            "d95878cf-50ed-4d91-8d26-0792cc4ce0ec"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "9ad812c5-93e6-40d3-8a68-ab2671bdac5a",
              "name_org": "INN"
            },
            {
              "uuid": "bc73ad3a-983c-4945-b846-7e32bcedf728",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "78cc9eec-d32a-8850-3af5-d820357180c7",
          "name": "Orotic acid [WHO-DD]",
          "stdName": "OROTIC ACID [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2db1129-1821-8358-30f9-3f3e05db1e92"
          ],
          "display_name": false
        },
        {
          "uuid": "1dd59788-56e6-4c39-90af-c23d04c3b44e",
          "name": "URACIL-6-CARBOXYLIC ACID",
          "stdName": "URACIL-6-CARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e73f943-7f4d-427f-a648-c622ccaa2caf"
          ],
          "display_name": false
        },
        {
          "uuid": "fdf613a5-aa1a-4d17-9c7d-d137144794f2",
          "name": "WHEY FACTOR",
          "stdName": "WHEY FACTOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e73f943-7f4d-427f-a648-c622ccaa2caf"
          ],
          "display_name": false
        },
        {
          "uuid": "acdf02fb-98ef-4210-8989-53072d69a95c",
          "name": "orotic acid [INN]",
          "stdName": "OROTIC ACID [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5ca3e11-6952-447d-8b68-ee5f563f527b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c99207f4-4145-46ba-8d5e-055017b4de27",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4062a0a0-5005-4fda-9d50-d28296d73940",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e73f943-7f4d-427f-a648-c622ccaa2caf",
          "citation": "Merck 14.3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5ca3e11-6952-447d-8b68-ee5f563f527b",
          "citation": "INN Proposed List 41",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL41.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cf85c29a-817f-44ef-8484-81d476abbf80",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f375608-9c78-4da3-b7a1-4285af06ae5a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5069c8a-ef94-45c4-be72-99b474a390d3",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f98a78ce-3dd2-45c7-9433-10d92a6cb52a",
          "citation": "MART",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e361340-a6e1-4489-a0a1-f13d621dbde1",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "66bbb038-9067-48b3-9171-b74c7525c7f6",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1eccfcfa-7ee5-4c10-aa5b-4d9e2c9c23f0",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e5840db-487e-4cbc-9074-d563933ae7c1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389685000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c968757-f9e3-4156-833b-f5b06ee62846",
          "citation": "SRS import [61H4T033E5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=61H4T033E5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389685000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb40dfc3-12a5-4723-8fa5-a278aae00923",
          "citation": "OROTIC ACID [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ecd0f95e-fad0-48eb-b82a-8b0b10371d8a",
          "citation": "OROTIC ACID [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d95878cf-50ed-4d91-8d26-0792cc4ce0ec",
          "citation": "OROTIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1de876f9-f84f-4916-8e80-31900f4ba6b8",
          "citation": "OROTIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "26ff93d3-ebbe-4fbd-a911-08db3b598776",
          "citation": "OROTIC ACID [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f389ee11-e190-4833-8322-9a2ce27b8e20",
          "citation": "OROTIC ACID [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "86b6fbdd-1cf3-47fe-b453-23e374c4d9f0",
          "citation": "OROTIC ACID [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a25a537c-f3d9-6439-a638-f5c34f3b9a43",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+65-86-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ed52247d-07a9-de5f-ae19-33dfe7e49b82",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=65-86-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2d4fa134-4703-f1b0-44df-fa2aa09211fb",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "b047ed9f-b09f-4c8f-8d26-f0715eba3fb3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "58bf950f-c0cf-18d9-0c4c-4dd3f3670517",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "04190ed8-dd54-45ec-acc9-540184eacf80",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1186105d-255c-4004-9aa2-c88f28a828ed",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d2db1129-1821-8358-30f9-3f3e05db1e92",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e24dd8db-42e0-e34f-06eb-7aa1f6e098d7",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "18a97813-4524-e147-66ce-e9cdcc6a63f7",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ab85a710-d7eb-4b64-b315-87fb5691e8cb",
          "id": "ab85a710-d7eb-4b64-b315-87fb5691e8cb",
          "molfile": "\n  Marvin  01132108542D          \n\n 11 11  0  0  0  0            999 V2000\n    3.5743   -2.0695    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8543   -2.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8543   -3.3101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1446   -2.0695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1446   -1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4297   -0.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4297    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7175   -1.2381    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7175   -2.0695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4297   -2.4813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n 11  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 11  1  0  0  0  0\nM  END",
          "smiles": "c1c(C(=O)O)[nH]c(=O)[nH]c1=O",
          "formula": "C5H4N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cb6abf95-a1ff-4cda-a0e9-01a2e88fa4e7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "156.0965",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "dacb276e-6e39-4105-a024-50d14279c4f2",
      "version": "20",
      "structure": {
        "id": "a29ebf48-4ec9-49f2-af61-78752fb46f61",
        "molfile": "\n  Marvin  01132108272D          \n\n 11 11  0  0  0  0            999 V2000\n    2.1446   -2.0695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7175   -1.2381    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7175   -2.0695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1446   -1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4297   -2.4813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4297   -0.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8543   -2.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4297    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5743   -2.0695    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8543   -3.3101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  5  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  3  2  0  0  0  0\n  9  6  2  0  0  0  0\n 10  7  2  0  0  0  0\n 11  7  1  0  0  0  0\n  6  2  1  0  0  0  0\nM  END",
        "smiles": "c1c(C(=O)O)[nH]c(=O)[nH]c1=O",
        "formula": "C5H4N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "156.0965",
        "optical_activity": "NONE",
        "references": [
          "c99207f4-4145-46ba-8d5e-055017b4de27",
          "0c968757-f9e3-4156-833b-f5b06ee62846",
          "b5ca3e11-6952-447d-8b68-ee5f563f527b"
        ],
        "stereo_centers": 0
      },
      "unii": "61H4T033E5"
    }
  ]
}