{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d89f4e02-2c5d-47c4-acb6-037f2a07d9bc", "code": "185608-75-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=185608-75-7", "code_system": "CAS", "references": [ "f8640ab7-2ced-4ddb-ba8e-9ee9879b79b4", "f65c2290-ce84-426f-b355-68991d4fd91e" ] }, { "uuid": "b40c2018-bfa4-45ef-a1fe-0e84da16b125", "code": "18772464", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18772464", "code_system": "PUBCHEM", "references": [ "f8640ab7-2ced-4ddb-ba8e-9ee9879b79b4" ] }, { "uuid": "1b00a081-b84f-4fc3-b145-32d1976c8b42", "code": "610LV0BX3Y", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "3653c06f-ed02-21b8-4051-0660fe471801", "code": "DTXSID601317230", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID601317230", "code_system": "EPA CompTox", "references": [ "477e3dd6-60ca-6015-3e61-a0286a5cc3c2" ] } ], "substance_class": "chemical", "names": [ { "uuid": "6e9cbc83-cede-456c-9ed1-8225cc3a0029", "name": "(R)-INDOXACARB", "stdName": "(R)-INDOXACARB", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "36627279-8205-4f82-bfff-7b623cbef2bf", "56c396fe-69ec-40d7-a35d-2e8ef2a907ca" ], "display_name": false }, { "uuid": "22022f09-2332-49ba-a748-3d88ee4e7484", "name": "DPX-KN-127", "stdName": "DPX-KN-127", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "9aa98f3d-3218-4b4b-b43e-ae17501fc744", "36627279-8205-4f82-bfff-7b623cbef2bf" ], "display_name": false }, { "uuid": "3c128290-50ae-4bb7-8033-1e174efcfedb", "name": "IN-KN-127", "stdName": "IN-KN-127", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "36627279-8205-4f82-bfff-7b623cbef2bf", "56c396fe-69ec-40d7-a35d-2e8ef2a907ca" ], "display_name": false }, { "uuid": "d8a93e93-2020-4a87-a215-96dcac1e1b1c", "name": "INDENO(1,2-E)(1,3,4)OXADIAZINE-4A(3H)-CARBOXYLIC ACID, 7-CHLORO-2,5-DIHYDRO-2-(((METHOXYCARBONYL)(4-(TRIFLUOROMETHOXY)PHENYL)AMINO)CARBONYL)-, METHYL ESTER, (4AR)-", "stdName": "INDENO(1,2-E)(1,3,4)OXADIAZINE-4A(3H)-CARBOXYLIC ACID, 7-CHLORO-2,5-DIHYDRO-2-(((METHOXYCARBONYL)(4-(TRIFLUOROMETHOXY)PHENYL)AMINO)CARBONYL)-, METHYL ESTER, (4AR)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "36627279-8205-4f82-bfff-7b623cbef2bf", "56c396fe-69ec-40d7-a35d-2e8ef2a907ca" ], "display_name": false }, { "uuid": "e8317caf-49bc-471c-9225-f3c525688a22", "name": "INDOXACARB, (-)-", "stdName": "INDOXACARB, (-)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1e6eb055-619f-47d3-9125-af760e15e5a1", "36627279-8205-4f82-bfff-7b623cbef2bf" ], "display_name": true }, { "uuid": "2fabc8f6-9fd2-4683-9e43-623b6ddde82a", "name": "INDOXACARB, (R)-", "stdName": "INDOXACARB, (R)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1e6eb055-619f-47d3-9125-af760e15e5a1", "36627279-8205-4f82-bfff-7b623cbef2bf" ], "display_name": false } ], "references": [ { "uuid": "1e6eb055-619f-47d3-9125-af760e15e5a1", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "36627279-8205-4f82-bfff-7b623cbef2bf", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "56c396fe-69ec-40d7-a35d-2e8ef2a907ca", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9aa98f3d-3218-4b4b-b43e-ae17501fc744", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f8640ab7-2ced-4ddb-ba8e-9ee9879b79b4", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392577000, "tags": [ "NOMEN" ] }, { "uuid": "90664476-31f8-44a2-8a3b-ce261832181d", "citation": "SRS import [610LV0BX3Y]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=610LV0BX3Y", "doc_type": "SRS", "public_domain": true, "document_date": 1493392577000, "tags": [ "NOMEN" ] }, { "uuid": "f65c2290-ce84-426f-b355-68991d4fd91e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "477e3dd6-60ca-6015-3e61-a0286a5cc3c2", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d0a83d7d-7e66-4ae6-89a0-1bdced0d133c", "id": "d0a83d7d-7e66-4ae6-89a0-1bdced0d133c", "molfile": "\n Marvin 01132110472D \n\n 36 39 0 0 1 0 999 V2000\n 8.6522 -3.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9377 -3.5475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2232 -3.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5088 -3.5475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2232 -4.7849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5088 -5.1974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5088 -6.0224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7943 -4.7849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7943 -3.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0798 -3.5475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3654 -3.9599 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 3.5808 -3.7050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0958 -4.3725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2754 -4.4586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9398 -5.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1193 -5.2986 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4247 -5.8798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2452 -5.7935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5808 -5.0399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3654 -4.7849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0798 -5.1974 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2791 -3.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9465 -2.6546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5255 -2.8039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4393 -1.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9377 -5.1974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6522 -4.7849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3666 -5.1974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3666 -6.0224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0811 -6.4349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0811 -7.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0811 -8.0849 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3666 -7.6724 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7956 -7.6724 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6522 -6.4349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9377 -6.0224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 2 0 0 0 0\n 5 3 1 0 0 0 0\n 6 5 1 0 0 0 0\n 5 26 1 0 0 0 0\n 6 7 2 0 0 0 0\n 8 6 1 0 0 0 0\n 8 9 1 0 0 0 0\n 21 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 20 1 0 0 0 0\n 11 22 1 6 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 19 2 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 22 23 2 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 26 36 2 0 0 0 0\n 28 27 2 0 0 0 0\n 29 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 35 29 2 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 1 0 0 0 0\n 31 34 1 0 0 0 0\n 36 35 1 0 0 0 0\nM END", "smiles": "COC(=O)[C@]12Cc3cc(ccc3C2=NN(CO1)C(=O)N(c4ccc(cc4)OC(F)(F)F)C(=O)OC)Cl", "formula": "C22H17ClF3N3O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "ed14078d-c95a-4716-8d87-0daba2d9f6e7" }, "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "527.8353", "optical_activity": "UNSPECIFIED", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "08a2e1f1-715d-479b-9d47-0da8a4360da0", "version": "3", "structure": { "id": "e7c9eb83-8192-46e7-80af-96f640b354aa", "molfile": "\n Marvin 01132112002D \n\n 36 39 0 0 1 0 999 V2000\n 1.9398 -5.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1193 -5.2986 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2754 -4.4586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0958 -4.3725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5808 -3.7050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3654 -3.9599 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.2791 -3.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5255 -2.8039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4393 -1.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9465 -2.6546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0798 -3.5475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7943 -3.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7943 -4.7849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5088 -5.1974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2232 -4.7849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9377 -5.1974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6522 -4.7849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3666 -5.1974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3666 -6.0224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0811 -6.4349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0811 -7.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0811 -8.0849 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3666 -7.6724 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7956 -7.6724 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6522 -6.4349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9377 -6.0224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2232 -3.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5088 -3.5475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9377 -3.5475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6522 -3.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5088 -6.0224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0798 -5.1974 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3654 -4.7849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5808 -5.0399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2452 -5.7935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4247 -5.8798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 6 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 7 10 2 0 0 0 0\n 6 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 1 0 0 0 0\n 21 24 1 0 0 0 0\n 25 19 2 0 0 0 0\n 26 25 1 0 0 0 0\n 16 26 2 0 0 0 0\n 15 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 27 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 14 31 2 0 0 0 0\n 32 13 1 0 0 0 0\n 33 32 2 0 0 0 0\n 6 33 1 0 0 0 0\n 34 33 1 0 0 0 0\n 4 34 1 0 0 0 0\n 35 34 2 0 0 0 0\n 36 35 1 0 0 0 0\n 1 36 2 0 0 0 0\nM END", "smiles": "COC(=O)[C@]12Cc3cc(ccc3C2=NN(CO1)C(=O)N(c4ccc(cc4)OC(F)(F)F)C(=O)OC)Cl", "formula": "C22H17ClF3N3O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "527.8353", "optical_activity": "UNSPECIFIED", "references": [ "56c396fe-69ec-40d7-a35d-2e8ef2a907ca", "90664476-31f8-44a2-8a3b-ce261832181d" ], "stereo_centers": 1 }, "unii": "610LV0BX3Y" } ] }